HU192464B - Herbicide compositions containing cyclohexenol derivatives as active ingredients and process for preparing cyclohexenol derivatives - Google Patents
Herbicide compositions containing cyclohexenol derivatives as active ingredients and process for preparing cyclohexenol derivatives Download PDFInfo
- Publication number
- HU192464B HU192464B HU843758A HU375884A HU192464B HU 192464 B HU192464 B HU 192464B HU 843758 A HU843758 A HU 843758A HU 375884 A HU375884 A HU 375884A HU 192464 B HU192464 B HU 192464B
- Authority
- HU
- Hungary
- Prior art keywords
- propyl
- alkyl
- ethyl
- group
- carbon atoms
- Prior art date
Links
- 239000004480 active ingredient Substances 0.000 title claims description 38
- 230000002363 herbicidal effect Effects 0.000 title claims description 17
- 239000000203 mixture Substances 0.000 title claims description 17
- QHDHNVFIKWGRJR-UHFFFAOYSA-N 1-cyclohexenol Chemical class OC1=CCCCC1 QHDHNVFIKWGRJR-UHFFFAOYSA-N 0.000 title claims description 11
- 239000004009 herbicide Substances 0.000 title description 20
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 methylene, carbonyl Chemical group 0.000 claims description 383
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 53
- 150000001875 compounds Chemical class 0.000 claims description 32
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 3
- 239000002270 dispersing agent Substances 0.000 claims description 3
- 239000003995 emulsifying agent Substances 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- 239000003208 petroleum Substances 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000002619 bicyclic group Chemical group 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims 2
- 239000000654 additive Substances 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- ABZZOPIABWYXSN-UHFFFAOYSA-N cyclohex-3-en-1-ol Chemical class OC1CCC=CC1 ABZZOPIABWYXSN-UHFFFAOYSA-N 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims 1
- 239000000080 wetting agent Substances 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 249
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 213
- 238000005160 1H NMR spectroscopy Methods 0.000 description 72
- 241000196324 Embryophyta Species 0.000 description 49
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 30
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 18
- 239000000243 solution Substances 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 10
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 10
- 244000068988 Glycine max Species 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 9
- 235000010469 Glycine max Nutrition 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 7
- 235000006463 Brassica alba Nutrition 0.000 description 7
- 244000140786 Brassica hirta Species 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 244000058871 Echinochloa crus-galli Species 0.000 description 7
- 235000011999 Panicum crusgalli Nutrition 0.000 description 7
- 241000209504 Poaceae Species 0.000 description 7
- 240000008042 Zea mays Species 0.000 description 7
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 6
- 240000002791 Brassica napus Species 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 240000005498 Setaria italica Species 0.000 description 6
- 235000007226 Setaria italica Nutrition 0.000 description 6
- 240000002439 Sorghum halepense Species 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 244000038559 crop plants Species 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 235000007320 Avena fatua Nutrition 0.000 description 5
- 241000209764 Avena fatua Species 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 5
- 235000011293 Brassica napus Nutrition 0.000 description 5
- 241000209082 Lolium Species 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- 240000006394 Sorghum bicolor Species 0.000 description 5
- 235000007244 Zea mays Nutrition 0.000 description 5
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 244000299507 Gossypium hirsutum Species 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 244000098338 Triticum aestivum Species 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 3
- 241001621841 Alopecurus myosuroides Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000335053 Beta vulgaris Species 0.000 description 3
- 244000152970 Digitaria sanguinalis Species 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- 235000014716 Eleusine indica Nutrition 0.000 description 3
- 244000025670 Eleusine indica Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000021506 Ipomoea Nutrition 0.000 description 3
- 241000207783 Ipomoea Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 235000005775 Setaria Nutrition 0.000 description 3
- 241000232088 Setaria <nematode> Species 0.000 description 3
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229920005610 lignin Polymers 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000006126 n-butyl sulfonyl group Chemical group 0.000 description 3
- 125000002811 oleoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 2
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical class CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 2
- MFKPLBUNJMEBRQ-UHFFFAOYSA-N 2-propan-2-yl-1,3-dioxepane Chemical compound CC(C)C1OCCCCO1 MFKPLBUNJMEBRQ-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 244000099147 Ananas comosus Species 0.000 description 2
- 235000007119 Ananas comosus Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 235000021537 Beetroot Nutrition 0.000 description 2
- 235000016068 Berberis vulgaris Nutrition 0.000 description 2
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 235000011371 Brassica hirta Nutrition 0.000 description 2
- 241000209200 Bromus Species 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 244000037364 Cinnamomum aromaticum Species 0.000 description 2
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 2
- 241000723377 Coffea Species 0.000 description 2
- 240000007154 Coffea arabica Species 0.000 description 2
- 241000219112 Cucumis Species 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000192043 Echinochloa Species 0.000 description 2
- 235000001950 Elaeis guineensis Nutrition 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 244000020551 Helianthus annuus Species 0.000 description 2
- 235000003222 Helianthus annuus Nutrition 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 244000017020 Ipomoea batatas Species 0.000 description 2
- 235000002678 Ipomoea batatas Nutrition 0.000 description 2
- 244000100545 Lolium multiflorum Species 0.000 description 2
- 241000220225 Malus Species 0.000 description 2
- 240000004658 Medicago sativa Species 0.000 description 2
- 235000004357 Mentha x piperita Nutrition 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 2
- 244000061176 Nicotiana tabacum Species 0.000 description 2
- 241001506137 Rapa Species 0.000 description 2
- 235000004443 Ricinus communis Nutrition 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 235000007230 Sorghum bicolor Nutrition 0.000 description 2
- 235000021536 Sugar beet Nutrition 0.000 description 2
- 244000204900 Talipariti tiliaceum Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 235000010726 Vigna sinensis Nutrition 0.000 description 2
- 244000042314 Vigna unguiculata Species 0.000 description 2
- 241000209149 Zea Species 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- HPXRVTGHNJAIIH-PTQBSOBMSA-N cyclohexanol Chemical class O[13CH]1CCCCC1 HPXRVTGHNJAIIH-PTQBSOBMSA-N 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- JRQSTWLYBFBPDX-UMKHLJCSSA-N helian Natural products OC[C@H]1O[C@@H](O[C@@H](C=C/CCCC=C)C#CC#C[C@@H](O)C=C)[C@H](O)[C@@H](O)[C@@H]1O JRQSTWLYBFBPDX-UMKHLJCSSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- IXQGCWUGDFDQMF-UHFFFAOYSA-N o-Hydroxyethylbenzene Natural products CCC1=CC=CC=C1O IXQGCWUGDFDQMF-UHFFFAOYSA-N 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- KBLAMUYRMZPYLS-UHFFFAOYSA-N 2,3-bis(2-methylpropyl)naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(CC(C)C)C(CC(C)C)=CC2=C1 KBLAMUYRMZPYLS-UHFFFAOYSA-N 0.000 description 1
- QFUSCYRJMXLNRB-UHFFFAOYSA-N 2,6-dinitroaniline Chemical class NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QFUSCYRJMXLNRB-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- HFSWIAHFNHJWKG-UHFFFAOYSA-N 2-[2-(ethoxyamino)butylidene]-5-(oxan-3-yl)cyclohexane-1,3-dione Chemical compound C1C(=O)C(=CC(CC)NOCC)C(=O)CC1C1COCCC1 HFSWIAHFNHJWKG-UHFFFAOYSA-N 0.000 description 1
- GBNPVXZNWBWNEN-UHFFFAOYSA-N 2-chloro-4-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=NC(Cl)=C1 GBNPVXZNWBWNEN-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- REEXLQXWNOSJKO-UHFFFAOYSA-N 2h-1$l^{4},2,3-benzothiadiazine 1-oxide Chemical class C1=CC=C2S(=O)NN=CC2=C1 REEXLQXWNOSJKO-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- FGQSHUZAYIVLMB-UHFFFAOYSA-N 4-iodopiperidine Chemical compound IC1CCNCC1 FGQSHUZAYIVLMB-UHFFFAOYSA-N 0.000 description 1
- MTPBUCCXRGSDCR-UHFFFAOYSA-N 4-piperidin-1-ylpyridine Chemical compound C1CCCCN1C1=CC=NC=C1 MTPBUCCXRGSDCR-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 1
- 235000004507 Abies alba Nutrition 0.000 description 1
- 241000191291 Abies alba Species 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 235000011446 Amygdalus persica Nutrition 0.000 description 1
- 235000003276 Apios tuberosa Nutrition 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000003416 Asparagus officinalis Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 244000060924 Brassica campestris Species 0.000 description 1
- 235000005637 Brassica campestris Nutrition 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 244000178924 Brassica napobrassica Species 0.000 description 1
- 235000011297 Brassica napobrassica Nutrition 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 244000052707 Camellia sinensis Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 244000020518 Carthamus tinctorius Species 0.000 description 1
- 244000068645 Carya illinoensis Species 0.000 description 1
- 235000009025 Carya illinoensis Nutrition 0.000 description 1
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 235000001759 Citrus maxima Nutrition 0.000 description 1
- 244000276331 Citrus maxima Species 0.000 description 1
- 240000004307 Citrus medica Species 0.000 description 1
- 241001672694 Citrus reticulata Species 0.000 description 1
- 235000005976 Citrus sinensis Nutrition 0.000 description 1
- 240000002319 Citrus sinensis Species 0.000 description 1
- 240000000560 Citrus x paradisi Species 0.000 description 1
- 241000892667 Cnidium silaifolium Species 0.000 description 1
- 235000007460 Coffea arabica Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 235000010071 Cucumis prophetarum Nutrition 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 244000133098 Echinacea angustifolia Species 0.000 description 1
- 240000003133 Elaeis guineensis Species 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- 244000307700 Fragaria vesca Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 240000000047 Gossypium barbadense Species 0.000 description 1
- 235000009429 Gossypium barbadense Nutrition 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 241000218652 Larix Species 0.000 description 1
- 235000005590 Larix decidua Nutrition 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 241000227653 Lycopersicon Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000010624 Medicago sativa Nutrition 0.000 description 1
- 240000000233 Melia azedarach Species 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 241001479543 Mentha x piperita Species 0.000 description 1
- 241001534756 Mungos Species 0.000 description 1
- 241000234295 Musa Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- 241000208134 Nicotiana rustica Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 240000008114 Panicum miliaceum Species 0.000 description 1
- 235000007199 Panicum miliaceum Nutrition 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 244000038248 Pennisetum spicatum Species 0.000 description 1
- 235000007195 Pennisetum typhoides Nutrition 0.000 description 1
- 244000062780 Petroselinum sativum Species 0.000 description 1
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 1
- 244000100170 Phaseolus lunatus Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 244000193463 Picea excelsa Species 0.000 description 1
- 235000008124 Picea excelsa Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241001290151 Prunus avium subsp. avium Species 0.000 description 1
- 244000141353 Prunus domestica Species 0.000 description 1
- 235000011435 Prunus domestica Nutrition 0.000 description 1
- 240000005809 Prunus persica Species 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- 240000000528 Ricinus communis Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 244000082988 Secale cereale Species 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 244000138286 Sorghum saccharatum Species 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 244000300264 Spinacia oleracea Species 0.000 description 1
- 235000006468 Thea sinensis Nutrition 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 240000002913 Trifolium pratense Species 0.000 description 1
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical class O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 1
- 240000000851 Vaccinium corymbosum Species 0.000 description 1
- 240000001717 Vaccinium macrocarpon Species 0.000 description 1
- 235000017606 Vaccinium vitis idaea Nutrition 0.000 description 1
- 244000077923 Vaccinium vitis idaea Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 244000042327 Vigna sinensis Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000013030 Voandzeia subterranea Nutrition 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000013011 aqueous formulation Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 235000009120 camo Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 150000001907 coumarones Chemical class 0.000 description 1
- 235000021019 cranberries Nutrition 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 235000014134 echinacea Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000004426 flaxseed Nutrition 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- LCDFWRDNEPDQBV-UHFFFAOYSA-N formaldehyde;phenol;urea Chemical compound O=C.NC(N)=O.OC1=CC=CC=C1 LCDFWRDNEPDQBV-UHFFFAOYSA-N 0.000 description 1
- 230000035929 gnawing Effects 0.000 description 1
- 235000002532 grape seed extract Nutrition 0.000 description 1
- 235000007924 ground bean Nutrition 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- 239000011487 hemp Substances 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical class CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 239000003864 humus Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000001771 mentha piperita Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 235000011197 perejil Nutrition 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical class OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 239000001739 pinus spp. Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- GBXQPDCOMJJCMJ-UHFFFAOYSA-M trimethyl-[6-(trimethylazaniumyl)hexyl]azanium;bromide Chemical compound [Br-].C[N+](C)(C)CCCCCC[N+](C)(C)C GBXQPDCOMJJCMJ-UHFFFAOYSA-M 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/32—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N35/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having two bonds to hetero atoms with at the most one bond to halogen, e.g. aldehyde radical
- A01N35/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having two bonds to hetero atoms with at the most one bond to halogen, e.g. aldehyde radical at least one of the bonds to hetero atoms is to nitrogen
- A01N35/10—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having two bonds to hetero atoms with at the most one bond to halogen, e.g. aldehyde radical at least one of the bonds to hetero atoms is to nitrogen containing a carbon-to-nitrogen double bond
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/10—Aromatic or araliphatic carboxylic acids, or thio analogues thereof; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N39/00—Biocides, pest repellants or attractants, or plant growth regulators containing aryloxy- or arylthio-aliphatic or cycloaliphatic compounds, containing the group or, e.g. phenoxyethylamine, phenylthio-acetonitrile, phenoxyacetone
- A01N39/02—Aryloxy-carboxylic acids; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N41/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom
- A01N41/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom containing a sulfur-to-oxygen double bond
- A01N41/04—Sulfonic acids; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/06—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings
- A01N43/08—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings with oxygen as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/14—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings
- A01N43/16—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings with oxygen as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/14—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings
- A01N43/18—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings with sulfur as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/90—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having two or more relevant hetero rings, condensed among themselves or with a common carbocyclic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N55/00—Biocides, pest repellants or attractants, or plant growth regulators, containing organic compounds containing elements other than carbon, hydrogen, halogen, oxygen, nitrogen and sulfur
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N57/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds
- A01N57/10—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-oxygen bonds or phosphorus-to-sulfur bonds
- A01N57/12—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-oxygen bonds or phosphorus-to-sulfur bonds containing acyclic or cycloaliphatic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/18—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/04—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D309/06—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/02—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/16—Esters of thiophosphoric acids or thiophosphorous acids
- C07F9/165—Esters of thiophosphoric acids
- C07F9/177—Esters of thiophosphoric acids with cycloaliphatic alcohols
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/576—Six-membered rings
- C07F9/58—Pyridine rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/655—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms
- C07F9/65515—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms the oxygen atom being part of a five-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Zoology (AREA)
- Pest Control & Pesticides (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cosmetics (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Description
A találmány tárgya hatóanyagként új ciklohexenol-származékokat tartalmazó gyomirtószerkészítmények, valamint az új ciklohexenolszármazékok előállítása.
Ismertek már ciklohexenol-származékokat ható- 5 anyagként tartalmazó olyan gyomirtószer-készítmények, amelyeket a széleslevelű haszonnövények közötti nem kívánt fűfélék irtására használnak (lásd 24 61 027. számú német szövetségi köztársasági nyilvánosságrahozatali irat). Τθ
Megállapítottuk, hogy az (I) általános képletű vegyületeket tartalmazó gyomirtószerek hatásosak; a képletben
R1 jelentése adott esetben 1—4 szénatomos alkilcsoporttal vagy 1—4 szénatomos alkoxi- 15 csoporttal monoszubsztituált, gyűrűtagként egy oxigén- vagy kénatomot vagy egy szulfinil- vagy szulfonilcsoportot tartalmazó, 6tagú, telített heteroatomos gyűrű, vagy tetrahidrofurilcsoport vagy adott esetben 1—4 20 szénatomos alkilcsoporttal monoszubsztituált piridilcsoport vagy adott esetben legfeljebb 3 metilcsoporttal szubsztituált 5 — 12 szénatomos cikloalkilcsoport, amelyben adott esetben legfeljebb egy kettőskötés van, 25 vagy 7—12 tagú biciklusos gyűrű, amelyben adott esetben legfeljebb 2 kettőskötés és adott esetben 2 oxigénatom van, vagy egy halogénatommal, két 1—4 szénatomos alkilvagy alkoxicsoporttal szubsztituált fenilcso- 30 port vagy B-Y-C- általános képletű csoport, a képletben B (1-4 szénatomos alkoxi)-(l-4 szénatomos alkil)-csoportot vagy benzilcsoportot, Y oxigén- vagy kénatomot és C legfeljebb 4 szénatomos alkilénláncot 35 jelent, azzal a megszorítással, hogy ha R1 szubsztituált fenilcsoportot jelent, úgy A nem jelenthet alkil-szulfonil-, alkanoil-, fenoxi-acetil-, alkil- vagy benzilcsoportot,
X jelentése hidrogénatom vagy metoxi-karbo- 40 nil-c söpört,
R2 jelentése legfeljebb 4 szénatomos alkilcsoport,
R3 jelentése legfeljebb 3 szénatomos alkilcsoport, adott esetben halogénatommal mo 45 noszubsztituált, 3—4 szénatomos alkenil csoport, vagy propargilcsoport, és
A jelentése DE általános képletű csoport, a képletben D metilén-, karbonil- vagy szulfonilcsoportot jelent, és ha D metiléncso- 50 port, E fenilcsoport, ha D szulfonil-csoport,
E 1—6 szénatomos alkilcsoport, ha D karbonilcsoport, E legfeljebb 20 szénatomos alkenil- vagy alkilcsoportot, adott esetben metilcsoporttal monoszubsztituált legfeljebb 55 6 szénatomos cikloalkilcsoportot, sztirilcsoportot vagy adott esetben halogén atommal, 1-4 szénatomos alkil-, 1-4 szénatomos alkoxi- és nitrocsoporttal legfeljebb háromszor szubsztituált fenilcsoportot, ben- 60 zilcsoportot, adott esetben halogénatommal vagy métoxicsoporttal monoszubsztituált alfa-metil-benzil- vagy alfa, alfa-dimetil-benzilcsoportot, legfeljebb 3 szénatomos alkilcsoportot, vagy (1-4 szénatomos alkoxi)-kar- 65 o
bonil-(l—4 szénatomos alkil)-csoportot jelent, továbbá adott esetben a fenoxicsoportban halogénatommal és 1—4 szénatomos alkilcsoporttal legfeljebb háromszor szubsztituált olyan fenoxi-alkilén-csoportot jelent, amelyben az alkilénlánc legfeljebb 5 szénatomos, és adott esetben elágazó szénláncú, továbbá adott esetben 1—4 szénatomos alkilcsoporttal legfeljebb diszubsztituált furilvagy izoxazolü-csoport vagy halogénatommal monoszubsztituált piridil-csoport vagy tienil-(l—4 szénatomos alkil)-csoport, vagy
A (a) általános képletű csoportot jelent, a képletben R4 jelentése trifluor-metil-csoporttal szubsztituált fenil-csoport, vagy
A (b) általános képletű csoportot jelent, a képletben R*, R9, és R’0 egymástól függetlenül alkil- vagy fenilcsoportokat jelentenek, vagy
A (c) általános képletű csoportot jelent, a képletben az Y-ok egymástól függetlenül oxigénvagy kénatomot jelentenek, valamint R1' és R12 1—4 szénatomos alkilcsoportokat jelentenek, vagy
A (d) általános képletű csoportot jelent, amelyben R1 tetrahidro-pirán-3-il-csoport, X legfeljebb 4 szénatomos alkilcsoport, R3 legfeljebb 3 szénatomos alkilcsoport és G feniléncsoport vagy legfeljebb 6 szénatomos alkiléncsoport.
Ezek a gyom irtószer-készítmények a gyomnövények fajtájától és a haszonnövények tűrőképességétől függően vagy szelektív herbicidek, vagy pedig a nem kívánt vegetáció irtására és korlátozására szolgálnak, beleértve a haszonnövények vegetatív és generatív részeinek növekedésgátlását.
Előnyösek azok az (I) általános képletű ciklohexenol-származékok, amelyek képletben R* hattagú heteroatomos gyűrűt jelent, például a tetrahidro-piranil-, tetrahidro-tiopiranil-, 1-oxo-tetrahidro-tiopiranil , 1,1-dioxo-tetrahidro-tiopiranilcsoport, és különösen a tetrahidro-pirán-3-il-, tetrahidro-tiopirán-3-il-, l-xo-tetrahidro-tiopirán-3-il- és az 1,1-dioxo-tetrahidro-t iopirán-3 -ilcsoport.
Előnyösek továbbá azok az (I) általános képletű ciklohexenol származékok, amelyek képletében X hidrogénatomot jelent.
Az (I) általános képletű ciklohexenol-származékokat előállíthatjuk (II) általános képletű vegyületeknek - a képletben R1, R2 , R3 és X jelentése azonos az (I) általános képletben megadott jelentésével - A-Z általános képletű vegyületekkel való reakciójával, a képletben A a fenti jelentésű és Z halogénatomot jelent. A reakciót bázis jelenlétében, közömbös oldószerben hajtjuk végre, — 5 °C-tól a reakcióelegy forráspontjáig terjedő hőmérsékleten. A reakcióelegyhez a bázist adott esetben vizes oldata formájában is hozzáadhatjuk. Az elegyedéstől függően a reakciót homogén fázisban vagy két fázisú rendszerben hajtjuk végre. Az utóbbi esetben a reakció gyorsítására a reakcióelegyhez fázistranszfer katalizátorokat, így ammónium és foszfóniunrsókat adhatunk.
Ezenkívül a reakció gyorsítására azolvegyületeket is használhatunk, így imidazolt, pirazolt, píridint valamint származékaikat, például 4-piperidino-piridint vagy a 4-(dimetil-amino)-piridint.
192 464
Megfelelő oldószerek a dimetil-szulfoxid, dimetilformamid, benzol, toluol, adott esetben klórozott szénhidrogének, így kloroform, diklór-metán, diklóretán, hexán, ciklohexán, a ketonok, így az aceton, a butanon, észterek, így az etil-acetát, az éterek, így a 5 dietil-éter, dioxán, tetrahidrofurán.
Megfelelő bázisok például az alkálifémek vagy az alkáliföldfémek, különösen a nátrium, kálium, magnézium és a kálcium karbonátjai, hidrogén-karbonátjai, acetátjai, alkoholátjai, hidroxidjai vagy oxidjai. W
Ezenkívül szerves bázisokat is használhatunk, így a piridint, vagy tercier aminokat.
A találmány szerinti vegyületek előállításánál kiindulási vegyületekként szolgálhatnak a (II) általános képletű vegyületek sói is. A reakciót ilyen esetben a 15 fenti módon, de bázis hozzáadása nélkül hajtjuk végre.
A (II) általános képletű vegyületeket ismert eljárásokkal, az (A) reakcióvázlat szerint állíthatjuk elő.
A következő példák az (I) általános képletű új 20 ciklohexanolszármazékok előállítását szemléltetik.
Az 1H—NMR adatok δ értékekben (ppm) vannak megadva és tetrametil-szilánra, mint belső standardra vonatkoznak. Oldószerként deuterokloroform szolgált. A jeleknél használt rövidítések: s = singulett, 25 d = dublett, t = triplett, q = quartett, m = multiplett, legerősebb jel.
A példákban a tömegrészek úgy aránylanak a térfogatrészhez, mint kilogramm a literhez.
1. példa l-Benzoil-oxi-2-(N-etoxi-butirimidoil)-5-(tetrahidro-pirán-J-il}-ciklohex-l -én-3-οη
3,1 tömegrész 2-(etoxi-amino)-butilidén-5-(tetrahidro-pirán-3-il-(ciklohexán-13-dion, 1,2 tömegrész 35 trietil-amin és 0,2 tömegrész 4-(dimetil-amino)-piridin 50 térfogatrész diklór-metánnal készült oldatát 0 °C-ra hűtjük. Ehhez az oldathoz 1,4 tömegrész benzoil-kloridot csepegtetünk, 0 t és 5 °C közötti hőmérsékleten. Végül a reakcióelegyet hagyjuk szó- 40 bahőmérsékletűre melegendi, még egy óra hosszat keverjük, 10 t%-os sósavval mossuk, 5 t%-os nátriumhidroxid oldattal kétszer mossuk, vízzel mossuk, nátrium-szulfáttal szárítjuk és az oldószert lehajtjuk. A cím szerinti vegyületet olajként nyeljük (1. számú 45 hatóanyag).
1H—NMR spektruma :
0,92 (t), 3,95 (t), 7,65 (m)
2. példa 50
I-Acetoxi-2-(N-etoxi-butirimidoil)-5-(tetrahidropirán-3-il)-ciklohex-l-én-3-on
8,0 tömegrész 2-(etoxi-amino)-butilidén-5-(tetrahidro-pirán-3-il)-ciklohexán-l ,3-diont feloldunk 50 térfogatrész acetonban, és ehhez az oldathoz adjuk 55
1,1 tömegrész nátrium-hidroxidnak 5 térfogatrész vízzel készült oldatát, az elegyet fél óra hosszat keverjük, 0 t-ra hűtjük és ezen a hőmérsékleten a reakcióelegyhez csöpögtetünk 2,2 tömegrész acetil-kloridot. Végül 2 óra hosszat keverjük szobahőmérsék- 60 létén, az oldószert vákuumban lehajtjuk, a bepárlási maradékot diklór-metánban oldjuk, az oldhatatlan részt kiszűrjük, 5 t%-os nátrium-hidroxid oldattal kétszet extraháljuk, vízzel semleges kémhatásúra mossuk, magnézium-szulfáttal szárítjuk és az oldó- 65 szert vákuumban lehajtjuk. A cím szerinti vegyületet olajként nyerjük (2. számú hatóanyag).
1H—NMR spekruma:
0,95 (t), 130 (t), 2,20 (s), 4,15 (q)
3. példa l-Acetcxi-2-(N-etoxi-butirimidoil)-5-(pirid-3-il)ciklohex-1 -én-3-on
6,5 tömegrész 2-(etoxi-amino)-butiIidén-5-(pirid-3-il)-ciklohexári-l,3-dion nátriumsót diklór-metánban szuszon dalunk, és ehhez az elegyhez szobahőmérsékleten 1,6 tömegrész acetil-kloridot csepegtetünk. Még 2 óra hosszat keverjük a reakcióelegyet, majd 5 t%-os nátrium-hidroxid oldattal és vízzel mossuk, nátrium-szulfáttal szárítjuk, és az oldószert vákuumban lehajtjuk. A cím szerinti vegyületet viszkózus olajként nyerjük (3. számú hatóanyag).
’ H-NMR spektruma:
1,0 (t), 4,0 (q), 8,6 (m)
Azonos módon nyerjük a következő (I) általános képletű vegyületeket:
4. példa R1 = tetrahidro-pirán-3-il, X - H, R2 = n-propil,
R3 = etil, A = 4-metoxi-benzoil 1 H-NMR spektruma: 0,85 (t), 3,90 (s). 7,0 (d)
5. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-metil-benzoil 1 H-NMR spektruma: 0,88 (t), 1,10 (t), 8,0 (d)
6. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 4-terc. butil-benzoil 1 H-NMR spektruma: 1,40 (s), 4,0 (q),
7,50 (d)
7. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A 4-klór-benzoil ’H—NMR spektruma: 0,90 (t), 4,0 (q),
7,50 (d)
8. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 4-nitro-benzoil ' H—NMR spektruma: 3,95 (q), 8,40 (m)
9. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = butiril 1 H—NMR spektruma: 1,25 (t), 1,90 (m),
3,35 (m)
10. példa R1 = tetrahidro-pirán-3-il, X - H, R2 = n-propil,
R3 = etil, A = benzolszulfonil ’ H—NMR spektruma: 1,82 (t), 3,4 (m),
6,62 (d)
11. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = etil-szulfonil ’H-NMR spektruma: 0,92 (t), 335 (q),
4,10 (q)
12. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = metil-szulfonil ’H-NMR spektruma: 0,90 (t), 3,20 (s),
4,10 (q)
192 464
13. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = fenil-acetil ‘H-NMR spektruma: 1,60 (m), 3,75 (s),
7.30 (m) 5
14. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 - etil, A = 3,5-diklór-benzoil 1H—NMR spektruma: 0,87 (t), 7,65 (m),
7,95 (m) 10
15. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = klór-acetil 1H-NMR spektruma: 0,92 (t), 4,0 (s)
16. példa R1 = tetrahidro-pirán-3-il, X = H, R2 - 15 n-propil,
R3 = etil, A = 2,5-diklór-6-metoxi-benzoil ‘H—NMR spektruma: 0,90 (t), 1,65 (m),
7,42 (d)
17. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = 20 n-propil,
R3 = etil, A = 3,5-dimetil-benzoil ‘H-NMR spektruma: 1,10 (t), 2,38 (s),
3.30 (m)
18. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = 25 n-propil,
R3 = etil, A = pivaloil ‘H-NMR spektruma: 0,88 (t), 1,26 (s),
4,10 (q)
19. példa R‘ = tetrahidro-pirán-3-il, X = H, R2 = 30 n-propil,
R3 = etil, A = lauroil
20. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = palmitoil 35 ‘H—NMR spektruma: 1,25 (m), 2,40 (m),
4,10(q)
21. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = sztearoil 40 ‘H-NMR spektruma: 0,90 (t), 1,30 (m),
4,10 (q)
22. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 - etil, A = oleoil 45 ‘H—NMR spektruma: 0,86 (t), 1,25 (m),
5,40 (t)
23. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A - (4-metoxi-fenil)-acetil 50
24. példa R‘ - tetrahidro-pirán-3-il, X = H, R2 n-propil,
R3 = etil, A = 2-(4-metoxi-fenil)-propionil ‘H-NMR spektruma: 0,84 (t), 6,95 (m),
3,82 (s) 55
25. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-(4-klór-2-metil-fenoxi)propionil ‘H-NMR spektruma: 1,25 (t), 4,85 (q), θθ
7,15 (m)
26. példa R* = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 4-(2,4-diklór-fenoxi)-butiril
29. példa
30. példa
31. példa
32. példa
33. példa
34. példa
35. példa
36. példa
37. példa
38. példa
39. példa ‘H-NMR spektruma: 1,60 (m), 2,17 (m), 7,18 (m)
27. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-metil-2-fenil-propionil ‘H-NMR spektruma: 0,80 (t), 3,12 (m),
7,36 (m)
28. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = metoxi-acetil ‘H-NMR spektruma: 1,65 (m), 2,65 (m),
3,45 (s)
R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = acetoxi-acetil ‘H-NMR spektruma: 1,65 (m), 2,20 (s),
4,15 (q)
R‘ = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 4-metoxi-szukcinil ‘H-NMR spektruma: 1,25 (t), 2,70 (m), 3,70 (s)
R‘ = tetrahjdro-pirán-3-il, X = H, R2 = n-propil,
R = etil, A - 2,5-dimetil-3-furil-karbonil ‘H-NMR spektruma: 1,16 (t), 2,26 (s), 4,05 (q)
R‘ = tetrahidro-pirán-3-il, X =H, R2 = n-propil,
R3 = etil, A = 3,5-dimetil-4-izoxazolil-karbonil ‘H-NMR spektruma: 0,83 (t), 2,64 (s), 4,00 (q)
R‘ = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 5-izoxazolil-karbonil ‘H-NMR spektruma: 2,75 (m), 7,10 (m),
8,55 (m)
R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 - etil, A = 3-piridil-karbonil R1 - tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R - etil, A = 2-klór-3-piridil-karbonil ‘H-NMR spektruma: 0,86 (t), 7,3 (m),
8,5 (m)
R‘ - tetrahidro-pirán-3-il, X = H, R2 n-propil,
R3 = etil, A = 3,6-diklór-2-piridil-karbonil R‘ = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = tíén-2-il-acetil ‘H-NMR spektruma: 1,28 (m), 3,98 (s), 7,00 (m)
R‘ = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = cinnamoil ‘H-NMR spektruma: 3,18 (q), 6,48 (d),
7,75 (d)
R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = ciklopropil-karbonil
192 464 ’H-NMR spektruma: 1,25 (t), 2,55 (m),
4,10 (q)
40. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 1-metil-ciklopropil-karbonil ’H-NMR spektruma: 0,82 (m), 1,30 (s),
3,20 (q)
41. példa R* - tetrahidro-pirán-3-il, X = H, R2 n-propil,
R3 = etil, A = 2,2-diklór-propionil
42. példa R1 - tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = n-butil-szulfonil ’H—NMR spektruma: 1,25 (t), 3,90 (m),
4,15 (q)
43. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 3-(2-klór-4-(trifluor-metil)-fenoxi)-6 -nitro-benzoil
44. példa R* = tetrahidro-pirán-3-il, X = H, R2 = etil,
R3 = etil, A = 3-(2-klór-4-(trifluor-metil)-fenoxi)-6-nitro-benzoil
45. példa R* = tetrahidro-pirán-3-il, X = H, R2 = etil,
R3 = allil, A = 3-(2-klór-4-(trifluor-metil)-fenoxi)-6-nitro-benzoil
46. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A := 2-[4-/4-trifluor-metil)-fenoxi/-fenoxi]-propionil
47. példa R1 - tetrahidro-pirán-3-il, X = H, R2 n-propil,
R3 = etil, A = 2-[4-(4-jód-pirid-2-il-oxi)-fenoxi]-propionil
48. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-[4-/4-(trifluor-metil)-pirid-2-il-oxi/-fenoxi[-propionil
49. példa R1 - tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A - 2-[4-/4-trifluor-metil)-6-klórpirid-2-il-oxi/-fenoxi]-propionil
50. példa R’ = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 - etil, A - 2-[4-(6-klór-2-kinoxalini])oxi)-fenoxi]-propionil
51. példa R1 - tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R - etil, A - 2-[4-(6-klór-benztiazol-2-iloxi)-fenoxi]-pröpionil
52. példa R* = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 - etil, A = 2-[4-(5-klór-benzoxazol-2-il-oxi)-fenoxi]-propionil
53. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 - n-propil, A = benzoil ’H-NMR spektruma: 0,75 (t), 2,6 (m),
7,6 (m)
54. példa R’ - tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = n-propil, A = 2-metil-benzoil
55. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R'' = metil, A = benzoil ’H-NMR spektruma: 0,85 (t), 3,70 (s),
7,6 (m)
56. példa R’ = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 = propargil, A - benzoil ’H-NMR spektruma: 0,86 (t), 4,46 (d),
7,45 (m)
57. példa R' = tetrahidro-pirán-3-il, X = H, R2 = n-propil,
R3 - 3 -klór-állil, A = benzoil ’H—NMR spektruma: 1,65 (m), 4,45 (d),
8,10 (d)
IS
58. példa R1 = 2-(etil-tio)-n-propil, n-propil, R3 = etil, A = butiril | X | = H, R2 = | |
59. példa R’ = 2-(etil-tio)-n-propil, | X | = H, | R2 = |
n-propil, R3 = etil, A = acetil | |||
60. példa Rl = 2 (etil-tio)-n-propil, | X | = H, | R2 = |
propil, 3 = etil. A = metil-szulfonil n-propil,
R3 - etil, A = benzoil ’H-NMR spektruma: 0,86 (t), 4,15 (q),
5,1 (s)
61. példa R1 = 2-(etil-tio)-n-propil, X = H, R2 = nR ’H-NMR spektruma: 0,92 (t), 1,35 (d),
3,15 (s)
62. példa R* = 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = fenil-acetil ’H-NMR spektruma: 1,6 (t), 4,1 (q),
7,32 (m)
63. példa R’ - 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = 3,5-diklór-benzoil
64. példa R’ = 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = klór-acetil
65. példa R’ = 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = 2,5-diklór-6-metoxi-benzoil
66. példa R’ = 2-(etíl-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = 3,5-dimetil-benzoil
67. példa R* = 2-(etil-tio)4i-propil, X = H, R2 = n-propil,
R3 = etil, A = pivaloil
68. példa R1 = 2-(etil-tio)-n-propil, X = H, R2 = n propil,
R3 - etil, A = sztearoil
69. példa R1 = 2-(etil-tio)-n-propil, X = H, R2 = n propil,
R3 = etil, A = oleoil
70. példa R’ = 2-(etil-tio)-n-propil, X = H, R2 = n propil,
R3 = etil, A = (4-metoxi-fenil)-acetil
71. példa R’ = 2-(etiI-tio)-n-propiI, X = H, R2 = n propil,
R3 = etil, A = 2-(4-metoxi-fenil)-propionil ’H-NMR spektruma: 1,27 (m), 3,82 (s),
6.9 (d)
72. példa R’ - 2-(etil-tio)-n-propil, X = H, R2 = n propil,
-5192 464
R3 = etil, A = 2-(4-klór-2-metil-fenoxi>propionil *H-NMR spektruma: 0,87 (t), 2,55 (m),
7,1 (m)
73. példa R1 = 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = 4-(2,4-diklór-fenoxi)-butiril 1 H-NMR spektruma: 0,85 (t), 4,05 (m),
7,16 (m)
74. példa R1 = 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = 2-metil-2-fenil-propionil 1 H-NMR spektruma: 0,85 (t), 1,64 (s),
7,35 (m)
R1 3 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 = etil, A = metoxi-acetil R1 - 2-(etil-tio)-n-propil, X 3 H, R2 =
75. példa
76. példa
77. példa
78. példa
79. példa n-propil,
R3 3 etil, A 3 acetoxi-acetil R1 - 2-{etil-tio)-n-propil, X = H, R2 n-propil
R3 3 etil, A 3 4-metoxi-szukcinil R1 3 2-(etil-tio)-n-propil, X - H, R2 = n-propil,
R3 3 etil, A = 2,5-dimetil-3-furil-karbonil R1 3 2-(etil-tio)-n-propil, X = H, R2 3 n-propil,
R3 = etil, A = 3,5-dimetil-izoxazol-4-il-karbonil 30 1 H-NMR spektruma: 2,45 (s), 2,6 (s),
4,02 (q)
R1 = 2-(etil-tio)-n-propil, X 3 H, R2 3 n-propil,
R3 3 etil, A 3 5-izoxazolil-karbonil R1 = 2-(etil-tio)-n-propil, X 3 H, R2 3 n-propil,
R3 3 etil, A 3 3-piridil-karbonil Rl 3 2-(etil-tio)-n-propil, X = H, R2 3
80. példa
81. példa
82. példa
83. példa
84. példa
85. példa
86. példa
87. példa
88. példa
89. példa
90. példa
2-(etil-tio)-n-propil, X 3 H, R2 = n-propil,
R3 3 etil, A 3 palmitoil
102. példa R1 3 2Xetil-tio)-n-propil, X 3 H, R2 3 n-propil,
R3 3 etil, A 3 2,4-fenoxi-acetil
103. példa R1 3 2-(etil-tio)-n-propil, X = H, R2 n-propil,
R - etil, A 3 butil-dimetil-szilil
104. példa R1 3 2-(etil-tio)-n-propil, X 3 H, R2 3 n-propil,
R3 3 etil, A 3 0,0-dietil-tiofoszforil ’H—NMR spektruma: 0,90 (t), 2,50 (m) . .. zv ..x R1 3 tetrahidro-tiopiran-3-il, X = H, R2 n-propil,
R3 3 etil, A 3 ciklopropil-karbonil R1 3 2-(etil-tio)-n-propil, X 3 H, R2 3 H,
R3 3 etil,
A 3 (l-metil)-ciklopropil-karbonil R1 3 2-(etil-tio)-n-propil, X 3 H, R2 3 H,
R3 '-etil,
A 3 2,2-diklór-propionil ......,.. . v.-----,
R* 3 2-(etil-tio)-n-propil, X 3 H, R2 = Η, θθ 108 példa R1 3 tetrahidro-tiopírán-3-il, X 3 H, R R3 3 etil, n-propil,
A 3 n-butil-szulfonil R3 - etil, A 3 4-klór-benzoil
R1 3 2-(etil-tio)-n-propil, X 3 H, R2 3 H, 109 példa R* 3 tétrahidro-tiopirán-3-il, X 3 H, R2 n-propil,
R3 3 etil, A 3 2-klór-3-piridil-karbonil R1 3 2-(etil-tio)-n-propil, X 3 H, R2 3 n-propil,
R3 3 etil, A = 3,6-diklór-2-piridil-karbonil R1 3 2-(etil-tio)-n-propil, X = H, R2 3 n-propil,
R3 3 etil, A 3 (2-tienil)-acetil
R1 3 2-(etil-tio)-n-propil, X = H, R2 3 n-propil,
R3 3 etil, A 3 pivaloil R1 3 2-(etil-tio)-n-propil, X
R3 3 etil,
A - 3-/2-klór-4-(trifluor-metil)-fenoxi|-6- θθ -nitro-benzoil
91. példa R1 = 2-(etil-tio)-n-propíl, X 3 H, R2 3 etil, R3 3 etil, A 3 3-/2-klór-4-(trifluor-metil)-fenoxi/-6-nitro-benzoil
92. példa R1 3 2-(etil-tio)-n-propil, X 3 H, R2 = etil, R3 3 allil, A 3 3-/2-klór-4-(trifluor-metil)-fenoxi/-6-nitro-benzoil
93. példa R1 3 2-(etil-tio)-n-propil, X 3 H, R2 n-propil,
R3 3 etil, A 3 2-[4-/4-(trifluor-metil)-fenoxi/-fenoxi]-propionil
94. példa R1 3 2-(etil-tio)-n-propil, X 3 H, R2 n-propil,
R3 3 etil, A 3 2[4-/4-jód-pirid-2-il-oxi)-fenoxi]-propionil
95. példa R* 3 2-(etil-tio)-n-propil, X = H, R2 3 n-propil,
R3 3 etil, A 3 2-[4-/4-(trifluor-metil)-pirid2-il-oxi/-fenoxi]-propionil
96. példa R1 3 2-(etíI-tío)-n-propil, X 3 H, R2 = n-propil,
R3 3 etil, A 3 2-[4-/4-trifluor-metil-6-klórpirid-2-il-oxi/-fenoxi]-propionil példa R1 3 2-(etil-tio)-n-propÜ, X = H, Rz 3 n-propil,
R3 3 etil, A 3 2-[4-/6-klór-2-kinoxaliniloxi/-fenoxi] -prop ion il példa R1 3 2-(etil-tio)-n-propil, X = H, R2 = n-propil,
R3 3 etil, A 3 2-(4-/6-klór-benztiazol-2-iloxi/-fenoxi]-propionil példa R1 3 2-(etil-tio)-n-propil, X 3 H, R2 3 n-propil,
R3 3 etil, A 3 2-[4-/5-klór-benzoxazol-2-iloxi/-fenoxi]-propionil
100. példa R1 3 2-(etil-tio)-n-propil, X 3 H, R2 3 n-propil,
R3 = etil, A 3 lauroil
101. példa R1
R2 3 | 105. | példa | |
= H, | 106. | példa | |
55 | |||
= H, | 107 | példa | |
= H, | 60 | 108 | példa |
3 H, | 109 | példa |
n-propil,
R3 3 etil, A 3 4-metoxi-benzoil n-propil R3 - ,:l n-propil,
R 3 etil, A 3 4-(t-butil)-benzoil etil, A 3 2-metil-benzoil n-propil,
R3 3 etil, A 3 benzoil
-6110. példa
111. példa
112. példa
113. példa
114. példa
115. példa
116. példa
117. példa
118. példa
119. példa
120. példa
121. példa
122. példa
123. példa
124. példa
125. példa
126. példa
127. példa
128. példa
129. példa
192 464 ‘H-NMR spektruma: 0,95 (t), 3,95 (q),
7,60 (m) 130. példa
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R = etil, A = butiril 5 131. példa
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = fenil-szulfonil 132. példa
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil, 1 θ
R3 = etil, A = benzoil 133. példa
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = metil-szulfonil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 15 134. példa n-propil,
R3 = etil, A = fenil-acetil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 135. példa n-propil,
R3 = etil, A = 3,5-diklór-benzoil 20
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 136. példa n-propil,
R® = etil, A = klór-acetil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 137. példa n-propil, 25
R3 - etil, A = 2,5-diklór-6-metoxi-benzoil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 138. példa n-propil,
R® = etil, A = 3,5-dimetil-benzoil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 30 139. példa n-propil,
R® = etil, A = pivaloil
R1 - tetrahidro-tiopirán-3-il, X = H, R2 = 140. példa n-propil,
R® = etil, A = lauroil 35
R* = tetrahidro-tiopirán-3-il, X = H, R2 = 141. példa n-propil,
R® = etil, A = palmitoil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 142. példa etil, 40
R3 - etil, A = sztearoil
Ή-NMR spektruma: 1,25 (s), 2,40 (t), 143. példa
4,10 (q)
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil, 45 144. példa
R® = etil, A = oleoil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = (4-metoxi-fenil)-acetil 145. példa
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 50 n-propil,
R3 = etil, A = 2-(4-metoxi-fenlil)-propionil 146. példa
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil, 55
R® = etil, A = 2-(4-klór-2-metil-fenoxi)propionil 147. példa
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 4-(2,4-diklór-fenoxi)-butiril 60 R1 = tetrahidro-tiopírán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-metil-2-fenil-propionil 148. példa R1 = tetrahidro-tiopirán-3-il, X - H, R2 = n-propil, 65
R3 = etil, A = metoxi-acetil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = acetoxi-acetil
R* = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = 4-metoxi-szukcinil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = 2,5-dimetil-3-furil-karbonil R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 3,5-dimetil-4-izoxazolilkarbonil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = 5-izoxazolil-karbonil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = 3-piridil-karbonil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = 2-klór-3-piridil-karbonil R* = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = 3,6-diklór-2-piridil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = (2-tienil)-acetil
Rl = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = pivaloil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = ciklopropil-karbonil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A - 1-metil-ciklopropil-karbonil R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = 2,2-diklór-propionil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R® = etil, A = n-butil-szulfonil
R1 = tetrahidro-tiopirán-3-il, X = H. R2 = n-propil,
R® = etil, A = 3-[2-klór-4-(trifluor-metil)fenoxi]-6-nitro-benzoil
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = etil,
R3 = etil, A = 3-{2-klór-4-(trifluor-metil)fenoxi]-6-nitro-benzoil R1 = tetrahidro-tiopirán-3-il, X = H, R2 etil,
R3 = allil, A = 3-[2-klór-4-(trifluor-metil)- fenoxi]-6-nitro-benzoil R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R = etil, A = 2-[4-/4-(trifluor-metil)-fenoxi/-fenoxi]-propionil 1 H—NMR spektruma: 1,30 (t), 4,15 (q), 7,58 (t)
R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-[4-(4-jód-pirid-2-il-oxi)-renoxi]-propionil
-71 192 464
149. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 167. példa n-propil,
R3 = etil, A = 2-[4-/4-(trifluor-metil)-pirid-2-il-oxi/-fenoxi]-propionil 168. példa
150. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 5 n-propil,
R3 = etil, A = 2-[4-/4-(trifluor-metil)-6- 169. példa klór-pirid-2-il-oxi/-fenoxi]-propionil
151. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil, 10
R3 = etil, A = 2-[4-(6-klór-2-kinoxalinil)-oxi)-fenoxi]-propionil 170. példa
152. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-[4-(6-klór-benztiazol-2- 15 -il-oxi)-fenoxi]-propionil 171. példa
153. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 2-[4-(6-klór-benzoxazol-2-il-oxi)-fenoxi]-propionil 20 172. példa
154. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = n-propil, A = benzoil
155. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 173. példa n-propil, 25
R3 = n-propil, A = 2-metil-benzoil
156. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 174. példa n-propil,
R3 = metil, A = benzoil
157. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 30 175. példa n-propil,
R3 = propargil, A = benzoil
158. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = 176. példa n-propil,
R3 = 3-klór-allil, A = benzoil 35
159. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = 3,7-diklór-kinolino-8-il 177. példa
160. példa R1 = pirid-3-il, X = H, R2 = etil, R3 = etil,
A = pivaloil 40 1 HNMR spektruma: 1,26 (s), 2,45 (m),
7.61 (d) 178. példa
161. példa R1 = pirid-3-il, X = H, R2 = n-propil, R3 = etil,
A = benzoil 45 1 H-NMR spektruma: 1,40 (m), 7.60 (m), 179. példa
8.62 (m)
162. példa R1 = pirid-3-il, X = H, R2 = n-propil, R3 = etil,
A = oleil 5θ 180. példa
163. példa R1 = pirid-3-il, X - H, R2 = n-propil, R3 = etil,
A = palmitoil *H-NMR spektruma: 1,25 (s), 4,10(q),
8,60 (m) 55 18·. példa
164. példa R1 = pírid-3-il, X = H, R2 = n-propil, R3 = etil,
A = 2-metil-2-fenil-propionil
165. példa R1 = ptrid-3-il, X = H, R2 = n-propil, R3 - 182. példa etil, θθ
A = 3,5-dimetil-benzoil
166. példa R* = pirid-3-il, X = H, R2 = etil, R3 =
R1 = pirid-3-il, X = H, R2 = etil, R3 = etil,
A = 4-(2,4-diklór-fenoxi)-butiril
R* = pirid-3-il, X = H, R2 = etil, R3 = etil,
A = 2-(2-metil-4-klór-fenoxi)-propionil R1 = pirid-3-il, X = H, R2 = metil, R3 = etil,
A = benzoil 1H—NMR spektruma: 1,40 (m), 7,60 (m), 8,62 (m)
R1 = pirid-3-il, X = H, R2 = etil, R3 = etil,
A = 3-{2-klór-4-(trifluor-metil)-fenoxi]-6nitro-benzoil
R’ = pirid-3-il, X = H, R2 = n-propil, R3 = etil,
A = 3-(2-klór-4-(trifluor-metil)-fenoxi]-6nitro-benzoil
R1 = pirid-3-il, X = H, R2 = n-propil, R3 = etil,
A = 2-[4-/4-(trifluor-metil)-fenoxi/-fenoxi]-propionil
R1 - pirid-3 -il, X = H, R2 = n-propil, R3 = etil,
A = t-butil-dimetil-szilil
R1 = pirid-3-il, X = H, R2 = etil, R3 = etil,
A = feníl-dimetíl-szilil
R* = pirid-3-il, X = H, R2 = etil, R3 = etil,
A = 0,0-dietil-tiofoszforil
R1 = pirid-3 -il, X = H, R2 = n-propil, R3 = etil,
A = 2-metil-benzoil ’HNMR spektruma: 2,60 (s), 7,4 (m), 8,65 (m)
R1 = 4a,7,8,8a-tetrahidro-2H, 5H-pirano(4,3-b)-pirán-3-iI, X = H, R2 = n-propil, R3 = etil,
A = benzoil
R1 = 4a,7,8,8a-tetrahidro-2H,5H-pirano(4,3-b)-pirán-3-il, X = H, R2 = n-propil, R3 = etil,
A = 2-metil-benzoil
R1 = 4a,7,8,8a-tetrahidro-2H,5H-pirano(4,3-b)-pirán-3-il, X = H, R2 = n-propil, R3 = etil,
A = sztearil
R1 = 4a,7,8,8a-tetrahidro-2H,5H-pirano(4,3b) pirán-3-il, X = H, R2 = n-propil, R3 = etil,
A = 3-/2-klór-4-(trifluor-metil)-fenoxi/-6nitro-benzoil
R1 = 4a,7,8,8a-tetrahidro-2H,5H-pirano(4,3-b) pirán-3-il, X - H, R2 = n-propil, R3 = etil,
A - acetil
R1 = 3,4,4a,7,8,8a-hexahidro-2H,5H-pirano-/'4,3 b/ pirán-3-il, X - H, R2 = n-propil, R3 = etil,
A = benzoil
R1 = ciklohexén-4-il, X - H, R2 = n-propil, R3 = etil, A = benzoil
183. péld:
etil,
A = 3,5-dimetil-benzoil
-8184. példa
185. példa
186. példa
187. példa
188. példa
189. példa
190. példa
191. példa
192. példa
193. példa
194. példa
195. példa
196. példa
197. példa
198. példa
199. példa
200. példa
201. példa
192 464
R1 = 4-metil-ciklohex-l-én-5-il, X = H, R2 202, = n-propil, R3 = etil, A = benzoil ’H-NMR spektruma: 0,85 (t), 5,62 (s),
8,18 (d) 203
R1 = 2-metil-l-ciklohexenil, X = H, R2 = ® etil,
R3 = etil, A = benzoil
R1 = 2,6,6-trimetil-l -ciklohexenil, X = H, 204
R2 = π-propil, R3 = etil, A = benzoil ’H-NMR spektruma: 0,85 (t), 1,75 (s), 10 8.05 (d)
R1 = 2,6,6-trimetil-l -ciklohexenil, X = H, 205
R2 = n-propil, R3 = allii, A - benzoil ’H—NMR spektruma: 1,05 (s), 4,50 (d),
7,6 (d) 15
R* - ciklododeka-4,8-dienil, X = H, R2 n-propil, 206
R3 - allii, A = benzoil R’ = ciklododeka4,8-dienil, X = H, R2 = etil, 20
R3 = etil, A = benzoil 1H -NMR spektruma: 1,05 (t), 5,30 (m), 207
7,50 (m)
R1 = ciklohexil, X = H, R2 = n-propil, R3 = etil, 25 példa példa példa példa példa példa
A - benzoil ’H—NMR spektruma: 1,10 (t), 1,75 (m), 7,50 (m)
R1 - 4-metil-ciklohex-3-enil, X - H, R2 = n-propil,
R3 = etil, A = benzoil ’H-NMR spektruma: 0,85 (t), 1,65 (s),
5,35 (s)
R1 = 4-metil-ciklohex-3-enil, X = H, R2 = n-propil,
R3 - allii, A = benzoil
R1 - 4-metil-ciklohex-3-enil, X = H, R2 = n-propil,
R3 = 3 -klőr-allil, A - benzoil
208. példa
209. példa
210. példa
211. példa
212. pé da
213 példa 214. példa
R1 - 4-metil-ciklohex-3-enil, X = H, R2 n-propil,
R3 = etil, A = 2-metil-benzoil 1 H—NMR spektruma: 1,10 (t), 2,60 (t), 5,35 (s)
R* = 2,6,6-trimetil-biciklo-(3.1.1) heptán-3-fl, X = H, R2 = n-propil, R3 = etil,
A - benzoil ’H—NMR spektruma: 1,38 (q), 3,98 (q),
7,46 (m)
R1 - 2-metoxi-tetrahidro-pirán-5-il, X - H, 50 215. példa
R2 = n-propil, R3 - etil, A = benzoil
R1 = 2-metoxi-tetrahidro-pirán-5-il, X = H,
R2 = n-propil, R3 = allii, A - benzoil R* = 4-metil-tetrahidro-pirán-3-il, X = H,
R2 = n-propil, R3 = etil, A = benzoil 55 216. példa
R’ - 4-metil-tetrahidro-pirán-3-il, X - H,
R2 = n-propil, R3 = etil, A = 2-[4-/4-(trifluor-metil)-fenoxi,l-fenoxi|-propionil '226. példa
R1 - 4-metil-tetrahidro-pirán-3-il, X = H,
R2 = n-propil, R3 - etil, A - 2-[4-/4-jód-pi- 60 227. példa rid-2-il-oxi/-fenoxi]-propionil
R1 = tetrahidro-furán-3-il, X = H, R2 = 228. példa n-propil,
R3 = etil, A - benzoil
R1 = 5,6-dihidro-2H-pirán-3-il, X = H, R2 = n-propil,
R3 = etil, A = benzoil
R1 = 2-metoxi-tetrahidro-pirán-6-il, X = H, R2 = n-propil, R3 = etil, A = benzoil ’H—NMR spektruma: 1,05 (t), 3,32 (s), 4,70 (s)
R’ = tetrahidro-pirán-3-il, X = COOCH3, R2 = n-propil, R3 = etil, A = benzoil ’H—NMR spektruma:0,88 (t), 3,75 (m),
7,45 (t)
R’ = 2-metil-pirid-6-il, X = H, R2 = n-propil,
R3 = etil, A = benzoil ’H—NMR spektruma: 1,08 (t), 2,55 (s), 8,05 (d)
R1 = pirid-4-il, X = H, R2 = n-propil, R3 = etil,
A = benzoil ’ H-NMR spektruma: 3,60 (m), 4,0 (q),
7,28 (m)
R’ = l-oxo-tetrahidro-tiopirán-3-il, X = H, R2 = etil, R3 = etil, A = benzoil * H—NMR spektruma: 1,85 (m), 3,45 (m), 4,00 (q)
R1 = l-oxo-tetrahidro-tiopirán-3-il,X = H, R2 = n-propil, R3 = etil, A = benzoil R* - 1,1 -dioxo-tetrahidro-tiopirán-3-il, X = H, R2 - n-propil, R3 = etil, A = benzoil R’ - 1,1 -dioxo-tetrahidro-tiopirán-3-il, X = H, R2 = etil, R3 = etil, A - benzoil ’H—NMR spektruma: 1,05 (t), 4,0 (q), 8,0 (d)
R1 - 1 (benzil-oxi)-etil, X - H, R2 = n-propil,
R3 = etil, A = benzoil 1 H-NMR spektruma: 0,90 (t), 3,55 (m),
7,35 (s)
R’ = l-[2-(n-butoxi)-etoxi]-etil, X = H, R2 = n-propil, R3 = etil, A = benzoil ’H-NMR spektruma: 3,60 (m), 4,0 (q),
7,60 (m)
R1 = 2-[2-(n-butoxi)-etoxi]-etil, X = H, R2 - n-propil, R3 = etil, A = benzoil R1 = 4-fluor-fenil, X = H, R2 = n-butil, R3 = etil,
A = benzoil ’H—NMR spektruma: 1,35 (m), 4,0 (q), 7,05 (t)
R’ = 3-metil-4-metoxi-fenil, X = H, R2 = n-propil,
R3 = etil, A = benzoil ’ H-NMR spektruma: 2,14 (s), 3,88 (s),
8,10 (m)
R1 = 3-metil-fenil, X = H, R2 = etil, R3 = etil,
A = benzoil
R1 = 2-izopropil-(l,3-dioxepán)-5-il, X = H, R2 = n-propil, R3 = etil, A = benzoil, R’ = 2-izopropil-(l,3-dioxepán)-5-il, X = H, R2 = etil, R3 = etil, A = benzoil R’ - tetrahídro-pirán-3-il, X = H, R2 = n-propil, R3 - etil, A - 2-(4-klór-fenil)-2metil-propionil
-91 192 464 2 ‘H—NMR spektruma: 1,61 (s), 4,08 (q),
7,31 (m)
229. példa R1 = tetrahidro-pirán-3-ü, X - H, R2 = η-propil, R3 = etil, A = 2-metü-fur-3-ükarbonil 1 H-NMR spektruma: 2,60 (s), 3,23 (q),
6.65 (s)
230. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil, R3 = etil, A = 2-(2,4,5-triklórfenoxi)-propionil ’H-NMR spektruma: 4,85 (m), 7,01 (s), 7,52 (s)
231. példa Rl = 4-metil-ciklohex-l-én-5-il, X = R2 = n-propil, R3 = allil, A = benzoil ’H-NMR spektruma: 0,85 (t), 4,45 (d),
5,60 (s)
232. példa R* = 4-metil-ciklohex-l-én-5-il, X - H, R2 = n-propil, R3 = etil, A = metil-szulfonil ’H-NMR spektruma: 1,30 (t), 3,25 (s),
6,67 (s)
233. példa R’ - 4-metil-ciklohex-l-én-5-il, X = H, R2 = etil, R3 = etil, A = benzoil ’H—NMR spektruma: 1,10 (t), 7,50 (m),
8,05 (d)
234. példa R’ = 4-metil-ciklohex-l-én-5-il, X = H, R2 = etil, R3 = etil, A = metil-szulfonil ’H-NMR spektruma: 1,25 (t), 3,2 (s),
5.65 (s)
235. példa R1 = 4-metil-ciklohex-l-én-5-il, X = H, R2 = etil, R3 = allil, A = benzoil
236. példa R* - 2-(etil-tio)-n-propil, X = H, R2 n-propil, R3 = etil, A = 2-(2,4,5-triklórfenoxi)-propionil ’H-NMR spektruma: 4,10 (q), 7,00 (s), 7,52 (s)
237. példa R’ = 2-(etil-tio)-n-propil, X = H, R2 = n-propil, R3 = etil, A = 2-(3-bróm-fenoxi)-propionil ’H-NMR spektruma: 4,05 (q), 4,81 (q),
7,10 (m)
238. példa R’ = 2-(etil-tio)-n-propü, X = H, R2 = n-propil, R3 - etil, A = 2-(4-bróm-fenil)-propionil ’H-NMR spektruma: 2,5 (m), 7,26 (m),
7,46 (m)
239. példa R’ = 2-(etil-tio)-n-propil, X = H, R2 = n-propil, R3 = etil, A = 2-(4-fluor-fenil)propionil ’H-NMR spektruma: 1,55 (d),4,05 (m), 7,04 (m)
240. példa R* = 5,6-dihidro-2H-l-oxo-tiopirán-3-il,
X - H, R2 - n-propil, R3 = 3-klór-allil, A benzoil ’ H—NMR spektruma: 0,85 (t), 3,60 (m),
7,55 (m)
241. példa R1 - 2-(etil-tio)-n-propil, X = H, R2 n-propil, R3 = etil, A = 0,0-dietil-foszforíl ’H-NMR spektruma: 0,95 (t), 2,58 (q),
4,2 (m)
242. példa R1 = 2-(etil-tio)-n-propil, X = H, R2 = n-propil, R3 = etil, A = n-butil-dimetil-szilil ’H-NMR spektruma: 0,08 (s), 1,3 (m),
2,9 (m)
243. példa R1 = 2-(etü-tio)-n-propü, X = H, R2 = n-propil, R3 = etil, A = fenil-dimetil-szilil ‘H-NMR spektruma: 0,35 (s), 1,0 (t), 7,4 (m)
244. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil, R3 = etil, A = 0,0-dietil-tiofoszforil ’H—NMR spektruma: 0,90 (t), 1,40 (t),
4.10 (q)
245. példa R’ - tetrahidro-pirán-3-il, X = H, R2 n-propil, R3 = etil, A = 0,0-dietil-foszforil ‘H—NMR spektruma: 0,95 (t), 1,38 (t),
4,2 (m)
246. példa R1 = tetrahidro-pirán-3-il, X = H, R2 = n-propil, R3 = etil, A = n-butil-dimetil-szilil
247. példa R* = tetrahidro-pirán-3-ü, X = H, R2 n-propfl, R3 = etil, A = fenil-dimetU-szilil ’H-NMR spektruma: 0,30 (s), 0,93 (t),
6,35 (m)
248. példa R’ = 2-(etil-tio)-n-propü, X = H, R2 = n-propil, R3 = etü
249. példa R’ = 4-metil-tetrahidro-pirán-3-il, X = H,
R2 - n-propü, R3 = 3-klór-allil, A = 0,0-di25 etü-tiofoszforil ’H-NMR spektruma: 0,92 (t), 1,37 (t),
4,7 (m)
250. példa R’ = 4-metil-tetrahidro-pirán-3-il, X = H,
R2 = n-propü, R3 = 3-klór-allil, A = 0,0-di30 etil-foszforil ’H-NMR spektruma: 0,95 (t), 1,4 (t),
6,15 (m)
251. példa R* = 4-metil-tetrahidro-pirán-3-il, X = H,
R2 - n-propil, R3 = 3-klór-allil, A = fenü35 -dimetü-szüil ’H—NMR spektruma: 0,62 (s), 5,08 (d),
7,63 (m)
252. példa R’ = 4-metil-tetrahidro-pirán-3-il, X = H,
R2 = n-propü, R3 = 3-klór-allil, A =
2-[4-/4-(tri-fluor-metil)-fenoxi/-fenoxi]-propionil ’H-NMR spektruma: 1,0 (d), 3,4 (t), 7,0 (m)
253 példa R’ = 2-(4-klór-feni]-tio)-etil, X = H, R2 = etil, R3 = etil, A = 4-klór-benzoil ’H-NMR spektruma: 1,10 (t), 1,80 (q),
2,97 (t), 7,26 (s)
254 példa R’ = tetrahidro-pirán-3-il, X = H, R2 = n-propü, R3 - etil, A - benzoil ’H—NMR spektruma: 0,90 (t), 1,30 (m),
5.10 (s), 7,35 (m)
255. példa R’ - 5,6-dihidro-2H-l ,l-dioxo-tiopirán-3-il, X = H, R2 = n-propil, R3 - 3-klór-allil, A = benzoil 1 H-NMR spektruma: 0,88 (t), 3,60 (m),
7,55 (ni)
256. példa R1 = piridil-3-il, X = H, R2 - n-propil, R3 = etil, A = pivaloil,
257. példa R1 = 5,6-dihidro-2H-l -oxo-tiopirán-3-il, X = R2 = n-propi), R3 = etil, A = benzoil
258. példa R1 = 4a,7,8,8a-tetrahidro-2H,5H-pirano(4,3-b)-3-il, X = H, R2 = n-propil, R3 = allil, A = benzoil
263. példa R1 = pirid-3-il, X = H, R2 = n-propil,
R3 - etil, A = 2,5-diklór-6-metoxi-benzoil
-101 192 1H-NMR spektruma: 0,90 (t), 3,90 (m),
8,60 (m)
264. példa R1 = 4-metil-ciklohex-l-én-5-il, X = H, R2 = n-propil, R3 - etil, A = benzoil 'H-NMR spektruma: 0,85 (t), 3,98 (q), 8,05 (d)
265. példa R1 = ciklododecil, X = H, R2 = n-propil,
R3 = etil, A = benzoil 1 H-NMR spektruma: 0,90 (t), 3,97 (q), 8,04 (d)
266. példa R1 = tetrahidro-fur-3-il, X = H, R2 = n-propil, R3 = etil, A = benzoil 'H-NMR spektruma: 0,85 (t), 3,85 (q),
7,50 (m)
267. példa R1 = tetrahidro-tiopirán-3-il, X = H, R2 = n-propil, R3 = etil, A = 0,0-dietil-tiofoszforil 1 H-NMR spektruma: 0,92 (t), 1,4 (m), 4,2 (m)
268. példa R1 = tetrahidro-pirán-4-il, X = H, R2 = n-propil, R3 = etil, A = benzoil
269. példa R = tetrahidro-pirán-4-il, X - H, R2 = n-propil, R3 = etil, A = palmitoil
270. példa R = tetrahidro-pirán-4-il, X = H, R2 = n-propil, R3 = etil, A = sztearoil
271. példa R = tetrahidro-pirán-4-il, X = H, R2 = n-propil, R3 = etil, A = 3-/2-klór-4-(trifluor-metil)-fenoxi/-6-nitro-benzoil
272. példa R1 = tetrahidro-pirán-4-il, X - H, R2 etil, R3 = etil, A - 3-/2-klór-4-(trifluormetil)-fenoxi/-6-nitro-benzoil
273. példa R* = tetrahidro-pirán-4-il, X - H, R2 = etil, R3 = allil, A = 372-klór-4-(trifluormetil)-fenoxi/-6-nitro-benzoil
274. példa R1 = tetrahidro-pirán-4-il, X - H, R2 = n-propil, R3 = etil, A = 2-[4-/4-(trifluormetil)-fenoxi/-fenoxi]-propionil
275. példa R1 = tetrahidro-pirán-4-il, X - H, R2 = n-propil, R3 = etil, A = 2-[4-(4-jód-pirid-2-il-oxi)-fenoxi]-propionil
276. példa R* = tetrahidro-pirán-4-il, X = H, R2 n-propil, R3 - etil, A = 2-[4-/4-(trifluormetil)-piril-2-il-oxi/-fenoxi]-propionil
277. példa R1 = tetrahidro-pirán-4-il, X = H, R2 = n-propii, R3 = etil, A = 2-[4-/4-(trifluormetil)-6-klór-pirid-2-il-oxi/fenoxi ]-p ropionil
278. példa R* = tetrahidro-pirán-4-il, X - H, R2 = n-propil, R3 = etil, A = 2-[4-(6-klór-2-kinoxalinil-oxi)-fenoxij-propionil
279. példa R1 = tetrahidro-pirán-4-il, X - H, R2 = n-propil. R3 = etil, A = 2-[4-(6-klór-benztiazol-2-il-oxi)-fenoxi]-propionll
280. példa R* - tetrahidro-pirán-4-il, X - H, R2 = n-propil, R3 = etil, A = 2-[4-(6-klór-bénzoxazol-2-il-oxi)-fenoxij-propionil
281. példa R1 = 6-metoxi-tetrahidro-pirán-2-il, X = H,
R2 - etil, R3 = etil, A = benzoil
282. példa R1 = 3,4,4a,7,8,8a-hexahidro-2H-5H-pirano(4,3-b)-pirán-3-il, X = H, R2 = n-propil, R3 = allil, A = benzoil ' H-NMR spektruma: 0,90 (t), 4,4 (d),
8,15 (d)
464 2
Azonos módon nyerjük a következő (IV) általános képletű vegyületeket:
218. példa R1 - tetrahidro-pirán-3-il, X = H, R2 = n-propil, R3 = etil, G = fenilén 1 H-NMR spektruma: 0,90 (t), 1,08 (t),
8,17 (s)
219. példa R1 - tetrahidro-piián-3-il, X = H, R2 = n-propil, R3 = etil, G = propilén 1H-NMR spektruma: 0,90 (t), 1,70 (s), 10 3,90 (m)
Az (I) általános képletű ciklohexanolszármazékokat hatóanyagként tartalmazó gyomirtószereket felhasználhatjuk például közvetlenül permetezhető oldatok, porok szuszpenziók, magas százalékos tartalmú 15 vizes, olajos vagy más szuszpenziók vagy diszperziók, emulziók, olaj diszperziók, paszták, porozószerek, szórószerek vagy granulátumok alakjában, permetezéssel, porlasztással, porozással, szórással vagy locsolással. Az alkalmazási formák teljes mértékben a fel20 használási célhoz igazodnak; minden esetben a hatóanyagok lelető legegyenletesebb eloszlatása a cél.
Közvetlenül permetezhető oldatok, emulziók, paszták vagy olajdiszperziók előállítására ásványolajfrakciókat vagy metanolt, etanolt, propanolt, buta25 nőit, kloroformot, széntetraldoridot, ciklohexanolt, ciklohexanont, klór benzolt, izoforont, erősen poláros oldószereket, így például dimetil-formamidot, dimetil-szulfoxidot, N-metil-pirrolidont, vizet használhatunk.
Vizes készítményeket emulziókoncentrátumokból, pasztákból vagy nedvesíthető porokból (permetporokból), olaj diszperziókból víz hozzáadásával készíthetünk. Emulziók, paszták vagy olajdiszperziók előállítására a hatóanyagokat magukban vagy olajban vagy oldószerben oldva nedvesítő-, tapadást elősegítő-, diszpergáló- vagy emulgeálószerekkel vízben homogenizálhatjuk. A hatóanyagokból, nedvesítő-, tapadást elősegítő-, diszpergáló- vagy emulgeálószerekből és adott esetben oldószerből vagy olajból álló kon40 centrátumok készíthetők, amelyek vízzel higíthatók. A felületaktív adalékok között megemlíthetjük a ligninszulfonsav, naftalinszulfonsav, fenolszulfonsav alkálifém-, alkáliföldfém- és ammóniumsóit, alkil-arilszulfonátokat, alkil-szulfátokat, alkil-szulfonátokat, a dibutil-naftalinszulfonsav alkálifém- és alkáliföldfémsóit, lauril-éter-szulfátot, zsíralkohol-szulfátokat, zsírsavak alkálifém- és alkáliföldfém-sóit, szulfátozott hexadekanolok, -heptadekanolok, -oktadekanolok sóit, szulfátozott zsíralkohol-glikol-éterek sóit, szulfo50 nált naftalinnak és naftalinszármazékoknak formaldehiddel képzett kondenzációs termékeit, naftalinnak illetve naftalinszulfonsavaknak fenollal és formaldehiddel alkotott kondenzációs termékeit, poli-(oxi-etilén)-oktil-feuol-étert, etoxilezett izooktil-fenolt, -ok55 til-fenolt, -ronil-fenolt, aikil-fenol-poliglikol-étereket, tributil-fenil-poliglikol-étert, alkil-aril-poliéter-alkoholokat, izotr decil-alkoholt, zsíralkohol - etilén-oxid kondenzátu nokat, etoxilezett ricinusolajat, poli-(oxietilén)-alkil-ítert, etoxilezett poli-(oxi-propilén)-t, la60 uril-alkohol-poliglikol-éter-acetált, szorbitésztert, lignint, szulfitszennylúgokat és metil-cellulózt.
Porokat, porozó- és szórószereket a hatóanyagoknak szilárd hordozóanyaggal való összekeverésével vagy összeőilésével készíthetünk.
-111
192 464
Granulátumokat, például bevont-, impregrált- és homogén granulátumokat a hatóanyagoknak szilárd hordozóanyagokon való megkötésével készíthetünk. Szilárd hordozóanyagok lehetnek például az ásványi termékek, így a szilikagél, kovasavak, kovasavgél, szilikátok, talkum, kaolin, attapulgit, mészkő, mész, kréta, bólusz, lösz, agyag, dolomit, kovaföld, kálciumés magnézium-szulfát, magnézium-oxid, őrölt műanyagok, műtrágyák, így például ammónium-szulfát, ammónium-foszfát, ammónium-nitrát, karbamid és növényi termékek, így gabonaliszt, fahéj-, fa- és csonthéjőrlemények, cellulózpor és egyéb szilárd hordozóanyagok.
A készítmények 0,1—95 tömegszázalékos, előnyösen 0,5—90 tömegszázalékos hatóanyagtartalmúak.
Példák a gyomirtószer készítményekre:
I. példa tömegrész 2. példa szerinti hatóanyagot elkeverünk 10 tömegrész N-metil-a-pirrolidonnal, és így olyan oldatot kapunk, ami vízben a legfinomabb cseppekre eloszlatva alkalmazható.
II. példa tömegrész 8. példa szerinti hatóanyagot feloldunk 80 tömegrész xilolból, 8-10 mól etilénoxidnak és 1 mól olajsav-N-monoetanolamidnak 10 tömegrésznyi reakciótermékéből, 5 súlyrész dodecilbenzolszulfonsav kálciumsóból és 40 mól etilénoxidnak és 1 mól ricinusolajnak 5 tömegrésznyi reakciótermékéből álló elegyben. A kapott oldatot 100 000 tömegrész vízbe öntve, és finoman eloszlatva 0,02 tömegszázalékos hatóanyagtartalmú vizes diszperziót kapunk.
III. példa tömegrész 5. példa szerinti hatóanyagot feloldunk 40 tömegrész ciklohexanonból, 30 tömegrész izobutanolból, 7 mól etilénoxidnak és 1 mól izooktilfenolnak 20 tömegrésznyi reakciótermékéből és 40 mól etilénoxidnak és 1 mól ricinusolajnak 10 tömegrésznyi reakciótermékéből álló elegyben. A kapott oldatot 100 000 tömegrész vízbe öntve, és finoman eloszlatva 0,02 tömegszázalékos hatóanyagtartalmú vizes diszperziót kapunk.
IV. példa tömegrész 253. példa szerinti hatóanyagot feloldaunk 25 tömegrész ciklohexanolból, 65 tömegrész 210—280 °C forráspontintervallumú ásványolaj frakcióból és 40 mól etilénoxidnak és 1 mól ricinusolajnak 10 tömegrésznyi reakciótermékéből álló elegyben. A kapott oldatot 100 000 tömegrész vízbe öntve, és finoman eloszlatva 0,02 tömegszázalékos hatóanyagtartalmú vizes diszperziót kapunk.
V. példa tömegrész 60. példa szerinti hatóanyagot, 3 tömegrész diizobutil-naftalin-a-szulfonsav nátriumsóval, 17 tömegrész szulfitszennylúgból származó ligninszulfonsav nátriumsóval és 60 tömegrész porított kovasavgéllel jól elkeverjük, és kalapácsos malomban összeőrlünk. Az elegyet 20 000 tömegrész vízben finoman eloszlatva 0,1 tömegszázalékos hatóanyagtartalmú permetlevet kapunk.
VI. példa tömegrész 109. példa szerinti hatóanyagot 97 tömegrész finomszemcsés kaolinnal elkeverünk. így 3 tömegszázalékos hatóanyagtartalmú porozószert kapunk.
Vn. példa tömegrész 252. példa szerinti hatóanyagot 92 tömegrész porított kovasavgél és 8 tömegrész parafinolaj elegyével — a paraffinolajat a kovasavgél felü5 'etére porlasztjuk — alaposan elkeverjük. így jó tapadóképességű szert kapunk.
VIII. példa tömegrész 1. példa szerinti hatóanyagot 2 tömegrész dodecil-benzolszulfonsav kálciumsóval, 8 tömegrész zsíralkohol-poliglikoléterrel, 2 tömegrész fenol-karbamid-formaldehid kondenzátum nátriumsóval és 68 tömegrész paraffmos jellegű ásványolajjal alaposan elkeverünk. így stabil olajos diszperziót kapunk.
A szerek alkalmazása történhet kikelés előtt vagy kikelés után. Ha a haszonnövények a hatóanyagokat kevéssé tűrik, akkor olyan kijuttatási technikát alkalmazhatunk, amelynél a gyomirtószert a permetezőkészülékkel úgy juttatjuk ki, hogy az lehetőség szerint az érzékeny haszonnövények leveleit ne érje, miközben a hatóanyagok az alul növekedő gyomnövények leveleire vagy a puszta talajra jutnak (post-directed, lay-by).
A felhasznált hatóanyagok mennyisége évszaktól, gyomnövénytől és a növekedési stádiumtól függően 0,025—3 kg/ha, előnyösen 0,1-1,5 kg/ha.
A találmány szerinti gyomirtószerek gyomirtóhatását az üvegházi kísérletek mutatják. (I—XVI. táblázatok).
A növények tenyészedényeként 300 cm3-es műanyag virágcserepek szolgáltak, amelyekben agyagos homok volt 1,5 t% humusszal, mint szubsztrátummal. A vizsgált növények magjait fajtánként elválasztva sekélyen elvetettük. A kikelés előtti alkalmazás35 nál a szereket közvetlenül ezután a talaj felületére juttattuk. Ehhez az 500-6000 mg nátrium-ligninszulfonáttal készült szereket vízben, mint diszperziós közegben (600 1/ha) szuszpendáltuk vagy emulgeáltuk, és egy finoman porlasztó permetezővel juttattuk ki.
A felhasznált mennyiség 3,0 kg/ha volt.
A szerek kijuttatása után a tenyészedényeket enyhén megöntöztük, hogy a csírázást és a növekedést megindítsuk. Ezután, amíg a növények fel nem nőttek, a tenyészedényeket átlátszó műanyag tetővel be45 redtük. A tenyészedények befedése a vizsgált növények egyenletes csírázását biztosította,amennyiben a hatóanyagok ezt nem befolyásolták.
A kikelés utáni kezelésnél a vizsgált növényeket jellegüktől függően csak 3—15 cm-es növekedési magasságig termesztettük, és ezután kezeltük. A szójapalántákat tőzegkorpával dúsított szubsztrátunon neveltük fel. A kikelés utáni kezelésnél vagy az elvetett és ugyanabban a tenyészedényben felnevelt növényeket választottuk ki, vagy a növényeket először csíranövényekként elválasztva külön felneveltük, és néhány nappal a kezelés előtt a kísérleti ‘enyészedénybe átültettük. A kikelés utáni kezelésnél a felhasznált mennyiségek például 0,125,0,25,0,5 és 3,0 kg hatóanyag/ha voltak. A kikelés utáni kezelésnél a tenyészedényeket nem fedtük le.
A kísérleti tenyészedényeket üvegházba állítottuk, ahol a melegkedvelő fajoknak 20—35 C-ot, a mérséklet klimájuaknak pedig 10-25 °C ol biztosítottunk. 4 kísérlet időtartama 2—4 hét volt. Ezalatt az idő alatt a növényeket gondoztuk, és az egyedi kezelcsek12
-121
192 464 re adott reakcióikat kiértékeltük. A kiértékelés egy 0—100 fok beosztású skála alapján történt, ahol a 100 azt jelenti, hogy a növény nem kelt ki illetve, hogy a növénynek legalább a talaj fölötti részei teljesen elpusztultak.
Az üvegházi kísérletekhez a következő növényfajtákat használtuk:
Alopecurus myosuroides (parlagi ecsetpázsit), Avena fatua (hélazab), Avena sativa (zab), Béta vulgáris (répa), Brassica napus (repce), Bromus spp. (rozsnok félék), Cassia spp., Digitaria sanguinalis (pirók ujjasmuhar), Echinochloa crus-galli (közönséges kakaslábfű), Eleusine indica (aszályfű), Glycine max (szójabab), Gossypium hirsutum (gyapot), Helianthus annuus (napraforgó), Hordeum vulgare (árpa), Ipomoea spp. (hajnalka félék), Lolium multiflorum (olaszperje), Setaria italica (olasz muhar), Sinapis alba (fehér mustár), Sorgum bicolor (tarka cirok), Sorgum halepense (fenyércirok), Triticum aestivum (búza), Zea mays (kukorica).
Kikelés előtti alkalmazás:
A kikelés előtti alkalmazásnál például azok a gyomirtószerek, amelyek a 39., 229., 109., 207.,
210., 55., 53., 161., 12., 2., 8., 61., 60., 160., 252.,
250., vagy 242. példa szerinti vegyületeket hatóanyagként tartalmazzák, a fűfélék családjába tartozó növényekkel szemben hatásosnak bizonyultak, míg a keresztesvirágúak (Crucifereae) családjába tartozó kétsziklevelű fehér mustár (Sinapis alba) egyáltalán nem károsodik. A 73., 230., 25. vagy a 72. példa szerinti vegyületeket hatóanyagként tartalmazó gyomirtószerek leküzdik mind a fűszerű növényeket mind pedig a széleslevelű mustárt.
Kikelés utáni alkalmazás:
Például a 28., 30., 22., 191., 79., 37., 239., 17. vagy a 228. példa szerinti vegyületeket hatóanyagként tartalmazó gyom irtószerkészítmények, 3,0 kg hatóanyagába adagolásban irtják a fűszerű növényeket. A 230., 26., 73., vagy a 72. példa szerinti vegyületeket hatóanyagként tartalmazó gyomirtószerek mind a fűszerű növényeket mind pedig a széleslevelű növényeket irtják.
A fűfélék családjába tartozó növényekkel szemben nagyon hatásosak például a 109., 207., 252., 40.,
20., 238., 71., 74., 35., 56., 186., 255., 122., 29.,
176., 33., 190., 206., 169., 7., 5., 13., 219., 254.,
9., 27.,31., 18., 32., 24., 57., 42, és a 266. példa szerinti vegyületet hatóanyagként tartalmazó gyomirtószerek 0,125 kg hatóanyag/ha adagolásban, valamint az 1., 2.,4., 5.,241.,242., 243., 245., és a 247. példa szerinti vegyületeket hatóanyagként tartalmazó gyomirtószerek 0,25 kg hatóanyag/ha adagolásban. A 253. példa szerinti vegyületet hatóanyagként tartalmazó gyomirtószerkészítmények 0,125 kg hatóanyag/ ha adagolásban szintén irtják a nem kívánt fűféle növényeket anélkül azonban, hogy a széleslevelű haszonnövényeket .károsítanák. A 161. példa szerinti vegyületet hatóanyagként tartalmazó gyomirtószerkészítmények 0,25 kg hatóanyag/ha adagolásban szelektíven irtják a nem kívánt fűféléket a búzavetésben, jóllehet a búza is a fűfélékhez tartozik. A gabonavetésben a nem kívánt füveket irtják még például a 194., 212., 233. és a 234. példa szerinti vegyületeket hatóanyagként tartalmazó gyomirtószerkészítmények.
Tekintettel a gyomirtás széles hatásspektrumára, a haszonnövények jó tűrőképességére, vagy növekedésük káros befolyásolásnak hiányára, továbbá figyelembe véve az alkalmazási módok sokféleségét, a találmány sze érinti vegyületeket még sok más haszonnövény term esztésében fel lehet használni.
Ilyen haszonnövények például a következők:
10 | Allium cepa | vöröshagyma |
Ananas comosus | ananász | |
Arachis h ypogaea | földimogyoró | |
Asparagus officinalis | spárga | |
Avena sa'iva | zab | |
15 | Béta vulgáris spp. altissima | cukorrépa |
Béta vulgáris spp. rapa | takarmányrépa | |
Béta vulgáris spp. esculenta | cékla | |
Brassica napus vaT. napus | repce | |
Brassica napus var. napobrassica | töves répa | |
20 | Brassica napus vai. rapa | fehér répa |
Brassica rapa var. silvestris | sárgarépa | |
Camellia sinensis | teacserje | |
Carthamus tinctorius | pórsáfrány | |
Carya illinoinensis | hikordiófa | |
25 | Citrus linón | citrom |
Citrus maxima | grapefruit | |
Citrus reticulata | mandarin | |
Citrus sinensis | narancs | |
Coffea arabica (Coffea canaphora, | ||
30 | Coffea Jiberica | kávé |
Cucumis meló | dinnye | |
Cucumis sat ívű s | uborka | |
Cynodcn dactylon | bermudafű | |
Daucus carota | murokrépa | |
35 | Elaeis guineensis | olajpálma |
Fragaria vesca | eper | |
Glycine max | szójabab | |
Gossypium hirsutum (Gossypium | ||
arborenm, Gossypium herbaceum, | ||
40 | Gossypium vitifolium) | gyapot |
Helian hús annuus | napraforgó | |
Helian hús tuberosus | csicsóka | |
Hevea brasiliensis | kaucsukfa | |
Hordeum vulgare | árpa | |
45 | Humu'us lupulus | komló |
Ipomoea batatas | édes burgonya | |
Juglans regia | diófa | |
Lactua sativa | fejessaláta | |
Lens culinarís | lencse | |
50 | Linum usitatissimum | kender |
Lycopersíocon lycopersicum | paradicsom | |
Malus spp. | alma | |
Manihot esculenta | manioka | |
Medicago sativa | lucerna | |
55 | Mentha piperita | borsmenta |
Musa spp. | banán | |
Nicotíana tabacum (N. rustica) | dohány | |
Olea europaea | olajfa | |
Oryza sativa | rizs | |
60 | Panicum miliaceum | köteles |
Phaseolus lunatus | holdbab, limabab | |
Phasr olus mungo | földi bab | |
Phaseolus vulgáris | bokorbab | |
Pétre selinum erispum | ||
65 | spp. tuberosum | petrezselyem |
-131
192 464
Pennisetum glaucum | négerköles |
Picea abies | vörösfenyő |
Abies alba | jegenyefenyő |
Pinus spp. | erdei fenyő |
Pisum sativum | borsó |
Prunus avium | cseresznye |
Prunus domestica | szilva |
Prunus dulcis | mandula |
Prunus persica | őszibarack |
Pyrus communis | körte |
Ribes sylvestre | vörös ribizke |
Ribes uva-crispa | egres |
Ricinus communis | ricinus |
Saccharum officinarum | cukornád |
Secale cereale | rozs |
Sesamum indicum | szezámfű |
Solanum tuberosum | burgonya |
Sorghum bicolor (s.vulgare) | cirok |
Sorghum dochna | cukorcirok |
Spinacia oleracea | paraj |
Theobroma cacao | kakaófa |
Trifolium pratense | lóhere |
Triticum aestivum | búza |
Vaccinium corymbosum | fekete áfonya |
Vaccinium vitis-idaea | vörös áfonya |
Vicia faba | lóbab |
Vigna sinensis (V. unguiculata) | tehén borsó |
Vitis vinifera | szőlő |
Zea mays | kukorica |
A hatásspektrum szélesítése céljából és szinergenus hatások elérésére a találmány szerinti új gyomirtószereket egymással vagy számos más gyomirtó- vagy növekedésszabályzó szerrel össze lehet keverni, és együtt kijuttatni. Keverékpartnerként szerepelhetnek például a diazinok, 4H-3,l-benzoxainszármazékok, benzotiadiazinonok, 2,6-dinitro-anilin-származékok, N-fenil-karbamátok, tiolkarbamátok, halogénkarbonsavak, triazinok, amidok, karbamidszármazé10 kok, difenií-éter-származékok, triazinonok, uracilszármazékok, benzofurán-származékok, kinolin-karbonsavak.
Ezen kívül hasznos a találmány szerinti gyomirtószereket magukban vagy más gyomirtószerekkel való kómbinációban még sok más növényvédőszerre! keverve együtt kijuttatni, például a kártevők vagy fitopatogén gombák illetve - baktériumok irtására szolgáló szerekkel. Érdekes továbbá az ásványi sóoldatokkal való keverhetőség, amiket a táp- és nyom20 elemek hiányának leküzdésére lehet bevezetni. A gyomirtószerekhez nem fitotoxikus olajokat és olajkoncentrátumokat is hozzáadhatunk.
I. táblázat
Gyomfűveket irtó hatás növényházban 3,0 kg/ha adaggal kikelés előtt
Hatóanyag száma | Növények kárcsodása, % | Lolium multifl. | ||
Sinapis alba (kétszikű) | Avena sativa+ | Echinochloa+ crus-galli | ||
39 | 0 | 100 | 100 | 100 |
229 | 0 | 100 | 100 | 100 |
109 | 0 | 100 | 100 | 100 |
207 | 0 | 100 | 90 | 100 |
210 | 0 | 100 | 80 | 100 |
55 | 0 | 100 | 85 | 100 |
53 | 0 | 100 | 80 | 100 |
161 | 0 | 100 | 95 | 100 |
12 | o · | 100 | 100 | 100 |
2 | 0 | 100 | 100 | 100 |
8 | 0 | 100 | 95 | 100 |
61 | 0 | 100 | 100 | 100 |
60 | 0 | 95 | 100 | 100 |
256 | 0 | 100 | 80 | 100 |
252 | 0 | 100 | 100 | 100 |
250 | 0 | 100 | 98 | 100 |
242 | 0 | 100 | 98 | 100 |
Tűfélék
-14192 464
II. táblázat
Gyomirtó hatás fűfélék és Sinapis alba ellen növényházban 3,0 kg/ha adaggal kikelés előtt
Növények károsodása %
Hatóanyag száma | Sinapis alba (kétszikű) | Avena sativa+ | Lolium multifl.'1 |
73 | 100 | 100 | 100 |
230 | 95 | 100 | 100 |
25 | 100 | 100 | 100 |
72 | 95 | 100 | 100 |
+Fűfélék
III. táblázat
Gyomfűveket itró hatás növényházban 3,0 kg/ha adaggal kikelés után
Növények | károsodása, % | ||
Hatóanyag száma | Avena sativa | Echinochloa crus-galli | Lolium multifl. |
28 | 100 | 100 | 100 |
30 | 100 | 100 | 100 |
22 | 100 | 100 | 100 |
191 | 100 | 100 | 100 |
79 | 100 | 98 | 100 |
37 | 100 | 100 | 100 |
239 | 100 | 100 | 100 |
17 | 100 | 95 | 100 |
228 | 100 | 98 | 100 |
IV. táblázat
Gyomirtó hatás növényházban 3,0 kg/ha adaggal kikelés után
Növények károsodása, %
Hatóanyag szám a | Echinochloa crus-galli | Lolium multifl. | Cassia app. | Ipomoea spp. |
230 | 100 | 100 | 100 | 100 |
26 | 95 | 100 | 95 | 95 |
73 | 95 | 100 | 100 | 100 |
72 | 98 | 100 | 95 | 80 |
-15192 464
V. táblázat
VIII. táblázat
Fűszerű növényeket irtó hatás növényházban 0,125 kg/ha adaggal kikelés után
A 253. hatóanyag gyomfüveket irtó hatása növényházban kikelés után 0,125 kg/ha adaggal
Növények károsodása, % | ||
Hatóanyag száma | Setaria italia | Zea mays |
109 | 98 | 95 |
207 | 98 | 95 |
252 | 98 | 90 |
40 | 95 | 95 |
20 | 95 | 98 |
Növények | Károsodás, % |
Brassica napus | 0 |
Helianthus annuus | 0 |
Alopecurus myosuroides | 95 |
Bromus spp. | 95 |
Digitaria sanguinalis | 95 |
Echinochloa crus-galli | 100 |
Hordeum vulgare4 | 90 |
4 itt gyomnövény |
VI. táblázat
Az 1. hatóanyag gyomfűveket irtó hatása növényházban kikelés után 0,25 kg/ha adaggal
Növények | Károsodás, % |
Béta vulgáris | 0 |
Glycine max | 0 |
Gossypium hirsutum | 0 |
Alopecurus myosuroides | 94 |
Avena fatua | 96 |
Eleusine indica | 95 |
Sorghum halepense | 95 |
IX. táblázat | |
A 161. hatóanyag gyomfüveket irtó szelektív hatása növényházban kikelés után 0,25 kg/ha adagban | |
Növények | Károsodás, % |
Triticum aestivum | 0 |
Setaria italica Sorghum halepense | 85 100 |
VII. táblázat
A 4. hatóanyag szelektív gyomirtó hatása szójában kikelés után 0,25 kg/ha adaggal (növényházi vizsgálat)
X. táblázat
Szelektív gyomfüveket irtó hatás növényházban kikelés után 0,25 kg/ha adaggal
Növények | Károsodás, % |
Glycine max | 0 |
Avena fatua | 98 |
Sorghum bicolor4 | 95 |
Sorghum halepense (magról) | 90 |
Zea mays+ | 100 |
+itt gyomnövény
Növények Károsodás, %
2. hatóanyag 5. hatóanyag
Glycine max | 0 | 0 |
Avena fatua | 100 | 98 |
Echinochloa crus-galli | 90 | 100 |
Sorghum halepense | 90 | 85 |
Zea mays+ | 100 | 100 |
+itt gyomnövény
-16192 464
XI. táblázat
Szelektív gyomfűirtó hatás cukorrépában kikelés után 0,125 kg/ha adaggal (növényházi vizsgálat)
Hatóanyag száma | Béta vulgáris | Növények károsodása, % Echinochloa Setaria crus-galli italica | Sorghum halepense | |
238 | 0 | 98 | 100 | 98 |
71 | 0 | 100 | 100 | 98 |
74 | 0 | 100 | 100 | 100 |
35 | 0 | 90 | 95 | 98 |
56 | 0 | 98 | 95 | 100 |
186 | 0 | 98 | 100 | 90 |
255 | 0 | 98 | 95 | 95 |
122 | 0 | 98 | 100 | 100 |
29 | 0 | 95 | 95 | 100 |
176 | 0 | 98 | 100 | 100 |
33 | 0 | 98 | 95 | 98 |
190 | 0 | 98 | 100 | 90 |
206 | 0 | 98 | 100 | 98 |
169 | 0 | 98 | 100 | 100 |
7 | 0 | 100 | 95 | 100 |
5 | 0 | 100 | 100 | 90 |
13 | 0 | 95 | 98 | 95 |
219 | 0 | 98 | 100 | 100 |
254 | 0 | 98 | 90 | 100 |
XII. táblázat
Szelektív gyomfűirtó hatás szójában kikelés után 0,25 kg/ha adaggal (növényházi vizsgálat)
Növények károsodása, %
Hatóanyag száma | kg/ha | Glycine max | Zea+ mays | Digitaria sang. | Setaria italica | Sorghum halep. |
245 | 0,25 | 0 | 98 | 98 | 95 | 98 |
241 | 0,25 | 0 | 95 | 85 | 95 | 90 |
242 | 0,25 | Q | 100 | 98 | 98 | 98 |
247 | 0,25 | Ö | 98 | 100 | 98 | 100 |
243 | 0,25 | 0 | 100 | 100 | 100 | 95 |
-17192 464
ΧΠΙ. táblázat
Gyomfüveket irtó hatás növényházban kikelés után 0,125 kg/ha adaggal
Növények károsodása, % | ||
Hatóanyag száma | Setaria italica | Zea mays |
9 | 100 - | 100 |
13 | 98 | 100 |
27 | 100 | 100 |
31 | 98 | 100 |
18 | 100 | 100 |
32 | 100 | 100 |
24 | 98 | 100 |
57 | 98 | 98 |
42 | 95 | 100 |
266 | 100 | 80 |
XIV. táblázat
Szelektív gyomirtó hatás növényházban kikelés utáni kezelés esetén
Növények károsodása, % | ||||
Hatóanyag száma | Adag | Triticum aestivum | Setaria italica | Echinochloa crus-galli |
161 | 0,25 | 0 | 85 | 100 |
212 | 0,5 | 0 | 95 | 98 |
234 | 0,5 | 0 | 95 | 100 |
233 | 0,5 | 10 | 100 | 100 |
194 | 0,5 | 10 | 100 | 100 |
XV. táblázat összehasonlító hatástani adatok növényházban kikelés után 0,25 kg/ha adaggal végzett vizsgálatok alapján;
(III) általános képlet
X’ | Y’ | R | Növények Lolium multiflorum | károsodása, % | Echinochloa crus-galli | Sorghum halepense | |
Setaria faberii | Digitaria sanguinalis | ||||||
tetrahidropiran -3 -il | H | etil | 90 | 80 | 85 | 90 | 75 |
tetrahidrotiopiran-3-il | H | etil | 100 | 95 | 100 | 100 | 100 |
(A) metil (ismert) | metil | etil | 20 | 0 | 20 | 0 | 30 |
tetrahidro piran -3 -il | H | propil | 100 | 90 | 75 | 90 | 100 |
tetrahidrotiopiran-3 -il | H | propil | 100 | 100 | 100 | 98 | 98 |
(B) metil (ismert) | metil | propil | 60 | 20 | 20 | 30 | 0 |
61 027 számú német szövetségi köztársasági nyilvánosságrahozatali iratból ismert 123 .(A) és 124.(B) hatóanyagok
-18192 464
XVI. táblázat
A gyomfűveket irtó hatásnak és a haszonnövények tűrőképességének összehasonlítása növényházban kikelés után 0,25 kg/ha adaggal; (III) általános képlet
X | Y | R | Növények Medicago sativa | károsodása, % | Eleusine indica | Avena fatua | ||
Béta vulgáris | Zea+ mays | Setaria italica | ||||||
tetrahidrotiopiran-3-il | H | propil | 0 | 0 | 100 | 100 | 98 | 100 |
(B) metil (ismert) | metil | propil | 30 | 10 | 0 | 0 | 60 | 10 |
+itt gyomnövény
Claims (4)
1. Gyomirtószerkészítmény azzal jellemezve, hogy hatóanyagként 0,1—95 tömegé (I) általános képletű ciklohexenolszármazékot tartalmaz - a képletben R1 jelentése piridil- vagy tetrahidrofurilcsoport, 25 vagy adott esetben 14 szénatomos alkilcsoporttal egyszeresen helyettesített, gyűrűtagként egy oxigén- vagy egy kénatomot vagy egy szulfinil- vagy egy szulfonilcsoportot tartalmazó 6 tagú, telített heteroatomos 30 gyűrű vagy legfeljebb '3 metilcsoporttal adott esetben szubsztituált olyan 5—12 szénatomos cikloalkilcsoport, amelyben adott esetben legfeljebb egy kettős kötés van, vagy B—Y—C—általános képletű csoport, a kép- 35 letben
B jelentése (14 szénatomos alkoxi)-(14 szénatomos alkil)- vagy benzilcsoport, Y jelentése oxigén- vagy kénatom és C jelentése legfeljebb 4 szénatomos alkilénlánc, 40
X jelentése hidrogénatom
R2 jelentése legfeljebb 3 szénatomos alkilcsoport, halogénatommal egyszeresen helyettesített 34 szénatomos alkenilcsoport vagy propargilcsoport, 45
A jelentése DE általános képletű csoport, a képletben D jelentése metilén-, karbonilvagy szulfonilcsoport és ha D jelentése metiléncsoport, E jelentése fenilcsoport, ha D jelentése szulfonilcsoport, E jelentése 1-6 szén- 50 atomos alkilcsoport, ha D jelentése karbonilcsoport, E jelentése legfeljebb 20 szénatomos alkenil- vagy alkilcsoport, benzilcsoport, metilcsoporttal adott esetben egyszeresen szubsztituált legfeljebb 6 szénato- 55 mos cikloalkilcsoport, 14 szénatomos alkil-,
14 szénatomos alkoxi-, nitrocsoporttal és halogénatommal adott esetben legfeljebb kétszeresen szubsztituált fenilcsoport, halogénatommal vagy metoxicsoporttal adott 60 esetben egyszeresen helyettesített alfa-metil-benzil- vagy alfa, alfa-dimetil-benzil-csoport, legfeljebb 3 szénatomos alkilcsoport, (14 szénatomos alkoxi)-karbonil-(14 szénatomos alkil-csoport, vagy fenoxicsoportban halogénatommal és 14 szénatomos alkilcsoporttal legfeljebb háromszorosan szubsztituált olyan fenoxi-alkilén-csoport, amelyben az alkilénlánc legfeljebb 5 szénatomos vagy 14 szénatomos alkilcsoporttal adott esetben kétszeresen helyettesített furil- vagy izoxazolilcsoport vagy halogénatommal egyszeresen helyettesített piridilcsoport vagy tienil(14 szénatomos alkil)-csoport vagy (a) általános képletű csoport, amelynek képletében R4 jelentése trifluor-metil-csoporttal helyettesített fenilcsoport vagy (b) általános képletű csoport, amelynek képletében R8, R9 és R10 jelentése egymástól függetlenül 14 szénatomos alkil- vagy fenilcsoport vagy (c) általános képletű csoport, amelynek képletében Y jelentése oxigénatom és R11 és R12 jelentése 14 szénatomos alkilcsoport vagy (d) általános képletű csoport, amelyben R1 jelentése tetrahidro-pirán-3-il-csoport, X jelentése hidrogénatom, R2 jelentése legfeljebb 4 szénatomos alkilcsoport, R3 jelentése legfeljebb 3 szénatomos alkilcsoport és G jelentése legfeljebb 6 szénatomos alkiléncsoport — szilárd vagy folyékony hordozó-, illetve higítóanyag — előnyösen természetes vagy mesterséges ásványi őrlemény, alifás, aromás vagy ciklusos szénhidrogén, víz, ásványolaj-frakció — és felületaktív adalék — előnyösen ionos vagy nemionos diszpergáló-, emulgeáló-, nedvesítőszer — legalább egyikével együtt.
2. \z 1. igénypont szerinti gyomirtószerkészítmény azzal jellemezve, hogy hatóanyagként olyan (l) általános képletű ciklohexenolszármazékot tartalmaz, amelynek képletében R1 tetrahidro-piranil-, tetrahidro-tiopiranil-, 1-oxo-tetrahidro-tiopiranil- vagy 1,1-dioxo-tetrahidro-tiopiranil-csoportot jelent.
3. Az 1. igénypont szerinti gyomirtószerkészítmény azzal jellemezve, hogy hatóanyagként olyan (I) általáros képletű ciklohexenol-származékot tartalmaz, amelynek képletében R1 tetrahidro-tiopirán-3-ilcsopoitot jelent.
4. Eljárás (Γ) általános képletű ciklohexenolszármazékok - a képletben
R1 jelentése adott esetben 14 szénatomos alkilcsoporttal vagy 1-4 szénatomos alkoxicso19
-191 192 4ι porttal monoszubsztituált, gyűrűtagként olyan oxigén- vagy kénatomot vagy egy szulfinil-vagy szulfonilcsoportot tartalmazó, 6tagú, telített heteroatomos gyűrű, vagy tetrahidrofurilcsoport vagy adott esetben 1-4 5 szénatomos alkilcsoporttal monoszubsztituált piridilcsoport vagy adott esetben legfeljebb 3 metilcsoporttal szubsztituált 5-12 szénatomos cikloalkilcsoport, amelyben adott esetben legfeljebb egy kettőskötés van, 10 vagy 7-12 tagú biciklusos gyűrű, amelyben adott esetben legfeljebb 2 kettőskötés és adott esetben 2 oxigénatom van, vagy egy halogénatommal, két 14 szénatomos alkilvagy alkoxicsoporttal szubsztituált fenil- 15 csoport vagy
B-Y-C— általános képletű csoport, a képletben B (14 szénatomos alkoxiX 14 szénatomos alkil)-csoportot vagy benzilcsoportot, Y oxigén-vagy kénatomot és C legfeljebb 20 4 szénatomos alkilénláncot jelent, azzal a megszorítással, hogy ha R1 szubsztituált fenilcsoportot jelent, úgy A alkfl-szulfonü-, alkanol-, benzoil-, fenoxi-acetil-, alkil- vagy benzilcsoporttól eltérő jelentésű, 25
X jelentése hidrogénatom vagy metoxi-karbonil-csoport,
R2 jelentése legfeljebb 4 szénatomos alkilcsoport,
R3 jelentése legfeljebb 3 szénatomos alkilcso- 30 port, adott esetben halogénatommal monoszubsztituált, 34 szénatomos alkenilcsoport, vagy propargilcsoport, és
A jelentése DE általános képletű csoport, a képletben 35
D metilén-, karbonil- vagy szulfonilcsoportot jelent, és ha D metiléncsoport, E fenilcsoport, ha
D szulfonilcsoport, E 1-6 szénatomos alkilcsoport, ha D karbonilcsoport, E legfeljebb 40 20 szénatomos alkenil- vagy alkilcsoportot, adott esetben metilcsoporttal monoszubsztituált legfeljebb 6 szénatomos cikloalkilcsoportot, sztirilcsoportot vagy adott esetben halogénatommal, 14 szénatomos alkil-, 14 szénatomos alkoxi- és nitrocsoporttal legfel1 2 jebb háromszor szubsztituált fenilcsoportot, benzilcsoportot, adott esetben halogénatommal vagy metoxi-csoporttal monoszubsztituált alfa-metil-benzil vagy alfa, alfa-dimetil-benzilcsoportot, legfeljebb 3 szénatomos alkilcsoportot, vagy (14 szénatomos alkoxi)-karbonil-(14 szénatomos alkil)-csoportot jelent, továbbá adott esetben a fenoxicsoportban halogénatommal és 14 szénatomos alkil-csoporttal legfeljebb háromszor szubsztituált olyan fenoxi-alkiléncsoportot jelent, amelyben az alkilénlánc legfeljebb 5 szénatomos, és adott esetben elágazó szénláncú, továbbá adott esetben 14 szénatomos alkilcsoporttal legfeljebb diszubsztituált furil- vagy izoxazolilcsoport vagy halogénatommal monoszubsztituált piridilcsoport vagy tienil-(14 szénatomos alkil)-csoport, vagy
A (a) általános képletű csoportot jelent, a képletben
R4 jelentése trifluor-metil-csoporttal szubsztituált fenilcsoport, vagy
A (b) általános képletű csoportot jelent, a képletben
R8, R9 és R10 egymástól függetlenül 14szénatomos alkil- vagy fenilcsoportokat jelentenek, vagy
A (c) általános képletű csoportot jelent, a képletben az Y-ok egymástól függetlenül oxigén- vagy kénatomot jelentenek, valamint R11 ésR12 14 szénatomos alkilcsoportokat jelentenek, vagy
A (d) általános képletű csoportot jelent, amelyben R1 tetrahidro-pirán-3-il-csoport, X jelentése hidrogénatom, R2 jelentése legfeljebb 4 szénatomos alkilcsoport, R3 legfeljebb 3 szénatomos alkilcsoport és G feniléncsoport vagy legfeljebb 6 szénatomos alkiléncsopon - előállítására azzal jellemezve, hogy egy (II) általános képletű vegyületet — a képletben R1, R2,
R3 és X jelentése az 1. igénypontban megadott A-Z általános képletű vegyülettel bázis jelenlétében reagáltatunk a - képletben A jelentése az 1. igénypontban megadott, és Z halogénatomot jelent.
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE3336140A DE3336140A1 (de) | 1983-10-05 | 1983-10-05 | Cyclohexanol-derivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
DE19833342630 DE3342630A1 (de) | 1983-11-25 | 1983-11-25 | Cyclohexenol-derivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
Publications (2)
Publication Number | Publication Date |
---|---|
HUT35925A HUT35925A (en) | 1985-08-28 |
HU192464B true HU192464B (en) | 1987-06-29 |
Family
ID=25814610
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
HU843758A HU192464B (en) | 1983-10-05 | 1984-10-04 | Herbicide compositions containing cyclohexenol derivatives as active ingredients and process for preparing cyclohexenol derivatives |
Country Status (10)
Country | Link |
---|---|
US (1) | US4761172A (hu) |
EP (1) | EP0136702B1 (hu) |
KR (1) | KR850002970A (hu) |
AT (1) | ATE52500T1 (hu) |
AU (1) | AU582124B2 (hu) |
BR (1) | BR8405020A (hu) |
CA (1) | CA1250293A (hu) |
DE (1) | DE3482180D1 (hu) |
HU (1) | HU192464B (hu) |
IL (1) | IL73152A0 (hu) |
Families Citing this family (21)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0177222B1 (en) * | 1984-09-25 | 1990-06-27 | Ici Australia Limited | Cyclohexane-1,3-dione derivatives, compositions containing them, processes for preparing them, and their use as herbicides and plant growth regulators |
AU579402B2 (en) * | 1984-09-28 | 1988-11-24 | Ici Australia Limited | Herbicidal cyclohexane-1,3-dione derivatives |
DE3437238A1 (de) * | 1984-10-11 | 1986-04-17 | Basf Ag, 6700 Ludwigshafen | Neue verbindungen, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
EP0202042B1 (en) * | 1985-05-06 | 1990-05-09 | Ici Australia Limited | Cyclohexane-1,3-dione derivatives, compositions containing them, processes for preparing them, and their use as herbicides and plant growth regulators |
AU583135B2 (en) * | 1985-08-08 | 1989-04-20 | Ici Australia Limited | Herbicidal cyclohexane-1,3-dione derivatives |
DE3536117A1 (de) * | 1985-10-10 | 1987-04-16 | Basf Ag | Cyclohexenonderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
DE3600642A1 (de) * | 1986-01-11 | 1987-07-16 | Basf Ag | Cyclohexenonderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide mittel |
EP0261710B1 (en) * | 1986-08-28 | 1990-05-23 | Shell Internationale Researchmaatschappij B.V. | Phenylurea herbicides |
DE3833264A1 (de) * | 1988-09-30 | 1990-04-05 | Basf Ag | Cyclohexenonderivate |
US5201935A (en) * | 1988-09-30 | 1993-04-13 | Basf Aktiengesellschaft | Cyclohexenone derivatives |
US5034047A (en) * | 1988-09-30 | 1991-07-23 | Basf Aktiengesellschaft | Cyclohexenone derivatives and their use as herbicides |
US5013352A (en) * | 1990-03-30 | 1991-05-07 | Dowelanco | Substituted pyridyl-cyclohexanediones and their herbicidal uses |
KR970010173B1 (ko) * | 1991-07-09 | 1997-06-21 | 닛뽕소다 가부시끼가이샤 | 함헤테로 시클로헥산디온 유도체, 그의 제조방법 및 제초제 |
US7214825B2 (en) | 2003-10-17 | 2007-05-08 | Honeywell International Inc. | O-(3-chloropropenyl) hydroxylamine free base |
WO2013032951A1 (en) | 2011-08-26 | 2013-03-07 | Neupharma, Inc. | Certain chemical entities, compositions, and methods |
WO2013040515A1 (en) | 2011-09-14 | 2013-03-21 | Neupharma, Inc. | Certain chemical entities, compositions, and methods |
US9249110B2 (en) | 2011-09-21 | 2016-02-02 | Neupharma, Inc. | Substituted quinoxalines as B-raf kinase inhibitors |
US9249111B2 (en) | 2011-09-30 | 2016-02-02 | Neupharma, Inc. | Substituted quinoxalines as B-RAF kinase inhibitors |
WO2013112950A2 (en) | 2012-01-25 | 2013-08-01 | Neupharma, Inc. | Certain chemical entities, compositions, and methods |
WO2014047648A1 (en) | 2012-09-24 | 2014-03-27 | Neupharma, Inc. | Certain chemical entities, compositions, and methods |
US9725421B2 (en) | 2012-11-12 | 2017-08-08 | Neupharma, Inc. | Substituted quinoxalines as B-raf kinase inhibitors |
Family Cites Families (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS577122B2 (hu) * | 1973-12-24 | 1982-02-09 | ||
CA1218379A (en) * | 1980-11-25 | 1987-02-24 | Tatao Luo | Herbicidal substituted 2-(1-oxyamino)-alkylidene)- cyclohexane-1,3-diones |
DE3121355A1 (de) * | 1981-05-29 | 1982-12-16 | Basf Ag, 6700 Ludwigshafen | Cyclohexandionderivate, verfahren zu ihrer herstellung und diese enthaltende herbizide |
NZ202284A (en) * | 1981-11-20 | 1986-06-11 | Ici Australia Ltd | 2-(1-(alkoxyimino)alkyl)-3-hydroxy-5-poly(methyl)phenyl-cyclohex-2-en-1-ones and herbicidal compositions |
AU555882B2 (en) * | 1981-11-20 | 1986-10-16 | Ici Australia Limited | Oximes |
NZ202691A (en) * | 1981-12-23 | 1986-02-21 | Ici Australia Ltd | Derivatives of 2-(-oxyiminoalkyl)-3-hydroxy-5-thiophenyl cyclohex-2-en-1-one |
AU557949B2 (en) * | 1982-01-29 | 1987-01-15 | Ici Australia Limited | 5-phenyl substituted cyclohexane 1,3 dione derivatives |
BE897413A (fr) * | 1982-08-09 | 1983-11-14 | Chevron Res | 2- [1-(oxvamino)-alkylidene] -5-(2-ethylthiopropyl)-cyclohexane-1,3-diones substituees herbicides |
NZ205525A (en) * | 1982-09-29 | 1985-12-13 | Ici Australia Ltd | 5-(pyridyl)-cyclohexene-1,3-dione derivatives and herbicidal compositions |
-
1984
- 1984-10-03 AT AT84111800T patent/ATE52500T1/de not_active IP Right Cessation
- 1984-10-03 EP EP84111800A patent/EP0136702B1/de not_active Expired - Lifetime
- 1984-10-03 CA CA000464643A patent/CA1250293A/en not_active Expired
- 1984-10-03 IL IL73152A patent/IL73152A0/xx unknown
- 1984-10-03 DE DE8484111800T patent/DE3482180D1/de not_active Expired - Lifetime
- 1984-10-04 HU HU843758A patent/HU192464B/hu not_active IP Right Cessation
- 1984-10-04 AU AU33848/84A patent/AU582124B2/en not_active Ceased
- 1984-10-04 BR BR8405020A patent/BR8405020A/pt unknown
- 1984-10-05 US US06/658,432 patent/US4761172A/en not_active Expired - Lifetime
- 1984-10-08 KR KR1019840006237A patent/KR850002970A/ko not_active Application Discontinuation
Also Published As
Publication number | Publication date |
---|---|
DE3482180D1 (de) | 1990-06-13 |
AU3384884A (en) | 1985-05-09 |
BR8405020A (pt) | 1985-08-20 |
ATE52500T1 (de) | 1990-05-15 |
EP0136702A2 (de) | 1985-04-10 |
IL73152A0 (en) | 1985-01-31 |
HUT35925A (en) | 1985-08-28 |
CA1250293A (en) | 1989-02-21 |
KR850002970A (ko) | 1985-05-28 |
AU582124B2 (en) | 1989-03-16 |
EP0136702B1 (de) | 1990-05-09 |
EP0136702A3 (en) | 1986-01-08 |
US4761172A (en) | 1988-08-02 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
HU192464B (en) | Herbicide compositions containing cyclohexenol derivatives as active ingredients and process for preparing cyclohexenol derivatives | |
HU203547B (en) | Herbicide compositions containing aromatic carboxylic acid derivatives as active components and process for producing the active components | |
CA1276934C (en) | Cyclohexenone derivatives and their use for controlling undesirable plant growth | |
HU203335B (en) | Herbicide compositions containing cyclohexanon-oximethersas active component sand process for producing the active components | |
HU214217B (hu) | Szalicil-éter-származékokat tartalmazó herbicid készítmények, eljárás szalicil-éter-származékok előállítására és gyomirtási eljárás | |
HU212480B (en) | Herbicidal composition containing cyclohexenone-oxymethers and process for the preparation of active ingredients | |
JPH0676398B2 (ja) | シクロヘキサン‐1,3‐ジオン誘導体、その製法及び該化合物を含有する除草剤 | |
DK165114B (da) | 2,5-substituerede 3-hydroxy-cyclohex-2-en-1-on-derivater, fremgangsmaade til fremstilling af saadanne derivater, samt herbicid indeholdende et saadant derivat og en fremgangsmaade til bekaempelse af uoensket plantevaekst ved brug af saadanne derivater | |
HU188926B (en) | Herbicides containing derivatives of cyclohexane-1,3-dione and process for preparing the active substances | |
EP0716653B1 (en) | Substituted 1-amino-3-phenyluracils with herbicidal activities | |
HU207855B (en) | Herbicide compositions containing salicylic acid derivatives and process for producing the active components | |
CS240979B2 (en) | Herbicide agent and production method of effective substances | |
CS255000B2 (en) | Herbicide and method of its efficient substances production | |
CA1231954A (en) | 3-phenyl-4-methoxycarbonylpyrazoles and their use for controlling undesirable plant growth | |
CA1265526A (en) | Cyclohexenone derivatives and their use for controlling undesirable plant growth | |
JP2872688B2 (ja) | テトラヒドロピラン−2,4−ジオン、該化合物を含有する除草剤および望ましからぬ植物成長を防除する方法 | |
US4842638A (en) | Herbicidal tetrahydro(thio)pyran-2,4-dione derivatives | |
EP0788479B1 (de) | Substituierte phthalimido-zimtsäurederivate mit herbizider wirkung | |
HU201299B (en) | Herbicides and compositions regulating the growth of plants containing derivatives of cyclohexonon and process for production of the active substances | |
US4522646A (en) | 3,7-Dichloroquinoline derivatives and their use for controlling undesirable plant growth | |
HU191011B (en) | Herbicides consisting of cyclohexanon derivatives and process for production of the agents | |
JPH10505589A (ja) | サッカリン誘導体 | |
CA1297910C (en) | Cyclohexenone derivatives, preparation thereof and use thereof as herbicidal and plant growth regulator agents | |
AU662018B2 (en) | Cyclohexenone derivates used as herbicides | |
HU212620B (en) | Herbicidal compositions containing cyclohexenone-oxymethers, process for the preparation of the active ingredients and method for combating weeds |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
HU90 | Patent valid on 900628 | ||
HMM4 | Cancellation of final prot. due to non-payment of fee |