GB1218623A - Susbtituted-5-pyrimidine compounds - Google Patents
Susbtituted-5-pyrimidine compoundsInfo
- Publication number
- GB1218623A GB1218623A GB20001/68A GB2000168A GB1218623A GB 1218623 A GB1218623 A GB 1218623A GB 20001/68 A GB20001/68 A GB 20001/68A GB 2000168 A GB2000168 A GB 2000168A GB 1218623 A GB1218623 A GB 1218623A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkyl
- april
- cycloalkyl
- phenyl
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 thieny] Chemical group 0.000 abstract 6
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 abstract 2
- 239000000203 mixture Substances 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- 230000008635 plant growth Effects 0.000 abstract 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 2
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000004423 acyloxy group Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 235000013305 food Nutrition 0.000 abstract 1
- 125000002541 furyl group Chemical group 0.000 abstract 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 231100001184 nonphytotoxic Toxicity 0.000 abstract 1
- 150000003230 pyrimidines Chemical class 0.000 abstract 1
- 125000000714 pyrimidinyl group Chemical group 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/60—Three or more oxygen or sulfur atoms
- C07D239/62—Barbituric acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US63407467A | 1967-04-27 | 1967-04-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1218623A true GB1218623A (en) | 1971-01-06 |
Family
ID=24542329
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB20001/68A Expired GB1218623A (en) | 1967-04-27 | 1968-04-26 | Susbtituted-5-pyrimidine compounds |
Country Status (16)
Cited By (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2648705A1 (de) * | 1975-10-29 | 1977-05-05 | Lilly Industries Ltd | Verfahren zur herstellung eines fungiziden mittels, fungizides mittel und verfahren zur behandlung von pilzinfektionen bei pflanzen |
| DE2655407A1 (de) * | 1975-12-09 | 1977-07-07 | Lilly Industries Ltd | Fungizide zubereitung, verfahren zu ihrer herstellung und verfahren zur behandlung von pilzinfektionen bei kulturpflanzen |
| DE2812287A1 (de) | 1977-03-28 | 1978-10-05 | Lilly Industries Ltd | Fungizides mittel |
| EP0029282A1 (en) * | 1979-11-02 | 1981-05-27 | Eli Lilly And Company | Process for preparing 5-halopyrimidines and 5-pyrimidine methanols |
| EP0096787A1 (de) * | 1982-06-09 | 1983-12-28 | Bayer Ag | Graswuchshemmende Mittel |
| DE3326664A1 (de) * | 1982-07-29 | 1984-02-02 | Lilly Industries Ltd., London | Fungizides mittel und verfahren zu seiner herstellung |
| GB2200110A (en) * | 1986-12-23 | 1988-07-27 | Ici Plc | Pyrimidine derivatives |
| EP0304171A1 (en) * | 1987-08-20 | 1989-02-22 | Imperial Chemical Industries Plc | Pyrimidine derivatives |
| GB2219794A (en) * | 1988-06-20 | 1989-12-20 | Ici Plc | Plant growth regulating and fungicidal pyrimidine derivatives |
| US4933339A (en) * | 1985-08-21 | 1990-06-12 | Rohm And Haas Company | (2-cyano-2-arylethyl)pyridine compounds useful in controlling fungicidal activity |
| US5464839A (en) * | 1993-09-24 | 1995-11-07 | Basf Aktiengesellschaft | Fungicidal mixtures |
| US5591726A (en) * | 1994-09-26 | 1997-01-07 | American Cyanamid Company | Heterocyclylalkyl diarylboron ester and thioester fungicidal agents |
| US5665680A (en) * | 1994-08-24 | 1997-09-09 | Sumitomo Chemical Company, Limited | Method for increasing yield of soybean by inhibition of gibberellin biosynthesis |
| US6194417B1 (en) | 1996-04-26 | 2001-02-27 | Basf Aktiengesellschaft | Fungicide mixtures |
| US6316452B1 (en) | 1998-05-18 | 2001-11-13 | Basf Aktiengesellschaft | Fungicidal mixture |
| US6372748B1 (en) | 1997-12-18 | 2002-04-16 | Basf Aktiengesellschaft | Fungicide mixtures based on pyridine amides and fenarimol |
| US6767923B2 (en) | 2001-10-31 | 2004-07-27 | Basf Aktiengesellschaft | Benzhydryl derivatives |
| WO2009040397A1 (en) | 2007-09-26 | 2009-04-02 | Basf Se | Ternary fungicidal compositions comprising boscalid and chlorothalonil |
| EP2258177A2 (en) | 2006-12-15 | 2010-12-08 | Rohm and Haas Company | Mixtures comprising 1-methylcyclopropene |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| EP2392662A2 (en) | 2007-04-23 | 2011-12-07 | Basf Se | Plant produtivity enhancement by combining chemical agents with transgenic modifications |
| WO2012010567A1 (en) * | 2010-07-19 | 2012-01-26 | Syngenta Participations Ag | Isoxazole, isothiazole, furane and thiophene compounds as microbicides |
| WO2012084670A1 (en) | 2010-12-20 | 2012-06-28 | Basf Se | Pesticidal active mixtures comprising pyrazole compounds |
| EP2481284A2 (en) | 2011-01-27 | 2012-08-01 | Basf Se | Pesticidal mixtures |
| EP2489266A2 (en) | 2006-09-18 | 2012-08-22 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| WO2012127009A1 (en) | 2011-03-23 | 2012-09-27 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| WO2013030338A2 (en) | 2011-09-02 | 2013-03-07 | Basf Se | Agricultural mixtures comprising arylquinazolinone compounds |
| WO2013189801A1 (en) | 2012-06-20 | 2013-12-27 | Basf Se | Pyrazole compound and pesticidal mixtures comprising a pyrazole compound |
| EP2679096A1 (en) | 2007-02-06 | 2014-01-01 | Basf Se | Pesticidal mixtures |
| WO2014056780A1 (en) | 2012-10-12 | 2014-04-17 | Basf Se | A method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| WO2014095994A1 (en) | 2012-12-20 | 2014-06-26 | Basf Se | Compositions comprising a triazole compound |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| WO2015036058A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| US10899932B2 (en) | 2014-10-24 | 2021-01-26 | Basf Se | Non-amphoteric, quaternisable and water-soluble polymers for modifying the surface charge of solid particles |
-
1968
- 1968-04-18 FR FR1569940D patent/FR1569940A/fr not_active Expired
- 1968-04-22 BE BE714003D patent/BE714003A/xx not_active IP Right Cessation
- 1968-04-23 SE SE05390/68A patent/SE347508B/xx unknown
- 1968-04-23 IL IL29865A patent/IL29865A/en unknown
- 1968-04-23 ES ES353047A patent/ES353047A1/es not_active Expired
- 1968-04-25 AT AT840469A patent/AT308466B/de not_active IP Right Cessation
- 1968-04-25 NO NO1598/68A patent/NO123851B/no unknown
- 1968-04-25 AT AT404868A patent/AT291263B/de not_active IP Right Cessation
- 1968-04-26 GB GB20001/68A patent/GB1218623A/en not_active Expired
- 1968-04-26 DK DK192868A patent/DK131991C/da active
- 1968-04-26 CH CH622068A patent/CH506241A/de not_active IP Right Cessation
- 1968-04-26 BR BR198651/68A patent/BR6898651D0/pt unknown
- 1968-04-29 FI FI681222A patent/FI51181C/fi active
- 1968-04-29 NL NL686806106A patent/NL139173B/xx unknown
-
1971
- 1971-01-22 JP JP46001947A patent/JPS5111176B1/ja active Pending
- 1971-01-22 JP JP46001946A patent/JPS4910512B1/ja active Pending
- 1971-11-10 CY CY62071A patent/CY620A/xx unknown
-
1972
- 1972-12-30 MY MY29/72A patent/MY7200029A/xx unknown
-
1974
- 1974-12-30 MY MY164/74A patent/MY7400164A/xx unknown
Cited By (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2648705A1 (de) * | 1975-10-29 | 1977-05-05 | Lilly Industries Ltd | Verfahren zur herstellung eines fungiziden mittels, fungizides mittel und verfahren zur behandlung von pilzinfektionen bei pflanzen |
| DK152661B (da) * | 1975-10-29 | 1988-04-11 | Lilly Industries Ltd | Fremgangsmaade til behandling eller forebyggelse af fungusinfektioner paa planter og fungicidt praeparat til anvendelse ved fremgangsmaaden |
| DE2655407A1 (de) * | 1975-12-09 | 1977-07-07 | Lilly Industries Ltd | Fungizide zubereitung, verfahren zu ihrer herstellung und verfahren zur behandlung von pilzinfektionen bei kulturpflanzen |
| DE2812287A1 (de) | 1977-03-28 | 1978-10-05 | Lilly Industries Ltd | Fungizides mittel |
| DE2858350C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1977-03-28 | 1988-06-16 | Lilly Industries Ltd., London, Gb | |
| EP0029282A1 (en) * | 1979-11-02 | 1981-05-27 | Eli Lilly And Company | Process for preparing 5-halopyrimidines and 5-pyrimidine methanols |
| EP0096787A1 (de) * | 1982-06-09 | 1983-12-28 | Bayer Ag | Graswuchshemmende Mittel |
| DE3326664A1 (de) * | 1982-07-29 | 1984-02-02 | Lilly Industries Ltd., London | Fungizides mittel und verfahren zu seiner herstellung |
| US4933339A (en) * | 1985-08-21 | 1990-06-12 | Rohm And Haas Company | (2-cyano-2-arylethyl)pyridine compounds useful in controlling fungicidal activity |
| GB2200110A (en) * | 1986-12-23 | 1988-07-27 | Ici Plc | Pyrimidine derivatives |
| AU606100B2 (en) * | 1986-12-23 | 1991-01-31 | Imperial Chemical Industries Plc | Pyrimidine derivatives |
| US4902332A (en) * | 1987-08-20 | 1990-02-20 | Imperial Chemical Industries Plc | Pyrimidine derivatives |
| EP0304171A1 (en) * | 1987-08-20 | 1989-02-22 | Imperial Chemical Industries Plc | Pyrimidine derivatives |
| GB2219794A (en) * | 1988-06-20 | 1989-12-20 | Ici Plc | Plant growth regulating and fungicidal pyrimidine derivatives |
| US5464839A (en) * | 1993-09-24 | 1995-11-07 | Basf Aktiengesellschaft | Fungicidal mixtures |
| US5665680A (en) * | 1994-08-24 | 1997-09-09 | Sumitomo Chemical Company, Limited | Method for increasing yield of soybean by inhibition of gibberellin biosynthesis |
| AU704406B2 (en) * | 1994-09-26 | 1999-04-22 | American Cyanamid Company | Heterocyclylalkyl diarylboron ester and thioester fungicidal agents |
| US5591726A (en) * | 1994-09-26 | 1997-01-07 | American Cyanamid Company | Heterocyclylalkyl diarylboron ester and thioester fungicidal agents |
| US6194417B1 (en) | 1996-04-26 | 2001-02-27 | Basf Aktiengesellschaft | Fungicide mixtures |
| US6372748B1 (en) | 1997-12-18 | 2002-04-16 | Basf Aktiengesellschaft | Fungicide mixtures based on pyridine amides and fenarimol |
| US6316452B1 (en) | 1998-05-18 | 2001-11-13 | Basf Aktiengesellschaft | Fungicidal mixture |
| US6767923B2 (en) | 2001-10-31 | 2004-07-27 | Basf Aktiengesellschaft | Benzhydryl derivatives |
| EP2489266A2 (en) | 2006-09-18 | 2012-08-22 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| EP2489268A2 (en) | 2006-09-18 | 2012-08-22 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| EP2489265A2 (en) | 2006-09-18 | 2012-08-22 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| EP2489267A2 (en) | 2006-09-18 | 2012-08-22 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| EP2258177A2 (en) | 2006-12-15 | 2010-12-08 | Rohm and Haas Company | Mixtures comprising 1-methylcyclopropene |
| EP2679094A1 (en) | 2007-02-06 | 2014-01-01 | Basf Se | Pesticidal mixtures |
| EP2679096A1 (en) | 2007-02-06 | 2014-01-01 | Basf Se | Pesticidal mixtures |
| EP2679095A1 (en) | 2007-02-06 | 2014-01-01 | Basf Se | Pesticidal mixtures |
| EP2392662A2 (en) | 2007-04-23 | 2011-12-07 | Basf Se | Plant produtivity enhancement by combining chemical agents with transgenic modifications |
| WO2009040397A1 (en) | 2007-09-26 | 2009-04-02 | Basf Se | Ternary fungicidal compositions comprising boscalid and chlorothalonil |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| WO2012010567A1 (en) * | 2010-07-19 | 2012-01-26 | Syngenta Participations Ag | Isoxazole, isothiazole, furane and thiophene compounds as microbicides |
| WO2012084670A1 (en) | 2010-12-20 | 2012-06-28 | Basf Se | Pesticidal active mixtures comprising pyrazole compounds |
| EP2481284A2 (en) | 2011-01-27 | 2012-08-01 | Basf Se | Pesticidal mixtures |
| WO2012127009A1 (en) | 2011-03-23 | 2012-09-27 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| EP3378313A1 (en) | 2011-03-23 | 2018-09-26 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| WO2013030338A2 (en) | 2011-09-02 | 2013-03-07 | Basf Se | Agricultural mixtures comprising arylquinazolinone compounds |
| EP3300602A1 (en) | 2012-06-20 | 2018-04-04 | Basf Se | Pesticidal mixtures comprising a pyrazole compound |
| WO2013189801A1 (en) | 2012-06-20 | 2013-12-27 | Basf Se | Pyrazole compound and pesticidal mixtures comprising a pyrazole compound |
| EP3646731A1 (en) | 2012-06-20 | 2020-05-06 | Basf Se | Pesticidal mixtures comprising a pyrazole compound |
| WO2014056780A1 (en) | 2012-10-12 | 2014-04-17 | Basf Se | A method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| WO2014095994A1 (en) | 2012-12-20 | 2014-06-26 | Basf Se | Compositions comprising a triazole compound |
| EP3498098A1 (en) | 2012-12-20 | 2019-06-19 | BASF Agro B.V. | Compositions comprising a triazole compound |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| WO2015036058A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| US10899932B2 (en) | 2014-10-24 | 2021-01-26 | Basf Se | Non-amphoteric, quaternisable and water-soluble polymers for modifying the surface charge of solid particles |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1218623A (en) | Susbtituted-5-pyrimidine compounds | |
| IE802359L (en) | Guanidines | |
| BG60032B2 (bg) | Метод за получаване на триазолни производни | |
| ES477004A1 (es) | Procedimiento para preparar 3-azolil-benzo-1,2,4-triazinas ysus 1-oxidos. | |
| PL297374A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| EP0045198A3 (en) | 1,1-disubstituted carba-2-penems and their production | |
| GB1354571A (en) | Amides and their use as insecticides | |
| IL79026A0 (en) | 1-aryl-5-alkoximinoalkylaminopyrazoles,their preparation and their use as herbicides and plant growth regulators | |
| JPS5283432A (en) | Preparation and applications of 3-(2-aryl-2-propyl) urea derivatives | |
| CA2006577A1 (en) | Hypoglycaemic phenylamidines and phenylguanidines | |
| ES8300095A1 (es) | "un procedimiento para preparar derivados de halofenil-piridil-alilamina". | |
| GR74504B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| GB1238314A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| IE812975L (en) | Use of azolylglycols as plant growth regulants | |
| IL83725A0 (en) | 3-methylphthalimide derivatives,their preparation and their use as herbicides and plant growth regulants | |
| JPS57175171A (en) | 3,5-di-tert-butyl-4-hydroxyphenyl-substituted heterocyclic compound | |
| JPS57197218A (en) | Central nervous system depressant containing thiazoline- 5-carboxylic acid derivative | |
| GB1194302A (en) | 2,3,4,5,6-Pentachlorobenzylidenamine Derivatives | |
| GB1201139A (en) | Process for the preparation of hydroxyphenazine-di-n-oxides | |
| KE3188A (en) | Pyrimidine and triazine derivatives and their use as herbicides and plant growth regulants | |
| JPS5346973A (en) | 3-substituted amino-1,3-thiazolidin-2,4-diones, their preparation, and repellents of aquatic organisms containing the same | |
| JPS55167206A (en) | Industrial bactericidal and fungicidal agent | |
| GB1271926A (en) | 0h-1,5-benzodiazepinecarboxamide antiinflammatory agents | |
| GB1449300A (en) | Tricyclic compounds | |
| NO911342L (no) | Substituerte 3-tia- h.h.v. 3-oksa-alkylflavoner, fremgangsmaater for fremstilling, samt anvendelser derav. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 429A | Application made for amendment of specification (sect. 29/1949) | ||
| 429H | Application (made) for amendment of specification now open to opposition (sect. 29/1949) | ||
| 429D | Case decided by the comptroller ** specification amended (sect. 29/1949) | ||
| PS | Patent sealed [section 19, patents act 1949] | ||
| PE20 | Patent expired after termination of 20 years |