IE42942B1 - Selective herbicidal triazine-diones - Google Patents
Selective herbicidal triazine-dionesInfo
- Publication number
- IE42942B1 IE42942B1 IE92/76A IE9276A IE42942B1 IE 42942 B1 IE42942 B1 IE 42942B1 IE 92/76 A IE92/76 A IE 92/76A IE 9276 A IE9276 A IE 9276A IE 42942 B1 IE42942 B1 IE 42942B1
- Authority
- IE
- Ireland
- Prior art keywords
- compounds
- compound
- triazine
- group
- plants
- Prior art date
Links
- BFGQTWYXWNCTSX-UHFFFAOYSA-N triazine-4,5-dione Chemical class O=C1C=NN=NC1=O BFGQTWYXWNCTSX-UHFFFAOYSA-N 0.000 title claims abstract description 19
- 230000002363 herbicidal effect Effects 0.000 title claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 16
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 13
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 9
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims abstract description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 106
- 239000000203 mixture Substances 0.000 claims description 37
- -1 triazine-dione compound Chemical class 0.000 claims description 30
- 239000004480 active ingredient Substances 0.000 claims description 12
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 12
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 7
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 6
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 11
- 241000209504 Poaceae Species 0.000 abstract description 6
- 238000011282 treatment Methods 0.000 abstract description 4
- 241000196324 Embryophyta Species 0.000 description 48
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 21
- 239000004009 herbicide Substances 0.000 description 14
- 230000006378 damage Effects 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 239000002689 soil Substances 0.000 description 9
- 239000004094 surface-active agent Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 241000894007 species Species 0.000 description 8
- 150000001721 carbon Chemical group 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000007921 spray Substances 0.000 description 6
- 230000001629 suppression Effects 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 4
- 244000025254 Cannabis sativa Species 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 4
- 235000021536 Sugar beet Nutrition 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical class N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 4
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 description 3
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical compound CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 3
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 244000152970 Digitaria sanguinalis Species 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- 241000508725 Elymus repens Species 0.000 description 3
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 3
- 240000008415 Lactuca sativa Species 0.000 description 3
- 235000003228 Lactuca sativa Nutrition 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 3
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 3
- 239000001166 ammonium sulphate Substances 0.000 description 3
- 235000011130 ammonium sulphate Nutrition 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 235000009973 maize Nutrition 0.000 description 3
- 231100000208 phytotoxic Toxicity 0.000 description 3
- 230000000885 phytotoxic effect Effects 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- 229940035044 sorbitan monolaurate Drugs 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 3
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 2
- HHWBTRFHERTBQG-UHFFFAOYSA-N 6-aminotriazine-4,5-dione Chemical class NC1=NN=NC(=O)C1=O HHWBTRFHERTBQG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000003276 Apios tuberosa Nutrition 0.000 description 2
- 235000010777 Arachis hypogaea Nutrition 0.000 description 2
- 235000010744 Arachis villosulicarpa Nutrition 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical class [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 235000014716 Eleusine indica Nutrition 0.000 description 2
- 244000025670 Eleusine indica Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- 240000003461 Setaria viridis Species 0.000 description 2
- 235000002248 Setaria viridis Nutrition 0.000 description 2
- 241001148683 Zostera marina Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- XXUJMEYKYHETBZ-UHFFFAOYSA-N ethyl 4-nitrophenyl ethylphosphonate Chemical compound CCOP(=O)(CC)OC1=CC=C([N+]([O-])=O)C=C1 XXUJMEYKYHETBZ-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 150000002357 guanidines Chemical class 0.000 description 2
- 231100001184 nonphytotoxic Toxicity 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- 229940093635 tributyl phosphate Drugs 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- WXJYKXOIFICRPR-UHFFFAOYSA-L 1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.COS([O-])(=O)=O.C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 WXJYKXOIFICRPR-UHFFFAOYSA-L 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
- OWZPCEFYPSAJFR-UHFFFAOYSA-N 2-(butan-2-yl)-4,6-dinitrophenol Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O OWZPCEFYPSAJFR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- WDRGQGLIUAMOOC-UHFFFAOYSA-N 2-benzamidooxyacetic acid Chemical compound OC(=O)CONC(=O)C1=CC=CC=C1 WDRGQGLIUAMOOC-UHFFFAOYSA-N 0.000 description 1
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- GNWGCMCOLIJPDN-UHFFFAOYSA-N 4-methylsulfanyltriazine Chemical class CSC1=CC=NN=N1 GNWGCMCOLIJPDN-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- XJPGYVQTGHUTFZ-UHFFFAOYSA-N 5-methyl-1h-triazine-6-thione Chemical compound CC1=CN=NNC1=S XJPGYVQTGHUTFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- AFIIBUOYKYSPKB-UHFFFAOYSA-N Aziprotryne Chemical compound CSC1=NC(NC(C)C)=NC(N=[N+]=[N-])=N1 AFIIBUOYKYSPKB-UHFFFAOYSA-N 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000006008 Brassica napus var napus Nutrition 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 241001148727 Bromus tectorum Species 0.000 description 1
- 235000003255 Carthamus tinctorius Nutrition 0.000 description 1
- 244000020518 Carthamus tinctorius Species 0.000 description 1
- 244000277285 Cassia obtusifolia Species 0.000 description 1
- 235000006719 Cassia obtusifolia Nutrition 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 235000016854 Cyperus rotundus Nutrition 0.000 description 1
- 244000075634 Cyperus rotundus Species 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-N Dalapon Chemical compound CC(Cl)(Cl)C(O)=O NDUPDOJHUQKPAG-UHFFFAOYSA-N 0.000 description 1
- 240000008853 Datura stramonium Species 0.000 description 1
- 239000005503 Desmedipham Substances 0.000 description 1
- 244000262903 Desmodium tortuosum Species 0.000 description 1
- 239000005504 Dicamba Substances 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- 239000005562 Glyphosate Substances 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 241000207890 Ipomoea purpurea Species 0.000 description 1
- 239000005572 Lenacil Substances 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 239000005575 MCPB Substances 0.000 description 1
- 101150039283 MCPB gene Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical class [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001358279 Malaya Species 0.000 description 1
- 235000010624 Medicago sativa Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- LRUUNMYPIBZBQH-UHFFFAOYSA-N Methazole Chemical compound O=C1N(C)C(=O)ON1C1=CC=C(Cl)C(Cl)=C1 LRUUNMYPIBZBQH-UHFFFAOYSA-N 0.000 description 1
- 239000005583 Metribuzin Substances 0.000 description 1
- 244000133018 Panax trifolius Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 241000044532 Paspalum conjugatum Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 239000005594 Phenmedipham Substances 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000006386 Polygonum aviculare Nutrition 0.000 description 1
- 244000292697 Polygonum aviculare Species 0.000 description 1
- 235000001855 Portulaca oleracea Nutrition 0.000 description 1
- 244000234609 Portulaca oleracea Species 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 241001355178 Setaria faberi Species 0.000 description 1
- 240000006410 Sida spinosa Species 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 241000209072 Sorghum Species 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 241000647292 Tripleurospermum maritimum Species 0.000 description 1
- 241000404538 Tripleurospermum maritimum subsp. inodorum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000002096 Vicia faba var. equina Nutrition 0.000 description 1
- 241000003690 Xanthium spinosum Species 0.000 description 1
- AKZWRTCWNXHHFR-PDIZUQLASA-N [(3S)-oxolan-3-yl] N-[(2S,3S)-4-[(5S)-5-benzyl-3-[(2R)-2-carbamoyloxy-2,3-dihydro-1H-inden-1-yl]-4-oxo-3H-pyrrol-5-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate Chemical compound NC(=O)O[C@@H]1Cc2ccccc2C1C1C=N[C@](C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOC2)(Cc2ccccc2)C1=O AKZWRTCWNXHHFR-PDIZUQLASA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229920005550 ammonium lignosulfonate Polymers 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N bentazone Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- HCWYXKWQOMTBKY-UHFFFAOYSA-N calcium;dodecyl benzenesulfonate Chemical compound [Ca].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 HCWYXKWQOMTBKY-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- WYKYKTKDBLFHCY-UHFFFAOYSA-N chloridazon Chemical compound O=C1C(Cl)=C(N)C=NN1C1=CC=CC=C1 WYKYKTKDBLFHCY-UHFFFAOYSA-N 0.000 description 1
- IVUXTESCPZUGJC-UHFFFAOYSA-N chloroxuron Chemical compound C1=CC(NC(=O)N(C)C)=CC=C1OC1=CC=C(Cl)C=C1 IVUXTESCPZUGJC-UHFFFAOYSA-N 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- LZEPOJMTQYNFTR-UHFFFAOYSA-N cyclopropanecarbonyl cyclopropanecarboxylate Chemical compound C1CC1C(=O)OC(=O)C1CC1 LZEPOJMTQYNFTR-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- WZJZMXBKUWKXTQ-UHFFFAOYSA-N desmedipham Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 WZJZMXBKUWKXTQ-UHFFFAOYSA-N 0.000 description 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 230000003631 expected effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000004426 flaxseed Nutrition 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 1
- 229940097068 glyphosate Drugs 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Chemical class 0.000 description 1
- 239000011777 magnesium Chemical class 0.000 description 1
- GXHFUVWIGNLZSC-UHFFFAOYSA-N meldrum's acid Chemical compound CC1(C)OC(=O)CC(=O)O1 GXHFUVWIGNLZSC-UHFFFAOYSA-N 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- NDNKHWUXXOFHTD-UHFFFAOYSA-N metizoline Chemical compound CC=1SC2=CC=CC=C2C=1CC1=NCCN1 NDNKHWUXXOFHTD-UHFFFAOYSA-N 0.000 description 1
- 229960002939 metizoline Drugs 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- YGLMVCVJLXREAK-NGDQXYMTSA-N n,n-dimethyl-n'-(octahydro-4,7-methano-1h-inden-5-yl)-(3aα,4α,5α,7α,7aα)-urea Chemical compound C([C@@H]12)CC[C@H]1[C@@H]1C[C@H](NC(=O)N(C)C)[C@@H]2C1 YGLMVCVJLXREAK-NGDQXYMTSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- IDOWTHOLJBTAFI-UHFFFAOYSA-N phenmedipham Chemical compound COC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 IDOWTHOLJBTAFI-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000004552 water soluble powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4885/75A GB1543037A (en) | 1975-02-05 | 1975-02-05 | Selective herbicidal triazine-diones |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42942L IE42942L (en) | 1976-08-05 |
| IE42942B1 true IE42942B1 (en) | 1980-11-19 |
Family
ID=9785684
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE92/76A IE42942B1 (en) | 1975-02-05 | 1976-01-16 | Selective herbicidal triazine-diones |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4105433A (enExample) |
| JP (1) | JPS51104032A (enExample) |
| AU (1) | AU498498B2 (enExample) |
| BE (1) | BE838305A (enExample) |
| BR (1) | BR7600699A (enExample) |
| CA (1) | CA1047496A (enExample) |
| CH (1) | CH616665A5 (enExample) |
| CS (1) | CS195720B2 (enExample) |
| DD (1) | DD124576A5 (enExample) |
| DE (1) | DE2603180A1 (enExample) |
| DK (1) | DK144271C (enExample) |
| ES (1) | ES444930A1 (enExample) |
| FR (1) | FR2299809A1 (enExample) |
| GB (1) | GB1543037A (enExample) |
| IE (1) | IE42942B1 (enExample) |
| IL (1) | IL48900A (enExample) |
| IT (1) | IT1055000B (enExample) |
| NL (1) | NL7601115A (enExample) |
| OA (1) | OA05237A (enExample) |
| PH (1) | PH10920A (enExample) |
| ZA (1) | ZA76316B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1599518A (en) * | 1977-02-21 | 1981-10-07 | Ici Ltd | 1,3,5-triazine-2,6-diones and pharmaceutical compositions thereof |
| EP0005911B1 (en) * | 1978-05-26 | 1982-02-17 | Imperial Chemical Industries Plc | Analgesic 6-acylaminotetrahydro-1,3,5-triazine-2,4-dione derivatives, pharmaceutical compositions thereof, and process for their manufacture |
| DE4141721A1 (de) * | 1991-12-18 | 1993-06-24 | Bayer Ag | Substituierte heterocyclyltriazindione |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE584305A (enExample) * | 1958-11-05 | |||
| US3218148A (en) * | 1958-11-05 | 1965-11-16 | Geigy Ag J R | Method of eliminating annual weeds |
| US3244712A (en) * | 1960-02-19 | 1966-04-05 | Geigy Ag J R | Acylamino symmetrical triazines |
| IL42103A (en) * | 1972-05-24 | 1976-05-31 | Du Pont | 6-amino-s-triazine-2,4-(1h,3h)-diones and corresponding 4-thio compounds,their preparation and their use as herbicides |
| ZA732906B (en) | 1972-05-24 | 1974-11-27 | Du Pont | Herbicidal triazines |
| DE2254200C2 (de) * | 1972-11-06 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
| US3902887A (en) * | 1973-04-05 | 1975-09-02 | Du Pont | Herbicidal 6-amino-s-triazinediones |
| US4226990A (en) * | 1973-11-01 | 1980-10-07 | Imperial Chemical Industries Limited | Triazine-diones |
| US4035365A (en) * | 1973-11-01 | 1977-07-12 | Imperial Chemical Industries Limited | Triazinediones |
-
1975
- 1975-02-05 GB GB4885/75A patent/GB1543037A/en not_active Expired
-
1976
- 1976-01-16 IE IE92/76A patent/IE42942B1/en unknown
- 1976-01-20 US US05/650,754 patent/US4105433A/en not_active Expired - Lifetime
- 1976-01-20 ZA ZA316A patent/ZA76316B/xx unknown
- 1976-01-23 AU AU10541/76A patent/AU498498B2/en not_active Expired
- 1976-01-26 PH PH18012A patent/PH10920A/en unknown
- 1976-01-26 IL IL48900A patent/IL48900A/xx unknown
- 1976-01-27 IT IT19644/76A patent/IT1055000B/it active
- 1976-01-28 DE DE19762603180 patent/DE2603180A1/de not_active Ceased
- 1976-02-04 DD DD191096A patent/DD124576A5/xx unknown
- 1976-02-04 NL NL7601115A patent/NL7601115A/xx unknown
- 1976-02-04 BR BR7600699A patent/BR7600699A/pt unknown
- 1976-02-04 FR FR7603122A patent/FR2299809A1/fr active Granted
- 1976-02-05 ES ES444930A patent/ES444930A1/es not_active Expired
- 1976-02-05 JP JP51010907A patent/JPS51104032A/ja active Pending
- 1976-02-05 DK DK47776A patent/DK144271C/da not_active IP Right Cessation
- 1976-02-05 OA OA55731A patent/OA05237A/xx unknown
- 1976-02-05 CA CA245,144A patent/CA1047496A/en not_active Expired
- 1976-02-05 BE BE164124A patent/BE838305A/xx not_active IP Right Cessation
- 1976-02-05 CH CH142476A patent/CH616665A5/de not_active IP Right Cessation
- 1976-02-05 CS CS76754A patent/CS195720B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS195720B2 (en) | 1980-02-29 |
| BE838305A (fr) | 1976-08-05 |
| IE42942L (en) | 1976-08-05 |
| FR2299809A1 (fr) | 1976-09-03 |
| ZA76316B (en) | 1977-01-26 |
| AU498498B2 (en) | 1979-03-15 |
| IT1055000B (it) | 1981-11-30 |
| US4105433A (en) | 1978-08-08 |
| GB1543037A (en) | 1979-03-28 |
| IL48900A0 (en) | 1976-04-30 |
| FR2299809B1 (enExample) | 1980-01-11 |
| CH616665A5 (enExample) | 1980-04-15 |
| JPS51104032A (enExample) | 1976-09-14 |
| DD124576A5 (enExample) | 1977-03-02 |
| DK144271C (da) | 1982-07-12 |
| NL7601115A (nl) | 1976-08-09 |
| DK144271B (da) | 1982-02-01 |
| DE2603180A1 (de) | 1976-08-19 |
| ES444930A1 (es) | 1977-04-16 |
| OA05237A (fr) | 1981-02-28 |
| IL48900A (en) | 1979-03-12 |
| BR7600699A (pt) | 1976-08-31 |
| PH10920A (en) | 1977-10-05 |
| CA1047496A (en) | 1979-01-30 |
| DK47776A (da) | 1976-08-06 |
| AU1054176A (en) | 1977-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2567235B2 (ja) | 置換ピリジンスルホンアミド系化合物、それらを含有する除草剤並びにそれらの製造方法 | |
| EP0342569B1 (de) | Heterocyclische 2-Alkoxyphenoxysulfonylharnstoffe und ihre Verwendung als Herbizide oder Pflanzenwachstumsregulatoren | |
| US4816064A (en) | Triazine derivatives, herbicidal composition containing them, and method of controlling growth of undesired vegetation by using same | |
| DK164166B (da) | N-oe(4,6-dimethoxypyrimidin-2-yl)aminocarbonylaa-3-trifluormethylpyridin-2-sulfonamid og salte deraf, herbicidt middel med et indhold deraf, fremgangsmaade til bekaempelse af skadelige ukrudtsplanter under anvendelse deraf og fremgangsmaade til fremstilling af forbindelsen | |
| US3734923A (en) | Thiazole derivatives | |
| US4116674A (en) | Process of severely damaging or killing unwanted plants with pyrimidine compounds | |
| US3845055A (en) | 2,4-diaminopyrimidine-5-carboxylic acid amides | |
| US4014677A (en) | 5-Nitropyrimidine derivatives and their use in agents for influencing plant growth | |
| GB2077732A (en) | Herbicidal cyclohexanedione derivatives | |
| US4133674A (en) | Herbicidal heterocyclic compounds | |
| US4105433A (en) | Selective herbicides | |
| SI9010535A (en) | Herbicidal esters of //(1,3,5-triazin-2-yl)aminocarbonyl /aminosulphonyl/-benzoic acid, process for their preparation and their use | |
| JPH0665135A (ja) | 2−ベンゾイルシクロヘキサンジオンの塩、選択的除草剤、その製造方法、およびそれを、雑草を制御するために使用する方法 | |
| US3756803A (en) | Herbicidal pyrido(1,2-delta)-s-triazinediones | |
| US3933815A (en) | Trifluoromethyl triazines | |
| JPS6270358A (ja) | N−置換3、4、5、6−テトラヒドロフタルイミド、それらの製造方法およびそれらを含有する除草剤 | |
| US4220770A (en) | Triazine compounds | |
| CA1151655A (en) | 5-amino-4-cyano-1-(2,4,6-trichlorophenyl) pyrazole and salts thereof | |
| US5129941A (en) | Heterocyclically substituted sulfonylureas, and their use as herbicides or plant growth regulators | |
| GB2103610A (en) | Herbicidal compounds derived from N-sulphonyl-aryloxybenamides and the processes for their preparation and use | |
| US4402733A (en) | Herbicidally active 1,2,4-triazin-5-one derivatives | |
| US3914224A (en) | 1,3,5-S-Triazines | |
| US3746710A (en) | 2-alkylthio-4,6-di(alkylamino)-s-triazines | |
| JPH04338356A (ja) | ハロアルコキシ− 置換ベンゾイルシクロヘキサンジオン、それらの製造方法および除草剤および植物生長調整剤としてのそれらの用途 | |
| US3938985A (en) | Substituted triazines |