IE39574B1 - 2-phenyl-as-triazine-3,5(2h,4h)diones - Google Patents
2-phenyl-as-triazine-3,5(2h,4h)dionesInfo
- Publication number
- IE39574B1 IE39574B1 IE946/74A IE94674A IE39574B1 IE 39574 B1 IE39574 B1 IE 39574B1 IE 946/74 A IE946/74 A IE 946/74A IE 94674 A IE94674 A IE 94674A IE 39574 B1 IE39574 B1 IE 39574B1
- Authority
- IE
- Ireland
- Prior art keywords
- dimethyl
- hydrogen
- phenyl
- triazine
- methyl
- Prior art date
Links
- XGPCOQNUQVZURR-UHFFFAOYSA-N 2-phenyl-1,2,4-triazine-3,5-dione Chemical class O=C1NC(=O)C=NN1C1=CC=CC=C1 XGPCOQNUQVZURR-UHFFFAOYSA-N 0.000 title abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 9
- 239000001257 hydrogen Substances 0.000 abstract 8
- 150000002431 hydrogen Chemical class 0.000 abstract 6
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 125000005843 halogen group Chemical group 0.000 abstract 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 4
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 abstract 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 3
- 239000005864 Sulphur Chemical group 0.000 abstract 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 3
- 238000006243 chemical reaction Methods 0.000 abstract 3
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 3
- -1 morpholino, thiomorpholino Chemical group 0.000 abstract 3
- 229910052757 nitrogen Inorganic materials 0.000 abstract 3
- 239000001301 oxygen Substances 0.000 abstract 3
- 229910052760 oxygen Inorganic materials 0.000 abstract 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 abstract 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 abstract 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 abstract 2
- HSOGVWWWGVFXGF-UHFFFAOYSA-N ethyl n-(2-cyanoacetyl)carbamate Chemical compound CCOC(=O)NC(=O)CC#N HSOGVWWWGVFXGF-UHFFFAOYSA-N 0.000 abstract 2
- 125000001153 fluoro group Chemical group F* 0.000 abstract 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- YLRBJYMANQKEAW-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)benzene Chemical compound BrCC1=CC=C(Br)C=C1 YLRBJYMANQKEAW-UHFFFAOYSA-N 0.000 abstract 1
- CRPBQFYNGTYVRE-UHFFFAOYSA-N 2-[(4-bromophenyl)methoxy]-1,3-dimethyl-5-nitrobenzene Chemical compound CC=1C=C(C=C(C1OCC1=CC=C(C=C1)Br)C)[N+](=O)[O-] CRPBQFYNGTYVRE-UHFFFAOYSA-N 0.000 abstract 1
- HJRAHPYBUABWMZ-UHFFFAOYSA-N 2-[4-[(4-bromophenyl)methoxy]-3,5-dimethylphenyl]-1H-1,2,4-triazine Chemical compound CC=1C=C(C=C(C=1OCC1=CC=C(C=C1)Br)C)N1NC=CN=C1 HJRAHPYBUABWMZ-UHFFFAOYSA-N 0.000 abstract 1
- ATOQKNUSBPHNFP-UHFFFAOYSA-N 2-[4-[(4-bromophenyl)methoxy]-3,5-dimethylphenyl]-3,5-dioxo-1,2,4-triazine-6-carboxylic acid Chemical compound CC1=CC(=CC(C)=C1OCC1=CC=C(Br)C=C1)N1N=C(C(O)=O)C(=O)NC1=O ATOQKNUSBPHNFP-UHFFFAOYSA-N 0.000 abstract 1
- XOTLSEJRAUKAPO-UHFFFAOYSA-N 2-chloro-1,3-dimethyl-5-nitrobenzene Chemical compound CC1=CC([N+]([O-])=O)=CC(C)=C1Cl XOTLSEJRAUKAPO-UHFFFAOYSA-N 0.000 abstract 1
- MMLPWOHLKRXZJA-UHFFFAOYSA-N 3,5-dimethyl-4-nitrophenol Chemical compound CC1=CC(O)=CC(C)=C1[N+]([O-])=O MMLPWOHLKRXZJA-UHFFFAOYSA-N 0.000 abstract 1
- YUXBNNVWBUTOQZ-UHFFFAOYSA-N 4-phenyltriazine Chemical group C1=CC=CC=C1C1=CC=NN=N1 YUXBNNVWBUTOQZ-UHFFFAOYSA-N 0.000 abstract 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 abstract 1
- BYSSEFYXCRGRDR-UHFFFAOYSA-N [acetyl(cyano)carbamoyl] N-[4-[(4-bromophenyl)methoxy]-3,5-dimethylphenyl]ethanehydrazonate Chemical compound CC=1C=C(C=C(C1OCC1=CC=C(C=C1)Br)C)NN=C(OC(N(C(C)=O)C#N)=O)C BYSSEFYXCRGRDR-UHFFFAOYSA-N 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000005012 alkyl thioether group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 abstract 1
- 238000006114 decarboxylation reaction Methods 0.000 abstract 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 abstract 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 abstract 1
- 125000000565 sulfonamide group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Feed For Specific Animals (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US364672A US3905971A (en) | 1971-03-29 | 1973-05-29 | 2-Phenyl-as-triazine-3,5(2H,4H)diones |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE39574L IE39574L (en) | 1974-11-29 |
| IE39574B1 true IE39574B1 (en) | 1978-11-08 |
Family
ID=23435557
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE946/74A IE39574B1 (en) | 1973-05-29 | 1974-05-03 | 2-phenyl-as-triazine-3,5(2h,4h)diones |
Country Status (24)
| Country | Link |
|---|---|
| JP (1) | JPS5019763A (enExample) |
| AR (2) | AR206797A1 (enExample) |
| AU (1) | AU6892674A (enExample) |
| BE (1) | BE815246A (enExample) |
| CA (1) | CA1013352A (enExample) |
| DD (1) | DD112128A5 (enExample) |
| DE (1) | DE2423972A1 (enExample) |
| DK (1) | DK274074A (enExample) |
| ES (1) | ES426484A1 (enExample) |
| FI (1) | FI154174A7 (enExample) |
| FR (1) | FR2231378B1 (enExample) |
| GB (1) | GB1448696A (enExample) |
| IE (1) | IE39574B1 (enExample) |
| IL (1) | IL44771A0 (enExample) |
| IT (1) | IT1049285B (enExample) |
| LU (1) | LU70128A1 (enExample) |
| NL (1) | NL7406647A (enExample) |
| PH (1) | PH11839A (enExample) |
| PL (1) | PL88793B1 (enExample) |
| RO (1) | RO63664A (enExample) |
| SE (1) | SE7405828L (enExample) |
| YU (1) | YU130574A (enExample) |
| ZA (1) | ZA742957B (enExample) |
| ZM (1) | ZM7774A1 (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2722537A1 (de) * | 1977-05-18 | 1978-11-23 | Hoechst Ag | Substituierte 2-phenyl-1,2,4-triazin-3,5-(2h,4h)-dione, verfahren zu ihrer herstellung und sie enthaltende coccidiostatische mittel |
| JPS5696179A (en) * | 1979-12-27 | 1981-08-04 | Teijin Seiki Co Ltd | Axial piston oil hydraulic pump motor |
| IL62151A (en) * | 1981-02-18 | 1984-10-31 | Abic B M | Hexahydro-1,2,4-triazine-3,5-dione derivatives,their preparation and feed compositions,drinking water and pharmaceutical compositions containing said derivatives |
| CA1244024A (en) * | 1984-08-01 | 1988-11-01 | Gustaaf M. Boeckx | .alpha.- ARYL-4-(4,5-DIHYDRO-3,5-DIOXO-1,2,4-TRIAZIN- 2(3H)-YL)BENZENEACETONITRILES |
| DE3531919A1 (de) * | 1985-09-07 | 1987-03-19 | Hoechst Ag | Substituierte 2-phenyl-hexahydro-1,2,4-triazin-3,5-dione, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung |
| CA1277548C (en) * | 1985-10-12 | 1990-12-11 | Ojima, Tadasu | Method of and an apparatus for making bread at home |
| GB8602342D0 (en) * | 1986-01-30 | 1986-03-05 | Janssen Pharmaceutica Nv | 5 6-dihydro-2-(substituted phenyl)-1 2 4-triazine-3 5(2h 4h)-diones |
| DE3805660A1 (de) * | 1988-02-24 | 1989-09-07 | Bayer Ag | Substituierte 1,2,4-triazindione, verfahren zu ihrer herstellung und ihre verwendung |
| CN1044905A (zh) * | 1989-02-16 | 1990-08-29 | 赫彻斯特股份公司 | 鱼和昆虫寄生虫对抗剂 |
| DE4120138A1 (de) * | 1991-06-19 | 1992-12-24 | Bayer Ag | Substituierte hexahydro-1,2,4-triazindione, verfahren zu ihrer herstellung, zwischenprodukte dafuer und ihre verwendung |
| EP0476439A1 (de) * | 1990-09-18 | 1992-03-25 | Bayer Ag | Substituierte 1,2,4-Triazindione, Verfahren zu ihrer Herstellung, Zwischenprodukte dafür und ihre Verwendung |
| JP3288132B2 (ja) * | 1992-06-25 | 2002-06-04 | サントリー株式会社 | 置換１，２，４−トリアジン−３，５−ジオンおよびそれを有効成分とする抗コクシジウム組成物 |
| DE4427529A1 (de) | 1994-08-04 | 1996-02-08 | Bayer Ag | Verfahren zur Herstellung von 1,2,4-Triazin-3,5-dionen |
| ES2823477T3 (es) | 2013-09-09 | 2021-05-07 | Peloton Therapeutics Inc | Aril éteres y usos de los mismos |
| WO2016145045A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Compositions for use in treating glioblastoma |
| WO2016145032A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Compositions for use in treating pulmonary arterial hypertension |
| WO2016144826A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Substituted pyridines and uses thereof |
| US10807948B2 (en) | 2015-03-11 | 2020-10-20 | Peloton Therapeutics, Inc. | Aromatic compounds and uses thereof |
| US10335388B2 (en) | 2015-04-17 | 2019-07-02 | Peloton Therapeutics, Inc. | Combination therapy of a HIF-2-alpha inhibitor and an immunotherapeutic agent and uses thereof |
-
1973
- 1973-09-21 GB GB4450973A patent/GB1448696A/en not_active Expired
-
1974
- 1974-01-01 AR AR256706A patent/AR206797A1/es active
- 1974-04-30 SE SE7405828A patent/SE7405828L/xx unknown
- 1974-05-03 IE IE946/74A patent/IE39574B1/xx unknown
- 1974-05-06 IL IL44771A patent/IL44771A0/xx unknown
- 1974-05-08 CA CA199,309A patent/CA1013352A/en not_active Expired
- 1974-05-09 PH PH15817A patent/PH11839A/en unknown
- 1974-05-09 ZA ZA00742957A patent/ZA742957B/xx unknown
- 1974-05-10 ZM ZM77/74A patent/ZM7774A1/xx unknown
- 1974-05-13 YU YU01305/74A patent/YU130574A/xx unknown
- 1974-05-14 AU AU68926/74A patent/AU6892674A/en not_active Expired
- 1974-05-17 FR FR7417284A patent/FR2231378B1/fr not_active Expired
- 1974-05-17 IT IT51059/74A patent/IT1049285B/it active
- 1974-05-17 NL NL7406647A patent/NL7406647A/xx unknown
- 1974-05-17 DE DE2423972A patent/DE2423972A1/de not_active Withdrawn
- 1974-05-20 RO RO7400078849A patent/RO63664A/ro unknown
- 1974-05-20 FI FI1541/74A patent/FI154174A7/fi unknown
- 1974-05-20 DK DK274074A patent/DK274074A/da unknown
- 1974-05-20 BE BE1005969A patent/BE815246A/xx unknown
- 1974-05-20 ES ES426484A patent/ES426484A1/es not_active Expired
- 1974-05-21 LU LU70128A patent/LU70128A1/xx unknown
- 1974-05-21 JP JP49056186A patent/JPS5019763A/ja active Pending
- 1974-05-21 PL PL1974171296A patent/PL88793B1/pl unknown
- 1974-05-21 DD DD178656A patent/DD112128A5/xx unknown
-
1976
- 1976-05-21 AR AR253850A patent/AR211841A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| NL7406647A (enExample) | 1974-12-03 |
| PL88793B1 (en) | 1976-09-30 |
| AR206797A1 (es) | 1976-08-23 |
| JPS5019763A (enExample) | 1975-03-01 |
| YU130574A (en) | 1982-06-30 |
| ZA742957B (en) | 1975-05-28 |
| FI154174A7 (enExample) | 1974-11-30 |
| FR2231378B1 (enExample) | 1977-10-28 |
| DD112128A5 (enExample) | 1975-03-20 |
| IT1049285B (it) | 1981-01-20 |
| DK274074A (enExample) | 1975-02-03 |
| ES426484A1 (es) | 1976-07-01 |
| FR2231378A1 (enExample) | 1974-12-27 |
| AR211841A1 (es) | 1978-03-31 |
| RO63664A (fr) | 1978-12-15 |
| IE39574L (en) | 1974-11-29 |
| AU6892674A (en) | 1975-11-20 |
| DE2423972A1 (de) | 1975-01-02 |
| LU70128A1 (enExample) | 1975-02-24 |
| CA1013352A (en) | 1977-07-05 |
| PH11839A (en) | 1978-07-21 |
| ZM7774A1 (en) | 1974-12-20 |
| GB1448696A (en) | 1976-09-08 |
| BE815246A (fr) | 1974-11-20 |
| SE7405828L (enExample) | 1974-12-02 |
| IL44771A0 (en) | 1974-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE39574B1 (en) | 2-phenyl-as-triazine-3,5(2h,4h)diones | |
| DK0562439T3 (da) | Triazolopyridazinforbindelser, deres fremstilling og anvendelse | |
| IE820421L (en) | Imidazodiazepines | |
| ES8203364A1 (es) | Un procedimiento para la preparacion de un derivado de ani- lina. | |
| IE45574L (en) | Piperidyl-indole derivatives | |
| GB1414932A (en) | 6-styrylpyrazole 3,4-d pyrimidinones and pyrimidines | |
| PH18858A (en) | Herbicidally active novel substituted phenyl-sulfonylurea derivatives and intermediates therefor | |
| SE8601646D0 (sv) | Intermediates for the production of epipodophyllotoxin and related compounds and processes for the preparation and use thereof | |
| GB1506070A (en) | Method of producing sulphur-containing l-amino acid | |
| ES8304958A1 (es) | Un procedimiento para la preparacion de arilaminas. | |
| GR3022492T3 (en) | Sulphonyl urea compounds with a herbicidal action, method of preparing them and their use. | |
| GB1476684A (en) | Fused-ring benzothiadiazepine and benzo-thiadiazocine deri vatives | |
| GB1467222A (en) | Triazoloquinazoline derivatives processes for producing them and compositions containing them | |
| ES517995A0 (es) | Un procedimiento para la preparacion de un compuesto de hidroxibencilaminobenceno, dotado de propiedades antiinflamatorias. | |
| IE43222L (en) | Piperazine derivatives | |
| GB1513257A (en) | Bis-substituted succinamides and the use thereof as herbicides | |
| Yamato et al. | A New Method for the Preparation of 2-(Alkylamino) benzoxazoles and 2-(Alkylimino) benzoxazolines | |
| IE810822L (en) | Phenyl-quinolizidines | |
| IE42758L (en) | Fungicidal agents | |
| JP4021760B2 (ja) | チオフェノールの製造方法 | |
| IE42386L (en) | 3-benzyl-pyridazine derivatives. | |
| GB1371907A (en) | 2-phenyl-as-triazine-3,5-2h,4h-diones | |
| IE781682L (en) | N-(4-pyrazolidinyl) benzamides. | |
| GB1510776A (en) | Herbicidal pyrazoles | |
| JPS57170588A (en) | Colorant laser |