GB1301431A - - Google Patents
Info
- Publication number
- GB1301431A GB1301431A GB2453871*A GB1301431DA GB1301431A GB 1301431 A GB1301431 A GB 1301431A GB 1301431D A GB1301431D A GB 1301431DA GB 1301431 A GB1301431 A GB 1301431A
- Authority
- GB
- United Kingdom
- Prior art keywords
- group
- hydrogen
- general formula
- amino
- halogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 6
- 125000005843 halogen group Chemical group 0.000 abstract 5
- 229910052739 hydrogen Inorganic materials 0.000 abstract 5
- 239000001257 hydrogen Substances 0.000 abstract 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 4
- 125000003282 alkyl amino group Chemical group 0.000 abstract 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 2
- WLTFPYVGECWXFO-UHFFFAOYSA-N 1-phenyl-4-piperidin-1-ylbutan-1-one Chemical class C=1C=CC=CC=1C(=O)CCCN1CCCCC1 WLTFPYVGECWXFO-UHFFFAOYSA-N 0.000 abstract 2
- GHHSOUYJYMAISL-UHFFFAOYSA-N 3-(3-piperidin-1-ylpropyl)-1h-indole Chemical compound C=1NC2=CC=CC=C2C=1CCCN1CCCCC1 GHHSOUYJYMAISL-UHFFFAOYSA-N 0.000 abstract 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 125000005236 alkanoylamino group Chemical group 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 238000006193 diazotization reaction Methods 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 150000002366 halogen compounds Chemical class 0.000 abstract 1
- 230000007062 hydrolysis Effects 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 230000003647 oxidation Effects 0.000 abstract 1
- 238000007254 oxidation reaction Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- 230000000506 psychotropic effect Effects 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/48—Oxygen atoms attached in position 4 having an acyclic carbon atom attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2372470 | 1970-03-20 | ||
| JP4430470A JPS5019553B1 (enExample) | 1970-05-22 | 1970-05-22 | |
| JP4666970 | 1970-05-29 | ||
| JP4667070 | 1970-05-29 | ||
| JP4677370A JPS5426551B1 (enExample) | 1970-05-30 | 1970-05-30 | |
| JP4697070 | 1970-05-30 | ||
| JP4677070 | 1970-05-30 | ||
| JP4893070 | 1970-06-06 | ||
| BE764537A BE764537A (fr) | 1970-03-20 | 1971-03-19 | Gamma-piperidino-butyrophenones |
| NL7103722A NL7103722A (enExample) | 1970-03-20 | 1971-03-19 | |
| DE19712113254 DE2113254C3 (de) | 1970-03-20 | 1971-03-19 | Verfahren zur Herstellung von γ-Piperidinoburyrophenonderivaten |
| FR7109952A FR2085728B1 (enExample) | 1970-03-20 | 1971-03-22 | |
| GB2453871 | 1971-04-19 | ||
| FR7229835A FR2196153B2 (enExample) | 1970-03-20 | 1972-08-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1301431A true GB1301431A (enExample) | 1972-12-29 |
Family
ID=27584630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB2453871*A Expired GB1301431A (enExample) | 1970-03-20 | 1971-04-19 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3799932A (enExample) |
| BE (1) | BE764537A (enExample) |
| CA (1) | CA975779A (enExample) |
| CH (3) | CH554861A (enExample) |
| DE (1) | DE2166381C3 (enExample) |
| FR (2) | FR2085728B1 (enExample) |
| GB (1) | GB1301431A (enExample) |
| NL (1) | NL7103722A (enExample) |
| SE (1) | SE394671B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3799932A (en) * | 1970-03-20 | 1974-03-26 | Sumitomo Chemical Co | Gamma-piperidinobutyrophenones |
| US4148796A (en) * | 1971-03-15 | 1979-04-10 | Sumitomo Chemical Company, Limited | γ-Piperidinobutyrophenones |
| JPS5755714B2 (enExample) * | 1972-03-18 | 1982-11-25 | ||
| SE419441B (sv) * | 1972-03-18 | 1981-08-03 | Sumitomo Chemical Co | Forfarande for framstellning av butyrofenonderivat |
| US4009173A (en) * | 1972-06-12 | 1977-02-22 | Sumitomo Chemical Company, Limited | Butyrophenone derivatives |
| JPS5760335B2 (enExample) * | 1972-06-14 | 1982-12-18 | Sumitomo Chemical Co | |
| US3992546A (en) * | 1973-10-18 | 1976-11-16 | Ciba-Geigy Corporation | 4-Piperidinobutyrophenones as neuroleptics |
| US3989707A (en) * | 1974-06-21 | 1976-11-02 | Janssen Pharmaceutica N.V. | Benzimidazolinone derivatives |
| FI60390C (fi) * | 1975-03-05 | 1982-01-11 | Sumitomo Chemical Co | Foerfarande foer framstaellning av neuroleptiska butyrofenoner |
| FI60559C (fi) * | 1975-07-17 | 1982-02-10 | Sumitomo Chemical Co | Foerfarande foer framstaellning av ny-(tertiaer amino)-orto-aminobutyrofenonfoereningar |
| US4284636A (en) * | 1979-09-04 | 1981-08-18 | Richardson-Merrell Inc. | Cinnamoylpiperidinobutyrophenone antipsychotic agents |
| GB8321157D0 (en) * | 1983-08-05 | 1983-09-07 | Fordonal Sa | Piperidine derivatives |
| JPH0832681B2 (ja) * | 1985-08-22 | 1996-03-29 | 住友化学工業株式会社 | 2−ヨ−ドブチロフエノン誘導体およびその製造法 |
| GB9523460D0 (en) * | 1995-11-16 | 1996-01-17 | Merck Sharp & Dohme | Therapeutic agents |
| US8604031B2 (en) * | 2006-05-18 | 2013-12-10 | Mannkind Corporation | Intracellular kinase inhibitors |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB895309A (en) * | 1959-11-18 | 1962-05-02 | Res Lab Dr C Janssen Nv | Pyrrolidine and piperidine derivatives |
| US3799932A (en) * | 1970-03-20 | 1974-03-26 | Sumitomo Chemical Co | Gamma-piperidinobutyrophenones |
-
1971
- 1971-03-15 US US00124522A patent/US3799932A/en not_active Expired - Lifetime
- 1971-03-18 CH CH398771A patent/CH554861A/xx not_active IP Right Cessation
- 1971-03-18 CH CH944774A patent/CH559724A5/xx not_active IP Right Cessation
- 1971-03-18 CH CH944874A patent/CH559177A5/xx not_active IP Right Cessation
- 1971-03-19 CA CA108,246A patent/CA975779A/en not_active Expired
- 1971-03-19 NL NL7103722A patent/NL7103722A/xx not_active Application Discontinuation
- 1971-03-19 SE SE7103639A patent/SE394671B/xx unknown
- 1971-03-19 DE DE2166381A patent/DE2166381C3/de not_active Expired
- 1971-03-19 BE BE764537A patent/BE764537A/xx not_active IP Right Cessation
- 1971-03-22 FR FR7109952A patent/FR2085728B1/fr not_active Expired
- 1971-04-19 GB GB2453871*A patent/GB1301431A/en not_active Expired
-
1972
- 1972-08-21 FR FR7229835A patent/FR2196153B2/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2113254B2 (de) | 1977-06-08 |
| DE2166381C3 (de) | 1982-02-04 |
| FR2196153B2 (enExample) | 1975-10-17 |
| CH559724A5 (enExample) | 1975-03-14 |
| US3799932A (en) | 1974-03-26 |
| FR2085728B1 (enExample) | 1974-08-30 |
| DE2166381A1 (de) | 1973-11-29 |
| DE2166381B2 (enExample) | 1981-02-05 |
| BE764537A (fr) | 1971-08-16 |
| NL7103722A (enExample) | 1971-09-22 |
| FR2196153A2 (enExample) | 1974-03-15 |
| CH554861A (de) | 1974-10-15 |
| FR2085728A1 (enExample) | 1971-12-31 |
| DE2113254A1 (de) | 1971-10-07 |
| CH559177A5 (enExample) | 1975-02-28 |
| CA975779A (en) | 1975-10-07 |
| SE394671B (sv) | 1977-07-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1301431A (enExample) | ||
| GB1323283A (en) | Benzothiazine 1,1, dioxide derivatives | |
| IE36106L (en) | Isoindoline derivatives | |
| GB1459065A (en) | Therapeutic thiophene derivatives | |
| IE40052L (en) | Piperidinoalkylindoles | |
| GB1513320A (en) | N-propargyl-2-phenylamino-2-imidazolines | |
| GB1342520A (en) | Alpha-alkyl-substituted benzyl or thenyl-benzyloxy derivatives of amines | |
| GB1411583A (en) | Aminophenyl-substituted alkyl-heterocyclic derivatives and processes for producing them | |
| IE43819L (en) | 1-naphthalene and 4-quinolinecarboxamides. | |
| GB1228736A (enExample) | ||
| GB1301243A (enExample) | ||
| GB1409648A (en) | Substituted pyrrolidinemethanol compounds and pharmaceutical compositions thereof | |
| GB1530074A (en) | Rho-acetamidophenol derivatives the preparation thereof and the use of such derivatives as therapeutic agents | |
| GB1448781A (en) | N- omega-amino- alkylaniline compounds | |
| GB1245155A (en) | NOVEL 5-SUBSTITUTED-gamma-CARBOLINE DERIVATIVES AND THE SALTS THEREOF | |
| GB1464242A (en) | Benzoyl benzofurans and compositions comprising them | |
| GB1449802A (en) | Piperazine derivatives and compositions containing them for treating parkinsons disease | |
| GB1467761A (en) | Phenoxypropylamine derivatives and preparation thereof | |
| GB1447580A (en) | Alpha-aminooxycarboxylic amides | |
| GB1327157A (en) | N-acyl-piperazinoalkyl-pyrazoles and their preparation | |
| GB1254270A (en) | Benzoxazepine derivatives | |
| GB1501475A (en) | Piperidinobutyrophenone derivatives | |
| GB1442619A (en) | 3-phenoxypropylamine derivatives their preparation and use | |
| GB1527483A (en) | 2-aminomethyl-5-phenyloxazoles and the pharmaceutically acceptable acid addition salts thereof | |
| GB1384523A (en) | Oxime derivatives and their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |