GB1452208A - Paper-making machines twin-wire forming section - Google Patents
Paper-making machines twin-wire forming sectionInfo
- Publication number
- GB1452208A GB1452208A GB1154974A GB1154974A GB1452208A GB 1452208 A GB1452208 A GB 1452208A GB 1154974 A GB1154974 A GB 1154974A GB 1154974 A GB1154974 A GB 1154974A GB 1452208 A GB1452208 A GB 1452208A
- Authority
- GB
- United Kingdom
- Prior art keywords
- roll
- web
- wires
- wire
- sector
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011888 foil Substances 0.000 abstract 2
- 238000004064 recycling Methods 0.000 abstract 1
- YSGSDAIMSCVPHG-UHFFFAOYSA-N valyl-methionine Chemical compound CSCCC(C(O)=O)NC(=O)C(N)C(C)C YSGSDAIMSCVPHG-UHFFFAOYSA-N 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F9/00—Complete machines for making continuous webs of paper
- D21F9/003—Complete machines for making continuous webs of paper of the twin-wire type
Landscapes
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00344260A US3846232A (en) | 1973-03-23 | 1973-03-23 | Twin-wire paper forming with wires wrapping around a suction web-forming breast roll and then following a curved path to a suction couch roll |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1452208A true GB1452208A (en) | 1976-10-13 |
Family
ID=23349745
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1154974A Expired GB1452208A (en) | 1973-03-23 | 1974-03-15 | Paper-making machines twin-wire forming section |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3846232A (enrdf_load_stackoverflow) |
| JP (1) | JPS5024511A (enrdf_load_stackoverflow) |
| AT (1) | AT340761B (enrdf_load_stackoverflow) |
| CA (1) | CA1009883A (enrdf_load_stackoverflow) |
| DE (1) | DE2413421C3 (enrdf_load_stackoverflow) |
| FR (1) | FR2222481B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1452208A (enrdf_load_stackoverflow) |
| IT (1) | IT1005881B (enrdf_load_stackoverflow) |
| SE (1) | SE397695B (enrdf_load_stackoverflow) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI72544C (fi) * | 1975-06-13 | 1987-06-08 | Valmet Oy | Formare med tvao viror i pappersmaskin. |
| JPS547884B2 (enrdf_load_stackoverflow) * | 1973-03-12 | 1979-04-11 | ||
| SE7507159L (sv) * | 1975-06-23 | 1976-12-24 | Karlstad Mekaniska Ab | Anordning for framstellning av en fiberbana |
| FI74060C (fi) * | 1975-09-17 | 1987-12-10 | Valmet Oy | Tissuepappersmaskin. |
| CH608051A5 (enrdf_load_stackoverflow) * | 1976-01-19 | 1978-12-15 | Escher Wyss Gmbh | |
| FI761030A7 (enrdf_load_stackoverflow) * | 1976-04-14 | 1977-10-15 | Valmet Oy | |
| FI64958C (fi) * | 1978-02-07 | 1984-02-10 | Valmet Oy | Banformare med dubbelvira foer en pappersmaskin |
| DE2951183C2 (de) * | 1979-12-19 | 1984-05-10 | Andreas Kufferath KG, 5160 Düren | Vorrichtung zur Beeinflussung einer vorentwässerten Fasersuspension |
| US4686005B1 (en) * | 1980-02-06 | 1995-10-17 | Escher Wyss Gmbh | Method of washing stock suspensions by removing undesired material through an endless revolving wire |
| CH644414A5 (de) * | 1980-02-06 | 1984-07-31 | Escher Wyss Gmbh | Siebmaschine, insbesondere zur behandlung von aus altpapier gewonnenen waesserigen faserstoffsuspensionen. |
| SE421939B (sv) * | 1980-06-05 | 1982-02-08 | Karlstad Mekaniska Ab | Forfarande for bakvattenhantering |
| US4443297A (en) * | 1980-08-18 | 1984-04-17 | James River-Dixie/Northern, Inc. | Apparatus and method for the manufacture of a non-woven fibrous web |
| US4443299A (en) * | 1980-08-18 | 1984-04-17 | James River-Dixie/Northern, Inc. | Apparatus and method for the manufacture of a non-woven fibrous web |
| DE3233724D2 (en) * | 1981-02-28 | 1983-01-13 | Voith Gmbh | Device for continuously dehydrating a fiber web |
| SE428811B (sv) * | 1981-12-03 | 1983-07-25 | Karlstad Mekaniska Ab | Forfarande och anordning for framstellning av en flerskiktad pappersbana |
| US4790909A (en) * | 1986-12-17 | 1988-12-13 | Beloit Corporation | Two-wire paper forming apparatus |
| FI79362C (fi) * | 1988-05-18 | 1989-12-11 | Tampella Oy Ab | Vals foer banbildningsdel av en pappersmaskin el. liknande. |
| DE3913292A1 (de) * | 1989-04-22 | 1990-10-25 | Voith Gmbh J M | Zylinder zur fuehrung von laufenden warenbahnen |
| FI83977C (fi) * | 1989-11-06 | 1991-09-25 | Valmet Paper Machinery Inc | Gapformare i pappersmaskin. |
| FI91788C (fi) * | 1990-09-12 | 1994-08-10 | Valmet Paper Machinery Inc | Paperikoneen kaksiviirainen rainanmuodostusosa |
| CA2053505C (en) | 1990-10-17 | 1999-04-13 | John Henry Dwiggins | Foam forming method and apparatus |
| DE4117597A1 (de) * | 1991-05-29 | 1992-12-03 | Voith Gmbh J M | Doppelsiebformer fuer eine papiermaschine |
| DE4420801C2 (de) * | 1994-06-16 | 1997-01-30 | Voith Gmbh J M | Verfahren zum Betreiben einer Doppelsiebzone einer Papiermaschine zur Herstellung von Faserstoffbahnen sowie Siebzone hierzu |
| DE19903943A1 (de) * | 1999-01-28 | 2000-08-03 | Voith Sulzer Papiertech Patent | Verfahren und Vorrichtung zum Bilden einer Faserstoffbahn |
| US6375799B1 (en) | 1999-01-28 | 2002-04-23 | Voith Sulzer Papiertechnik Patent Gmbh | Process and apparatus for producing a fibrous material web |
| DE10063516A1 (de) * | 2000-12-20 | 2002-06-27 | Voith Paper Patent Gmbh | Doppelsiebformer einer Maschine zur Herstellung einer Faserstoffbahn aus einer Faserstoffsuspension |
| FI115512B (fi) * | 2001-11-09 | 2005-05-31 | Ahlstrom Glassfibre Oy | Menetelmä ja laitteisto vaahtorainauksen suorittamiseksi |
| US6921459B2 (en) * | 2002-09-10 | 2005-07-26 | Fibermark, Inc. | Process for making a sheet of aramid fibers using a foamed medium |
| SE532154C2 (sv) * | 2006-10-06 | 2009-11-03 | Metso Paper Inc | Dubbelvirapress innefattande tätningselement för avvattning av en fibersuspension |
-
1973
- 1973-03-23 US US00344260A patent/US3846232A/en not_active Expired - Lifetime
-
1974
- 1974-03-15 GB GB1154974A patent/GB1452208A/en not_active Expired
- 1974-03-19 AT AT226274A patent/AT340761B/de not_active IP Right Cessation
- 1974-03-20 DE DE2413421A patent/DE2413421C3/de not_active Expired
- 1974-03-20 JP JP49031067A patent/JPS5024511A/ja active Pending
- 1974-03-20 FR FR7409433A patent/FR2222481B1/fr not_active Expired
- 1974-03-21 SE SE7403820A patent/SE397695B/xx unknown
- 1974-03-22 CA CA195,947A patent/CA1009883A/en not_active Expired
- 1974-03-25 IT IT49633/74A patent/IT1005881B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5024511A (enrdf_load_stackoverflow) | 1975-03-15 |
| DE2413421B2 (de) | 1978-06-15 |
| DE2413421C3 (de) | 1979-02-22 |
| CA1009883A (en) | 1977-05-10 |
| ATA226274A (de) | 1976-04-15 |
| FR2222481B1 (enrdf_load_stackoverflow) | 1979-10-12 |
| AT340761B (de) | 1978-01-10 |
| DE2413421A1 (de) | 1974-10-24 |
| IT1005881B (it) | 1976-09-30 |
| SE397695B (sv) | 1977-11-14 |
| FR2222481A1 (enrdf_load_stackoverflow) | 1974-10-18 |
| US3846232A (en) | 1974-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1452208A (en) | Paper-making machines twin-wire forming section | |
| US3846233A (en) | Papermaking machine having a single wire run and a double wire run over a downwardly curving dewatering box | |
| US4417950A (en) | Papermaking machine containing two movable water pervious dewatering bands | |
| GB1577273A (en) | Machine for making tissue paper | |
| US4056433A (en) | Ascending twin-wire paper machine without web pick-up | |
| US4055461A (en) | Paper machine with single-wire and curved twin-wire formers | |
| EP0373133A2 (en) | Method and device in the formation of a paper or board web | |
| US5599427A (en) | Twin-wire web former in a paper machine | |
| EP0296135B1 (en) | Hydrid former for a paper machine | |
| GB1477049A (en) | Method and apparatus for continuously forming a fibrous web | |
| DE69124557D1 (de) | Doppelsiebbahnbildner in einer Papiermaschine | |
| US3746613A (en) | Twin wire paper making machine wherein the wires travel in an arc | |
| CA2151645C (en) | Hybrid former for a paper machine | |
| GB1482855A (en) | Twin-wire paper-making machine and a method of making paper therewith | |
| CA1317141C (en) | Twin-wire former and method for producing a fibrous web | |
| SE8604035D0 (sv) | Forfarande och anordning for att forbettra pappersframstellningsprocessen i en planvirasektion | |
| GB1288277A (enrdf_load_stackoverflow) | ||
| GB1488540A (en) | Paper-making machine twin wire forming section | |
| GB1512617A (en) | Twin-wire former in a paper machine | |
| GB1327444A (en) | Apparatus for forming a fibrous web | |
| EP1461491B1 (en) | Method and apparatus for draining fibre pulp suspension | |
| ES474996A1 (es) | Maquina para hacer papel continuo | |
| GB1315925A (en) | Wire part of a twin-wire web-forming machine | |
| ATE207154T1 (de) | Doppelsiebformer in einer papiermaschine | |
| GB1287154A (en) | Improved paper forming arrangement |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |