IE43004B1 - Cyano acetic acid anilide derivatives, processes for their manufacture and compositions containing them - Google Patents
Cyano acetic acid anilide derivatives, processes for their manufacture and compositions containing themInfo
- Publication number
- IE43004B1 IE43004B1 IE1203/76A IE120376A IE43004B1 IE 43004 B1 IE43004 B1 IE 43004B1 IE 1203/76 A IE1203/76 A IE 1203/76A IE 120376 A IE120376 A IE 120376A IE 43004 B1 IE43004 B1 IE 43004B1
- Authority
- IE
- Ireland
- Prior art keywords
- group
- compound
- general formula
- acid
- acid anilide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 26
- 239000000203 mixture Substances 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 3
- XCTQPMCULSZKLT-UHFFFAOYSA-N 2-cyano-n-phenylacetamide Chemical class N#CCC(=O)NC1=CC=CC=C1 XCTQPMCULSZKLT-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 44
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000002585 base Substances 0.000 claims abstract description 15
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000002253 acid Substances 0.000 claims abstract description 14
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims abstract description 11
- -1 orthoformic acid ester Chemical class 0.000 claims abstract description 9
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 6
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 6
- GLPCMJHDPXSCPC-UHFFFAOYSA-N 2-cyano-4-hydroxy-n-phenylbut-2-enamide Chemical compound OCC=C(C#N)C(=O)NC1=CC=CC=C1 GLPCMJHDPXSCPC-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 claims abstract description 4
- 239000011707 mineral Substances 0.000 claims abstract description 4
- 150000007524 organic acids Chemical class 0.000 claims abstract description 4
- 238000010438 heat treatment Methods 0.000 claims abstract description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 53
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 14
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 12
- 239000003960 organic solvent Substances 0.000 claims description 10
- 150000003931 anilides Chemical class 0.000 claims description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 150000003868 ammonium compounds Chemical class 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 206010061218 Inflammation Diseases 0.000 claims description 2
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 230000004054 inflammatory process Effects 0.000 claims description 2
- 150000002576 ketones Chemical class 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 150000002736 metal compounds Chemical class 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 230000003110 anti-inflammatory effect Effects 0.000 abstract description 5
- 230000001760 anti-analgesic effect Effects 0.000 abstract description 3
- 150000003863 ammonium salts Chemical class 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- 239000000243 solution Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- 208000009386 Experimental Arthritis Diseases 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 3
- RIFXXMYHOTWSEC-UHFFFAOYSA-N n-(3,4-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide Chemical compound O1N=CC(C(=O)NC=2C=C(Cl)C(Cl)=CC=2)=C1C RIFXXMYHOTWSEC-UHFFFAOYSA-N 0.000 description 3
- 229960002895 phenylbutazone Drugs 0.000 description 3
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 230000001562 ulcerogenic effect Effects 0.000 description 3
- SXLMKYWQRMFXBZ-UHFFFAOYSA-N 2-(ethoxymethylidene)-3-oxo-n-phenylbutanamide Chemical compound CCOC=C(C(C)=O)C(=O)NC1=CC=CC=C1 SXLMKYWQRMFXBZ-UHFFFAOYSA-N 0.000 description 2
- UXAGBBWETXVJBA-UHFFFAOYSA-N 2-cyano-4-hydroxy-N-[3-(trifluoromethyl)phenyl]but-2-enamide Chemical compound FC(C=1C=C(NC(C(C#N)=CCO)=O)C=CC=1)(F)F UXAGBBWETXVJBA-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- WTAWWICNIPRYJS-UHFFFAOYSA-N ClC=1C=C(NC(C(C#N)=CCO)=O)C=CC=1Cl Chemical compound ClC=1C=C(NC(C(C#N)=CCO)=O)C=CC=1Cl WTAWWICNIPRYJS-UHFFFAOYSA-N 0.000 description 2
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 description 2
- 108010081348 HRT1 protein Hairy Proteins 0.000 description 2
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 230000003902 lesion Effects 0.000 description 2
- ODRMLQDLKQZGQR-UHFFFAOYSA-N n-(3,4-dichlorophenyl)-2-(ethoxymethylidene)-3-oxobutanamide Chemical compound CCOC=C(C(C)=O)C(=O)NC1=CC=C(Cl)C(Cl)=C1 ODRMLQDLKQZGQR-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- VQBXUKGMJCPBMF-UHFFFAOYSA-N 5-methyl-1,2-oxazole-4-carboxylic acid Chemical compound CC=1ON=CC=1C(O)=O VQBXUKGMJCPBMF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 101100175010 Caenorhabditis elegans gbf-1 gene Proteins 0.000 description 1
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- 238000011694 lewis rat Methods 0.000 description 1
- BPAFBORSRKBCPI-UHFFFAOYSA-N n-(3,4-dichlorophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(Cl)C(Cl)=C1 BPAFBORSRKBCPI-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/66—Nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/18—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Pain & Pain Management (AREA)
- Public Health (AREA)
- Rheumatology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2524929A DE2524929C3 (de) | 1975-06-05 | 1975-06-05 | 2-Hydroxyäthylidencyanessigsäureanilide, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43004L IE43004L (en) | 1976-12-05 |
| IE43004B1 true IE43004B1 (en) | 1980-12-03 |
Family
ID=5948272
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1203/76A IE43004B1 (en) | 1975-06-05 | 1976-06-04 | Cyano acetic acid anilide derivatives, processes for their manufacture and compositions containing them |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4061767A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS6032620B2 (cg-RX-API-DMAC7.html) |
| AT (1) | AT343641B (cg-RX-API-DMAC7.html) |
| BE (1) | BE842688A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1082202A (cg-RX-API-DMAC7.html) |
| CH (1) | CH627444A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2524929C3 (cg-RX-API-DMAC7.html) |
| DK (1) | DK157078C (cg-RX-API-DMAC7.html) |
| FR (1) | FR2313031A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1555555A (cg-RX-API-DMAC7.html) |
| IE (1) | IE43004B1 (cg-RX-API-DMAC7.html) |
| IT (1) | IT1063593B (cg-RX-API-DMAC7.html) |
| LU (1) | LU75075A1 (cg-RX-API-DMAC7.html) |
| MX (1) | MX3170E (cg-RX-API-DMAC7.html) |
| NL (2) | NL186239C (cg-RX-API-DMAC7.html) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4173650A (en) * | 1978-11-03 | 1979-11-06 | American Cyanamid Company | Cis-2-benzoyl-3-hydroxy-2-alkenonitriles as anti-inflammatory agents |
| JPS55500866A (cg-RX-API-DMAC7.html) * | 1978-11-03 | 1980-10-30 | ||
| US4181677A (en) * | 1978-12-13 | 1980-01-01 | American Cyanamid Company | 2-Benzoyl-3-alkoxy-2-alkenonitriles |
| US4259256A (en) * | 1978-12-13 | 1981-03-31 | American Cyanamid Company | 2-Benzoyl-3-dimethylamino-2-alkenonitriles |
| US4256759A (en) * | 1979-06-11 | 1981-03-17 | Ciba-Geigy Corporation | Alphacarbamoyl-pyrrolpropionitriles |
| FI71129C (fi) * | 1979-06-11 | 1986-11-24 | Ciba Geigy Ag | Foerfarande foer framstaellning av farmaceutiskt aktiva alfakarbamoylpyrrolpropionitriler |
| US4277420A (en) * | 1979-09-24 | 1981-07-07 | Monsanto Company | Ephedrine and pseudoephedrine precursors |
| US4254049A (en) * | 1979-12-17 | 1981-03-03 | American Cyanamid Company | Substituted phenyl-2-cyano-2-alkenoic acid esters |
| US4254048A (en) * | 1979-12-17 | 1981-03-03 | American Cyanamid Company | Substituted phenyl alkylidene acetoacetonitriles |
| US4254047A (en) * | 1979-12-17 | 1981-03-03 | American Cyanamid Company | Substituted phenyl-2-cyano-2-thioalkenoic acid esters |
| US4435407A (en) | 1982-01-07 | 1984-03-06 | Ciba-Geigy Corporation | Certain substituted β-oxo-α-carbamoylpyrrolepropionitriles |
| US4644010A (en) * | 1982-09-28 | 1987-02-17 | Ciba-Geigy Corporation | Certain β-oxo-α-carbamoylpyrrolepropionitriles |
| DE3247454A1 (de) * | 1982-12-22 | 1984-06-28 | Laboratorios Bago S.A., Buenos Aires | Substituierte 3-phenyl-5-methyl-isoxazol-4-carboxy-anilide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE3534440A1 (de) * | 1985-09-27 | 1987-04-02 | Hoechst Ag | Arzneimittel gegen chronische graft-versus-host-krankheiten sowie gegen autoimmunerkrankungen, insbesondere systemischen lupus erythematodes |
| US5268382A (en) * | 1985-09-27 | 1993-12-07 | Hoechst Aktiengesellschaft | Medicaments to combat autoimmune diseases, in particular systemic lupus erythematosus |
| GB8619432D0 (en) * | 1986-08-08 | 1986-09-17 | Lilly Industries Ltd | Pharmaceutical compounds |
| GB8619433D0 (en) * | 1986-08-08 | 1986-09-17 | Lilly Industries Ltd | Pharmaceutical compounds |
| US4888357A (en) * | 1988-01-26 | 1989-12-19 | Bristol-Myers Company | Antiarthritic β-cycloalkyl-β-oxopropionitriles |
| US4975462A (en) * | 1988-07-29 | 1990-12-04 | Bristol-Myers Company | Antiarthritic α-arylcarbamoyl cyanoacetic acid derivatives |
| DD297328A5 (de) | 1989-08-18 | 1992-01-09 | �������@���������k���Kk�� | 5-methyl-isoxalol-4-carbonsaeureanilide und 2 hydroxyethyliden-cyanoessigsaeureanilide zur behandlung von augenerkrankungen |
| US5583150A (en) * | 1989-08-18 | 1996-12-10 | Alcon Laboratories, Inc. | 5-methyl-isoxazole-4-carboxylic acid anilides and 2-hydroxyethylidene-cyano acetic anilides for the treatment of ocular diseases |
| US5034410A (en) * | 1989-10-11 | 1991-07-23 | Syntex (U.S.A.) Inc. | Anthelmintically active benzenepropanamide derivatives |
| ZA913762B (en) | 1990-05-18 | 1992-01-29 | Hoechst Ag | Isoxazole-4-carboxamides and hydroxyalkylidenecyanoacetamides,pharmaceuticals containing these compounds and their use |
| JP2995086B2 (ja) * | 1990-05-18 | 1999-12-27 | ヘキスト・アクチエンゲゼルシヤフト | イソオキサゾール−4−カルボキサミド類およびヒドロキシアルキリデンシアノアセトアミド類を含有する製剤 |
| DK0492497T3 (da) * | 1990-12-24 | 1997-01-06 | Hoechst Ag | Fremgangsmåde til acylering af alkoholer med en immobiliseret pseudomonas-lipase |
| US6133301A (en) * | 1991-08-22 | 2000-10-17 | Aventis Pharma Deutschland Gmbh | Pharmaceuticals for the treatment of rejection reactions in organ transplantations |
| DE4127737A1 (de) | 1991-08-22 | 1993-02-25 | Hoechst Ag | Arzneimittel zur behandlung von abstossungsreaktionen bei organverpflanzungen |
| IL102790A (en) * | 1991-09-17 | 1996-01-31 | Roussel Uclaf | 3-Cycloalkyl-prop-2- enamide derivatives |
| ATE128353T1 (de) * | 1991-10-23 | 1995-10-15 | Hoechst Ag | N-phenyl-2-cyano-3-hydroxycrotonsäureamidderiva e und deren verwendung als arzneimittel mit immunmodulatorischer eigenschaft. |
| GB9200275D0 (en) * | 1992-01-08 | 1992-02-26 | Roussel Lab Ltd | Chemical compounds |
| GB9209330D0 (en) * | 1992-04-30 | 1992-06-17 | Roussel Lab Ltd | Chemical compounds |
| GB9300083D0 (en) | 1993-01-05 | 1993-03-03 | Roussel Lab Ltd | Chemical compounds |
| TW314467B (cg-RX-API-DMAC7.html) * | 1993-03-31 | 1997-09-01 | Hoechst Ag | |
| FI955798L (fi) * | 1993-06-03 | 1996-02-01 | Therapeutic Antibodies Inc | Terapeuttiset vasta-ainefrangmentit |
| GB9313365D0 (en) * | 1993-06-29 | 1993-08-11 | Roussel Lab Ltd | Chemical compounds |
| GB9322781D0 (en) * | 1993-11-04 | 1993-12-22 | Roussel Lab Ltd | Aromatic amides |
| LT3589B (en) | 1993-11-30 | 1995-12-27 | Hoechst Ag | Using of known combination for treatment of rejection reaction by transplantation of organs |
| US5700823A (en) * | 1994-01-07 | 1997-12-23 | Sugen, Inc. | Treatment of platelet derived growth factor related disorders such as cancers |
| US5519042A (en) * | 1994-01-13 | 1996-05-21 | Hoechst Aktiengesellschaft | Method of treating hyperproliferative vascular disease |
| US6331555B1 (en) | 1995-06-01 | 2001-12-18 | University Of California | Treatment of platelet derived growth factor related disorders such as cancers |
| DE19539638A1 (de) * | 1995-10-25 | 1997-04-30 | Hoechst Ag | Die Verwendung von Isoxazol- und Crotonsäureamidderivaten zur Behandlung von Krebserkrankungen |
| DE19547648A1 (de) | 1995-12-20 | 1997-06-26 | Hoechst Ag | Zubereitung, enthaltend High Density Lipoproteine und Crotonsäureamidderivate |
| US5981536A (en) * | 1996-07-31 | 1999-11-09 | Hoechst Aktiengesellschaft | Use of xanthine derivatives for the modulation of apoptosis |
| US6011051A (en) * | 1996-07-31 | 2000-01-04 | Hoechst Aktiengesellschaft | Use of isoxazole and crotonamide derivatives for the modulation of apoptosis |
| US5856330A (en) * | 1996-07-31 | 1999-01-05 | Hoechst Aktiengesellschaft | Use of xanthine derivatives for the inhibition of dephosphorylation of cofilin |
| US6316479B1 (en) | 1997-05-19 | 2001-11-13 | Sugen, Inc. | Isoxazole-4-carboxamide compounds active against protein tryosine kinase related disorders |
| ES2150808T3 (es) | 1997-08-08 | 2000-12-01 | Aventis Pharma Gmbh | Forma cristalina de (4-trifluorometil)-anilida de acido 5-metilisoxazol-4-carboxilico. |
| US6355678B1 (en) | 1998-06-29 | 2002-03-12 | Parker Hughes Institute | Inhibitors of the EGF-receptor tyrosine kinase and methods for their use |
| US20050255071A1 (en) * | 1998-12-10 | 2005-11-17 | Aventis Pharma Deutschland Gmbh | Preparation having improved therapeutic breadth comprising nucleotide synthesis inhibitors |
| GB0123571D0 (en) * | 2001-04-05 | 2001-11-21 | Aventis Pharm Prod Inc | Use of (Z)-2-cyano-3-hydroxy-but-2-enoic acid-(4'-trifluoromethylphenyl)-amide for treating multiple sclerosis |
| DE10132308A1 (de) * | 2001-07-06 | 2003-01-30 | Aventis Behring Gmbh | Kombinationspräparat zur Therapie von immunologischen Erkrankungen |
| MXPA04000224A (es) | 2001-07-10 | 2005-07-25 | 4Sc Ag | Novedosos compuestos como agentes antiinflamatorios, inmunomoduladores y antiproliferativos. |
| US20050158371A1 (en) * | 2002-02-12 | 2005-07-21 | Sumitomo Pharmaceuticals Co., Ltd. | Novel external agent |
| AU2003293914B2 (en) | 2002-12-23 | 2010-09-23 | Panoptes Pharma Ges.M.B.H. | Aromatic compounds as anti-inflammatory, immunomodulatory and anti-proliferatory agents |
| UA108760C2 (uk) | 2010-07-01 | 2015-06-10 | Кальцієві солі сполуки як протизапальні, імуномодулюючі та антипроліферативні засоби | |
| US20160287549A1 (en) | 2013-11-22 | 2016-10-06 | Genzyme Corporation | Novel methods for treating neurodegenerative diseases |
| RU2722316C2 (ru) * | 2015-06-17 | 2020-05-29 | Биокон Лимитед | Новый способ получения терифлуномида |
| KR102764121B1 (ko) | 2018-03-16 | 2025-02-05 | 이뮤닉 아게 | 항-염증제, 면역조절제 및 항-증식제로서의 신규한 칼슘 염 다형체 |
| EP3900717B1 (en) | 2020-04-21 | 2024-11-20 | Immunic AG | Vidofludimus for use in the treatment or prevention of viral diseases |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2288863A (en) * | 1940-02-27 | 1942-07-07 | Hoffmann La Roche | Process for the manufacture of substituted amides of 3,5-dimethylisoxazole-4-carboxylic acid |
| BE506549A (cg-RX-API-DMAC7.html) * | 1950-10-19 |
-
0
- NL NLAANVRAGE7605845,A patent/NL186239B/xx unknown
-
1975
- 1975-06-05 DE DE2524929A patent/DE2524929C3/de not_active Expired
-
1976
- 1976-05-31 NL NLAANVRAGE7605845,A patent/NL186239C/xx not_active IP Right Cessation
- 1976-06-02 CH CH696376A patent/CH627444A5/de not_active IP Right Cessation
- 1976-06-03 LU LU75075A patent/LU75075A1/xx unknown
- 1976-06-03 IT IT23922/76A patent/IT1063593B/it active
- 1976-06-03 US US05/692,318 patent/US4061767A/en not_active Expired - Lifetime
- 1976-06-04 IE IE1203/76A patent/IE43004B1/en unknown
- 1976-06-04 CA CA254,136A patent/CA1082202A/en not_active Expired
- 1976-06-04 AT AT413576A patent/AT343641B/de not_active IP Right Cessation
- 1976-06-04 FR FR7617042A patent/FR2313031A1/fr active Granted
- 1976-06-04 MX MX000269U patent/MX3170E/es unknown
- 1976-06-04 JP JP51065477A patent/JPS6032620B2/ja not_active Expired
- 1976-06-04 DK DK248476A patent/DK157078C/da active
- 1976-06-07 GB GB23437/76A patent/GB1555555A/en not_active Expired
- 1976-06-08 BE BE167706A patent/BE842688A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2313031A1 (fr) | 1976-12-31 |
| DK157078C (da) | 1990-04-09 |
| LU75075A1 (cg-RX-API-DMAC7.html) | 1977-03-07 |
| MX3170E (es) | 1980-06-05 |
| AT343641B (de) | 1978-06-12 |
| DE2524929A1 (de) | 1976-12-16 |
| DK248476A (da) | 1976-12-06 |
| US4061767A (en) | 1977-12-06 |
| GB1555555A (en) | 1979-11-14 |
| IT1063593B (it) | 1985-02-11 |
| JPS527929A (en) | 1977-01-21 |
| CA1082202A (en) | 1980-07-22 |
| JPS6032620B2 (ja) | 1985-07-29 |
| CH627444A5 (de) | 1982-01-15 |
| DE2524929C3 (de) | 1980-10-09 |
| DE2524929B2 (de) | 1980-01-31 |
| NL7605845A (en) | 1976-12-07 |
| ATA413576A (de) | 1977-10-15 |
| DK157078B (da) | 1989-11-06 |
| NL186239C (nl) | 1990-10-16 |
| IE43004L (en) | 1976-12-05 |
| BE842688A (fr) | 1976-12-08 |
| FR2313031B1 (cg-RX-API-DMAC7.html) | 1979-10-12 |
| NL186239B (nl) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE43004B1 (en) | Cyano acetic acid anilide derivatives, processes for their manufacture and compositions containing them | |
| US4087535A (en) | 5-Methyl-isoxazole-4-carboxylic acid anilides | |
| Hannah et al. | Novel analgesic-antiinflammatory salicylates | |
| EP0116948B1 (en) | (2-oxo-1,2,3,5-tetrahydroimidazo-(2,1-b)quinazolinyl)-oxyalkyl-amides | |
| Abadi et al. | Synthesis of novel 4-substituted-7-trifluoromethylquinoline derivatives with nitric oxide releasing properties and their evaluation as analgesic and anti-inflammatory agents | |
| US7202364B2 (en) | Certain phenylacetic acids and derivatives | |
| CA1129867A (en) | Isoxazole derivative, processes for its preparation, compositions containing it, and its use for combating rheumatism | |
| US3856967A (en) | Novel indoles in the treatment of pain | |
| US4365076A (en) | Process for the preparation of cycloalkylidenemethylphenylacetic acid derivatives | |
| US4663320A (en) | (2-oxo-1,2,3,5-tetrahydroimidazo[2,1-b]quinoazolinyl)oxyalkylamides, compositions and the use thereof | |
| JPH0390063A (ja) | 二置換された(キノリン―2―イル―メトキシ)フエニル酢酸誘導体 | |
| HUT54617A (en) | Process for producing new substituted acyl-phenols and pharmaceutical compositions containing them | |
| US5449783A (en) | Diphenylthiazole derivative | |
| IL29775A (en) | Glyceryl esters of a history of the acids N-phenyl anthranyl and 2-anilino-nicotinic | |
| US4025528A (en) | Thiazole derivatives of benzoic and phenylalkanoic acids | |
| US3969355A (en) | 5-Aminoethyl-2,4-diphenylpyrimidine dihydrobromide | |
| DE2524959A1 (de) | Neue isoxazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel | |
| Kees et al. | Synthesis and antiallergic activity of a novel series of 5-lipoxygenase inhibitors | |
| US4767767A (en) | 2-pyrrolidinylethyl-2-(7-trifluoromethyl-4-quinolyl-aminobenzoate having analgesic, antipyretic and anti-inflammatory activities | |
| Musser et al. | N-[(arylmethoxy) phenyl] and N-[(arylmethoxy) naphthyl] sulfonamides: Potent orally active leukotriene D4 antagonists of novel structure | |
| IE46001B1 (en) | Process for the manufacture of 5-methyl isoxazole-4-carboxylic acid anilide derivatives | |
| US4077968A (en) | Thiazole derivatives | |
| US4495196A (en) | Antiinflammatory 4,5-diaryl-α-polyfluoroalkyl-1H-pyrrole-2-methanols and method for use thereof | |
| US4873232A (en) | Novel use for carbamoyl benzoates | |
| US3703513A (en) | Novel 3,5-dioxopyrazolidine derivatives |