HU180358B - Process for producing substituted cyclopropane derivatives - Google Patents
Process for producing substituted cyclopropane derivatives Download PDFInfo
- Publication number
- HU180358B HU180358B HU80801423A HU142380A HU180358B HU 180358 B HU180358 B HU 180358B HU 80801423 A HU80801423 A HU 80801423A HU 142380 A HU142380 A HU 142380A HU 180358 B HU180358 B HU 180358B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- compounds
- group
- process according
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 32
- 125000001559 cyclopropyl group Chemical class [H]C1([H])C([H])([H])C1([H])* 0.000 title claims 4
- 150000001875 compounds Chemical class 0.000 claims description 62
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 53
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 32
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 32
- 238000002360 preparation method Methods 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- -1 lithium halide Chemical class 0.000 claims description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 15
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 14
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical group [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- JNDLSOLVHDGEOE-UHFFFAOYSA-N CC(=C(CCC(=O)O)C=O)C Chemical compound CC(=C(CCC(=O)O)C=O)C JNDLSOLVHDGEOE-UHFFFAOYSA-N 0.000 claims description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 6
- 239000002585 base Substances 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 238000004587 chromatography analysis Methods 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 4
- 238000002425 crystallisation Methods 0.000 claims description 4
- 230000008025 crystallization Effects 0.000 claims description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 3
- 238000006555 catalytic reaction Methods 0.000 claims description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 3
- 239000012312 sodium hydride Substances 0.000 claims description 3
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- 230000007704 transition Effects 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 2
- 150000004678 hydrides Chemical class 0.000 claims description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 2
- 239000012433 hydrogen halide Substances 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 239000003999 initiator Substances 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 3
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims 1
- 150000008041 alkali metal carbonates Chemical class 0.000 claims 1
- 235000011114 ammonium hydroxide Nutrition 0.000 claims 1
- 150000001924 cycloalkanes Chemical class 0.000 claims 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 63
- 239000000243 solution Substances 0.000 description 26
- 239000000047 product Substances 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 16
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000012043 crude product Substances 0.000 description 10
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 238000005481 NMR spectroscopy Methods 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- 125000001743 benzylic group Chemical group 0.000 description 5
- RHDGNLCLDBVESU-UHFFFAOYSA-N but-3-en-4-olide Chemical compound O=C1CC=CO1 RHDGNLCLDBVESU-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 5
- 235000019799 monosodium phosphate Nutrition 0.000 description 5
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 5
- 239000001488 sodium phosphate Substances 0.000 description 5
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229940043279 diisopropylamine Drugs 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- LGJCFVYMIJLQJO-UHFFFAOYSA-N 1-dodecylperoxydodecane Chemical compound CCCCCCCCCCCCOOCCCCCCCCCCCC LGJCFVYMIJLQJO-UHFFFAOYSA-N 0.000 description 1
- WEAYCYAIVOIUMG-UHFFFAOYSA-N 1-methyl-4-(4-methylphenyl)sulfonylbenzene Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C1=CC=C(C)C=C1 WEAYCYAIVOIUMG-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- FGLBSLMDCBOPQK-UHFFFAOYSA-N 2-nitropropane Chemical compound CC(C)[N+]([O-])=O FGLBSLMDCBOPQK-UHFFFAOYSA-N 0.000 description 1
- URGBSLJFXRHMJC-UHFFFAOYSA-N 3-[(3-phenoxyphenyl)methoxy]oxolan-2-one Chemical compound O(C1=CC=CC=C1)C=1C=C(C=CC=1)COC1C(OCC1)=O URGBSLJFXRHMJC-UHFFFAOYSA-N 0.000 description 1
- TVJBQFODEVNIBU-UHFFFAOYSA-N 4-methoxy-2-(3-phenoxyphenyl)-2h-furan-5-one Chemical compound O1C(=O)C(OC)=CC1C1=CC=CC(OC=2C=CC=CC=2)=C1 TVJBQFODEVNIBU-UHFFFAOYSA-N 0.000 description 1
- DUAZKLYNTLDKQK-UHFFFAOYSA-N 5-hydroxy-2(5h)-furanone Chemical compound OC1OC(=O)C=C1 DUAZKLYNTLDKQK-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 1
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 1
- 150000001942 cyclopropanes Chemical class 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- NIDHFQDUBOVBKZ-UHFFFAOYSA-N hex-4-enoic acid Chemical compound CC=CCCC(O)=O NIDHFQDUBOVBKZ-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- JTJMJGYZQZDUJJ-UHFFFAOYSA-N phencyclidine Chemical class C1CCCCN1C1(C=2C=CC=CC=2)CCCCC1 JTJMJGYZQZDUJJ-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- CMONRXAARYPMCP-UHFFFAOYSA-N propan-2-ylphosphanium;iodide Chemical compound [I-].CC(C)[PH3+] CMONRXAARYPMCP-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/74—Unsaturated compounds containing —CHO groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7914425A FR2458533A1 (fr) | 1979-06-06 | 1979-06-06 | Acide pentenoique substitue, son procede de preparation et son application a la preparation de derives cyclopropaniques substitues |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU180358B true HU180358B (en) | 1983-02-28 |
Family
ID=9226263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU80801423A HU180358B (en) | 1979-06-06 | 1980-06-05 | Process for producing substituted cyclopropane derivatives |
Country Status (7)
| Country | Link |
|---|---|
| US (3) | US4556732A (https=) |
| EP (3) | EP0023849B1 (https=) |
| JP (4) | JPS5629544A (https=) |
| AT (2) | ATE9225T1 (https=) |
| CA (1) | CA1142958A (https=) |
| FR (1) | FR2458533A1 (https=) |
| HU (1) | HU180358B (https=) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2463134A1 (fr) * | 1979-08-10 | 1981-02-20 | Roussel Uclaf | Nouveaux composes sulfones comportant un cycle lactonique, leur procede de preparation et leur application a la preparation de derives cyclopropaniques |
| FR2485000A1 (fr) * | 1980-06-20 | 1981-12-24 | Roussel Uclaf | 4-methyl 3-formyl pentene 1-oates d'alcoyle inferieur, leur procede de preparation et leur application |
| US4673672A (en) * | 1985-10-28 | 1987-06-16 | Sandoz Pharmaceuticals Corp. | Substituted-[hydroxy(tetrahydro)-5-oxo-(2- and 3-furanyl or 2-thienyl)alkoxyphosphinyloxy]-alkanaminium hydroxide, inner salt oxides |
| FR2618781B2 (fr) * | 1987-01-09 | 1990-05-04 | Roussel Uclaf | Procede de preparation de derives de la 4,4-dimethyl tetrahydro pyr-2-one |
| JPH01107723U (https=) * | 1988-01-14 | 1989-07-20 | ||
| US5032653A (en) * | 1988-06-28 | 1991-07-16 | Exxon Chemical Patents, Inc. | Direct synthesis by cationic polymerization of nitrogen-containing polymers |
| JPH02240033A (ja) * | 1989-03-13 | 1990-09-25 | Daikin Ind Ltd | 新規モノテルペン及びその誘導体 |
| JPH0444346U (https=) * | 1990-08-08 | 1992-04-15 | ||
| JPH069936U (ja) * | 1992-02-24 | 1994-02-08 | 明和グラビア株式会社 | 装飾用貼着シート |
| JPH0585991U (ja) * | 1992-04-14 | 1993-11-19 | 日本バイリーン株式会社 | 窓ガラス用貼付材 |
| DE60110026T2 (de) | 2001-01-08 | 2006-05-18 | Calzaturificio S.C.A.R.P.A. S.P.A., Asolo | Skischuh |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE870252C (de) * | 1944-05-13 | 1953-03-12 | Guenther O Dr Schenck | Verfahren zur Darstellung von ª†-Oxocarbonsaeuren |
| US2493676A (en) * | 1947-07-21 | 1950-01-03 | Staley Mfg Co A E | Pseudo esters of levulinic acid |
| US2485100A (en) * | 1948-09-25 | 1949-10-18 | Us Rubber Co | Lactonization of 2, 4-polyhalogenoalkanoic esters |
| US2726250A (en) * | 1951-05-15 | 1955-12-06 | Koege Kemisk Vaerk | 5-monosubstituted 2-oxo-2, 5-dihydrofurans |
| GB893322A (en) * | 1957-08-19 | 1962-04-04 | Unilever Ltd | Lactonols |
| NL301342A (https=) * | 1962-12-08 | |||
| FR1362039A (fr) * | 1963-04-17 | 1964-05-29 | Ct D Etudes Experimentales Et | Nouveau procédé de préparation du semi-aldéhyde succinique |
| FR1394863A (fr) * | 1964-02-24 | 1965-04-09 | Electrochimie Soc | Procédé de préparation d'acides gamma formyl-carboxyliques ou de leurs dérivés,et produits obtenus |
| US4132717A (en) * | 1977-08-09 | 1979-01-02 | Shell Oil Company | Enol lactone intermediate for the preparation of (1R,cis)-caronaldehydic acid |
| FR2463134A1 (fr) * | 1979-08-10 | 1981-02-20 | Roussel Uclaf | Nouveaux composes sulfones comportant un cycle lactonique, leur procede de preparation et leur application a la preparation de derives cyclopropaniques |
| US4342694A (en) * | 1979-11-01 | 1982-08-03 | Fmc Corporation | Processes for producing pyrethroid insecticide intermediates |
| US4235780A (en) * | 1979-11-01 | 1980-11-25 | Fmc Corporation | Derivatives of 2H-pyran-2-one |
| FR2479213A1 (fr) * | 1980-03-28 | 1981-10-02 | Roussel Uclaf | Procede de preparation d'acide pentenoique possedant une fonction aldehyde |
-
1979
- 1979-06-06 FR FR7914425A patent/FR2458533A1/fr active Granted
-
1980
- 1980-05-27 US US06/153,338 patent/US4556732A/en not_active Expired - Lifetime
- 1980-06-03 EP EP80400789A patent/EP0023849B1/fr not_active Expired
- 1980-06-03 AT AT82200370T patent/ATE9225T1/de not_active IP Right Cessation
- 1980-06-03 EP EP82200366A patent/EP0057491B1/fr not_active Expired
- 1980-06-03 EP EP82200370A patent/EP0057045B1/fr not_active Expired
- 1980-06-03 AT AT82200366T patent/ATE8781T1/de active
- 1980-06-05 CA CA000353428A patent/CA1142958A/fr not_active Expired
- 1980-06-05 HU HU80801423A patent/HU180358B/hu not_active IP Right Cessation
- 1980-06-06 JP JP7569080A patent/JPS5629544A/ja active Granted
-
1982
- 1982-07-01 US US06/394,457 patent/US4443617A/en not_active Expired - Lifetime
-
1984
- 1984-01-19 US US06/571,995 patent/US4500720A/en not_active Expired - Lifetime
-
1987
- 1987-01-13 JP JP62004211A patent/JPS62161778A/ja active Granted
- 1987-01-13 JP JP62004212A patent/JPS63239279A/ja active Granted
-
1990
- 1990-11-09 JP JP2302825A patent/JPH03173880A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ATE9225T1 (de) | 1984-09-15 |
| JPS5629544A (en) | 1981-03-24 |
| ATE8781T1 (de) | 1984-08-15 |
| EP0057045B1 (fr) | 1984-09-05 |
| EP0023849A2 (fr) | 1981-02-11 |
| CA1142958A (fr) | 1983-03-15 |
| EP0057045A2 (fr) | 1982-08-04 |
| JPH03173880A (ja) | 1991-07-29 |
| FR2458533B1 (https=) | 1983-07-18 |
| EP0057491A3 (en) | 1982-08-18 |
| EP0023849B1 (fr) | 1983-05-04 |
| US4500720A (en) | 1985-02-19 |
| JPH02352B2 (https=) | 1990-01-08 |
| JPH0321550B2 (https=) | 1991-03-22 |
| EP0057491B1 (fr) | 1984-08-01 |
| JPS62161778A (ja) | 1987-07-17 |
| US4556732A (en) | 1985-12-03 |
| JPS63239279A (ja) | 1988-10-05 |
| JPH0417953B2 (https=) | 1992-03-26 |
| FR2458533A1 (fr) | 1981-01-02 |
| EP0057045A3 (en) | 1982-08-18 |
| US4443617A (en) | 1984-04-17 |
| JPS6234027B2 (https=) | 1987-07-24 |
| EP0057491A2 (fr) | 1982-08-11 |
| EP0023849A3 (en) | 1981-05-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Aristoff et al. | Total synthesis of a novel antiulcer agent via a modification of the intramolecular Wadsworth-Emmons-Wittig reaction | |
| HU196198B (en) | Process for producing cis-1-aryl-2-(fluoromethyl)-oxiranes | |
| HU180358B (en) | Process for producing substituted cyclopropane derivatives | |
| US4536334A (en) | Preparation of β-lactam derivatives | |
| Ent et al. | 2-azonia-Cope rearrangement in N-acyliminium cyclizations | |
| Tanikaga et al. | Stereochemical behavior of intermediary compounds in the amine-catalyzed Knoevenagel reaction. | |
| US4413145A (en) | Process for the synthesis of 3-keto-cyclopentene-5-oxy derivatives having insecticide activity | |
| US5142066A (en) | Stereoselective process for the preparation of 2-amino-ethanol derivatives having a central analgesic activity and intermidiates thereof | |
| EP0240338B1 (en) | Butenoic acid derivatives | |
| HU182338B (en) | Process for producing bis-hydroxybenzyl derivatives and pharmaceutical compositions containing them | |
| US4769478A (en) | Preparation of (1,5) 6,6-dimethyl-4-hydroxy-3-oxabicyclo (3,1,0) hexan-2-one and its ethers | |
| US4585880A (en) | Process for the preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetoxyacetic acid | |
| US4985571A (en) | 6-membered lactones useful as intermediates for antilipemic mevalonic acid lactones | |
| WO2010013510A1 (ja) | 光学活性化合物の製造方法 | |
| US6049009A (en) | Production method of optically active trans-vinylsulfide alcohol | |
| FI85375B (fi) | Nytt foerfarande foer framstaellning av apovinkaminolderivat. | |
| Gunda et al. | Asymmetric synthesis of cis 3-phthalimido-4-styryl-2-azetidinones. Application of a new chiral N-protecting group in monobactam chemistry | |
| US4434099A (en) | Beta-lactam compounds containing a protected C-acetyl group, process for their preparation and pharmaceutical compositions containing them | |
| US4220794A (en) | Synthetic intermediates for the preparation of diaromatic O-(amino-alkyl)oximes | |
| US3028393A (en) | Novel 1-(3-indoyl)-1, 2-alkanediols and substituted hydroxymethyl 3-in-dolyl ketones | |
| JPH0129793B2 (https=) | ||
| SE453083B (sv) | Forfarande for framstellning av azetidinonettiksyraderivat | |
| SU475770A3 (ru) | Способ получени изомеров 1 ( -оксифенэтил)-1-фенил-2,3,дигидроизоиндолов | |
| JPS62132838A (ja) | テトラヒドロナフタセン誘導体の製造法 | |
| JPH04321682A (ja) | 1,4−ジヒドロピリジン誘導体の製造法及びその中間体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |