HU190498B - Process for preparing 4-amino-5-/dialkoxy-methyl/-pyrimidine derivatives - Google Patents
Process for preparing 4-amino-5-/dialkoxy-methyl/-pyrimidine derivatives Download PDFInfo
- Publication number
- HU190498B HU190498B HU832627A HU262783A HU190498B HU 190498 B HU190498 B HU 190498B HU 832627 A HU832627 A HU 832627A HU 262783 A HU262783 A HU 262783A HU 190498 B HU190498 B HU 190498B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- mixture
- mmol
- amino
- reaction
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims abstract description 28
- 238000000034 method Methods 0.000 claims abstract description 28
- 239000007858 starting material Substances 0.000 claims abstract description 14
- 150000001409 amidines Chemical class 0.000 claims abstract description 11
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical class CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000001875 compounds Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 239000005977 Ethylene Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 claims description 2
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 claims description 2
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910017053 inorganic salt Inorganic materials 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- 235000019441 ethanol Nutrition 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 22
- -1 formic acid ester Chemical class 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 238000003756 stirring Methods 0.000 description 17
- 238000009835 boiling Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 238000004821 distillation Methods 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 229910052783 alkali metal Inorganic materials 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 6
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 6
- FLCFSWDRVQTDOK-UHFFFAOYSA-N 2-(dimethoxymethyl)-3-methoxyprop-2-enenitrile Chemical compound COC=C(C#N)C(OC)OC FLCFSWDRVQTDOK-UHFFFAOYSA-N 0.000 description 5
- WCJTULPFKRGBNH-UHFFFAOYSA-N 3-butoxy-2-(dibutoxymethyl)prop-2-enenitrile Chemical compound CCCCOC=C(C#N)C(OCCCC)OCCCC WCJTULPFKRGBNH-UHFFFAOYSA-N 0.000 description 5
- 238000004817 gas chromatography Methods 0.000 description 5
- 238000006386 neutralization reaction Methods 0.000 description 5
- 150000003230 pyrimidines Chemical class 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 238000004445 quantitative analysis Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 3
- QODCADXMYFDAMD-UHFFFAOYSA-N 2-(dimethoxymethyl)-3,3-dimethoxypropanenitrile Chemical compound COC(OC)C(C#N)C(OC)OC QODCADXMYFDAMD-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 238000004566 IR spectroscopy Methods 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 3
- FLVHGIJGBKMFBB-UHFFFAOYSA-N [Na].COC(OC)C(=CO)C#N Chemical compound [Na].COC(OC)C(=CO)C#N FLVHGIJGBKMFBB-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 229910001628 calcium chloride Inorganic materials 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 235000019155 vitamin A Nutrition 0.000 description 3
- 239000011719 vitamin A Substances 0.000 description 3
- 229940045997 vitamin a Drugs 0.000 description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- HEPMEJCHTBWKIB-UHFFFAOYSA-N 5-(dibutoxymethyl)-2-methylpyrimidin-4-amine Chemical compound CCCCOC(OCCCC)C1=CN=C(C)N=C1N HEPMEJCHTBWKIB-UHFFFAOYSA-N 0.000 description 2
- WPNRPBRVBAICQQ-UHFFFAOYSA-N 5-(dimethoxymethyl)-2-methylpyrimidin-4-amine Chemical compound COC(OC)C1=CN=C(C)N=C1N WPNRPBRVBAICQQ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- DRFJNEVYLFPWFD-UHFFFAOYSA-N 2-(diethoxymethyl)-3,3-diethoxypropanenitrile Chemical compound CCOC(OCC)C(C#N)C(OCC)OCC DRFJNEVYLFPWFD-UHFFFAOYSA-N 0.000 description 1
- BYEOUVGYGCYXLI-UHFFFAOYSA-N 2-(diethoxymethyl)-3-ethoxyprop-2-enenitrile Chemical compound CCOC=C(C#N)C(OCC)OCC BYEOUVGYGCYXLI-UHFFFAOYSA-N 0.000 description 1
- YVCLRNJQIURSKF-UHFFFAOYSA-N 2-(diethoxymethyl)-3-hydroxyprop-2-enenitrile Chemical compound CCOC(OCC)C(=CO)C#N YVCLRNJQIURSKF-UHFFFAOYSA-N 0.000 description 1
- JVQUIFRKEPFYBR-UHFFFAOYSA-N 2-(dimethoxymethyl)-3-hydroxyprop-2-enenitrile Chemical compound COC(OC)C(=CO)C#N JVQUIFRKEPFYBR-UHFFFAOYSA-N 0.000 description 1
- IPCRTSDORDQHRO-UHFFFAOYSA-N 3-methoxyprop-2-enenitrile Chemical compound COC=CC#N IPCRTSDORDQHRO-UHFFFAOYSA-N 0.000 description 1
- XQSJHQXYQAUDFC-UHFFFAOYSA-N 4,6-dichloropyrimidine-5-carbaldehyde Chemical compound ClC1=NC=NC(Cl)=C1C=O XQSJHQXYQAUDFC-UHFFFAOYSA-N 0.000 description 1
- GOJNFUXEBVBARW-UHFFFAOYSA-N 4-amino-6-chloropyrimidine-5-carbaldehyde Chemical compound NC1=NC=NC(Cl)=C1C=O GOJNFUXEBVBARW-UHFFFAOYSA-N 0.000 description 1
- PDZKNPQAPGGAFJ-UHFFFAOYSA-N 4-aminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=NC=C1C=O PDZKNPQAPGGAFJ-UHFFFAOYSA-N 0.000 description 1
- MKYITYRIURYLEQ-UHFFFAOYSA-N 5-(aminomethyl)pyrimidin-4-amine Chemical class NCC1=CN=CN=C1N MKYITYRIURYLEQ-UHFFFAOYSA-N 0.000 description 1
- XURCRGQBWOXHDS-UHFFFAOYSA-N 5-(diethoxymethyl)-2-methylpyrimidin-4-amine Chemical compound CCOC(OCC)C1=CN=C(C)N=C1N XURCRGQBWOXHDS-UHFFFAOYSA-N 0.000 description 1
- CBTMVNREUWQZLS-UHFFFAOYSA-N 5-(dimethoxymethyl)-2-phenylpyrimidin-4-amine Chemical compound N1=C(N)C(C(OC)OC)=CN=C1C1=CC=CC=C1 CBTMVNREUWQZLS-UHFFFAOYSA-N 0.000 description 1
- PARURSQSRZANMS-UHFFFAOYSA-N 5-(dimethoxymethyl)pyrimidin-4-amine Chemical compound COC(OC)C1=CN=CN=C1N PARURSQSRZANMS-UHFFFAOYSA-N 0.000 description 1
- YBCSVKQHGWCCQX-UHFFFAOYSA-N C(CCC)OC(C#N)C(OCCCC=C)OCCCC Chemical compound C(CCC)OC(C#N)C(OCCCC=C)OCCCC YBCSVKQHGWCCQX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- NMVVJCLUYUWBSZ-UHFFFAOYSA-N aminomethylideneazanium;chloride Chemical compound Cl.NC=N NMVVJCLUYUWBSZ-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- LZCZIHQBSCVGRD-UHFFFAOYSA-N benzenecarboximidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])C1=CC=CC=C1 LZCZIHQBSCVGRD-UHFFFAOYSA-N 0.000 description 1
- BDFJWKALVSRGSR-UHFFFAOYSA-N butan-1-ol;sodium Chemical compound [Na].CCCCO BDFJWKALVSRGSR-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP57156687A JPS5946255A (ja) | 1982-09-10 | 1982-09-10 | 2−アルコキシメチレン−3,3−ジアルコキシプロパンニトリル類の製法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU190498B true HU190498B (en) | 1986-09-29 |
Family
ID=15633128
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU832627A HU190498B (en) | 1982-09-10 | 1983-07-26 | Process for preparing 4-amino-5-/dialkoxy-methyl/-pyrimidine derivatives |
| HU854784A HU194810B (en) | 1982-09-10 | 1983-07-26 | Process for producing new 2-/alkoxy-methylene/-3,3-dialkoxy-propanonitril derivatives |
| HU854785A HU193617B (en) | 1982-09-10 | 1983-07-26 | Process for producing 2-/dialkoxy-methyl/-3,3-dialkoxy-propane-nitril derivatives |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU854784A HU194810B (en) | 1982-09-10 | 1983-07-26 | Process for producing new 2-/alkoxy-methylene/-3,3-dialkoxy-propanonitril derivatives |
| HU854785A HU193617B (en) | 1982-09-10 | 1983-07-26 | Process for producing 2-/dialkoxy-methyl/-3,3-dialkoxy-propane-nitril derivatives |
Country Status (7)
| Country | Link |
|---|---|
| EP (1) | EP0103126B1 (enExample) |
| JP (1) | JPS5946255A (enExample) |
| KR (1) | KR900001179B1 (enExample) |
| AT (1) | ATE25680T1 (enExample) |
| CA (1) | CA1253498A (enExample) |
| DK (2) | DK159432C (enExample) |
| HU (3) | HU190498B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3829850A1 (de) * | 1988-09-02 | 1990-03-15 | Basf Ag | Verfahren zur herstellung von 2-n-propyl-4-amino-5-methoxymethyl-pyrimidin |
| US6395920B1 (en) * | 2000-01-28 | 2002-05-28 | Creanova, Inc. | Process for preparing substituted acetals of malondialdehyde |
| CN101627017B (zh) * | 2006-03-15 | 2013-02-27 | 帝斯曼知识产权资产管理有限公司 | 用于制造维生素b1前体的方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE937057C (de) * | 1954-04-02 | 1956-08-09 | Shionogi & Co | Verfahren zur Herstellung von 2-Methyl-4-amino-5-acetaminomethyl-(bzw. -5-aminomethyl-) pyrimidin |
| DE1016266B (de) * | 1954-09-01 | 1957-09-26 | Shionogi & Co | Verfahren zur Herstellung von 2-Methyl-4-amino-5-acetaminomethylpyrimidin |
| US4319024A (en) * | 1979-03-29 | 1982-03-09 | Dynamit Nobel Aktiengesellschaft | Method of preparing β-alkoxyacrlonitriles |
-
1982
- 1982-09-10 JP JP57156687A patent/JPS5946255A/ja active Granted
-
1983
- 1983-07-19 CA CA000432781A patent/CA1253498A/en not_active Expired
- 1983-07-26 HU HU832627A patent/HU190498B/hu not_active IP Right Cessation
- 1983-07-26 HU HU854784A patent/HU194810B/hu not_active IP Right Cessation
- 1983-07-26 HU HU854785A patent/HU193617B/hu not_active IP Right Cessation
- 1983-07-26 DK DK342383A patent/DK159432C/da not_active IP Right Cessation
- 1983-07-27 KR KR1019830003495A patent/KR900001179B1/ko not_active Expired
- 1983-07-27 EP EP83107398A patent/EP0103126B1/en not_active Expired
- 1983-07-27 AT AT83107398T patent/ATE25680T1/de not_active IP Right Cessation
-
1989
- 1989-09-01 DK DK434689A patent/DK434689D0/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| ATE25680T1 (de) | 1987-03-15 |
| KR840006217A (ko) | 1984-11-22 |
| CA1273347C (enExample) | 1990-08-28 |
| HU194810B (en) | 1988-03-28 |
| CA1253498A (en) | 1989-05-02 |
| HU193617B (en) | 1987-11-30 |
| DK342383D0 (da) | 1983-07-26 |
| DK159432B (da) | 1990-10-15 |
| DK434689A (da) | 1989-09-01 |
| EP0103126B1 (en) | 1987-03-04 |
| EP0103126A1 (en) | 1984-03-21 |
| DK159432C (da) | 1991-03-18 |
| JPS6121624B2 (enExample) | 1986-05-28 |
| DK434689D0 (da) | 1989-09-01 |
| KR900001179B1 (ko) | 1990-02-27 |
| JPS5946255A (ja) | 1984-03-15 |
| DK342383A (da) | 1984-03-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4466915A (en) | Non-catalytic ketoform syntheses | |
| WO2004016581A1 (en) | Processes for the preparation of 4-[[4-[[4-(2-cyanoethenyl)-2,6-dimethylphenyl]amino]-2-pyrimidinyl]amino]benzonitrile | |
| CA1271489A (en) | .alpha.,.beta.-SUBSTITUTED ACROLEINS AND THEIR PREPARATION | |
| US7847117B2 (en) | Process for preparing alkyl(methoxymethyl)trimethylsilanylmethylamines | |
| HU190498B (en) | Process for preparing 4-amino-5-/dialkoxy-methyl/-pyrimidine derivatives | |
| US6187926B1 (en) | Process for producing quinolone derivatives | |
| Frazier et al. | Isocyanurates. I. Some condensation reactions of cyanuric acid1 | |
| EP0808826B1 (en) | A method for preparing 3-amino substituted crotonates | |
| KR102458638B1 (ko) | 메데토미딘의 합성에서 유용한 3-아릴부탄알과 같은 화합물의 제조 방법 | |
| US4144263A (en) | Benzyl cyanoacetals | |
| KR100233068B1 (ko) | 2-치환된 4,6-디알콕시피리미딘의 제조방법 | |
| Sulmon et al. | New synthesis of N-aryl-2-methyleneazetidines | |
| US4428887A (en) | Method of producing mono-substituted terminal diesters | |
| US4492792A (en) | Process for preparing 4-amino-5-dialkoxy-methylpyrimidine derivatives | |
| HUT73357A (en) | Process for the preparation of substituted 4,6-diamino-5-cyanopyrimidine derivatives | |
| US5777154A (en) | Method for preparing 3-amino substituted crotonates | |
| JP3731925B2 (ja) | モノビニルエーテルの製法 | |
| US2609384A (en) | alpha-aryl-beta-alkoxyacrylonitriles and method of preparing same | |
| US5208337A (en) | Process for the preparation of aminopyrimidines | |
| JPS626706B2 (enExample) | ||
| US5290944A (en) | Method for producing dichloromethylpyridines | |
| EP0003866B1 (en) | 3-azabicyclo(3.1.0)hexane derivatives and a process for their preparation | |
| FI76789B (fi) | Foerfarande foer framstaellning 2,4-diamino-5-(3',4',5'-trimetoxibensyl)pyrimidin. | |
| US7179914B2 (en) | Process for the production of 4-alkylpyrimidine | |
| JP4561635B2 (ja) | 4−アルコキシカルボニルテトラヒドロピラン又はテトラヒドロピラニル−4−カルボン酸の製法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee | ||
| HRH9 | Withdrawal of annulment decision |