IE35727B1 - Novel benzodiazepines the preparation thereof and compositions containing the same - Google Patents
Novel benzodiazepines the preparation thereof and compositions containing the sameInfo
- Publication number
- IE35727B1 IE35727B1 IE753/70A IE75370A IE35727B1 IE 35727 B1 IE35727 B1 IE 35727B1 IE 753/70 A IE753/70 A IE 753/70A IE 75370 A IE75370 A IE 75370A IE 35727 B1 IE35727 B1 IE 35727B1
- Authority
- IE
- Ireland
- Prior art keywords
- group
- general formula
- benzodiazepin
- tetrahydro
- reaction
- Prior art date
Links
- 229940049706 benzodiazepine Drugs 0.000 title 1
- 150000001557 benzodiazepines Chemical class 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 abstract 7
- 238000006243 chemical reaction Methods 0.000 abstract 4
- 125000005843 halogen group Chemical group 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- 239000002253 acid Substances 0.000 abstract 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 abstract 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 2
- 238000007363 ring formation reaction Methods 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 abstract 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 abstract 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 150000001450 anions Chemical class 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000004429 atom Chemical group 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 125000004981 cycloalkylmethyl group Chemical group 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 235000019253 formic acid Nutrition 0.000 abstract 1
- -1 heteroaryl halide Chemical class 0.000 abstract 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 239000000546 pharmaceutical excipient Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 230000002936 tranquilizing effect Effects 0.000 abstract 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract 1
- 229920002554 vinyl polymer Polymers 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/12—1,5-Benzodiazepines; Hydrogenated 1,5-benzodiazepines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691929656 DE1929656A1 (de) | 1969-06-11 | 1969-06-11 | Neue Tetrahydro-benzodiazepinone |
| DE19702006600 DE2006600A1 (en) | 1970-02-13 | 1970-02-13 | Tetrahydro-1,5-benzodiazepine-4-ones |
| DE19702019627 DE2019627A1 (de) | 1969-06-11 | 1970-04-23 | Neue Tetrahydrobenzodiazepinone |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE35727L IE35727L (en) | 1970-12-11 |
| IE35727B1 true IE35727B1 (en) | 1976-05-12 |
Family
ID=27181978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE753/70A IE35727B1 (en) | 1969-06-11 | 1970-06-10 | Novel benzodiazepines the preparation thereof and compositions containing the same |
Country Status (16)
| Country | Link |
|---|---|
| JP (3) | JPS49192B1 (show.php) |
| AT (2) | AT303746B (show.php) |
| BE (1) | BE751834A (show.php) |
| BG (4) | BG17602A3 (show.php) |
| CA (1) | CA967154A (show.php) |
| CH (1) | CH549582A (show.php) |
| ES (4) | ES380557A1 (show.php) |
| FR (1) | FR2052950B1 (show.php) |
| GB (1) | GB1317475A (show.php) |
| IE (1) | IE35727B1 (show.php) |
| IL (1) | IL34689A (show.php) |
| NL (1) | NL7008404A (show.php) |
| NO (1) | NO129524B (show.php) |
| RO (4) | RO58405A (show.php) |
| SE (1) | SE381873B (show.php) |
| SU (1) | SU423299A3 (show.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN110256365B (zh) * | 2019-06-24 | 2022-06-07 | 陕西师范大学 | 二氯二茂钛催化制备苯二氮卓衍生物的方法 |
| CN110183397B (zh) * | 2019-06-24 | 2022-08-23 | 陕西师范大学 | 二氯二茂锆催化制备1,5-苯并噻嗪类化合物的方法 |
-
1970
- 1970-04-10 BG BG014913A patent/BG17602A3/xx unknown
- 1970-06-05 RO RO63562A patent/RO58405A/ro unknown
- 1970-06-05 RO RO69783A patent/RO58640A/ro unknown
- 1970-06-05 SU SU701666624A patent/SU423299A3/ru active
- 1970-06-05 CA CA084,760A patent/CA967154A/en not_active Expired
- 1970-06-05 RO RO69784A patent/RO58641A/ro unknown
- 1970-06-05 RO RO69785A patent/RO58887A/ro unknown
- 1970-06-09 CH CH863170A patent/CH549582A/xx not_active IP Right Cessation
- 1970-06-09 ES ES380557A patent/ES380557A1/es not_active Expired
- 1970-06-09 IL IL34689A patent/IL34689A/en unknown
- 1970-06-10 BG BG017287A patent/BG17973A3/xx unknown
- 1970-06-10 NL NL7008404A patent/NL7008404A/xx unknown
- 1970-06-10 GB GB2819770A patent/GB1317475A/en not_active Expired
- 1970-06-10 IE IE753/70A patent/IE35727B1/xx unknown
- 1970-06-10 AT AT00409/72A patent/AT303746B/de not_active IP Right Cessation
- 1970-06-10 AT AT522570A patent/AT303737B/de not_active IP Right Cessation
- 1970-06-10 BG BG017289A patent/BG17974A3/xx unknown
- 1970-06-10 NO NO02256/70A patent/NO129524B/no unknown
- 1970-06-11 SE SE7008152A patent/SE381873B/xx unknown
- 1970-06-11 FR FR7021448A patent/FR2052950B1/fr not_active Expired
- 1970-06-11 BE BE751834D patent/BE751834A/xx unknown
-
1971
- 1971-01-11 ES ES387136A patent/ES387136A1/es not_active Expired
- 1971-01-11 ES ES387138A patent/ES387138A1/es not_active Expired
- 1971-01-11 ES ES71387137A patent/ES387137A1/es not_active Expired
- 1971-04-07 BG BG017288A patent/BG17603A3/xx unknown
- 1971-10-01 JP JP46077046A patent/JPS49192B1/ja active Pending
- 1971-10-01 JP JP46077048A patent/JPS5031158B1/ja active Pending
- 1971-10-01 JP JP46077047A patent/JPS5013273B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL7008404A (show.php) | 1970-12-15 |
| RO58405A (show.php) | 1975-11-15 |
| BG17974A3 (bg) | 1974-03-05 |
| RO58640A (show.php) | 1975-10-15 |
| BG17973A3 (bg) | 1974-03-05 |
| IE35727L (en) | 1970-12-11 |
| JPS5013273B1 (show.php) | 1975-05-19 |
| RO58641A (show.php) | 1975-09-15 |
| CA967154A (en) | 1975-05-06 |
| AT303746B (de) | 1972-11-15 |
| AT303737B (de) | 1972-12-11 |
| ES380557A1 (es) | 1973-04-01 |
| RO58887A (show.php) | 1975-10-15 |
| IL34689A (en) | 1973-03-30 |
| CH549582A (de) | 1974-05-31 |
| IL34689A0 (en) | 1970-08-19 |
| NO129524B (show.php) | 1974-04-22 |
| ES387136A1 (es) | 1974-01-01 |
| SU423299A3 (ru) | 1974-04-05 |
| JPS49192B1 (show.php) | 1974-01-05 |
| JPS5031158B1 (show.php) | 1975-10-07 |
| BG17602A3 (bg) | 1973-11-10 |
| ES387137A1 (es) | 1974-01-01 |
| SE381873B (sv) | 1975-12-22 |
| ES387138A1 (es) | 1973-05-01 |
| BG17603A3 (bg) | 1973-11-10 |
| BE751834A (fr) | 1970-12-11 |
| GB1317475A (en) | 1973-05-16 |
| FR2052950A1 (show.php) | 1971-04-16 |
| FR2052950B1 (show.php) | 1974-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1222708A (en) | Novel 5-(n-substituted aminomethyl)-2-oxazolidinones and their process of preparation | |
| GB1205957A (en) | Pharmaceutical compositions comprising 1-pnenoxy-2-aminopropanes | |
| IE780515L (en) | Morphine derivatives | |
| GB1294763A (en) | 3-oxo-2,3-dihydro-1,4-benzoxazine derivatives | |
| GB1301431A (show.php) | ||
| GB1456627A (en) | Pyridobenzodiazepinones | |
| GB1513320A (en) | N-propargyl-2-phenylamino-2-imidazolines | |
| IE35727B1 (en) | Novel benzodiazepines the preparation thereof and compositions containing the same | |
| GB1409648A (en) | Substituted pyrrolidinemethanol compounds and pharmaceutical compositions thereof | |
| GB1337371A (en) | 3-amino-imidazo-1,5-a- pyridines processes for their preparation and pharmaceutical compositions incorporating them | |
| IE39481L (en) | Imidazoline derivatives. | |
| GB1394504A (en) | 1,2-bis-4-phenyl-1-piperazinyl-ethane derivatives | |
| GB1353508A (en) | Aminoisoquinolines | |
| GB1254270A (en) | Benzoxazepine derivatives | |
| GB1305725A (show.php) | ||
| GB1321390A (en) | Basic quinobenzazepines | |
| GB1229996A (show.php) | ||
| GB1276719A (en) | Benzomorphan derivatives and their salts | |
| GB1245155A (en) | NOVEL 5-SUBSTITUTED-gamma-CARBOLINE DERIVATIVES AND THE SALTS THEREOF | |
| GB1384523A (en) | Oxime derivatives and their preparation | |
| GB1377610A (en) | 5-piperidine-4-spiro- oxazolidinones method for their preparation and applications thereof | |
| GB1453910A (en) | Benzazepine derivatives | |
| GB1468079A (en) | Ethanolamine derivatives | |
| GB1186062A (en) | Benzonaphthyridine Derivatives | |
| GB1390091A (en) | 4-4-biphenylyl-butyric acid derivatives |