HU195176B - Process for producing 2,4-difluor-5-halogen- resp. 2,4-difluor-3,5-dihalogen-benzol derivatives - Google Patents
Process for producing 2,4-difluor-5-halogen- resp. 2,4-difluor-3,5-dihalogen-benzol derivatives Download PDFInfo
- Publication number
- HU195176B HU195176B HU852148A HU214885A HU195176B HU 195176 B HU195176 B HU 195176B HU 852148 A HU852148 A HU 852148A HU 214885 A HU214885 A HU 214885A HU 195176 B HU195176 B HU 195176B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- acid
- chloride
- chloro
- fluoride
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 28
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims description 71
- 238000002360 preparation method Methods 0.000 claims description 37
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 claims description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 29
- 239000002253 acid Substances 0.000 claims description 22
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 20
- 229910052731 fluorine Chemical group 0.000 claims description 18
- 239000011698 potassium fluoride Substances 0.000 claims description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 15
- 235000003270 potassium fluoride Nutrition 0.000 claims description 15
- 239000000460 chlorine Chemical group 0.000 claims description 14
- 125000001153 fluoro group Chemical group F* 0.000 claims description 12
- 239000007858 starting material Substances 0.000 claims description 12
- 239000011737 fluorine Chemical group 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 9
- HDPODBQAFOAFJY-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(Cl)=C(F)C(F)=C1F HDPODBQAFOAFJY-UHFFFAOYSA-N 0.000 claims description 8
- 150000002431 hydrogen Chemical group 0.000 claims description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 7
- HPMLGNIUXVXALD-UHFFFAOYSA-N benzoyl fluoride Chemical compound FC(=O)C1=CC=CC=C1 HPMLGNIUXVXALD-UHFFFAOYSA-N 0.000 claims description 6
- IEDMMCZBIKXEJP-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(Cl)=C1F IEDMMCZBIKXEJP-UHFFFAOYSA-N 0.000 claims description 5
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 claims description 5
- 150000001805 chlorine compounds Chemical class 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 235000019445 benzyl alcohol Nutrition 0.000 claims description 4
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 4
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 229910003902 SiCl 4 Inorganic materials 0.000 claims description 3
- 150000003935 benzaldehydes Chemical class 0.000 claims description 3
- 125000001475 halogen functional group Chemical group 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- IDOFZVGHXAVYEZ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzonitrile Chemical compound ClC1=CC(C#N)=C(Cl)C(Cl)=C1Cl IDOFZVGHXAVYEZ-UHFFFAOYSA-N 0.000 claims description 2
- RPZXUSJCSDQNTE-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(Cl)C=C1Cl RPZXUSJCSDQNTE-UHFFFAOYSA-N 0.000 claims description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 claims description 2
- 150000005524 benzylchlorides Chemical class 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 4
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical group [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims 2
- 239000005711 Benzoic acid Substances 0.000 claims 2
- 235000010233 benzoic acid Nutrition 0.000 claims 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 claims 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 claims 1
- 229910021529 ammonia Inorganic materials 0.000 claims 1
- 239000007864 aqueous solution Substances 0.000 claims 1
- 150000001540 azides Chemical class 0.000 claims 1
- 229960000686 benzalkonium chloride Drugs 0.000 claims 1
- 150000001555 benzenes Chemical class 0.000 claims 1
- 150000008359 benzonitriles Chemical class 0.000 claims 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 claims 1
- 229940073608 benzyl chloride Drugs 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 claims 1
- 239000007800 oxidant agent Substances 0.000 claims 1
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 claims 1
- AKAMNXFLKYKFOJ-UHFFFAOYSA-N 2,4,5-trifluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C=C1F AKAMNXFLKYKFOJ-UHFFFAOYSA-N 0.000 abstract description 8
- STBGCAUUOPNJBH-UHFFFAOYSA-N 2,4,5-trifluorobenzoyl chloride Chemical compound FC1=CC(F)=C(C(Cl)=O)C=C1F STBGCAUUOPNJBH-UHFFFAOYSA-N 0.000 abstract 1
- -1 2-amino-4,5-difluorobenzoic acid ester Chemical class 0.000 description 53
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- 238000006243 chemical reaction Methods 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 238000009835 boiling Methods 0.000 description 20
- 239000000047 product Substances 0.000 description 18
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 10
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 10
- 238000004821 distillation Methods 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 7
- 239000011230 binding agent Substances 0.000 description 7
- 239000003085 diluting agent Substances 0.000 description 7
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- IROWIXYGGPOJFJ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl IROWIXYGGPOJFJ-UHFFFAOYSA-N 0.000 description 6
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 238000003682 fluorination reaction Methods 0.000 description 6
- VROGRHFTUYFGFX-UHFFFAOYSA-N 1-chloro-5-(chloromethyl)-2,3,4-trifluorobenzene Chemical compound FC1=C(F)C(Cl)=CC(CCl)=C1F VROGRHFTUYFGFX-UHFFFAOYSA-N 0.000 description 5
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 5
- 238000004508 fractional distillation Methods 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- TXALMWNWYDSWQO-UHFFFAOYSA-N 2,4,5-trifluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(F)C=C1F TXALMWNWYDSWQO-UHFFFAOYSA-N 0.000 description 4
- JOMNTHCQHJPVAZ-UHFFFAOYSA-N 2-methylpiperazine Chemical compound CC1CNCCN1 JOMNTHCQHJPVAZ-UHFFFAOYSA-N 0.000 description 4
- VWNMVYACOKCDLR-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(Cl)=C(F)C(Cl)=C1F VWNMVYACOKCDLR-UHFFFAOYSA-N 0.000 description 4
- 239000007983 Tris buffer Substances 0.000 description 4
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 4
- 238000005660 chlorination reaction Methods 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 238000004334 fluoridation Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 3
- WWYFHDNQGVTJJJ-UHFFFAOYSA-N 2-cyclohexylpiperazine Chemical class C1CCCCC1C1NCCNC1 WWYFHDNQGVTJJJ-UHFFFAOYSA-N 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- KBESHLYCSZINAJ-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(Cl)=C1F KBESHLYCSZINAJ-UHFFFAOYSA-N 0.000 description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- ORWKVZNEPHTCQE-UHFFFAOYSA-N acetic formic anhydride Chemical compound CC(=O)OC=O ORWKVZNEPHTCQE-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- XEMRAKSQROQPBR-UHFFFAOYSA-N (trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=CC=C1 XEMRAKSQROQPBR-UHFFFAOYSA-N 0.000 description 2
- QVCUKHQDEZNNOC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1NC2 QVCUKHQDEZNNOC-UHFFFAOYSA-N 0.000 description 2
- ZFZHCAIFWXGSNS-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzoyl fluoride Chemical compound FC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl ZFZHCAIFWXGSNS-UHFFFAOYSA-N 0.000 description 2
- ZYEWNAMVVRPNJX-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(F)C(F)=C1F ZYEWNAMVVRPNJX-UHFFFAOYSA-N 0.000 description 2
- XOQQVKDBGLYPGH-UHFFFAOYSA-N 2-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=CC=C2NC(=O)C(C(=O)O)=CC2=C1 XOQQVKDBGLYPGH-UHFFFAOYSA-N 0.000 description 2
- MUZBUPSZMGQWMU-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzamide Chemical compound NC(=O)C1=CC(Cl)=C(F)C(Cl)=C1F MUZBUPSZMGQWMU-UHFFFAOYSA-N 0.000 description 2
- DVXDXLUGMVTANY-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(F)C(Cl)=C1F DVXDXLUGMVTANY-UHFFFAOYSA-N 0.000 description 2
- FLFHKEPFQPBDPK-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzaldehyde Chemical compound FC1=C(F)C(Cl)=CC(C=O)=C1F FLFHKEPFQPBDPK-UHFFFAOYSA-N 0.000 description 2
- UMJMPQGMWKLZEC-UHFFFAOYSA-N 6,8-dichloro-1-cyclopropyl-7-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(F)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 UMJMPQGMWKLZEC-UHFFFAOYSA-N 0.000 description 2
- KWJDQEWXENHGMW-UHFFFAOYSA-N 6-chloro-1-cyclopropyl-7,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 KWJDQEWXENHGMW-UHFFFAOYSA-N 0.000 description 2
- RVNRLLPNOCEJKU-UHFFFAOYSA-N 6-chloro-1-cyclopropyl-8-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCNCC3)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 RVNRLLPNOCEJKU-UHFFFAOYSA-N 0.000 description 2
- ZHFGWIOLVRSZNQ-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ZHFGWIOLVRSZNQ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerol Natural products OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001409 amidines Chemical class 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 150000003938 benzyl alcohols Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 239000012973 diazabicyclooctane Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- NSMWYRLQHIXVAP-OLQVQODUSA-N (2r,5s)-2,5-dimethylpiperazine Chemical compound C[C@H]1CN[C@H](C)CN1 NSMWYRLQHIXVAP-OLQVQODUSA-N 0.000 description 1
- IFNWESYYDINUHV-PHDIDXHHSA-N (2r,6r)-2,6-dimethylpiperazine Chemical compound C[C@@H]1CNC[C@@H](C)N1 IFNWESYYDINUHV-PHDIDXHHSA-N 0.000 description 1
- NSMWYRLQHIXVAP-WDSKDSINSA-N (2s,5s)-2,5-dimethylpiperazine Chemical compound C[C@H]1CN[C@@H](C)CN1 NSMWYRLQHIXVAP-WDSKDSINSA-N 0.000 description 1
- IFNWESYYDINUHV-OLQVQODUSA-N (2s,6r)-2,6-dimethylpiperazine Chemical compound C[C@H]1CNC[C@@H](C)N1 IFNWESYYDINUHV-OLQVQODUSA-N 0.000 description 1
- ALJZEMRUAOJSPP-ZDUSSCGKSA-N (4-nitrophenyl) (2s)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound CC(C)(C)OC(=O)N[C@@H](C(C)C)C(=O)OC1=CC=C([N+]([O-])=O)C=C1 ALJZEMRUAOJSPP-ZDUSSCGKSA-N 0.000 description 1
- YQLQFFHXBLDWLW-UHFFFAOYSA-N (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate Chemical compound CC(C)(C)OC(=O)NCC(=O)OC1=CC=C([N+]([O-])=O)C=C1 YQLQFFHXBLDWLW-UHFFFAOYSA-N 0.000 description 1
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- ACVIQVKMDMHZHO-UHFFFAOYSA-N 1,2-diethylpiperazine Chemical compound CCC1CNCCN1CC ACVIQVKMDMHZHO-UHFFFAOYSA-N 0.000 description 1
- KMWKVZQFAZDUFH-UHFFFAOYSA-N 1,3-dichloro-5-(chloromethyl)-2,4-difluorobenzene Chemical compound FC1=C(Cl)C=C(CCl)C(F)=C1Cl KMWKVZQFAZDUFH-UHFFFAOYSA-N 0.000 description 1
- MSSDTZLYNMFTKN-UHFFFAOYSA-N 1-Piperazinecarboxaldehyde Chemical compound O=CN1CCNCC1 MSSDTZLYNMFTKN-UHFFFAOYSA-N 0.000 description 1
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- HDJXUAANNBUBDU-UHFFFAOYSA-N 1-chloro-2,3,4-trifluoro-5-(trichloromethyl)benzene Chemical compound FC1=C(F)C(Cl)=CC(C(Cl)(Cl)Cl)=C1F HDJXUAANNBUBDU-UHFFFAOYSA-N 0.000 description 1
- QEIDAZALPGAFIS-UHFFFAOYSA-N 1-chloro-2,3,4-trifluorobenzene Chemical compound FC1=CC=C(Cl)C(F)=C1F QEIDAZALPGAFIS-UHFFFAOYSA-N 0.000 description 1
- CZHLPWNZCJEPJB-UHFFFAOYSA-N 1-chloro-3-methylbutane Chemical compound CC(C)CCCl CZHLPWNZCJEPJB-UHFFFAOYSA-N 0.000 description 1
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-chloropentane Chemical compound CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 1
- SCGAVZGSIVHGPP-UHFFFAOYSA-N 1-ethylpiperazin-2-one Chemical compound CCN1CCNCC1=O SCGAVZGSIVHGPP-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- KJCIMSSFGUGTGA-UHFFFAOYSA-N 1-methylpiperazin-2-one Chemical compound CN1CCNCC1=O KJCIMSSFGUGTGA-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-N 2,2-diethylpropanedioic acid Chemical compound CCC(CC)(C(O)=O)C(O)=O LTMRRSWNXVJMBA-UHFFFAOYSA-N 0.000 description 1
- RKSFYVMVPGFXLN-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl fluoride Chemical compound FC(=O)C1=CC(F)=C(Cl)C=C1Cl RKSFYVMVPGFXLN-UHFFFAOYSA-N 0.000 description 1
- FWCXZCJLPBVQKT-UHFFFAOYSA-N 2,5-dichloro-3,4,6-trifluorobenzoic acid Chemical compound OC(=O)C1=C(F)C(Cl)=C(F)C(F)=C1Cl FWCXZCJLPBVQKT-UHFFFAOYSA-N 0.000 description 1
- BYYCSTYYULCJLQ-UHFFFAOYSA-N 2-(2-methylpropyl)piperazine Chemical compound CC(C)CC1CNCCN1 BYYCSTYYULCJLQ-UHFFFAOYSA-N 0.000 description 1
- SZZIGSBHEDAVBX-UHFFFAOYSA-N 2-(3,4,5-trimethoxyphenyl)piperazine Chemical compound COC1=C(OC)C(OC)=CC(C2NCCNC2)=C1 SZZIGSBHEDAVBX-UHFFFAOYSA-N 0.000 description 1
- VGANTLKDSNLDDD-UHFFFAOYSA-N 2-(3-nitrophenyl)piperazine Chemical compound [O-][N+](=O)C1=CC=CC(C2NCCNC2)=C1 VGANTLKDSNLDDD-UHFFFAOYSA-N 0.000 description 1
- ZXWFFOCOSVMOPB-UHFFFAOYSA-N 2-(4-bromophenyl)piperazine Chemical compound C1=CC(Br)=CC=C1C1NCCNC1 ZXWFFOCOSVMOPB-UHFFFAOYSA-N 0.000 description 1
- OTOVNNDSINVUBR-UHFFFAOYSA-N 2-(4-chlorophenyl)piperazine Chemical compound C1=CC(Cl)=CC=C1C1NCCNC1 OTOVNNDSINVUBR-UHFFFAOYSA-N 0.000 description 1
- NZAKSEMIIIZYEM-UHFFFAOYSA-N 2-(4-fluorophenyl)piperazine Chemical compound C1=CC(F)=CC=C1C1NCCNC1 NZAKSEMIIIZYEM-UHFFFAOYSA-N 0.000 description 1
- INKLSJITWMAFRT-UHFFFAOYSA-N 2-(4-methoxyphenyl)piperazine Chemical compound C1=CC(OC)=CC=C1C1NCCNC1 INKLSJITWMAFRT-UHFFFAOYSA-N 0.000 description 1
- FCNXNUWTNOYQME-UHFFFAOYSA-N 2-(4-methylphenyl)piperazine Chemical compound C1=CC(C)=CC=C1C1NCCNC1 FCNXNUWTNOYQME-UHFFFAOYSA-N 0.000 description 1
- WWRUGVIJFUXWFW-UHFFFAOYSA-N 2-(4-nitrophenyl)piperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1NCCNC1 WWRUGVIJFUXWFW-UHFFFAOYSA-N 0.000 description 1
- MUECOXPJCJWOTK-UHFFFAOYSA-N 2-(4-phenylmethoxyphenyl)piperazine Chemical compound C=1C=CC=CC=1COC(C=C1)=CC=C1C1CNCCN1 MUECOXPJCJWOTK-UHFFFAOYSA-N 0.000 description 1
- HIEDNYNFVIKPKN-UHFFFAOYSA-N 2-(4-piperidin-1-ylphenyl)piperazine Chemical compound C1CCCCN1C1=CC=C(C2NCCNC2)C=C1 HIEDNYNFVIKPKN-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- BSPCSKHALVHRSR-UHFFFAOYSA-N 2-chlorobutane Chemical compound CCC(C)Cl BSPCSKHALVHRSR-UHFFFAOYSA-N 0.000 description 1
- KVQJVAOMYWTLEO-UHFFFAOYSA-N 2-chlorobutanoyl chloride Chemical compound CCC(Cl)C(Cl)=O KVQJVAOMYWTLEO-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- DXOHZOPKNFZZAD-UHFFFAOYSA-N 2-ethylpiperazine Chemical compound CCC1CNCCN1 DXOHZOPKNFZZAD-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- RIMRLBGNCLMSNH-UHFFFAOYSA-N 2-phenylpiperazine Chemical compound C1NCCNC1C1=CC=CC=C1 RIMRLBGNCLMSNH-UHFFFAOYSA-N 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- HBCSNWKQNPKIHK-UHFFFAOYSA-N 2-propan-2-ylpiperazine Chemical compound CC(C)C1CNCCN1 HBCSNWKQNPKIHK-UHFFFAOYSA-N 0.000 description 1
- FNJWLOHHZVGUIX-UHFFFAOYSA-N 2-propylpiperazine Chemical compound CCCC1CNCCN1 FNJWLOHHZVGUIX-UHFFFAOYSA-N 0.000 description 1
- BFVCDPJJFUPNAQ-UHFFFAOYSA-N 2-thiophen-2-ylpiperazine Chemical compound C1NCCNC1C1=CC=CS1 BFVCDPJJFUPNAQ-UHFFFAOYSA-N 0.000 description 1
- SHLNHUHKYANNLC-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(F)C(Cl)=C1F SHLNHUHKYANNLC-UHFFFAOYSA-N 0.000 description 1
- ASQQXYQZMYOGIL-UHFFFAOYSA-N 3,5-dichloro-2,4-difluorobenzoyl chloride Chemical compound FC1=C(Cl)C=C(C(Cl)=O)C(F)=C1Cl ASQQXYQZMYOGIL-UHFFFAOYSA-N 0.000 description 1
- OVSJMIKVDNAXDN-UHFFFAOYSA-N 3-chloro-1-(chloromethyl)-2,4,5-trifluorobenzene Chemical compound FC1=CC(CCl)=C(F)C(Cl)=C1F OVSJMIKVDNAXDN-UHFFFAOYSA-N 0.000 description 1
- FNOTUPISSVMOCU-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzaldehyde Chemical compound FC1=CC(C=O)=C(F)C(Cl)=C1F FNOTUPISSVMOCU-UHFFFAOYSA-N 0.000 description 1
- XGIMFAMVOLVNPP-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzamide Chemical compound NC(=O)C1=CC(F)=C(F)C(Cl)=C1F XGIMFAMVOLVNPP-UHFFFAOYSA-N 0.000 description 1
- LAMUXTNQCICZQX-UHFFFAOYSA-N 3-chloropropan-1-ol Chemical compound OCCCCl LAMUXTNQCICZQX-UHFFFAOYSA-N 0.000 description 1
- JSMDUOFOPDSKIQ-UHFFFAOYSA-N 3-methoxypropanoyl chloride Chemical compound COCCC(Cl)=O JSMDUOFOPDSKIQ-UHFFFAOYSA-N 0.000 description 1
- VUHYROBFXQJOMM-UHFFFAOYSA-N 3-oxo-7-piperazin-1-yl-2h-quinoline-2-carboxylic acid Chemical compound C1=CC2=CC(=O)C(C(=O)O)N=C2C=C1N1CCNCC1 VUHYROBFXQJOMM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- HXHGULXINZUGJX-UHFFFAOYSA-N 4-chlorobutanol Chemical compound OCCCCCl HXHGULXINZUGJX-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- SASIFHOHGBPKMK-UHFFFAOYSA-N 4-piperazin-2-ylphenol Chemical compound C1=CC(O)=CC=C1C1NCCNC1 SASIFHOHGBPKMK-UHFFFAOYSA-N 0.000 description 1
- LKJCRANQTRBCON-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzamide Chemical compound NC(=O)C1=CC(Cl)=C(F)C(F)=C1F LKJCRANQTRBCON-UHFFFAOYSA-N 0.000 description 1
- GWEORAFZBMNWGX-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(F)C(F)=C1F GWEORAFZBMNWGX-UHFFFAOYSA-N 0.000 description 1
- ZTFLZDAEKQPVLD-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzonitrile Chemical compound FC1=C(F)C(Cl)=CC(C#N)=C1F ZTFLZDAEKQPVLD-UHFFFAOYSA-N 0.000 description 1
- HRGAJVOGQZVZSW-UHFFFAOYSA-N 5-chloro-2,3,4-trifluorobenzoyl chloride Chemical compound FC1=C(F)C(Cl)=CC(C(Cl)=O)=C1F HRGAJVOGQZVZSW-UHFFFAOYSA-N 0.000 description 1
- YDCABRFIMRVMGF-UHFFFAOYSA-N 6,8-dichloro-1-cyclopropyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(N3CCNCC3)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 YDCABRFIMRVMGF-UHFFFAOYSA-N 0.000 description 1
- QVUHIQSYEIYDEH-UHFFFAOYSA-N 6,8-dichloro-1-cyclopropyl-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C)CCN1C1=C(Cl)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1Cl QVUHIQSYEIYDEH-UHFFFAOYSA-N 0.000 description 1
- RQBLLVJGAAWYEN-UHFFFAOYSA-N 6-chloro-1-cyclopropyl-8-fluoro-4-oxo-7-(4-propan-2-ylpiperazin-1-yl)quinoline-3-carboxylic acid Chemical compound C1CN(C(C)C)CCN1C1=C(Cl)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F RQBLLVJGAAWYEN-UHFFFAOYSA-N 0.000 description 1
- NOTPABMDVNLNBC-UHFFFAOYSA-N 6-chloro-1-cyclopropyl-8-fluoro-4-oxoquinoline-3-carboxylic acid Chemical class C12=C(F)C=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 NOTPABMDVNLNBC-UHFFFAOYSA-N 0.000 description 1
- GDWFFUKEOCWCSL-UHFFFAOYSA-N 6-chloro-1-cyclopropyl-8-fluoro-7-[3-(4-hydroxyphenyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CC(NCC3)C=3C=CC(O)=CC=3)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 GDWFFUKEOCWCSL-UHFFFAOYSA-N 0.000 description 1
- QPINHVFSIVYZQT-UHFFFAOYSA-N 6-chloro-1-cyclopropyl-8-fluoro-7-[3-(4-methylphenyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1=CC(C)=CC=C1C1NCCN(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2Cl)F)C1 QPINHVFSIVYZQT-UHFFFAOYSA-N 0.000 description 1
- RLYNUEUBYAUDQN-UHFFFAOYSA-N 6-chloro-7-[3-(4-chlorophenyl)piperazin-1-yl]-1-cyclopropyl-8-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CC(NCC3)C=3C=CC(Cl)=CC=3)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 RLYNUEUBYAUDQN-UHFFFAOYSA-N 0.000 description 1
- JHDNUMKGLSVIEQ-UHFFFAOYSA-N 7-(4-acetylpiperazin-1-yl)-6,8-dichloro-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C(=O)C)CCN1C1=C(Cl)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1Cl JHDNUMKGLSVIEQ-UHFFFAOYSA-N 0.000 description 1
- MHRZNSDGITWYDT-UHFFFAOYSA-N 7-(4-acetylpiperazin-1-yl)-6-chloro-1-cyclopropyl-8-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C(=O)C)CCN1C1=C(Cl)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F MHRZNSDGITWYDT-UHFFFAOYSA-N 0.000 description 1
- OBLARDPCWHWGBV-UHFFFAOYSA-N 7-[3-(4-bromophenyl)piperazin-1-yl]-6-chloro-1-cyclopropyl-8-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CC(NCC3)C=3C=CC(Br)=CC=3)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 OBLARDPCWHWGBV-UHFFFAOYSA-N 0.000 description 1
- GXTSEMWAXIHJOM-UHFFFAOYSA-N 7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound C1=CC2=CC(C(=O)O)=CN=C2C=C1N1CCNCC1 GXTSEMWAXIHJOM-UHFFFAOYSA-N 0.000 description 1
- SUVHVMBUDRXNKI-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-4-oxo-7-(3-phenylpiperazin-1-yl)quinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(N3CC(NCC3)C=3C=CC=CC=3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 SUVHVMBUDRXNKI-UHFFFAOYSA-N 0.000 description 1
- XITVYBAKLJHNIS-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-4-oxo-7-(3-thiophen-2-ylpiperazin-1-yl)quinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(N3CC(NCC3)C=3SC=CC=3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 XITVYBAKLJHNIS-UHFFFAOYSA-N 0.000 description 1
- VVBQZKOGRSGVPT-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-4-oxo-7-[3-(4-piperidin-1-ylphenyl)piperazin-1-yl]quinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(N3CC(NCC3)C=3C=CC(=CC=3)N3CCCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 VVBQZKOGRSGVPT-UHFFFAOYSA-N 0.000 description 1
- MVXLDPRRAAVKTB-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(N3CCCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MVXLDPRRAAVKTB-UHFFFAOYSA-N 0.000 description 1
- CGOQDZKBNDSFNO-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-7-[2-(4-nitrophenyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(N3C(CNCC3)C=3C=CC(=CC=3)[N+]([O-])=O)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 CGOQDZKBNDSFNO-UHFFFAOYSA-N 0.000 description 1
- LRWBASJYUSHZQN-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-7-piperazin-1-yl-4h-quinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1=C(F)C(N2CCNCC2)=C(Cl)C2=C1CC(C(=O)O)=CN2C1CC1 LRWBASJYUSHZQN-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 238000007045 Balz-Schiemann reaction Methods 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- QFQRGLNOQMLEGB-UHFFFAOYSA-N C(C)OC(C(C(C1=C(C(=C(C(=C1)F)F)Cl)F)=O)CC)=O Chemical compound C(C)OC(C(C(C1=C(C(=C(C(=C1)F)F)Cl)F)=O)CC)=O QFQRGLNOQMLEGB-UHFFFAOYSA-N 0.000 description 1
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 1
- OHGBOMMRQANHOP-UHFFFAOYSA-N CN(C(C#N)Br)C(Cl)=O Chemical compound CN(C(C#N)Br)C(Cl)=O OHGBOMMRQANHOP-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940124350 antibacterial drug Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- QGPKADBNRMWEQR-UHFFFAOYSA-N clinafloxacin Chemical compound C1C(N)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1Cl QGPKADBNRMWEQR-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000002587 enol group Chemical group 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- KISUGMULAAIILF-UHFFFAOYSA-N ethyl 2-(3-chloro-2,4,5-trifluorobenzoyl)-3-(cyclopropylamino)prop-2-enoate Chemical compound C=1C(F)=C(F)C(Cl)=C(F)C=1C(=O)C(C(=O)OCC)=CNC1CC1 KISUGMULAAIILF-UHFFFAOYSA-N 0.000 description 1
- BNEXAOCXYOUGIB-UHFFFAOYSA-N ethyl 2-(5-chloro-2,3,4-trifluorobenzoyl)-3-(cyclopropylamino)prop-2-enoate Chemical compound C=1C(Cl)=C(F)C(F)=C(F)C=1C(=O)C(C(=O)OCC)=CNC1CC1 BNEXAOCXYOUGIB-UHFFFAOYSA-N 0.000 description 1
- PZHBCYPIIDMQIW-UHFFFAOYSA-N ethyl 3-(5-chloro-2,3,4-trifluorophenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC(Cl)=C(F)C(F)=C1F PZHBCYPIIDMQIW-UHFFFAOYSA-N 0.000 description 1
- UCFRMVIODHQKQP-UHFFFAOYSA-N ethyl 3-(cyclopropylamino)-2-(3,5-dichloro-2,4-difluorobenzoyl)prop-2-enoate Chemical compound C=1C(Cl)=C(F)C(Cl)=C(F)C=1C(=O)C(C(=O)OCC)=CNC1CC1 UCFRMVIODHQKQP-UHFFFAOYSA-N 0.000 description 1
- FCGILORQEAHNMB-UHFFFAOYSA-N ethyl 6,8-dichloro-1-cyclopropyl-7-fluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(Cl)C(F)=C(Cl)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 FCGILORQEAHNMB-UHFFFAOYSA-N 0.000 description 1
- UUAYWVOLZVLIAX-UHFFFAOYSA-N ethyl 6-chloro-1-cyclopropyl-7,8-difluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(F)C(F)=C(Cl)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 UUAYWVOLZVLIAX-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- CJXGPJZUDUOZDX-UHFFFAOYSA-N fluoromethanone Chemical group F[C]=O CJXGPJZUDUOZDX-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- XDKQUSKHRIUJEO-UHFFFAOYSA-N magnesium;ethanolate Chemical compound [Mg+2].CC[O-].CC[O-] XDKQUSKHRIUJEO-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- KPBSJEBFALFJTO-UHFFFAOYSA-N propane-1-sulfonyl chloride Chemical compound CCCS(Cl)(=O)=O KPBSJEBFALFJTO-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- NGXSWUFDCSEIOO-UHFFFAOYSA-N pyrrolidin-3-amine Chemical compound NC1CCNC1 NGXSWUFDCSEIOO-UHFFFAOYSA-N 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
- C07C17/14—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms in the side-chain of aromatic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/16—Preparation of halogenated hydrocarbons by replacement by halogens of hydroxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C25/00—Compounds containing at least one halogen atom bound to a six-membered aromatic ring
- C07C25/02—Monocyclic aromatic halogenated hydrocarbons
- C07C25/13—Monocyclic aromatic halogenated hydrocarbons containing fluorine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/40—Halogenated unsaturated alcohols
- C07C33/46—Halogenated unsaturated alcohols containing only six-membered aromatic rings as cyclic parts
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
- C07C45/292—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups with chromium derivatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/42—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by hydrolysis
- C07C45/43—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by hydrolysis of >CX2 groups, X being halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/68—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings containing halogen
- C07C63/70—Monocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quinoline Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843420796 DE3420796A1 (de) | 1984-06-04 | 1984-06-04 | 2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT38297A HUT38297A (en) | 1986-05-28 |
| HU195176B true HU195176B (en) | 1988-04-28 |
Family
ID=6237596
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU852148A HU195176B (en) | 1984-06-04 | 1985-06-03 | Process for producing 2,4-difluor-5-halogen- resp. 2,4-difluor-3,5-dihalogen-benzol derivatives |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US5072038A (enExample) |
| EP (1) | EP0164619B1 (enExample) |
| JP (1) | JPS617220A (enExample) |
| KR (1) | KR920005845B1 (enExample) |
| AT (1) | ATE37866T1 (enExample) |
| CA (1) | CA1242742A (enExample) |
| DE (2) | DE3420796A1 (enExample) |
| HU (1) | HU195176B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5872283A (en) * | 1996-07-09 | 1999-02-16 | Bayer Aktiengesellschaft | Process for decarboxylation of halogenated aromatic carboxylic acids |
| US6452056B1 (en) * | 1998-09-17 | 2002-09-17 | Asahi Glass Company, Limited | Process for the preparation of fluorobenzyl derivatives |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0174131A3 (en) * | 1984-09-01 | 1989-06-07 | FISONS plc | Dihydropyridines, processes and intermediates for their production, and pharmaceutical formulations containing them |
| US4791225A (en) * | 1986-01-20 | 1988-12-13 | Kyorin Pharmaceutical Co., Ltd. | Halogenobenzoic acid derivatives and their preparation |
| EP0230946A3 (en) * | 1986-01-20 | 1988-09-07 | Kyorin Pharmaceutical Co., Ltd. | Process for the preparation of quinolonecarboxylic acid derivatives |
| DE3601566A1 (de) * | 1986-01-21 | 1987-07-23 | Bayer Ag | Pharmazeutische zubereitungen von ciprofloxacin |
| US5286754A (en) * | 1986-01-21 | 1994-02-15 | Bayer Aktiengesellschaft | Pharmaceutical formulations of ciprofloxacin |
| JPS62192321A (ja) * | 1986-02-19 | 1987-08-22 | Bayer Japan Kk | 魚類用抗菌剤 |
| DE3631906A1 (de) * | 1986-09-19 | 1988-03-31 | Bayer Ag | Verfahren zur herstellung von benzoesaeure-derivaten |
| US5227531A (en) * | 1986-10-31 | 1993-07-13 | Hoechst Aktiengesellschaft | Process for the preparation of fluorobenzaldehydes |
| DE3637156C2 (de) * | 1986-10-31 | 1995-12-21 | Hoechst Ag | Verfahren zur Herstellung von Fluorbenzaldehyden |
| US4831190A (en) * | 1986-12-04 | 1989-05-16 | Ube Industries, Ltd. | Trifluorohydroxyaromatic acid and preparation thereof |
| DE3853654T2 (de) * | 1987-08-14 | 1996-01-18 | Asahi Glass Co Ltd | Fluorierte Benzoylverbindungen. |
| JPH072679B2 (ja) * | 1988-04-15 | 1995-01-18 | 旭硝子株式会社 | 2―クロロ―4,5―ジフルオロ安息香酸誘導体 |
| US4996355A (en) * | 1989-04-14 | 1991-02-26 | Mallinckrodt, Inc. | Novel intermediates for the production of 2,4,5-trifluorobenzoyl fluoride |
| IE72169B1 (en) * | 1989-11-17 | 1997-03-26 | Asahi Glass Co Ltd | Processes for producing 5-fluorobenzoic acids and their intermediates |
| US4935541A (en) * | 1989-11-20 | 1990-06-19 | Occidental Chemical Corporation | Preparation of 2,4,5-trifluorobenzoic acid by decarboxylation of 3,4,6-trifluorophthalic anhydride |
| DE4301247A1 (de) * | 1993-01-19 | 1994-07-21 | Bayer Ag | Verfahren zur Herstellung mehrfach halogenierter Benzotrichloride und Benzoylchloride sowie neue Trihalogenbenzotrichloride und -benzoylchloride |
| DE4338525A1 (de) * | 1993-11-11 | 1995-05-18 | Bayer Ag | Verfahren zur Herstellung von 4,5-Difluorbenzaldehyden |
| DE4409578A1 (de) | 1994-03-21 | 1995-09-28 | Bayer Ag | Verfahren zur Herstellung von 2-Halogen-4,5-difluorbenzoylfluoriden |
| DE4416329A1 (de) * | 1994-05-09 | 1995-11-16 | Hoechst Ag | Substituierte 2-Chlor-3,4,5-trifluorbenzole und ein Verfahren zu ihrer Herstellung |
| US5639888A (en) * | 1994-10-03 | 1997-06-17 | American Cyanamid Co. | Process for the preparation of acid chloride compounds |
| DE19740632A1 (de) | 1997-09-16 | 1999-03-18 | Bayer Ag | Verfahren zur Herstellung von 2,3,4,5-Tetrafluorbenzolderivaten |
| JP4200704B2 (ja) * | 2002-07-24 | 2008-12-24 | 昭和電工株式会社 | フッ素化ベンゾニトリルの製造方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB977963A (en) * | 1960-05-12 | 1964-12-16 | Imp Smelting Corp Ltd | Derivatives of carboxylic acids containing the pentafluorophenyl group |
| US3230268A (en) * | 1962-04-09 | 1966-01-18 | Fuso Chemical Co Ltd | Preparation of chloro-substituted benzene derivatives |
| NL129620C (enExample) * | 1963-04-01 | |||
| US3485865A (en) * | 1967-04-05 | 1969-12-23 | Velsicol Chemical Corp | N-methoxy and n-ethoxy benzamides |
| US3816526A (en) * | 1972-10-03 | 1974-06-11 | Mobil Oil Corp | Method for producing halobenzoyl halides |
| DE3142856A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoylchlorid |
| US4582948A (en) * | 1982-02-09 | 1986-04-15 | Occidental Chemical Corporation | 3-chloro-4-fluoro-5-nitrobenzotrifluoride |
| JPS58150543A (ja) * | 1982-03-04 | 1983-09-07 | Chisso Corp | 2,4,5−トリフルオロ安息香酸トランス−4−(トランス−4′−アルキルシクロヘキシル)シクロヘキシルエステル |
| JPS6072885A (ja) * | 1983-09-28 | 1985-04-24 | Dai Ichi Seiyaku Co Ltd | トリフルオロベンゾイル化合物類 |
| CA1267413A (en) * | 1984-04-26 | 1990-04-03 | Abbott Laboratories | Quino-benoxazine antibacterial compounds |
| US4792618A (en) * | 1984-05-02 | 1988-12-20 | Occidental Chemical Corporation | Fluorinated carbocylic compounds |
| US4791225A (en) * | 1986-01-20 | 1988-12-13 | Kyorin Pharmaceutical Co., Ltd. | Halogenobenzoic acid derivatives and their preparation |
-
1984
- 1984-06-04 DE DE19843420796 patent/DE3420796A1/de not_active Withdrawn
-
1985
- 1985-05-22 DE DE8585106251T patent/DE3565528D1/de not_active Expired
- 1985-05-22 AT AT85106251T patent/ATE37866T1/de not_active IP Right Cessation
- 1985-05-22 EP EP85106251A patent/EP0164619B1/de not_active Expired
- 1985-05-31 CA CA000482913A patent/CA1242742A/en not_active Expired
- 1985-06-03 HU HU852148A patent/HU195176B/hu not_active IP Right Cessation
- 1985-06-04 KR KR1019850003889A patent/KR920005845B1/ko not_active Expired
- 1985-06-04 JP JP60119907A patent/JPS617220A/ja active Granted
-
1990
- 1990-01-02 US US07/459,876 patent/US5072038A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5872283A (en) * | 1996-07-09 | 1999-02-16 | Bayer Aktiengesellschaft | Process for decarboxylation of halogenated aromatic carboxylic acids |
| US6452056B1 (en) * | 1998-09-17 | 2002-09-17 | Asahi Glass Company, Limited | Process for the preparation of fluorobenzyl derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3565528D1 (en) | 1988-11-17 |
| HUT38297A (en) | 1986-05-28 |
| DE3420796A1 (de) | 1985-12-05 |
| EP0164619A1 (de) | 1985-12-18 |
| JPS617220A (ja) | 1986-01-13 |
| KR920005845B1 (ko) | 1992-07-23 |
| US5072038A (en) | 1991-12-10 |
| EP0164619B1 (de) | 1988-10-12 |
| JPH0246015B2 (enExample) | 1990-10-12 |
| CA1242742A (en) | 1988-10-04 |
| KR860000240A (ko) | 1986-01-27 |
| ATE37866T1 (de) | 1988-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU195176B (en) | Process for producing 2,4-difluor-5-halogen- resp. 2,4-difluor-3,5-dihalogen-benzol derivatives | |
| US5969141A (en) | Intermediates for 7-amino-1-cyclopropyl-6,8-dihalogeno-1,4-dihydro-4-oxo-3-quinolinecarbox ylic acid antibacterial agents | |
| JP2504895B2 (ja) | 1−アミノ−2,2−ジフルオロシクロプロパン | |
| FI82041C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 1-cyklopropyl-6-fluor-1,4-dihydro-4-pxo-7- (1-piperazinyl)-3-kinolinkarboxylsyraderivat. | |
| HU187580B (en) | Process for producing 1-cyclopropy-6-fluoro-1,4-dihydro-4-oxo-7-piperazino-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing them as active agents | |
| JPH0592922A (ja) | 抗バクテリア剤 | |
| JPH0323549B2 (enExample) | ||
| EP0191185B1 (en) | Quinoline-carboxylic acid derivatives | |
| KR910003616B1 (ko) | 할로겐화 퀴놀론 카복실산의 제조방법 | |
| KR970005191B1 (ko) | 퀴놀린카르복실산의 제조 방법 | |
| CN86104256A (zh) | 1,8-桥连 4-喹诺酮-3-羧酸类的制备方法 | |
| US5565614A (en) | 2,4,5-trihalogeno-and 2,3,4,5-tetrahalogenobenzene derivatives | |
| US2797218A (en) | Cinnoline derivatives | |
| US5362909A (en) | Process for the preparation of 3-chloro-2,4,5-trifluorobenzoyl chloride, 2,4,5-trifuluorobenzoyl fluoride, and 2,3,4,5-tetrahalogenobenzene derivatives | |
| US5468861A (en) | 8-chloro-1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid and alkyl esters thereof | |
| KR920005493B1 (ko) | 할로겐화 퀴놀론카복실산 제조용 중간체의 제조방법 | |
| KR870000893B1 (ko) | 퀴놀론 카복실산의 제조방법 | |
| CN85101810A (zh) | 7-胺基-1-环丙基-6,8-二卤基-1,4-二氢化-4-氧代-3-喹啉羧酸的制备方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |