IE46102B1 - 5-methylisoxazole-4-carboxylic acid anilides having pharmaceutical activity - Google Patents
5-methylisoxazole-4-carboxylic acid anilides having pharmaceutical activityInfo
- Publication number
- IE46102B1 IE46102B1 IE245177A IE245177A IE46102B1 IE 46102 B1 IE46102 B1 IE 46102B1 IE 245177 A IE245177 A IE 245177A IE 245177 A IE245177 A IE 245177A IE 46102 B1 IE46102 B1 IE 46102B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- group
- radical
- carbon atoms
- salt
- Prior art date
Links
- ZYEWRBNSDKQNSJ-UHFFFAOYSA-N 5-methyl-n-phenyl-1,2-oxazole-4-carboxamide Chemical class O1N=CC(C(=O)NC=2C=CC=CC=2)=C1C ZYEWRBNSDKQNSJ-UHFFFAOYSA-N 0.000 title abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 32
- 150000001875 compounds Chemical class 0.000 claims abstract description 25
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 16
- 125000005843 halogen group Chemical group 0.000 claims abstract description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 13
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 12
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract 2
- 239000001257 hydrogen Substances 0.000 claims abstract 2
- -1 alkyl radical Chemical class 0.000 claims description 31
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 17
- 229910052801 chlorine Inorganic materials 0.000 claims description 17
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 16
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 16
- 229910052794 bromium Inorganic materials 0.000 claims description 16
- 229910052731 fluorine Inorganic materials 0.000 claims description 16
- 239000011737 fluorine Substances 0.000 claims description 16
- 150000003839 salts Chemical group 0.000 claims description 14
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- 229910052740 iodine Inorganic materials 0.000 claims description 10
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 239000011630 iodine Substances 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 3
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- ZKAQPVQEYCFRTK-UHFFFAOYSA-N 5-methyl-1,2-oxazole-4-carbonyl chloride Chemical compound CC=1ON=CC=1C(Cl)=O ZKAQPVQEYCFRTK-UHFFFAOYSA-N 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- VQBXUKGMJCPBMF-UHFFFAOYSA-N 5-methyl-1,2-oxazole-4-carboxylic acid Chemical class CC=1ON=CC=1C(O)=O VQBXUKGMJCPBMF-UHFFFAOYSA-N 0.000 abstract description 5
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 3
- 230000000202 analgesic effect Effects 0.000 abstract 1
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 239000002260 anti-inflammatory agent Substances 0.000 abstract 1
- 230000001741 anti-phlogistic effect Effects 0.000 abstract 1
- 230000001754 anti-pyretic effect Effects 0.000 abstract 1
- 239000002221 antipyretic Substances 0.000 abstract 1
- 230000002496 gastric effect Effects 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 230000001988 toxicity Effects 0.000 abstract 1
- 231100000419 toxicity Toxicity 0.000 abstract 1
- AGQOIYCTCOEHGR-UHFFFAOYSA-N 5-methyl-1,2-oxazole Chemical compound CC1=CC=NO1 AGQOIYCTCOEHGR-UHFFFAOYSA-N 0.000 description 10
- 238000000354 decomposition reaction Methods 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- IFXKXCLVKQVVDI-UHFFFAOYSA-N 2-amino-5-chlorobenzoic acid Chemical compound NC1=CC=C(Cl)C=C1C(O)=O IFXKXCLVKQVVDI-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SRIPKJKTMUAJMC-UHFFFAOYSA-N 2-chloro-5-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid Chemical compound O1N=CC(C(=O)NC=2C=C(C(Cl)=CC=2)C(O)=O)=C1C SRIPKJKTMUAJMC-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- PDEGBONVUJDOFN-UHFFFAOYSA-N 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid Chemical compound OC(=O)C1=C(C)ON=C1C1=CC=C(F)C=C1 PDEGBONVUJDOFN-UHFFFAOYSA-N 0.000 description 1
- YBLSBWHFPXDRHC-UHFFFAOYSA-N 3-methyl-1,2-oxazole-4-carboxylic acid Chemical compound CC1=NOC=C1C(O)=O YBLSBWHFPXDRHC-UHFFFAOYSA-N 0.000 description 1
- PKIJXUFVNGXSEN-UHFFFAOYSA-N 4-bromo-2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid Chemical compound O1N=CC(C(=O)NC=2C(=CC=C(Br)C=2)C(O)=O)=C1C PKIJXUFVNGXSEN-UHFFFAOYSA-N 0.000 description 1
- YQNGTNOFBNZADU-UHFFFAOYSA-N 5-chloro-2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid Chemical compound O1N=CC(C(=O)NC=2C(=CC(Cl)=CC=2)C(O)=O)=C1C YQNGTNOFBNZADU-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- LITCYFDFTKSNSK-UHFFFAOYSA-N O1N=CC(C(=O)NC=2C(=CC=C(Cl)C=2)O)=C1C Chemical compound O1N=CC(C(=O)NC=2C(=CC=C(Cl)C=2)O)=C1C LITCYFDFTKSNSK-UHFFFAOYSA-N 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical group [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/18—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762655094 DE2655094A1 (de) | 1976-12-04 | 1976-12-04 | Isoxazolderivate, verfahren zu ihrer herstellung und diese enthaltende mittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE46102L IE46102L (en) | 1978-06-04 |
| IE46102B1 true IE46102B1 (en) | 1983-02-23 |
Family
ID=5994722
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE245177A IE46102B1 (en) | 1976-12-04 | 1977-12-02 | 5-methylisoxazole-4-carboxylic acid anilides having pharmaceutical activity |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5371069A (enExample) |
| AT (1) | AT362788B (enExample) |
| BE (1) | BE861502R (enExample) |
| CA (1) | CA1094564A (enExample) |
| CH (1) | CH614945A5 (enExample) |
| DE (1) | DE2655094A1 (enExample) |
| DK (1) | DK538577A (enExample) |
| ES (1) | ES464553A2 (enExample) |
| FR (1) | FR2372813A2 (enExample) |
| GB (1) | GB1595467A (enExample) |
| IE (1) | IE46102B1 (enExample) |
| IT (1) | IT1113801B (enExample) |
| LU (1) | LU78626A1 (enExample) |
| NL (1) | NL7713148A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1980000964A1 (en) * | 1978-11-03 | 1980-05-15 | American Cyanamid Co | Anti-inflammatory agents including 2-carbonyl-3-hydroxy-2-alkenonitriles |
| EP0035285A3 (en) * | 1979-08-17 | 1981-10-14 | American Cyanamid Company | Novel isoxazole carboxylic acid phenyl esters, pharmaceutical compositions containing certain of said esters, and process for preparing said esters |
| DE3247454A1 (de) * | 1982-12-22 | 1984-06-28 | Laboratorios Bago S.A., Buenos Aires | Substituierte 3-phenyl-5-methyl-isoxazol-4-carboxy-anilide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| FR2538806B1 (fr) * | 1982-12-30 | 1986-02-21 | Bago Sa Labor | Composes phenyl-3 methyl isoxazole-5 carboxy-4 anilides substitues, actifs therapeutiquement contre l'inflammation et la douleur |
| US20040110802A1 (en) * | 2002-08-23 | 2004-06-10 | Atli Thorarensen | Antibacterial benzoic acid derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2126329A (en) * | 1936-03-20 | 1938-08-09 | Hoffmann La Roche | Amide derivatives of isoxazole carboxylic acids |
| US2288863A (en) * | 1940-02-27 | 1942-07-07 | Hoffmann La Roche | Process for the manufacture of substituted amides of 3,5-dimethylisoxazole-4-carboxylic acid |
-
1976
- 1976-12-04 DE DE19762655094 patent/DE2655094A1/de not_active Withdrawn
-
1977
- 1977-11-15 CH CH1393377A patent/CH614945A5/xx not_active IP Right Cessation
- 1977-11-29 ES ES464553A patent/ES464553A2/es not_active Expired
- 1977-11-29 NL NL7713148A patent/NL7713148A/xx not_active Application Discontinuation
- 1977-12-02 CA CA292,276A patent/CA1094564A/en not_active Expired
- 1977-12-02 GB GB5034677A patent/GB1595467A/en not_active Expired
- 1977-12-02 DK DK538577A patent/DK538577A/da unknown
- 1977-12-02 AT AT0866277A patent/AT362788B/de not_active IP Right Cessation
- 1977-12-02 IT IT3035177A patent/IT1113801B/it active
- 1977-12-02 LU LU78626A patent/LU78626A1/xx unknown
- 1977-12-02 IE IE245177A patent/IE46102B1/en unknown
- 1977-12-03 JP JP14562177A patent/JPS5371069A/ja active Pending
- 1977-12-05 FR FR7736546A patent/FR2372813A2/fr active Granted
- 1977-12-05 BE BE183169A patent/BE861502R/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ATA866277A (de) | 1980-11-15 |
| IE46102L (en) | 1978-06-04 |
| LU78626A1 (enExample) | 1978-07-11 |
| IT1113801B (it) | 1986-01-27 |
| ES464553A2 (es) | 1979-08-01 |
| NL7713148A (nl) | 1978-06-06 |
| FR2372813A2 (fr) | 1978-06-30 |
| DE2655094A1 (de) | 1978-06-15 |
| GB1595467A (en) | 1981-08-12 |
| AT362788B (de) | 1981-06-10 |
| DK538577A (da) | 1978-06-05 |
| CA1094564A (en) | 1981-01-27 |
| CH614945A5 (en) | 1979-12-28 |
| JPS5371069A (en) | 1978-06-24 |
| FR2372813B2 (enExample) | 1980-06-20 |
| BE861502R (fr) | 1978-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL164432B1 (pl) | Sposób wytwarzania nowych pochodnych aminofenolu PL | |
| NO811730L (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive n-acylaniliner. | |
| CS208112B2 (en) | Method of making the new fluoralcylsubstituted derivatives of theacylanilides | |
| PL84493B1 (enExample) | ||
| IE46269B1 (en) | Isoxazole derivatives,process for their manufacture and preparations containing these compounds | |
| IE46102B1 (en) | 5-methylisoxazole-4-carboxylic acid anilides having pharmaceutical activity | |
| US3324121A (en) | Alpha-(secondary aminomethyl)acylphenoxy (and phenylmercapto) monocarboxylic acids | |
| IE46001B1 (en) | Process for the manufacture of 5-methyl isoxazole-4-carboxylic acid anilide derivatives | |
| US3900486A (en) | 3-methyl-2-phenyl-5-benzothiazoline acetic acid compounds and process for producing the same | |
| GB2146983A (en) | Preparation of substituted benzamides | |
| HU199800B (en) | Process for producing substituted pyridylalkylketone derivatives | |
| US4895950A (en) | 5-halogeno-6-amino-nicotinic acid halides | |
| IL149063A0 (en) | Process to prepare aryltriazolinones and novel intermediates thereto | |
| US5952494A (en) | Method for the preparation of pyrido benzoxazine derivatives | |
| JPS5927343B2 (ja) | 3−アミノイソオキサゾ−ル類の合成法 | |
| US3703513A (en) | Novel 3,5-dioxopyrazolidine derivatives | |
| KR800001145B1 (ko) | 이속사졸 유도체의 제조 방법 | |
| JPS63280084A (ja) | 1−アルキル−3−カルボキシ−4−シンノロン類の製造方法 | |
| US5071994A (en) | 2-aryl-4-halomethyl-4-isoxazolin-3-one derivatives | |
| JP2538335B2 (ja) | 芳香族アミン類の製法 | |
| PL192002B1 (pl) | Sposób wytwarzania propynylowego estru kwasu (R)(+)-2-[4-(5-chloro-3-fluoropirydyn-2-yloksy)-fenoksy]-propionowego | |
| CN120987772A (zh) | 苯唑草酮中间体及其制备方法 | |
| SU1325052A1 (ru) | Способ получени 5,5-бис-/2-метил-5-нитро-1,3-диоксанила/ | |
| JP2743441B2 (ja) | シクロペンタ〔1,2―c〕―3―ピラゾールカルボン酸誘導体 | |
| JPS5920668B2 (ja) | キナゾリン誘導体の製法 |