IE45007B1 - New iodinated isophthalamic acid derivatives - Google Patents
New iodinated isophthalamic acid derivativesInfo
- Publication number
- IE45007B1 IE45007B1 IE1251/77A IE125177A IE45007B1 IE 45007 B1 IE45007 B1 IE 45007B1 IE 1251/77 A IE1251/77 A IE 1251/77A IE 125177 A IE125177 A IE 125177A IE 45007 B1 IE45007 B1 IE 45007B1
- Authority
- IE
- Ireland
- Prior art keywords
- salt
- triiodo
- compound
- isophthalamic acid
- acid
- Prior art date
Links
- FVUKYCZRWSQGAS-UHFFFAOYSA-N 3-carbamoylbenzoic acid Chemical class NC(=O)C1=CC=CC(C(O)=O)=C1 FVUKYCZRWSQGAS-UHFFFAOYSA-N 0.000 title abstract description 3
- 150000003839 salts Chemical class 0.000 claims abstract description 40
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 16
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 15
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 12
- 150000007530 organic bases Chemical class 0.000 claims abstract description 12
- 150000007529 inorganic bases Chemical class 0.000 claims abstract description 11
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 35
- -1 2-hydroxypropyl Chemical group 0.000 claims description 26
- 239000000243 solution Substances 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 19
- 238000002360 preparation method Methods 0.000 claims description 17
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 159000000000 sodium salts Chemical class 0.000 claims description 6
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 238000001990 intravenous administration Methods 0.000 claims description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 3
- HCWQGWYSYFPSSY-UHFFFAOYSA-N 3-(2-hydroxyethylcarbamoyl)-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzoic acid Chemical compound COCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NCCO)=C1I HCWQGWYSYFPSSY-UHFFFAOYSA-N 0.000 claims description 3
- JEVOKYNOFWOTDF-UHFFFAOYSA-N 3-(2-hydroxypropylcarbamoyl)-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzoic acid Chemical compound COCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NCC(C)O)=C1I JEVOKYNOFWOTDF-UHFFFAOYSA-N 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- OLSACIQFUBMEOU-UHFFFAOYSA-N 3-(3-hydroxypropylcarbamoyl)-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzoic acid Chemical compound COCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NCCCO)=C1I OLSACIQFUBMEOU-UHFFFAOYSA-N 0.000 claims description 2
- QQWMDJIMRQNBEN-UHFFFAOYSA-N 3-[(4-hydroxy-2-methylbutan-2-yl)carbamoyl]-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzoic acid Chemical compound COCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NC(C)(C)CCO)=C1I QQWMDJIMRQNBEN-UHFFFAOYSA-N 0.000 claims description 2
- GYOWOGCNKSFOLL-UHFFFAOYSA-N 3-carbamoyl-2,4,5-triiodobenzoic acid Chemical compound NC(=O)C1=C(I)C(I)=CC(C(O)=O)=C1I GYOWOGCNKSFOLL-UHFFFAOYSA-N 0.000 claims description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims description 2
- 239000004475 Arginine Substances 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 claims description 2
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 claims description 2
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 claims description 2
- 239000004472 Lysine Substances 0.000 claims description 2
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 claims description 2
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 claims description 2
- 150000001413 amino acids Chemical class 0.000 claims description 2
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 150000002411 histidines Chemical class 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 159000000003 magnesium salts Chemical class 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims description 2
- 150000002780 morpholines Chemical class 0.000 claims description 2
- 229960003104 ornithine Drugs 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 5
- SJLGYQKNNUISJH-UHFFFAOYSA-N 3-[(1-hydroxy-2-methylpropan-2-yl)carbamoyl]-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzoic acid Chemical compound COCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NC(C)(C)CO)=C1I SJLGYQKNNUISJH-UHFFFAOYSA-N 0.000 claims 3
- CUGDYSSBTWBKII-LXGUWJNJSA-N (2r,3r,4r,5s)-6-(dimethylamino)hexane-1,2,3,4,5-pentol Chemical compound CN(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO CUGDYSSBTWBKII-LXGUWJNJSA-N 0.000 claims 1
- WZGJPSUTZCFEGK-UHFFFAOYSA-N 3-(2-hydroxypropylcarbamoyl)-2,4,6-triiodo-5-[[2-(2-methoxyethoxy)acetyl]amino]benzoic acid Chemical compound COCCOCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NCC(C)O)=C1I WZGJPSUTZCFEGK-UHFFFAOYSA-N 0.000 claims 1
- TWVAHPKAWCFMLK-UHFFFAOYSA-N 3-[[6-[3-carboxy-5-(2-hydroxypropylcarbamoyl)-2,4,6-triiodoanilino]-6-oxohexanoyl]amino]-5-(2-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C(C(=O)NCC(O)C)=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)NCC(C)O)C(I)=C(C(O)=O)C=2I)I)=C1I TWVAHPKAWCFMLK-UHFFFAOYSA-N 0.000 claims 1
- XZZJOHPTPMVLGT-UHFFFAOYSA-N 3-[[6-[3-carboxy-5-[(1-hydroxy-2-methylpropan-2-yl)carbamoyl]-2,4,6-triiodoanilino]-6-oxohexanoyl]amino]-5-[(1-hydroxy-2-methylpropan-2-yl)carbamoyl]-2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C(C(=O)NC(C)(CO)C)=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)NC(C)(C)CO)C(I)=C(C(O)=O)C=2I)I)=C1I XZZJOHPTPMVLGT-UHFFFAOYSA-N 0.000 claims 1
- GBLJKDMJSRSFKM-UHFFFAOYSA-N 3-acetamido-5-(2-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid Chemical compound CC(O)CNC(=O)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I GBLJKDMJSRSFKM-UHFFFAOYSA-N 0.000 claims 1
- OJZPRIWSCMWFKY-UHFFFAOYSA-N 3-acetamido-5-(3-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid Chemical compound CC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NCCCO)=C1I OJZPRIWSCMWFKY-UHFFFAOYSA-N 0.000 claims 1
- BWKWJRRDHNBJTI-UHFFFAOYSA-N 3-amino-5-carbamoyl-2,4,6-triiodobenzoic acid Chemical class NC(=O)C1=C(I)C(N)=C(I)C(C(O)=O)=C1I BWKWJRRDHNBJTI-UHFFFAOYSA-N 0.000 claims 1
- 229940125810 compound 20 Drugs 0.000 claims 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 claims 1
- 239000002872 contrast media Substances 0.000 abstract description 4
- 150000002430 hydrocarbons Chemical class 0.000 abstract description 3
- 239000004215 Carbon black (E152) Substances 0.000 abstract description 2
- 229930195733 hydrocarbon Natural products 0.000 abstract description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- 238000000354 decomposition reaction Methods 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 17
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 238000003756 stirring Methods 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000012266 salt solution Substances 0.000 description 6
- OVBJJZOQPCKUOR-UHFFFAOYSA-L EDTA disodium salt dihydrate Chemical compound O.O.[Na+].[Na+].[O-]C(=O)C[NH+](CC([O-])=O)CC[NH+](CC([O-])=O)CC([O-])=O OVBJJZOQPCKUOR-UHFFFAOYSA-L 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 5
- 229910000564 Raney nickel Inorganic materials 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- RMIODHQZRUFFFF-UHFFFAOYSA-N methoxyacetic acid Chemical compound COCC(O)=O RMIODHQZRUFFFF-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- ZCRNIIJXDRYWDU-UHFFFAOYSA-N 3-(methoxycarbonyl)-5-nitrobenzoic acid Chemical compound COC(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1 ZCRNIIJXDRYWDU-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- PLOOSLXUCKGWTD-UHFFFAOYSA-N 3-(2-hydroxypropylcarbamoyl)-5-nitrobenzoic acid Chemical compound CC(O)CNC(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1 PLOOSLXUCKGWTD-UHFFFAOYSA-N 0.000 description 2
- QXKCXYSYOWRIIO-UHFFFAOYSA-N 3-(3-hydroxypropylcarbamoyl)-5-nitrobenzoic acid Chemical compound OCCCNC(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1 QXKCXYSYOWRIIO-UHFFFAOYSA-N 0.000 description 2
- NCNNGAICORZFBE-UHFFFAOYSA-N 3-amino-5-(2-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid Chemical compound CC(O)CNC(=O)C1=C(I)C(N)=C(I)C(C(O)=O)=C1I NCNNGAICORZFBE-UHFFFAOYSA-N 0.000 description 2
- ZQSLBUWPRBNEIC-UHFFFAOYSA-N 3-amino-5-[(1-hydroxy-2-methylpropan-2-yl)carbamoyl]-2,4,6-triiodobenzoic acid Chemical compound OCC(C)(C)NC(=O)C1=C(I)C(N)=C(I)C(C(O)=O)=C1I ZQSLBUWPRBNEIC-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- HZDNNJABYXNPPV-UHFFFAOYSA-N (2-chloro-2-oxoethyl) acetate Chemical compound CC(=O)OCC(Cl)=O HZDNNJABYXNPPV-UHFFFAOYSA-N 0.000 description 1
- GVTLFGJNTIRUEG-ZHACJKMWSA-N (e)-n-(3-methoxyphenyl)-3-phenylprop-2-enamide Chemical compound COC1=CC=CC(NC(=O)\C=C\C=2C=CC=CC=2)=C1 GVTLFGJNTIRUEG-ZHACJKMWSA-N 0.000 description 1
- OZJZCCMIOZPPIT-UHFFFAOYSA-N 2-(2-methoxyethoxy)acetyl chloride Chemical compound COCCOCC(Cl)=O OZJZCCMIOZPPIT-UHFFFAOYSA-N 0.000 description 1
- HQEYSTYHTZBYGI-UHFFFAOYSA-N 3-amino-5-[(4-hydroxy-2-methylbutan-2-yl)carbamoyl]-2,4,6-triiodobenzoic acid Chemical compound OCCC(C)(C)NC(=O)C1=C(I)C(N)=C(I)C(C(O)=O)=C1I HQEYSTYHTZBYGI-UHFFFAOYSA-N 0.000 description 1
- MQOHVLNYIWPHAQ-UHFFFAOYSA-N 3-carbamoyl-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]benzoic acid Chemical compound IC1=C(C(=C(C(=C1C(=O)O)I)C(=O)N)I)NC(COC)=O MQOHVLNYIWPHAQ-UHFFFAOYSA-N 0.000 description 1
- LAYSDIAIUSJVAR-UHFFFAOYSA-N 3-carbamoyl-2-[(2-methoxyacetyl)amino]benzoic acid Chemical compound COCC(=O)NC1=C(C(=O)O)C=CC=C1C(=O)N LAYSDIAIUSJVAR-UHFFFAOYSA-N 0.000 description 1
- QYSFWRSPKNSNOY-UHFFFAOYSA-N 3-carbamoyl-2-nitrobenzoic acid Chemical compound NC(=O)C1=CC=CC(C(O)=O)=C1[N+]([O-])=O QYSFWRSPKNSNOY-UHFFFAOYSA-N 0.000 description 1
- MGGVALXERJRIRO-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-2-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-1H-pyrazol-5-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)O MGGVALXERJRIRO-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- QLKISOCKGGPANH-UHFFFAOYSA-N acetonitrile;chlorobenzene Chemical compound CC#N.ClC1=CC=CC=C1 QLKISOCKGGPANH-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000002583 angiography Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- ACYGYJFTZSAZKR-UHFFFAOYSA-J dicalcium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Ca+2].[Ca+2].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O ACYGYJFTZSAZKR-UHFFFAOYSA-J 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- OLAOYPRJVHUHCF-UHFFFAOYSA-N iooxitalamic acid Chemical compound CC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(=O)NCCO)=C1I OLAOYPRJVHUHCF-UHFFFAOYSA-N 0.000 description 1
- 229960003781 ioxitalamic acid Drugs 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000009608 myelography Methods 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- MARBWAUIHIOFNA-UHFFFAOYSA-N pentoxy hydrogen carbonate Chemical compound CCCCCOOC(O)=O MARBWAUIHIOFNA-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000007487 urography Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/04—X-ray contrast preparations
- A61K49/0433—X-ray contrast preparations containing an organic halogenated X-ray contrast-enhancing agent
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/04—X-ray contrast preparations
- A61K49/0433—X-ray contrast preparations containing an organic halogenated X-ray contrast-enhancing agent
- A61K49/0447—Physical forms of mixtures of two different X-ray contrast-enhancing agents, containing at least one X-ray contrast-enhancing agent which is a halogenated organic compound
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having the nitrogen atom of the carboxamide group bound to an acyclic carbon atom of a hydrocarbon radical substituted by oxygen atoms
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2629228A DE2629228C2 (de) | 1976-06-25 | 1976-06-25 | Jodierte Isophthalamsäure-Derivate Verfahren zu deren Herstellung sowie deren Verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE45007L IE45007L (en) | 1977-12-25 |
| IE45007B1 true IE45007B1 (en) | 1982-06-02 |
Family
ID=5981778
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1251/77A IE45007B1 (en) | 1976-06-25 | 1977-06-20 | New iodinated isophthalamic acid derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4132731A (Direct) |
| JP (1) | JPS6058742B2 (Direct) |
| AT (1) | AT358164B (Direct) |
| BE (1) | BE856095A (Direct) |
| CH (1) | CH631697A5 (Direct) |
| DE (1) | DE2629228C2 (Direct) |
| DK (1) | DK281377A (Direct) |
| FR (1) | FR2355807A1 (Direct) |
| GB (1) | GB1587663A (Direct) |
| IE (1) | IE45007B1 (Direct) |
| IT (1) | IT1114811B (Direct) |
| LU (1) | LU77592A1 (Direct) |
| NL (1) | NL7706302A (Direct) |
| SE (1) | SE7707173L (Direct) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4321368A (en) * | 1975-10-20 | 1982-03-23 | Mallinckrodt, Inc. | Glycosyl triidobenzoic acid derivatives |
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
| AU523295B2 (en) * | 1978-07-04 | 1982-07-22 | Nycomed Imaging As | X-ray contrast agent |
| DE2852094A1 (de) * | 1978-11-30 | 1980-06-12 | Schering Ag | Neue roentgenkontrastmittel |
| GB2156345B (en) * | 1984-03-30 | 1987-07-08 | Squibb & Sons Inc | Alkylamine salts of 3,5-diacetylamino-2,4,6-triiodobenzoic acid as x-ray contrast agents |
| US4567034A (en) * | 1984-09-07 | 1986-01-28 | E. R. Squibb & Sons, Inc. | Esters of diatrizoic acid as X-ray contrast agents |
| IE63232B1 (en) * | 1987-05-22 | 1995-04-05 | Bracco Int Bv | A process for the preparation of 5-acylamino-2,4,6-triiodo- or tribromo-benzoic acid derivatives and corresponding novel 5-acylamino-2,4,6-triiodo or tribromo-benzoic acid derivatives obtained by said process |
| US5143715A (en) * | 1990-03-28 | 1992-09-01 | Molecular Biosystems, Inc. | Organic contrast agent analog and method of making same |
| US5250283A (en) * | 1990-03-28 | 1993-10-05 | Molecular Biosystems, Inc. | Organic contrast agent analog and method of making same |
| DK0593624T3 (da) * | 1991-07-05 | 1997-05-20 | Nycomed Imaging As | Forbedringer af eller i relation til kontrastmidler |
| US20060068362A1 (en) * | 2004-09-27 | 2006-03-30 | Ormco Corporation | Endodontic instrument with depth markers |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR6777M (Direct) * | 1967-07-10 | 1969-03-10 | ||
| US3660464A (en) * | 1970-06-19 | 1972-05-02 | Squibb & Sons Inc | Tri-iodinated diaminobenzoic acid derivatives |
| DE2124904C3 (de) * | 1971-05-15 | 1980-09-18 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Hydroxy- und Alkoxyacetamido-trijodbenzoesäuren, deren Salze mit physiologisch verträglichen Basen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Röntgenkontrastmittel |
| BE787669A (fr) * | 1971-08-17 | 1973-02-19 | Schering Ag | Anilides d'acide n-methyl-dicarboxylique triiodes, et leur procede de preparation |
| US4032567A (en) * | 1972-02-16 | 1977-06-28 | Schering Aktiengesellschaft | Triiodoisophthalic acid monoamino acid amides, process for the preparation thereof, and use thereof as x-ray contrast media |
| US3914294A (en) * | 1972-06-01 | 1975-10-21 | Squibb & Sons Inc | 3,5-Disubstituted-2,4,6-triiodobenzoic acids |
| DD104193A5 (Direct) * | 1972-12-22 | 1974-03-05 | ||
| CH576256A5 (Direct) * | 1973-07-17 | 1976-06-15 | Bracco Ind Chimica Spa | |
| AR207465A1 (es) * | 1974-05-31 | 1976-10-08 | Guerbet Lab Andre | Procedimiento de preparacion de derivados de acido triiodoi2,4,6-(triiodo-2,4,6-benzoil)-amino-alcanoilaminobenzoico de acido triiodo-2,4,6-(triiodo-2,4,6-(triiodo-2,4,6-benzoil)-aminoalcanoilaminobenzoil)-amino-alcanoil-aminobenzoico y de acido triiodo-2,4,6-bis((triiodo-2,4,6-fenil)-carbamoil-metil)-aminoalcanoil-aminobenzoico |
| US3953497A (en) * | 1974-07-29 | 1976-04-27 | Mallinckrodt, Inc. | 2,4,6-Triiodo-5-methoxyacetamido-N-methylisophthalamic acid and salts, acyl halides and esters thereof |
-
1976
- 1976-06-25 DE DE2629228A patent/DE2629228C2/de not_active Expired
-
1977
- 1977-06-08 NL NL7706302A patent/NL7706302A/xx not_active Application Discontinuation
- 1977-06-14 US US05/806,383 patent/US4132731A/en not_active Expired - Lifetime
- 1977-06-20 GB GB25645/77A patent/GB1587663A/en not_active Expired
- 1977-06-20 IE IE1251/77A patent/IE45007B1/en unknown
- 1977-06-21 SE SE7707173A patent/SE7707173L/xx unknown
- 1977-06-21 CH CH761377A patent/CH631697A5/de not_active IP Right Cessation
- 1977-06-21 LU LU77592A patent/LU77592A1/xx unknown
- 1977-06-23 AT AT443877A patent/AT358164B/de not_active IP Right Cessation
- 1977-06-24 DK DK281377A patent/DK281377A/da not_active Application Discontinuation
- 1977-06-24 IT IT25036/77A patent/IT1114811B/it active
- 1977-06-24 BE BE178769A patent/BE856095A/xx not_active IP Right Cessation
- 1977-06-24 JP JP52075362A patent/JPS6058742B2/ja not_active Expired
- 1977-06-27 FR FR7719635A patent/FR2355807A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| SE7707173L (sv) | 1977-12-26 |
| DE2629228A1 (de) | 1978-01-05 |
| ATA443877A (de) | 1980-01-15 |
| US4132731A (en) | 1979-01-02 |
| DE2629228C2 (de) | 1984-10-18 |
| JPS6058742B2 (ja) | 1985-12-21 |
| AT358164B (de) | 1980-08-25 |
| FR2355807A1 (fr) | 1978-01-20 |
| DK281377A (da) | 1977-12-26 |
| IT1114811B (it) | 1986-01-27 |
| GB1587663A (en) | 1981-04-08 |
| CH631697A5 (de) | 1982-08-31 |
| LU77592A1 (Direct) | 1977-09-29 |
| BE856095A (fr) | 1977-12-27 |
| FR2355807B1 (Direct) | 1980-12-12 |
| NL7706302A (nl) | 1977-12-28 |
| JPS532448A (en) | 1978-01-11 |
| IE45007L (en) | 1977-12-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU666220B2 (en) | Iodinated aroyloxy esters | |
| US4364921A (en) | Novel triiodinated isophthalic acid diamides as nonionic X-ray contrast media | |
| US4239747A (en) | Dicarboxylic acid bis(3,5-dicarbamoyl-2,4,6-triiodoanilides) useful as x-ray contrast agents | |
| HUT66945A (en) | Iodinated aromatic propanedioates, x-ray contrast composition contg them and process to prepare them | |
| IE57929B1 (en) | New complexing agents,complexes and complex salts | |
| IE45007B1 (en) | New iodinated isophthalamic acid derivatives | |
| IE882808L (en) | New dicarboxylic acid-bis-(3,5-dicarbamoyl-2,4,6-triiodoanilides), process for their production as well as X-ray contrast media containing them | |
| AU662442B2 (en) | Iodinated aroyloxy carboxamides | |
| CA1129438A (en) | Triiodated isophthalamide x-ray contrast agents | |
| EP0558395B1 (fr) | Composés utilisables dans des produits de contraste pour la radiographie | |
| US5670136A (en) | 2,4,6-triiodo-5-substituted-amino-isophthalate esters useful as x-ray contrast agents for medical diagnostics imaging | |
| JPH03115232A (ja) | 非イオン性化合物及び該化合物を含有する放射線造影剤組成物 | |
| US3883535A (en) | Radiopaque derivatives of triiodobenzoic acid with heterocyclic side chains | |
| US3732293A (en) | Iodinated bis(aminobenzoic acids) and esters thereof | |
| IE64759B1 (en) | New substituted dicarboxylic acid-bis (3,5-dicarbamoyl-2,4,6-triiodoanilides) process for their production as well as x-ray contrast media containing them | |
| US4107286A (en) | Polyiods benzene derivatives and X-ray contrast media containing the same | |
| US3772376A (en) | X-ray contrast agents | |
| HU185855B (en) | X-ray-contrast materials containing ionic 5-c-substituted 2,4,6-tri-iodo-isophtaloic acid derivatives and process for producing the compounds for giving shadow | |
| US5730953A (en) | Tris(substituted phenyl) bismuth derivatives | |
| US2853424A (en) | X-ray contrast agents comprising symmetrical bifunctional analogs of nu-acyl derivatives of 2, 4, 6 triiodo-3-amino benzoic acid | |
| CA1048536A (en) | X-ray contrast agents | |
| JPH0641065A (ja) | 非イオン性放射線造影剤 | |
| US2592105A (en) | Iodinated aminophenylsulfonylamino carboxylic acids | |
| US3781338A (en) | Nitrilotriacyltriimino-tris-(2,4,6-triiodobenzoic acid)compounds | |
| FI67841C (fi) | Saosom roentgenkonstrastmedel anvaendbara jodbensenderivat |