HU196381B - Process for preparing 8-halogen-5,6-dialkoxy-quinazolin-2,4-dione derivatives - Google Patents
Process for preparing 8-halogen-5,6-dialkoxy-quinazolin-2,4-dione derivatives Download PDFInfo
- Publication number
- HU196381B HU196381B HU853595A HU359585A HU196381B HU 196381 B HU196381 B HU 196381B HU 853595 A HU853595 A HU 853595A HU 359585 A HU359585 A HU 359585A HU 196381 B HU196381 B HU 196381B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- preparation
- compound
- alkyl
- resulting
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000002360 preparation method Methods 0.000 claims abstract description 16
- 238000000034 method Methods 0.000 claims abstract description 11
- 150000003839 salts Chemical class 0.000 claims abstract description 5
- 229910052751 metal Inorganic materials 0.000 claims abstract description 4
- 239000002184 metal Substances 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 16
- -1 nitro ester Chemical class 0.000 claims description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 11
- 239000005695 Ammonium acetate Substances 0.000 claims description 4
- 229940043376 ammonium acetate Drugs 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical group ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical group CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 230000002140 halogenating effect Effects 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 125000005210 alkyl ammonium group Chemical group 0.000 claims 1
- QHIBGMPAPSVCSX-UHFFFAOYSA-N benzene;carbamic acid Chemical class NC(O)=O.C1=CC=CC=C1 QHIBGMPAPSVCSX-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 159000000001 potassium salts Chemical class 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 241000551547 Dione <red algae> Species 0.000 abstract 1
- 239000000496 cardiotonic agent Substances 0.000 abstract 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 230000000747 cardiac effect Effects 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- MSEFOJHLQKTCGQ-UHFFFAOYSA-N 2,3-dimethoxy-6-nitrobenzoic acid Chemical compound COC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1OC MSEFOJHLQKTCGQ-UHFFFAOYSA-N 0.000 description 3
- DOLGCKRBFFGXLJ-UHFFFAOYSA-N 8-chloro-5,6-dimethoxy-1h-quinazoline-2,4-dione Chemical compound N1=C(O)N=C(O)C2=C(OC)C(OC)=CC(Cl)=C21 DOLGCKRBFFGXLJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 150000008515 quinazolinediones Chemical class 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- KWXFQMHMUVDCGC-UHFFFAOYSA-N 2,3-dimethoxy-6-nitrobenzaldehyde Chemical compound COC1=CC=C([N+]([O-])=O)C(C=O)=C1OC KWXFQMHMUVDCGC-UHFFFAOYSA-N 0.000 description 2
- LPUYRRFGCOZEEK-UHFFFAOYSA-N 2-hydroxy-3-methoxy-6-nitrobenzaldehyde Chemical compound COC1=CC=C([N+]([O-])=O)C(C=O)=C1O LPUYRRFGCOZEEK-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- OKKJXQCMGYOARE-UHFFFAOYSA-N benzenesulfonic acid;2-hydroxy-3-methoxy-6-nitrobenzaldehyde Chemical compound OS(=O)(=O)C1=CC=CC=C1.COC1=CC=C([N+]([O-])=O)C(C=O)=C1O OKKJXQCMGYOARE-UHFFFAOYSA-N 0.000 description 2
- CACNQBCAROJFBX-UHFFFAOYSA-N benzenesulfonic acid;2-hydroxy-3-methoxybenzaldehyde Chemical compound OS(=O)(=O)C1=CC=CC=C1.COC1=CC=CC(C=O)=C1O CACNQBCAROJFBX-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- FXHZMWOXUYSDQS-UHFFFAOYSA-N ethyl 6-amino-2,3-dimethoxybenzoate Chemical compound CCOC(=O)C1=C(N)C=CC(OC)=C1OC FXHZMWOXUYSDQS-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 230000002107 myocardial effect Effects 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical class C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- AKZWRTCWNXHHFR-PDIZUQLASA-N [(3S)-oxolan-3-yl] N-[(2S,3S)-4-[(5S)-5-benzyl-3-[(2R)-2-carbamoyloxy-2,3-dihydro-1H-inden-1-yl]-4-oxo-3H-pyrrol-5-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate Chemical compound NC(=O)O[C@@H]1Cc2ccccc2C1C1C=N[C@](C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOC2)(Cc2ccccc2)C1=O AKZWRTCWNXHHFR-PDIZUQLASA-N 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- SXAWVGMHRUWXGG-UHFFFAOYSA-N ethyl 2,3-dimethoxy-6-nitrobenzoate Chemical compound CCOC(=O)C1=C(OC)C(OC)=CC=C1[N+]([O-])=O SXAWVGMHRUWXGG-UHFFFAOYSA-N 0.000 description 1
- UUFOVOYAAYMTHE-UHFFFAOYSA-N ethyl 3-chloro-2-(ethoxycarbonylamino)-5,6-dimethoxybenzoate Chemical compound CCOC(=O)NC1=C(Cl)C=C(OC)C(OC)=C1C(=O)OCC UUFOVOYAAYMTHE-UHFFFAOYSA-N 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000005440 nitrobenzoic acid derivatives Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- QQKDTTWZXHEGAQ-UHFFFAOYSA-N propyl carbonochloridate Chemical compound CCCOC(Cl)=O QQKDTTWZXHEGAQ-UHFFFAOYSA-N 0.000 description 1
- 230000035485 pulse pressure Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- XELRMPRLCPFTBH-UHFFFAOYSA-N quinazoline-2,4-diamine Chemical class C1=CC=CC2=NC(N)=NC(N)=C21 XELRMPRLCPFTBH-UHFFFAOYSA-N 0.000 description 1
- 210000005241 right ventricle Anatomy 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
- C07D239/96—Two oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/654,350 US4634769A (en) | 1984-09-25 | 1984-09-25 | Process for the preparation of 8-halo-5,6-dialkoxyquinazoline-2,4-diones and their salts |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT40088A HUT40088A (en) | 1986-11-28 |
| HU196381B true HU196381B (en) | 1988-11-28 |
Family
ID=24624507
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU853595A HU196381B (en) | 1984-09-25 | 1985-09-24 | Process for preparing 8-halogen-5,6-dialkoxy-quinazolin-2,4-dione derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4634769A (en:Method) |
| EP (1) | EP0183348A1 (en:Method) |
| KR (1) | KR890003840B1 (en:Method) |
| AU (1) | AU575998B2 (en:Method) |
| DK (1) | DK433585A (en:Method) |
| ES (1) | ES8703145A1 (en:Method) |
| FI (1) | FI853663L (en:Method) |
| GR (1) | GR852322B (en:Method) |
| HU (1) | HU196381B (en:Method) |
| IL (1) | IL76468A0 (en:Method) |
| IN (1) | IN162709B (en:Method) |
| NO (1) | NO853751L (en:Method) |
| NZ (1) | NZ213473A (en:Method) |
| PL (1) | PL255515A1 (en:Method) |
| PT (1) | PT81187B (en:Method) |
| RO (1) | RO92377B (en:Method) |
| ZA (1) | ZA857357B (en:Method) |
| ZW (1) | ZW17085A1 (en:Method) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4639518A (en) * | 1984-09-24 | 1987-01-27 | Ortho Pharmaceutical Corporation | Substituted quinazolinediones |
| US4668787A (en) * | 1985-12-20 | 1987-05-26 | Ortho Pharmaceutical Corporation | 5,6-dialkoxy-4-imino-2(1H)quinazolinone derivatives |
| US4672116A (en) * | 1985-12-20 | 1987-06-09 | Ortho Pharmaceutical Corporation | Substituted 5,6-dialkoxyquinazoline derivatives |
| IL79249A (en) * | 1986-06-26 | 1992-02-16 | Makhteshim Chem Works Ltd | Herbicidal compositions containing haloalkylthioquinazoline di(thi)ones and some new such compounds |
| EP0742213A1 (de) * | 1995-05-10 | 1996-11-13 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von substituierten 3-Arylchinazolin-2,4-dionen |
| CN103848835B (zh) * | 2012-12-07 | 2018-07-06 | 上海阳帆医药科技有限公司 | 二肽基肽酶-iv抑制剂、其用途及其中间体和中间体的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4202895A (en) * | 1971-06-04 | 1980-05-13 | Sumitomo Chemical Company, Limited | 1-Polyhaloalkyl-2(1H)-quinazolinone derivatives |
| US4146717A (en) * | 1972-04-07 | 1979-03-27 | Sumitomo Chemical Company, Limited | Nitroquinazolinone compounds having antiviral properties |
| US3983120A (en) * | 1974-11-06 | 1976-09-28 | Bristol-Myers Company | Process for the preparation of optionally substituted 1,2,3,5-tetrahydroimidazo[2,1-b]quinazolin-2-ones |
| US3988340A (en) * | 1975-01-23 | 1976-10-26 | Bristol-Myers Company | 6-Alkoxymethyl-1,2,3,5-tetrahydroimidazo[2,1-b]quinazolin-2-ones and 7-alkoxymethyl-6-[H]-1,2,3,4-tetrahydropyrimido[2,1-b]quinazolin-2-ones |
| US4335127A (en) * | 1979-01-08 | 1982-06-15 | Janssen Pharmaceutica, N.V. | Piperidinylalkyl quinazoline compounds, composition and method of use |
| US4287341A (en) * | 1979-11-01 | 1981-09-01 | Pfizer Inc. | Alkoxy-substituted-6-chloro-quinazoline-2,4-diones |
-
1984
- 1984-09-25 US US06/654,350 patent/US4634769A/en not_active Expired - Lifetime
-
1985
- 1985-09-13 NZ NZ213473A patent/NZ213473A/en unknown
- 1985-09-20 IN IN663/CAL/85A patent/IN162709B/en unknown
- 1985-09-23 RO RO120181A patent/RO92377B/ro unknown
- 1985-09-23 GR GR852322A patent/GR852322B/el unknown
- 1985-09-23 IL IL76468A patent/IL76468A0/xx unknown
- 1985-09-24 HU HU853595A patent/HU196381B/hu unknown
- 1985-09-24 ES ES547255A patent/ES8703145A1/es not_active Expired
- 1985-09-24 ZW ZW170/85A patent/ZW17085A1/xx unknown
- 1985-09-24 NO NO853751A patent/NO853751L/no unknown
- 1985-09-24 AU AU47843/85A patent/AU575998B2/en not_active Ceased
- 1985-09-24 EP EP85306772A patent/EP0183348A1/en not_active Withdrawn
- 1985-09-24 KR KR1019850006995A patent/KR890003840B1/ko not_active Expired
- 1985-09-24 ZA ZA857357A patent/ZA857357B/xx unknown
- 1985-09-24 FI FI853663A patent/FI853663L/fi not_active IP Right Cessation
- 1985-09-24 DK DK433585A patent/DK433585A/da not_active Application Discontinuation
- 1985-09-25 PL PL25551585A patent/PL255515A1/xx unknown
- 1985-09-25 PT PT81187A patent/PT81187B/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IN162709B (en:Method) | 1988-07-02 |
| NZ213473A (en) | 1988-03-30 |
| DK433585D0 (da) | 1985-09-24 |
| DK433585A (da) | 1986-03-26 |
| KR860002479A (ko) | 1986-04-26 |
| US4634769A (en) | 1987-01-06 |
| ZW17085A1 (en) | 1987-04-15 |
| IL76468A0 (en) | 1986-01-31 |
| HUT40088A (en) | 1986-11-28 |
| AU575998B2 (en) | 1988-08-11 |
| KR890003840B1 (ko) | 1989-10-05 |
| RO92377A (ro) | 1987-11-30 |
| EP0183348A1 (en) | 1986-06-04 |
| ES547255A0 (es) | 1986-10-16 |
| FI853663A7 (fi) | 1986-03-26 |
| NO853751L (no) | 1986-03-26 |
| ZA857357B (en) | 1987-05-27 |
| FI853663L (fi) | 1986-03-26 |
| AU4784385A (en) | 1986-04-10 |
| PT81187A (en) | 1985-10-01 |
| GR852322B (en:Method) | 1986-01-24 |
| FI853663A0 (fi) | 1985-09-24 |
| PL255515A1 (en) | 1986-12-30 |
| PT81187B (en) | 1987-03-30 |
| RO92377B (ro) | 1987-12-01 |
| ES8703145A1 (es) | 1986-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66372B (fi) | Foerfarande foer framstaellning av farmakologiskt verkande i 5- eller 6-staellning med en pyridazinonring substituerade besimidazoler | |
| EP0248420B1 (en) | Benzopyran derivatives | |
| SU1344246A3 (ru) | Способ получени замещенных хиназолинонов-2 | |
| DE2559509A1 (de) | Benzcyloamidderivate und verfahren zu ihrer herstellung sowie pharmazeutische mittel, worin sie enthalten sind | |
| US4110338A (en) | Product and preparation of 1H-tetrazole-5-thiol derivatives | |
| EP0161632A2 (de) | Neue Pyrrolo-Benzimidazole, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel sowie Zwischenprodukte | |
| JPS62187462A (ja) | 5,6−ジアルコキシキナゾリン誘導体 | |
| EP0023343A2 (de) | Substituierte 3-Amino-sydnonimine, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
| US4028370A (en) | Novel pyrazolo [1,5-a]pyridines | |
| HU196381B (en) | Process for preparing 8-halogen-5,6-dialkoxy-quinazolin-2,4-dione derivatives | |
| US4097483A (en) | Pyrazolo 1,5-a!pyridines | |
| US4639518A (en) | Substituted quinazolinediones | |
| US4390541A (en) | Quinolone derivatives and their use in a method of controlling an immediate hypersensitivity disease | |
| HU186765B (en) | Process for producing acylized 2-formyl-benzimidazol derivatives | |
| EP0138490B1 (en) | 4-alkyl methylenedioxy-2-1[H]-quinazolinones | |
| HU196758B (en) | Process for production of 3-hidroxi-methil-quinolines and medical compositions containing them | |
| SU1124886A3 (ru) | Способ получени хинолонов | |
| US5877318A (en) | Hydroquinone derivative and pharmaceutical use thereof | |
| US4182876A (en) | Substituted-phthalazone 7-carboxylic acid and salts and process for preparing same | |
| KR840001034B1 (ko) | 디하이드로니코틴산 유도체의 제조방법 | |
| US4745118A (en) | Substituted quinazoline-3-oxides providing pharmacological activity | |
| US3336296A (en) | Preparation of 5-substituted-2h-1, 4-benzodiazepin-2-one-4-oxides | |
| US4092311A (en) | Hypotensive alkyl-3-[6-(aryl)-3-pyridazinyl]-carbazates | |
| US4565872A (en) | Process for 8-cyano-6,7-dihydro-5-methyl-1-oxo-1H,5H-benzo[ij]quinolizine-2-carboxylic acids and intermediates thereof | |
| US4302463A (en) | 1-Azaxanthone-3-carboxylic acids and their production |