FR2621594A1 - - Google Patents
Download PDFInfo
- Publication number
- FR2621594A1 FR2621594A1 FR8714268A FR8714268A FR2621594A1 FR 2621594 A1 FR2621594 A1 FR 2621594A1 FR 8714268 A FR8714268 A FR 8714268A FR 8714268 A FR8714268 A FR 8714268A FR 2621594 A1 FR2621594 A1 FR 2621594A1
- Authority
- FR
- France
- Prior art keywords
- weight
- compositions according
- polyamide
- carbon atoms
- lanthanide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000203 mixture Substances 0.000 claims abstract description 81
- 229910052747 lanthanoid Inorganic materials 0.000 claims abstract description 55
- 150000002602 lanthanoids Chemical class 0.000 claims abstract description 49
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 35
- 229920002647 polyamide Polymers 0.000 claims abstract description 34
- 239000004952 Polyamide Substances 0.000 claims abstract description 31
- 239000000454 talc Substances 0.000 claims abstract description 23
- 229910052623 talc Inorganic materials 0.000 claims abstract description 23
- 150000001875 compounds Chemical class 0.000 claims abstract description 19
- 239000003365 glass fiber Substances 0.000 claims abstract description 11
- 239000005083 Zinc sulfide Substances 0.000 claims abstract description 10
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 claims abstract description 10
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000003063 flame retardant Substances 0.000 claims abstract description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 45
- -1 saturated aliphatic dicarboxylic acids Chemical class 0.000 claims description 29
- 229920000642 polymer Polymers 0.000 claims description 19
- 229910052684 Cerium Inorganic materials 0.000 claims description 16
- 239000002245 particle Substances 0.000 claims description 12
- 229910052746 lanthanum Inorganic materials 0.000 claims description 11
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims description 11
- 229910052779 Neodymium Inorganic materials 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 10
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 claims description 10
- 229910052777 Praseodymium Inorganic materials 0.000 claims description 9
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 claims description 9
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052727 yttrium Inorganic materials 0.000 claims description 6
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 claims description 6
- 229910052692 Dysprosium Inorganic materials 0.000 claims description 5
- 229910052693 Europium Inorganic materials 0.000 claims description 5
- 229910052688 Gadolinium Inorganic materials 0.000 claims description 5
- 229910052689 Holmium Inorganic materials 0.000 claims description 5
- 229910052765 Lutetium Inorganic materials 0.000 claims description 5
- 229910052773 Promethium Inorganic materials 0.000 claims description 5
- 229910052772 Samarium Inorganic materials 0.000 claims description 5
- 229910052771 Terbium Inorganic materials 0.000 claims description 5
- 229910052775 Thulium Inorganic materials 0.000 claims description 5
- 229910052769 Ytterbium Inorganic materials 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 claims description 5
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 claims description 5
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 claims description 5
- KJZYNXUDTRRSPN-UHFFFAOYSA-N holmium atom Chemical compound [Ho] KJZYNXUDTRRSPN-UHFFFAOYSA-N 0.000 claims description 5
- OHSVLFRHMCKCQY-UHFFFAOYSA-N lutetium atom Chemical compound [Lu] OHSVLFRHMCKCQY-UHFFFAOYSA-N 0.000 claims description 5
- VQMWBBYLQSCNPO-UHFFFAOYSA-N promethium atom Chemical compound [Pm] VQMWBBYLQSCNPO-UHFFFAOYSA-N 0.000 claims description 5
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 claims description 5
- NAWDYIZEMPQZHO-UHFFFAOYSA-N ytterbium Chemical compound [Yb] NAWDYIZEMPQZHO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052691 Erbium Inorganic materials 0.000 claims description 4
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 claims description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 4
- 229920001688 coating polymer Polymers 0.000 claims description 4
- UYAHIZSMUZPPFV-UHFFFAOYSA-N erbium Chemical compound [Er] UYAHIZSMUZPPFV-UHFFFAOYSA-N 0.000 claims description 4
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 claims description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 4
- 229920001568 phenolic resin Polymers 0.000 claims description 4
- 229920001169 thermoplastic Polymers 0.000 claims description 4
- 239000004416 thermosoftening plastic Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 150000004985 diamines Chemical class 0.000 claims description 3
- 239000003822 epoxy resin Substances 0.000 claims description 3
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 3
- 229920001308 poly(aminoacid) Polymers 0.000 claims description 3
- 238000006068 polycondensation reaction Methods 0.000 claims description 3
- 229920000647 polyepoxide Polymers 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 150000003951 lactams Chemical class 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims description 2
- 229920000728 polyester Polymers 0.000 claims description 2
- 229920006254 polymer film Polymers 0.000 claims description 2
- 238000006116 polymerization reaction Methods 0.000 claims description 2
- 244000249914 Hemigraphis reptans Species 0.000 claims 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 230000032683 aging Effects 0.000 abstract description 6
- 239000003381 stabilizer Substances 0.000 abstract description 4
- 230000001747 exhibiting effect Effects 0.000 abstract 1
- 238000012360 testing method Methods 0.000 description 28
- 235000012222 talc Nutrition 0.000 description 19
- 239000004677 Nylon Substances 0.000 description 15
- 229920001778 nylon Polymers 0.000 description 15
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 14
- 125000000217 alkyl group Chemical group 0.000 description 13
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 12
- 125000003545 alkoxy group Chemical group 0.000 description 11
- 125000001424 substituent group Chemical group 0.000 description 11
- 229920002302 Nylon 6,6 Polymers 0.000 description 10
- 125000005843 halogen group Chemical group 0.000 description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 229910052698 phosphorus Inorganic materials 0.000 description 9
- 239000011574 phosphorus Substances 0.000 description 9
- 229910052984 zinc sulfide Inorganic materials 0.000 description 9
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 8
- 125000003342 alkenyl group Chemical group 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000004122 cyclic group Chemical group 0.000 description 7
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 6
- 125000004429 atom Chemical group 0.000 description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 6
- 238000001125 extrusion Methods 0.000 description 6
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 239000000470 constituent Substances 0.000 description 5
- 239000000975 dye Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 239000004594 Masterbatch (MB) Substances 0.000 description 4
- 235000011037 adipic acid Nutrition 0.000 description 4
- 239000001361 adipic acid Substances 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 description 4
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 238000004079 fireproofing Methods 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000004595 color masterbatch Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- AKWLSBGVYJYBAL-UHFFFAOYSA-N 4-hexoxy-4-oxo-3-sulfanylbutanoic acid Chemical compound CCCCCCOC(=O)C(S)CC(O)=O AKWLSBGVYJYBAL-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 2
- YZBOVSFWWNVKRJ-UHFFFAOYSA-N Monobutylphthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(O)=O YZBOVSFWWNVKRJ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- 229920000305 Nylon 6,10 Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 150000005840 aryl radicals Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 2
- HDFRDWFLWVCOGP-UHFFFAOYSA-N carbonothioic O,S-acid Chemical class OC(S)=O HDFRDWFLWVCOGP-UHFFFAOYSA-N 0.000 description 2
- BTVVNGIPFPKDHO-UHFFFAOYSA-K cerium(3+);octadecanoate Chemical compound [Ce+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O BTVVNGIPFPKDHO-UHFFFAOYSA-K 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052950 sphalerite Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- QDKNFZZPOLFFQO-UHFFFAOYSA-N (4-tert-butylcyclohexyl) 2-sulfanylacetate Chemical compound CC(C)(C)C1CCC(OC(=O)CS)CC1 QDKNFZZPOLFFQO-UHFFFAOYSA-N 0.000 description 1
- PAUIKJKTXNZJEV-ARJAWSKDSA-N (z)-4-(2-ethoxyethoxy)-4-oxobut-2-enoic acid Chemical compound CCOCCOC(=O)\C=C/C(O)=O PAUIKJKTXNZJEV-ARJAWSKDSA-N 0.000 description 1
- FDNBQVCBHKEDOJ-FPLPWBNLSA-N (z)-4-(6-methylheptoxy)-4-oxobut-2-enoic acid Chemical compound CC(C)CCCCCOC(=O)\C=C/C(O)=O FDNBQVCBHKEDOJ-FPLPWBNLSA-N 0.000 description 1
- LIKQHVGPOUBDTG-UHFFFAOYSA-N 1,4-diphenylbutane-1,3-dione Chemical compound C=1C=CC=CC=1CC(=O)CC(=O)C1=CC=CC=C1 LIKQHVGPOUBDTG-UHFFFAOYSA-N 0.000 description 1
- LRQGFQDEQPZDQC-UHFFFAOYSA-N 1-Phenyl-1,3-eicosanedione Chemical compound CCCCCCCCCCCCCCCCCC(=O)CC(=O)C1=CC=CC=C1 LRQGFQDEQPZDQC-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 1
- GUOSQNAUYHMCRU-UHFFFAOYSA-N 11-Aminoundecanoic acid Chemical compound NCCCCCCCCCCC(O)=O GUOSQNAUYHMCRU-UHFFFAOYSA-N 0.000 description 1
- PBLZLIFKVPJDCO-UHFFFAOYSA-N 12-aminododecanoic acid Chemical compound NCCCCCCCCCCCC(O)=O PBLZLIFKVPJDCO-UHFFFAOYSA-N 0.000 description 1
- XSXWOBXNYNULJG-UHFFFAOYSA-N 2-(2,4,4-trimethylpentan-2-yl)phenol Chemical class CC(C)(C)CC(C)(C)C1=CC=CC=C1O XSXWOBXNYNULJG-UHFFFAOYSA-N 0.000 description 1
- QJQIVZBVEBCTKR-UHFFFAOYSA-N 2-(3-methylbutyl)phenol Chemical class CC(C)CCC1=CC=CC=C1O QJQIVZBVEBCTKR-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical class CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- IXQGCWUGDFDQMF-UHFFFAOYSA-N 2-Ethylphenol Chemical class CCC1=CC=CC=C1O IXQGCWUGDFDQMF-UHFFFAOYSA-N 0.000 description 1
- JINGUCXQUOKWKH-UHFFFAOYSA-N 2-aminodecanoic acid Chemical compound CCCCCCCCC(N)C(O)=O JINGUCXQUOKWKH-UHFFFAOYSA-N 0.000 description 1
- GJYCVCVHRSWLNY-UHFFFAOYSA-N 2-butylphenol Chemical class CCCCC1=CC=CC=C1O GJYCVCVHRSWLNY-UHFFFAOYSA-N 0.000 description 1
- FDIPWBUDOCPIMH-UHFFFAOYSA-N 2-decylphenol Chemical class CCCCCCCCCCC1=CC=CC=C1O FDIPWBUDOCPIMH-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical class CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-L 2-mercaptosuccinate Chemical compound OC(=O)CC([S-])C([O-])=O NJRXVEJTAYWCQJ-UHFFFAOYSA-L 0.000 description 1
- JKDSJCNGFMDCRM-UHFFFAOYSA-N 2-methyl-1-phenylhexane-1,5-dione Chemical compound CC(=O)CCC(C)C(=O)C1=CC=CC=C1 JKDSJCNGFMDCRM-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- REHCNBGWPLVSIJ-UHFFFAOYSA-N 3-methyl-2-(4-methylpentyl)phenol Chemical class CC(C)CCCC1=C(C)C=CC=C1O REHCNBGWPLVSIJ-UHFFFAOYSA-N 0.000 description 1
- LOWIJRWWCNSKNW-UHFFFAOYSA-N 4-(2-ethylhexoxy)-4-oxo-3-sulfanylbutanoic acid Chemical compound CCCCC(CC)COC(=O)C(CC(=O)O)S LOWIJRWWCNSKNW-UHFFFAOYSA-N 0.000 description 1
- ORVJKEZLLOINDW-UHFFFAOYSA-N 4-butoxy-4-oxo-3-sulfanylbutanoic acid Chemical compound CCCCOC(=O)C(S)CC(O)=O ORVJKEZLLOINDW-UHFFFAOYSA-N 0.000 description 1
- YNBMKIQUCDDXAN-UHFFFAOYSA-N 4-cyclohexyloxy-4-oxo-3-sulfanylbutanoic acid Chemical compound C1CCC(CC1)OC(=O)C(CC(=O)O)S YNBMKIQUCDDXAN-UHFFFAOYSA-N 0.000 description 1
- OAHMVZYHIJQTQC-UHFFFAOYSA-N 4-cyclohexylphenol Chemical compound C1=CC(O)=CC=C1C1CCCCC1 OAHMVZYHIJQTQC-UHFFFAOYSA-N 0.000 description 1
- PHCPBISEICKUTD-UHFFFAOYSA-N 4-dodecoxy-4-oxo-3-sulfanylbutanoic acid Chemical compound CCCCCCCCCCCCOC(=O)C(CC(=O)O)S PHCPBISEICKUTD-UHFFFAOYSA-N 0.000 description 1
- UOJBPVNHCNJBSQ-UHFFFAOYSA-N 4-methylfuran-2-carboxylic acid Chemical compound CC1=COC(C(O)=O)=C1 UOJBPVNHCNJBSQ-UHFFFAOYSA-N 0.000 description 1
- FXLWITIASMBJTP-UHFFFAOYSA-N 4-oxo-4-phenylmethoxy-3-sulfanylbutanoic acid Chemical compound C1=CC=C(C=C1)COC(=O)C(CC(=O)O)S FXLWITIASMBJTP-UHFFFAOYSA-N 0.000 description 1
- JJMDCOVWQOJGCB-UHFFFAOYSA-N 5-aminopentanoic acid Chemical compound [NH3+]CCCCC([O-])=O JJMDCOVWQOJGCB-UHFFFAOYSA-N 0.000 description 1
- IUNVCWLKOOCPIT-UHFFFAOYSA-N 6-methylheptylsulfanyl 2-hydroxyacetate Chemical compound CC(C)CCCCCSOC(=O)CO IUNVCWLKOOCPIT-UHFFFAOYSA-N 0.000 description 1
- XDOLZJYETYVRKV-UHFFFAOYSA-N 7-Aminoheptanoic acid Chemical compound NCCCCCCC(O)=O XDOLZJYETYVRKV-UHFFFAOYSA-N 0.000 description 1
- VWPQCOZMXULHDM-UHFFFAOYSA-N 9-aminononanoic acid Chemical compound NCCCCCCCCC(O)=O VWPQCOZMXULHDM-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-K Arsenate3- Chemical compound [O-][As]([O-])([O-])=O DJHGAFSJWGLOIV-UHFFFAOYSA-K 0.000 description 1
- 229920001342 Bakelite® Polymers 0.000 description 1
- DPUOLQHDNGRHBS-UHFFFAOYSA-N Brassidinsaeure Natural products CCCCCCCCC=CCCCCCCCCCCCC(O)=O DPUOLQHDNGRHBS-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- GGYUHICQSWMYRP-UHFFFAOYSA-N C(C(S)CC(=O)O)(=O)O.C(CCCCCO)O Chemical compound C(C(S)CC(=O)O)(=O)O.C(CCCCCO)O GGYUHICQSWMYRP-UHFFFAOYSA-N 0.000 description 1
- CVEWKQAJRMVFHZ-UHFFFAOYSA-N C(CCCCCCCCCCCCCCCCC)(=O)C(CCCCCCC)=O Chemical compound C(CCCCCCCCCCCCCCCCC)(=O)C(CCCCCCC)=O CVEWKQAJRMVFHZ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 150000000703 Cerium Chemical class 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- NMEZJSDUZQOPFE-UHFFFAOYSA-N Cyclohex-1-enecarboxylic acid Chemical class OC(=O)C1=CCCCC1 NMEZJSDUZQOPFE-UHFFFAOYSA-N 0.000 description 1
- URXZXNYJPAJJOQ-UHFFFAOYSA-N Erucic acid Natural products CCCCCCC=CCCCCCCCCCCCC(O)=O URXZXNYJPAJJOQ-UHFFFAOYSA-N 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 150000001206 Neodymium Chemical class 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 229920000571 Nylon 11 Polymers 0.000 description 1
- 229920000299 Nylon 12 Polymers 0.000 description 1
- 229920001007 Nylon 4 Polymers 0.000 description 1
- 229920000393 Nylon 6/6T Polymers 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 150000001213 Praseodymium Chemical class 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- KYLHKTAZXDYIBE-UHFFFAOYSA-N [1-(2-sulfanylacetyl)oxycyclohexyl] 2-sulfanylacetate Chemical compound SCC(=O)OC1(CCCCC1)OC(CS)=O KYLHKTAZXDYIBE-UHFFFAOYSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940000489 arsenate Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- YDLSUFFXJYEVHW-UHFFFAOYSA-N azonan-2-one Chemical compound O=C1CCCCCCCN1 YDLSUFFXJYEVHW-UHFFFAOYSA-N 0.000 description 1
- 239000004637 bakelite Substances 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- XTCXSNIRIUQZLY-UHFFFAOYSA-N benzyl 2-sulfanylacetate Chemical compound SCC(=O)OCC1=CC=CC=C1 XTCXSNIRIUQZLY-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- VYLVYHXQOHJDJL-UHFFFAOYSA-K cerium trichloride Chemical compound Cl[Ce](Cl)Cl VYLVYHXQOHJDJL-UHFFFAOYSA-K 0.000 description 1
- IKNAJTLCCWPIQD-UHFFFAOYSA-K cerium(3+);lanthanum(3+);neodymium(3+);oxygen(2-);phosphate Chemical compound [O-2].[La+3].[Ce+3].[Nd+3].[O-]P([O-])([O-])=O IKNAJTLCCWPIQD-UHFFFAOYSA-K 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 229960004643 cupric oxide Drugs 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- 150000005378 cyclohexanecarboxylic acids Chemical class 0.000 description 1
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- WTVNFKVGGUWHQC-UHFFFAOYSA-N decane-2,4-dione Chemical compound CCCCCCC(=O)CC(C)=O WTVNFKVGGUWHQC-UHFFFAOYSA-N 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- NZZIMKJIVMHWJC-UHFFFAOYSA-N dibenzoylmethane Chemical compound C=1C=CC=CC=1C(=O)CC(=O)C1=CC=CC=C1 NZZIMKJIVMHWJC-UHFFFAOYSA-N 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- WVDDGKGOMKODPV-OCAPALNOSA-N dideuterio(phenyl)methanol Chemical compound [2H][13C]([2H])(O)C1=CC=CC=C1 WVDDGKGOMKODPV-OCAPALNOSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000007323 disproportionation reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- DPUOLQHDNGRHBS-KTKRTIGZSA-N erucic acid Chemical compound CCCCCCCC\C=C/CCCCCCCCCCCC(O)=O DPUOLQHDNGRHBS-KTKRTIGZSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 230000009970 fire resistant effect Effects 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- ZBRRLVWJAPULGW-UHFFFAOYSA-N henicosane-2,4-dione Chemical compound CCCCCCCCCCCCCCCCCC(=O)CC(C)=O ZBRRLVWJAPULGW-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid group Chemical group C(CCCCC)(=O)O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012770 industrial material Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 229910000311 lanthanide oxide Inorganic materials 0.000 description 1
- 150000002603 lanthanum Chemical class 0.000 description 1
- ICAKDTKJOYSXGC-UHFFFAOYSA-K lanthanum(iii) chloride Chemical compound Cl[La](Cl)Cl ICAKDTKJOYSXGC-UHFFFAOYSA-K 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000011325 microbead Substances 0.000 description 1
- 229910052590 monazite Inorganic materials 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- JQTFPHLEQLLQOT-UHFFFAOYSA-N octadecyl 2-sulfanylacetate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CS JQTFPHLEQLLQOT-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920005749 polyurethane resin Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- IKDJNUWVVVAEBZ-UHFFFAOYSA-N propane-1,3-diol 2-sulfanylbutanedioic acid Chemical compound C(C(S)CC(=O)O)(=O)O.C(CCO)O IKDJNUWVVVAEBZ-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229940082569 selenite Drugs 0.000 description 1
- MCAHWIHFGHIESP-UHFFFAOYSA-L selenite(2-) Chemical compound [O-][Se]([O-])=O MCAHWIHFGHIESP-UHFFFAOYSA-L 0.000 description 1
- 150000003346 selenoethers Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical compound [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000005482 strain hardening Methods 0.000 description 1
- WGPCGCOKHWGKJJ-UHFFFAOYSA-N sulfanylidenezinc Chemical compound [Zn]=S WGPCGCOKHWGKJJ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- XSOKHXFFCGXDJZ-UHFFFAOYSA-N telluride(2-) Chemical compound [Te-2] XSOKHXFFCGXDJZ-UHFFFAOYSA-N 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- PBYZMCDFOULPGH-UHFFFAOYSA-N tungstate Chemical compound [O-][W]([O-])(=O)=O PBYZMCDFOULPGH-UHFFFAOYSA-N 0.000 description 1
- LSGOVYNHVSXFFJ-UHFFFAOYSA-N vanadate(3-) Chemical compound [O-][V]([O-])([O-])=O LSGOVYNHVSXFFJ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 150000003739 xylenols Chemical class 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L77/00—Compositions of polyamides obtained by reactions forming a carboxylic amide link in the main chain; Compositions of derivatives of such polymers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/09—Carboxylic acids; Metal salts thereof; Anhydrides thereof
- C08K5/098—Metal salts of carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/02—Elements
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/34—Silicon-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K9/00—Use of pretreated ingredients
- C08K9/10—Encapsulated ingredients
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8714268A FR2621594B1 (OSRAM) | 1987-10-12 | 1987-10-12 | |
| CA000578002A CA1308210C (fr) | 1987-10-12 | 1988-09-21 | Compositions a base de polyamide ignifuge |
| AR88312147A AR246536A1 (es) | 1987-10-12 | 1988-10-07 | Composiciones basadas en poliamidas ignifugas y los objetos conformados mediante dichas composiciones. |
| EP88420342A EP0312471B1 (fr) | 1987-10-12 | 1988-10-07 | Compositions à base de polyamide ignifuge |
| DE3884734T DE3884734T2 (de) | 1987-10-12 | 1988-10-07 | Flammwidrige Polyamid-Mischungen. |
| AT88420342T ATE95534T1 (de) | 1987-10-12 | 1988-10-07 | Flammwidrige polyamid-mischungen. |
| PT88720A PT88720B (pt) | 1987-10-12 | 1988-10-10 | Processo para a preparacao de composicoes a base de poliamida ignifugada |
| NO88884505A NO884505L (no) | 1987-10-12 | 1988-10-10 | Brannhemmende polyamidblandinger. |
| DK565988A DK565988A (da) | 1987-10-12 | 1988-10-11 | Brandhaemmede, polyamidbaserede formstofblandinger |
| FI884681A FI884681L (fi) | 1987-10-12 | 1988-10-11 | Polyamidbasfoereningar som gjorts eldfasta. |
| BR8805225A BR8805225A (pt) | 1987-10-12 | 1988-10-11 | Composicoes a base de poliamida |
| IN712/MAS/88A IN172231B (OSRAM) | 1987-10-12 | 1988-10-11 | |
| JP63253957A JPH01129061A (ja) | 1987-10-12 | 1988-10-11 | ポリアミドを基とする防火加工された組成物 |
| KR1019880013315A KR890006752A (ko) | 1987-10-12 | 1988-10-12 | 방염성 폴리아미드를 주성분으로 하는 조성물 |
| US07/256,921 US4921896A (en) | 1987-10-12 | 1988-10-12 | Fireproofed polyamide compositions |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8714268A FR2621594B1 (OSRAM) | 1987-10-12 | 1987-10-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2621594A1 true FR2621594A1 (OSRAM) | 1989-04-14 |
| FR2621594B1 FR2621594B1 (OSRAM) | 1990-01-26 |
Family
ID=9355865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR8714268A Expired - Lifetime FR2621594B1 (OSRAM) | 1987-10-12 | 1987-10-12 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4921896A (OSRAM) |
| EP (1) | EP0312471B1 (OSRAM) |
| JP (1) | JPH01129061A (OSRAM) |
| KR (1) | KR890006752A (OSRAM) |
| AR (1) | AR246536A1 (OSRAM) |
| AT (1) | ATE95534T1 (OSRAM) |
| BR (1) | BR8805225A (OSRAM) |
| CA (1) | CA1308210C (OSRAM) |
| DE (1) | DE3884734T2 (OSRAM) |
| DK (1) | DK565988A (OSRAM) |
| FI (1) | FI884681L (OSRAM) |
| FR (1) | FR2621594B1 (OSRAM) |
| IN (1) | IN172231B (OSRAM) |
| NO (1) | NO884505L (OSRAM) |
| PT (1) | PT88720B (OSRAM) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0739539B2 (ja) * | 1989-12-15 | 1995-05-01 | 宇部興産株式会社 | 溶融中子成形用ポリアミド樹脂組成物及びその成形品 |
| JPH04353536A (ja) * | 1991-05-30 | 1992-12-08 | Idemitsu Petrochem Co Ltd | ガラス繊維強化樹脂成形品の製造方法 |
| FR2687407A1 (fr) * | 1992-02-18 | 1993-08-20 | Rhone Poulenc Chimie | Compositions a base de polyamide ignifuge. |
| JP3217171B2 (ja) * | 1992-04-14 | 2001-10-09 | 住友化学工業株式会社 | 樹脂組成物およびそれから作られた二次加工品 |
| DE4301541A1 (de) * | 1993-01-21 | 1994-07-28 | Basf Ag | Flammgeschützte schwarzeingefärbte Polyamidformmassen |
| GB9417234D0 (en) * | 1994-08-26 | 1994-10-19 | Albright & Wilson | Flame-retardent materials |
| US5543447A (en) * | 1994-09-28 | 1996-08-06 | Southwest Research Institute | Stabilization of red amorphous phosphorus by ordered polymeric structures for the manufacture of non-emissive fire retardant plastics |
| US5698323A (en) * | 1996-03-28 | 1997-12-16 | Union Carbide Chemicals & Plastics Technology Corporation | Flame retardant cable |
| WO1998036022A1 (de) * | 1997-02-17 | 1998-08-20 | Basf Aktiengesellschaft | Flammgeschützte thermoplastische formmassen |
| DE69926319T2 (de) * | 1998-03-25 | 2006-04-27 | Teijin Ltd. | Harzzusammensetzung |
| DE10224887A1 (de) * | 2002-06-05 | 2003-12-18 | Bayer Ag | Flammwidrig ausgerüstete Kunststoff-Formmassen |
| US8524821B2 (en) * | 2007-11-23 | 2013-09-03 | Solvay Advanced Polymers, L.L.C. | Gamma radiation sterilizable, reinforced polymer composition with improved color stability |
| BR112014005781B1 (pt) * | 2011-09-15 | 2021-01-26 | Basf Se | composição termoplástica para moldagem compreendendo estabilizantes de prata e óxido de zinco para poliamida retardadora de chama, uso das composições termoplásticas para moldagem, e, fibra, filme ou peça moldada |
| CN103408960B (zh) * | 2013-01-25 | 2015-07-22 | 河北大学 | 锡酸镧及其与无机阻燃剂的组合物在含卤高聚物中的应用 |
| CN106751778B (zh) * | 2016-12-20 | 2019-03-05 | 浙江大学宁波理工学院 | 稀土氧化物与微胶囊红磷协同阻燃pa6复合材料及其制备方法 |
| CN116640440B (zh) * | 2023-04-03 | 2024-07-05 | 金旸(厦门)新材料科技有限公司 | 一种低析出红磷阻燃玻纤增强尼龙及其制备方法和应用 |
| WO2025040550A1 (en) * | 2023-08-21 | 2025-02-27 | Basf Se | Polymer composition with flame retardant |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2332306A1 (fr) * | 1975-11-18 | 1977-06-17 | Basf Ag | Matieres a mouler polyamides ignifugees |
| EP0093456A1 (de) * | 1980-05-20 | 1983-11-09 | Peter Kollmer | Verwendung von bindemittelfreiem, nachleuchtendem ZnS zum Markieren von aus Gummi oder Kunststoffen bestehenden Gegenständen |
| EP0141763A2 (fr) * | 1983-10-21 | 1985-05-15 | Rhone-Poulenc Chimie | Compositions à base de polyamide ignifuge |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2226932B2 (de) * | 1972-06-02 | 1976-03-18 | Basf Ag, 6700 Ludwigshafen | Mit anorganischen pigmenten pigmentierte glasfaserverstaerkte thermoplastische formmassen |
| FR2314221A1 (fr) * | 1975-06-10 | 1977-01-07 | Rhone Poulenc Ind | Compositions destinees a l'ignifugation de matieres plastiques |
| US4208317A (en) * | 1975-06-10 | 1980-06-17 | Rhone-Poulenc Industries | Flameproofed plastic compositions |
| FR2314219A1 (fr) * | 1975-06-10 | 1977-01-07 | Rhone Poulenc Ind | Compositions destinees a l'ignifugation de matieres plastiques |
| DE2734103A1 (de) * | 1977-07-28 | 1979-02-08 | Bayer Ag | Flammfeste polyamidformmassen |
| US4255319A (en) * | 1978-12-15 | 1981-03-10 | Union Carbide Corporation | Polymeric compositions containing elemental red phosphorus, aldehydes or ketones or mixtures thereof |
| DE3063066D1 (en) * | 1979-06-02 | 1983-06-16 | Basf Ag | Flameproof polyamide moulding compositions containing a filler |
| US4356282A (en) * | 1981-07-06 | 1982-10-26 | Allied Corporation | Phosphine suppressants for polymeric compositions including red phosphorus as a flame retardant |
| CA1196437A (en) * | 1981-12-19 | 1985-11-05 | Kazushi Hirobe | Flame resistant resin composition |
| DE3317822A1 (de) * | 1983-05-17 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Stabilisierter, roter phosphor und dessen verwendung fuer flammfeste, thermoplastische polyamid-formmassen |
| DE3509568A1 (de) * | 1985-03-16 | 1986-09-18 | Bayer Ag, 5090 Leverkusen | Stabilisierter, roter phosphor und dessen verwendung fuer flammfeste, thermoplastische polyamid-formmassen |
-
1987
- 1987-10-12 FR FR8714268A patent/FR2621594B1/fr not_active Expired - Lifetime
-
1988
- 1988-09-21 CA CA000578002A patent/CA1308210C/fr not_active Expired - Lifetime
- 1988-10-07 DE DE3884734T patent/DE3884734T2/de not_active Expired - Fee Related
- 1988-10-07 AT AT88420342T patent/ATE95534T1/de not_active IP Right Cessation
- 1988-10-07 EP EP88420342A patent/EP0312471B1/fr not_active Expired - Lifetime
- 1988-10-07 AR AR88312147A patent/AR246536A1/es active
- 1988-10-10 PT PT88720A patent/PT88720B/pt not_active IP Right Cessation
- 1988-10-10 NO NO88884505A patent/NO884505L/no unknown
- 1988-10-11 BR BR8805225A patent/BR8805225A/pt not_active Application Discontinuation
- 1988-10-11 IN IN712/MAS/88A patent/IN172231B/en unknown
- 1988-10-11 DK DK565988A patent/DK565988A/da not_active Application Discontinuation
- 1988-10-11 FI FI884681A patent/FI884681L/fi not_active IP Right Cessation
- 1988-10-11 JP JP63253957A patent/JPH01129061A/ja active Pending
- 1988-10-12 US US07/256,921 patent/US4921896A/en not_active Expired - Fee Related
- 1988-10-12 KR KR1019880013315A patent/KR890006752A/ko not_active Ceased
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2332306A1 (fr) * | 1975-11-18 | 1977-06-17 | Basf Ag | Matieres a mouler polyamides ignifugees |
| EP0093456A1 (de) * | 1980-05-20 | 1983-11-09 | Peter Kollmer | Verwendung von bindemittelfreiem, nachleuchtendem ZnS zum Markieren von aus Gummi oder Kunststoffen bestehenden Gegenständen |
| EP0141763A2 (fr) * | 1983-10-21 | 1985-05-15 | Rhone-Poulenc Chimie | Compositions à base de polyamide ignifuge |
Also Published As
| Publication number | Publication date |
|---|---|
| DK565988A (da) | 1989-04-12 |
| KR890006752A (ko) | 1989-06-15 |
| DE3884734D1 (de) | 1993-11-11 |
| AR246536A1 (es) | 1994-08-31 |
| FI884681A0 (fi) | 1988-10-11 |
| BR8805225A (pt) | 1989-05-23 |
| US4921896A (en) | 1990-05-01 |
| DE3884734T2 (de) | 1994-06-16 |
| EP0312471A2 (fr) | 1989-04-19 |
| NO884505D0 (no) | 1988-10-10 |
| CA1308210C (fr) | 1992-09-29 |
| EP0312471B1 (fr) | 1993-10-06 |
| EP0312471A3 (en) | 1989-09-13 |
| ATE95534T1 (de) | 1993-10-15 |
| FI884681A7 (fi) | 1989-04-13 |
| PT88720B (pt) | 1992-12-31 |
| DK565988D0 (da) | 1988-10-11 |
| FI884681L (fi) | 1989-04-13 |
| NO884505L (no) | 1989-04-13 |
| JPH01129061A (ja) | 1989-05-22 |
| FR2621594B1 (OSRAM) | 1990-01-26 |
| IN172231B (OSRAM) | 1993-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0312471B1 (fr) | Compositions à base de polyamide ignifuge | |
| EP0141763B1 (fr) | Compositions à base de polyamide ignifuge | |
| EP0557222B1 (fr) | Compositions à base de polyamide ignifugé | |
| EP0813568B1 (fr) | Composition a base de polyamide a stabilite lumiere elevee | |
| CH624974A5 (OSRAM) | ||
| EP0364377B1 (fr) | Compositions à base de polyamide ignifugé | |
| EP0161191B1 (fr) | Procédé de stabilisation de polyamides, les compositions stabilisantes utilisées pour la mise en oeuvre de ce procédé et les polyamides stabilisées obtenus | |
| US5021488A (en) | Flameproofed, non-dripping polyamide moulding compositions | |
| FR2764295A1 (fr) | Utilisation de composes beta-dicetoniques comme fondants et/ou solubilisants de l'acetylacetonate de calcium | |
| US3730939A (en) | Flame retardant polyamide compositions containing certain sulfanilamides | |
| JPS63305158A (ja) | 成形用樹脂組成物 | |
| FR2782087A1 (fr) | Utilisation d'acetylacetonate de zinc monohydrate comme stabilisant de polymeres halogenes et son procede de preparation | |
| JP2999273B2 (ja) | 安定化ポリオキシメチレン樹脂組成物 | |
| FR2703361A1 (fr) | Compositions ignifugées à base de polyamide. | |
| KR20090073628A (ko) | 가스발생량이 감소된 무기충진재 및 이를 적용한 수지조성물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ER | Errata listed in the french official journal (bopi) |
Free format text: 15/89 |
|
| ST | Notification of lapse |