ZM7774A1 - 2-phenyl-as-triazine-3,5(2h,4h) diones and their preparation - Google Patents
2-phenyl-as-triazine-3,5(2h,4h) diones and their preparationInfo
- Publication number
- ZM7774A1 ZM7774A1 ZM77/74A ZM7774A ZM7774A1 ZM 7774 A1 ZM7774 A1 ZM 7774A1 ZM 77/74 A ZM77/74 A ZM 77/74A ZM 7774 A ZM7774 A ZM 7774A ZM 7774 A1 ZM7774 A1 ZM 7774A1
- Authority
- ZM
- Zambia
- Prior art keywords
- diones
- triazine
- phenyl
- preparation
- Prior art date
Links
- XGPCOQNUQVZURR-UHFFFAOYSA-N 2-phenyl-1,2,4-triazine-3,5-dione Chemical class O=C1NC(=O)C=NN1C1=CC=CC=C1 XGPCOQNUQVZURR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Feed For Specific Animals (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US364672A US3905971A (en) | 1971-03-29 | 1973-05-29 | 2-Phenyl-as-triazine-3,5(2H,4H)diones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZM7774A1 true ZM7774A1 (en) | 1974-12-20 |
Family
ID=23435557
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZM77/74A ZM7774A1 (en) | 1973-05-29 | 1974-05-10 | 2-phenyl-as-triazine-3,5(2h,4h) diones and their preparation |
Country Status (24)
| Country | Link |
|---|---|
| JP (1) | JPS5019763A (enExample) |
| AR (2) | AR206797A1 (enExample) |
| AU (1) | AU6892674A (enExample) |
| BE (1) | BE815246A (enExample) |
| CA (1) | CA1013352A (enExample) |
| DD (1) | DD112128A5 (enExample) |
| DE (1) | DE2423972A1 (enExample) |
| DK (1) | DK274074A (enExample) |
| ES (1) | ES426484A1 (enExample) |
| FI (1) | FI154174A7 (enExample) |
| FR (1) | FR2231378B1 (enExample) |
| GB (1) | GB1448696A (enExample) |
| IE (1) | IE39574B1 (enExample) |
| IL (1) | IL44771A0 (enExample) |
| IT (1) | IT1049285B (enExample) |
| LU (1) | LU70128A1 (enExample) |
| NL (1) | NL7406647A (enExample) |
| PH (1) | PH11839A (enExample) |
| PL (1) | PL88793B1 (enExample) |
| RO (1) | RO63664A (enExample) |
| SE (1) | SE7405828L (enExample) |
| YU (1) | YU130574A (enExample) |
| ZA (1) | ZA742957B (enExample) |
| ZM (1) | ZM7774A1 (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2722537A1 (de) * | 1977-05-18 | 1978-11-23 | Hoechst Ag | Substituierte 2-phenyl-1,2,4-triazin-3,5-(2h,4h)-dione, verfahren zu ihrer herstellung und sie enthaltende coccidiostatische mittel |
| JPS5696179A (en) * | 1979-12-27 | 1981-08-04 | Teijin Seiki Co Ltd | Axial piston oil hydraulic pump motor |
| IL62151A (en) * | 1981-02-18 | 1984-10-31 | Abic B M | Hexahydro-1,2,4-triazine-3,5-dione derivatives,their preparation and feed compositions,drinking water and pharmaceutical compositions containing said derivatives |
| CA1244024A (en) * | 1984-08-01 | 1988-11-01 | Gustaaf M. Boeckx | .alpha.- ARYL-4-(4,5-DIHYDRO-3,5-DIOXO-1,2,4-TRIAZIN- 2(3H)-YL)BENZENEACETONITRILES |
| DE3531919A1 (de) * | 1985-09-07 | 1987-03-19 | Hoechst Ag | Substituierte 2-phenyl-hexahydro-1,2,4-triazin-3,5-dione, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung |
| CA1277548C (en) * | 1985-10-12 | 1990-12-11 | Ojima, Tadasu | Method of and an apparatus for making bread at home |
| GB8602342D0 (en) * | 1986-01-30 | 1986-03-05 | Janssen Pharmaceutica Nv | 5 6-dihydro-2-(substituted phenyl)-1 2 4-triazine-3 5(2h 4h)-diones |
| DE3805660A1 (de) * | 1988-02-24 | 1989-09-07 | Bayer Ag | Substituierte 1,2,4-triazindione, verfahren zu ihrer herstellung und ihre verwendung |
| CN1044905A (zh) * | 1989-02-16 | 1990-08-29 | 赫彻斯特股份公司 | 鱼和昆虫寄生虫对抗剂 |
| EP0476439A1 (de) * | 1990-09-18 | 1992-03-25 | Bayer Ag | Substituierte 1,2,4-Triazindione, Verfahren zu ihrer Herstellung, Zwischenprodukte dafür und ihre Verwendung |
| DE4120138A1 (de) * | 1991-06-19 | 1992-12-24 | Bayer Ag | Substituierte hexahydro-1,2,4-triazindione, verfahren zu ihrer herstellung, zwischenprodukte dafuer und ihre verwendung |
| JP3288132B2 (ja) * | 1992-06-25 | 2002-06-04 | サントリー株式会社 | 置換1,2,4−トリアジン−3,5−ジオンおよびそれを有効成分とする抗コクシジウム組成物 |
| DE4427529A1 (de) | 1994-08-04 | 1996-02-08 | Bayer Ag | Verfahren zur Herstellung von 1,2,4-Triazin-3,5-dionen |
| SI3417851T1 (sl) | 2013-09-09 | 2020-11-30 | Peloton Therapeutics, Inc. | Aril etri in njihova uporaba |
| WO2016144825A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Aromatic compounds and uses thereof |
| EP3268362B1 (en) | 2015-03-11 | 2021-10-20 | Peloton Therapeutics, Inc. | Substituted pyridines and uses thereof |
| WO2016145045A1 (en) | 2015-03-11 | 2016-09-15 | Peloton Therapeutics, Inc. | Compositions for use in treating glioblastoma |
| US10278942B2 (en) | 2015-03-11 | 2019-05-07 | Peloton Therapeutics, Inc. | Compositions for use in treating pulmonary arterial hypertension |
| WO2016168510A1 (en) | 2015-04-17 | 2016-10-20 | Peloton Therapeutics, Inc. | Combination therapy of a hif-2-alpha inhibitor and an immunotherapeutic agent and uses thereof |
-
1973
- 1973-09-21 GB GB4450973A patent/GB1448696A/en not_active Expired
-
1974
- 1974-01-01 AR AR256706A patent/AR206797A1/es active
- 1974-04-30 SE SE7405828A patent/SE7405828L/xx unknown
- 1974-05-03 IE IE946/74A patent/IE39574B1/xx unknown
- 1974-05-06 IL IL44771A patent/IL44771A0/xx unknown
- 1974-05-08 CA CA199,309A patent/CA1013352A/en not_active Expired
- 1974-05-09 ZA ZA00742957A patent/ZA742957B/xx unknown
- 1974-05-09 PH PH15817A patent/PH11839A/en unknown
- 1974-05-10 ZM ZM77/74A patent/ZM7774A1/xx unknown
- 1974-05-13 YU YU01305/74A patent/YU130574A/xx unknown
- 1974-05-14 AU AU68926/74A patent/AU6892674A/en not_active Expired
- 1974-05-17 NL NL7406647A patent/NL7406647A/xx unknown
- 1974-05-17 FR FR7417284A patent/FR2231378B1/fr not_active Expired
- 1974-05-17 IT IT51059/74A patent/IT1049285B/it active
- 1974-05-17 DE DE2423972A patent/DE2423972A1/de not_active Withdrawn
- 1974-05-20 DK DK274074A patent/DK274074A/da unknown
- 1974-05-20 FI FI1541/74A patent/FI154174A7/fi unknown
- 1974-05-20 RO RO7400078849A patent/RO63664A/ro unknown
- 1974-05-20 BE BE1005969A patent/BE815246A/xx unknown
- 1974-05-20 ES ES426484A patent/ES426484A1/es not_active Expired
- 1974-05-21 PL PL1974171296A patent/PL88793B1/pl unknown
- 1974-05-21 DD DD178656A patent/DD112128A5/xx unknown
- 1974-05-21 JP JP49056186A patent/JPS5019763A/ja active Pending
- 1974-05-21 LU LU70128A patent/LU70128A1/xx unknown
-
1976
- 1976-05-21 AR AR253850A patent/AR211841A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| CA1013352A (en) | 1977-07-05 |
| PH11839A (en) | 1978-07-21 |
| PL88793B1 (en) | 1976-09-30 |
| FR2231378A1 (enExample) | 1974-12-27 |
| BE815246A (fr) | 1974-11-20 |
| AR211841A1 (es) | 1978-03-31 |
| IE39574B1 (en) | 1978-11-08 |
| IL44771A0 (en) | 1974-07-31 |
| SE7405828L (enExample) | 1974-12-02 |
| AU6892674A (en) | 1975-11-20 |
| LU70128A1 (enExample) | 1975-02-24 |
| YU130574A (en) | 1982-06-30 |
| FI154174A7 (enExample) | 1974-11-30 |
| IT1049285B (it) | 1981-01-20 |
| AR206797A1 (es) | 1976-08-23 |
| ZA742957B (en) | 1975-05-28 |
| GB1448696A (en) | 1976-09-08 |
| RO63664A (fr) | 1978-12-15 |
| DE2423972A1 (de) | 1975-01-02 |
| DD112128A5 (enExample) | 1975-03-20 |
| JPS5019763A (enExample) | 1975-03-01 |
| DK274074A (enExample) | 1975-02-03 |
| ES426484A1 (es) | 1976-07-01 |
| NL7406647A (enExample) | 1974-12-03 |
| FR2231378B1 (enExample) | 1977-10-28 |
| IE39574L (en) | 1974-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL46202A0 (en) | 1,3-dihydrospiro-(isobenzofuran)and derivatives thereof | |
| ZM7774A1 (en) | 2-phenyl-as-triazine-3,5(2h,4h) diones and their preparation | |
| ZA755614B (en) | 1,3,4-trisubstituted-4-arylpiperidines and their preparation | |
| IL45096A0 (en) | The preparation of 2,2,6,6-tetramethyl-4-oxopiperidine | |
| IL45095A0 (en) | The preparation of 2,2,6,6-tetramethyl-4-oxopiperidine | |
| PH12918A (en) | 1,3-dioxo-2-aminoalkyl-4,4-dimethyl-isoquinolines and salts thereof | |
| IL45092A0 (en) | The preparation of 2,2,6,6-tetramethyl-4-oxopiperidine | |
| IL45566A0 (en) | Novel 2,3-dihydrobenzofuranyl-7-n-methylcarbamates,their preparation and their use as insecticides | |
| CA1028705A (en) | Preparation of 2-aryl-as-triazine-3,5(2h,4h)-diones | |
| ZA745608B (en) | 3,3-methylene-bis-(4-hydroxy-5-azacoumarin) its preparation and use | |
| ZA741232B (en) | New derivatives of 2-aminoindane, the preparation and use thereof | |
| ZA763622B (en) | 1-acyl-1,2,3,4-tetrahydro-6-quinolinols and their preparation | |
| IE40060L (en) | 1,5- and 1,8-dinitroanthraquinones | |
| ZA747672B (en) | New derivatives of 1,3-benzodioxole and the preparation thereof | |
| IL48140A0 (en) | Novel 2,6-methano-3-benzazocines and their preparation | |
| IL43619A0 (en) | The preparation of 2,2'-anhydro-1beta-d-arabinofuranosyl-5-fluorocytosine | |
| PH10149A (en) | Preparation of 2(aryl)-as-triazine-3,5(2h,4h)diones | |
| AU6593074A (en) | 1, 4-dihydro-2-h-isoquinoline | |
| IL46220A0 (en) | 4-organosulfinyl-and 4-organosulfonyl-2,3,5,6-tetrachlorobenzonitriles and their preparation | |
| ZA744640B (en) | 1,2,3,4-tetrahydroisoquinoline derivatives and the preparation thereof | |
| ZA741341B (en) | 1,2-dihydro-3-phenoxymethylpyrido <3,4-e>-as-triazine hydrochoride and 3-phenoxymethylpyrido<3,4-e>-as-triazine | |
| ZA745692B (en) | New 1,2-oxaphospholanes | |
| EG11323A (en) | Thiazolatriazolylphosphonothioates,preparation and uses thereof | |
| IL45527A (en) | 4,5,6,7-tetrachloro-2-thiophthalide,its preparation and its use as fungicide | |
| ZA744477B (en) | 1,3-oxygenated 8alpha-oestratrienes |