FR2483433A1 - Dispersions aqueuses de prepolymeres de polyisocyanantes aromatiques, et procedes pour les fabriquer - Google Patents
Dispersions aqueuses de prepolymeres de polyisocyanantes aromatiques, et procedes pour les fabriquer Download PDFInfo
- Publication number
- FR2483433A1 FR2483433A1 FR8107077A FR8107077A FR2483433A1 FR 2483433 A1 FR2483433 A1 FR 2483433A1 FR 8107077 A FR8107077 A FR 8107077A FR 8107077 A FR8107077 A FR 8107077A FR 2483433 A1 FR2483433 A1 FR 2483433A1
- Authority
- FR
- France
- Prior art keywords
- prepolymer
- groups
- aqueous dispersion
- salt
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000006185 dispersion Substances 0.000 title claims abstract description 92
- 238000000034 method Methods 0.000 title claims description 20
- 229920000642 polymer Polymers 0.000 claims abstract description 98
- 229920000768 polyamine Polymers 0.000 claims abstract description 71
- -1 HYDROGEN ATOMS Chemical group 0.000 claims abstract description 58
- 238000006243 chemical reaction Methods 0.000 claims abstract description 49
- 150000003839 salts Chemical class 0.000 claims abstract description 35
- 239000005056 polyisocyanate Substances 0.000 claims abstract description 24
- 229920001228 polyisocyanate Polymers 0.000 claims abstract description 23
- 239000003153 chemical reaction reagent Substances 0.000 claims abstract 12
- 150000001734 carboxylic acid salts Chemical class 0.000 claims abstract 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 95
- 239000002904 solvent Substances 0.000 claims description 51
- 229920005862 polyol Polymers 0.000 claims description 47
- 150000003077 polyols Chemical class 0.000 claims description 45
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 41
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 33
- 125000003118 aryl group Chemical group 0.000 claims description 33
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 31
- 150000001412 amines Chemical class 0.000 claims description 24
- 238000002360 preparation method Methods 0.000 claims description 23
- 239000012948 isocyanate Substances 0.000 claims description 19
- 239000000047 product Substances 0.000 claims description 19
- 150000003512 tertiary amines Chemical class 0.000 claims description 18
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical group C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 claims description 15
- 230000015572 biosynthetic process Effects 0.000 claims description 15
- 150000002923 oximes Chemical class 0.000 claims description 15
- 239000007787 solid Substances 0.000 claims description 15
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical group CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 14
- 229920002396 Polyurea Polymers 0.000 claims description 14
- 229920000570 polyether Polymers 0.000 claims description 12
- PTBDIHRZYDMNKB-UHFFFAOYSA-N 2,2-Bis(hydroxymethyl)propionic acid Chemical compound OCC(C)(CO)C(O)=O PTBDIHRZYDMNKB-UHFFFAOYSA-N 0.000 claims description 11
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 claims description 11
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 10
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 9
- 150000002513 isocyanates Chemical class 0.000 claims description 9
- 229920005906 polyester polyol Polymers 0.000 claims description 9
- 239000004814 polyurethane Substances 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 7
- 150000004985 diamines Chemical class 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 150000001340 alkali metals Chemical class 0.000 claims 2
- 150000001447 alkali salts Chemical class 0.000 claims 1
- 229920003226 polyurethane urea Polymers 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 56
- 239000000853 adhesive Substances 0.000 abstract description 3
- 230000001070 adhesive effect Effects 0.000 abstract description 3
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical group N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 abstract 3
- 238000003756 stirring Methods 0.000 description 33
- 239000000243 solution Substances 0.000 description 32
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 26
- 239000010408 film Substances 0.000 description 26
- 239000007858 starting material Substances 0.000 description 24
- 238000000576 coating method Methods 0.000 description 20
- 238000001816 cooling Methods 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 17
- 239000007788 liquid Substances 0.000 description 16
- 239000000126 substance Substances 0.000 description 15
- 125000005442 diisocyanate group Chemical group 0.000 description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 11
- 230000000704 physical effect Effects 0.000 description 11
- WHIVNJATOVLWBW-PLNGDYQASA-N (nz)-n-butan-2-ylidenehydroxylamine Chemical compound CC\C(C)=N/O WHIVNJATOVLWBW-PLNGDYQASA-N 0.000 description 10
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 10
- 239000000839 emulsion Substances 0.000 description 10
- 229920000554 ionomer Polymers 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- 239000008096 xylene Substances 0.000 description 10
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 9
- OYQYHJRSHHYEIG-UHFFFAOYSA-N ethyl carbamate;urea Chemical class NC(N)=O.CCOC(N)=O OYQYHJRSHHYEIG-UHFFFAOYSA-N 0.000 description 9
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- 125000001931 aliphatic group Chemical group 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000008199 coating composition Substances 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 239000002245 particle Substances 0.000 description 8
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 7
- 239000002981 blocking agent Substances 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 7
- 229920002635 polyurethane Polymers 0.000 description 7
- 150000003141 primary amines Chemical class 0.000 description 7
- 229950011008 tetrachloroethylene Drugs 0.000 description 7
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 5
- 239000012429 reaction media Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 238000007710 freezing Methods 0.000 description 4
- 230000008014 freezing Effects 0.000 description 4
- 150000002596 lactones Chemical class 0.000 description 4
- 238000000465 moulding Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 239000004433 Thermoplastic polyurethane Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000004581 coalescence Methods 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 239000004815 dispersion polymer Substances 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 150000003335 secondary amines Chemical group 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 2
- MEBONNVPKOBPEA-UHFFFAOYSA-N 1,1,2-trimethylcyclohexane Chemical compound CC1CCCCC1(C)C MEBONNVPKOBPEA-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- ADRNSOYXKABLGT-UHFFFAOYSA-N 8-methylnonyl diphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OCCCCCCCC(C)C)OC1=CC=CC=C1 ADRNSOYXKABLGT-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 2
- PXAJQJMDEXJWFB-UHFFFAOYSA-N acetone oxime Chemical compound CC(C)=NO PXAJQJMDEXJWFB-UHFFFAOYSA-N 0.000 description 2
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- VEZUQRBDRNJBJY-UHFFFAOYSA-N cyclohexanone oxime Chemical compound ON=C1CCCCC1 VEZUQRBDRNJBJY-UHFFFAOYSA-N 0.000 description 2
- VSSAZBXXNIABDN-UHFFFAOYSA-N cyclohexylmethanol Chemical compound OCC1CCCCC1 VSSAZBXXNIABDN-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 238000001879 gelation Methods 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 231100000989 no adverse effect Toxicity 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 229920000162 poly(ureaurethane) Polymers 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 238000010257 thawing Methods 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- QEDNBHNWMHJNAB-UHFFFAOYSA-N tris(8-methylnonyl) phosphite Chemical compound CC(C)CCCCCCCOP(OCCCCCCCC(C)C)OCCCCCCCC(C)C QEDNBHNWMHJNAB-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- CIRMGZKUSBCWRL-LHLOQNFPSA-N (e)-10-[2-(7-carboxyheptyl)-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enoic acid Chemical compound CCCCCCC1C=CC(CCCCCCCC(O)=O)C(\C=C\CCCCCCCC(O)=O)C1CCCCCC CIRMGZKUSBCWRL-LHLOQNFPSA-N 0.000 description 1
- JHNRZXQVBKRYKN-VQHVLOKHSA-N (ne)-n-(1-phenylethylidene)hydroxylamine Chemical compound O\N=C(/C)C1=CC=CC=C1 JHNRZXQVBKRYKN-VQHVLOKHSA-N 0.000 description 1
- VTWKXBJHBHYJBI-SOFGYWHQSA-N (ne)-n-benzylidenehydroxylamine Chemical compound O\N=C\C1=CC=CC=C1 VTWKXBJHBHYJBI-SOFGYWHQSA-N 0.000 description 1
- KGGVGTQEGGOZRN-PLNGDYQASA-N (nz)-n-butylidenehydroxylamine Chemical compound CCC\C=N/O KGGVGTQEGGOZRN-PLNGDYQASA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- ULQISTXYYBZJSJ-UHFFFAOYSA-N 12-hydroxyoctadecanoic acid Chemical compound CCCCCCC(O)CCCCCCCCCCC(O)=O ULQISTXYYBZJSJ-UHFFFAOYSA-N 0.000 description 1
- JVYDLYGCSIHCMR-UHFFFAOYSA-N 2,2-bis(hydroxymethyl)butanoic acid Chemical compound CCC(CO)(CO)C(O)=O JVYDLYGCSIHCMR-UHFFFAOYSA-N 0.000 description 1
- UHAMPPWFPNXLIU-UHFFFAOYSA-N 2,2-bis(hydroxymethyl)pentanoic acid Chemical compound CCCC(CO)(CO)C(O)=O UHAMPPWFPNXLIU-UHFFFAOYSA-N 0.000 description 1
- PQXKWPLDPFFDJP-UHFFFAOYSA-N 2,3-dimethyloxirane Chemical class CC1OC1C PQXKWPLDPFFDJP-UHFFFAOYSA-N 0.000 description 1
- KIHBGTRZFAVZRV-UHFFFAOYSA-N 2-Hydroxyoctadecanoic acid Natural products CCCCCCCCCCCCCCCCC(O)C(O)=O KIHBGTRZFAVZRV-UHFFFAOYSA-N 0.000 description 1
- KLSLBUSXWBJMEC-UHFFFAOYSA-N 4-Propylphenol Chemical compound CCCC1=CC=C(O)C=C1 KLSLBUSXWBJMEC-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- 208000001840 Dandruff Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- DNNXXFFLRWCPBC-UHFFFAOYSA-N N=C=O.N=C=O.C1=CC=CC=C1 Chemical compound N=C=O.N=C=O.C1=CC=CC=C1 DNNXXFFLRWCPBC-UHFFFAOYSA-N 0.000 description 1
- 241001465805 Nymphalidae Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- XZAHJRZBUWYCBM-UHFFFAOYSA-N [1-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1(CN)CCCCC1 XZAHJRZBUWYCBM-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 125000000271 carboxylic acid salt group Chemical group 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000001246 colloidal dispersion Methods 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- PYFRLDVYGBCYLI-UHFFFAOYSA-N decyl dihydrogen phosphite Chemical compound CCCCCCCCCCOP(O)O PYFRLDVYGBCYLI-UHFFFAOYSA-N 0.000 description 1
- 125000004427 diamine group Chemical group 0.000 description 1
- KEIQPMUPONZJJH-UHFFFAOYSA-N dicyclohexylmethanediamine Chemical compound C1CCCCC1C(N)(N)C1CCCCC1 KEIQPMUPONZJJH-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical class OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012972 dimethylethanolamine Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002240 furans Chemical class 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- XJRAOMZCVTUHFI-UHFFFAOYSA-N isocyanic acid;methane Chemical class C.N=C=O.N=C=O XJRAOMZCVTUHFI-UHFFFAOYSA-N 0.000 description 1
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- ZETYUTMSJWMKNQ-UHFFFAOYSA-N n,n',n'-trimethylhexane-1,6-diamine Chemical compound CNCCCCCCN(C)C ZETYUTMSJWMKNQ-UHFFFAOYSA-N 0.000 description 1
- GNVRJGIVDSQCOP-UHFFFAOYSA-N n-ethyl-n-methylethanamine Chemical compound CCN(C)CC GNVRJGIVDSQCOP-UHFFFAOYSA-N 0.000 description 1
- SQDFHQJTAWCFIB-UHFFFAOYSA-N n-methylidenehydroxylamine Chemical compound ON=C SQDFHQJTAWCFIB-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 150000004040 pyrrolidinones Chemical class 0.000 description 1
- 229920005604 random copolymer Polymers 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 235000020354 squash Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- RINCXYDBBGOEEQ-UHFFFAOYSA-N succinic anhydride Chemical compound O=C1CCC(=O)O1 RINCXYDBBGOEEQ-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- 239000003017 thermal stabilizer Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/10—Prepolymer processes involving reaction of isocyanates or isothiocyanates with compounds having active hydrogen in a first reaction step
- C08G18/12—Prepolymer processes involving reaction of isocyanates or isothiocyanates with compounds having active hydrogen in a first reaction step using two or more compounds having active hydrogen in the first polymerisation step
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
- C08G18/0819—Manufacture of polymers containing ionic or ionogenic groups containing anionic or anionogenic groups
- C08G18/0823—Manufacture of polymers containing ionic or ionogenic groups containing anionic or anionogenic groups containing carboxylate salt groups or groups forming them
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0838—Manufacture of polymers in the presence of non-reactive compounds
- C08G18/0842—Manufacture of polymers in the presence of non-reactive compounds in the presence of liquid diluents
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/10—Prepolymer processes involving reaction of isocyanates or isothiocyanates with compounds having active hydrogen in a first reaction step
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Polyurethanes Or Polyureas (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/138,750 US4387181A (en) | 1980-04-09 | 1980-04-09 | Polymer compositions and manufacture |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2483433A1 true FR2483433A1 (fr) | 1981-12-04 |
| FR2483433B1 FR2483433B1 (enExample) | 1983-06-03 |
Family
ID=22483464
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR8107077A Granted FR2483433A1 (fr) | 1980-04-09 | 1981-04-08 | Dispersions aqueuses de prepolymeres de polyisocyanantes aromatiques, et procedes pour les fabriquer |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4387181A (enExample) |
| JP (1) | JPS6336328B2 (enExample) |
| AU (1) | AU544399B2 (enExample) |
| CA (1) | CA1183992A (enExample) |
| DE (1) | DE3142255T1 (enExample) |
| FR (1) | FR2483433A1 (enExample) |
| GB (1) | GB2083485B (enExample) |
| IT (1) | IT1144328B (enExample) |
| NL (1) | NL186577B (enExample) |
| WO (1) | WO1981002894A1 (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4554308A (en) * | 1978-10-02 | 1985-11-19 | Wilmington Chemical Corporation | Crosslinked polyurethane dispersions |
| US4335029A (en) * | 1980-12-15 | 1982-06-15 | Witco Chemical Corporation | Aqueous polyurethane compositions |
| DE3227017A1 (de) * | 1982-07-20 | 1984-01-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von kunststoffen aus polyisocyanat-basis |
| DE3233605A1 (de) * | 1982-09-10 | 1984-03-15 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von vernetzten polyurethan-ionomerdispersionen |
| US4501852A (en) * | 1983-06-20 | 1985-02-26 | Mobay Chemical Corporation | Stable, aqueous dispersions of polyurethane-ureas |
| GB8524579D0 (en) * | 1985-10-04 | 1985-11-06 | Polyvinyl Chemicals Inc | Coating compositions |
| US4780523A (en) * | 1987-03-02 | 1988-10-25 | The Goodyear Tire & Rubber Company | Meta-tetramethyl xylene diamine polyurethane compositions and process of making the same |
| US4937283A (en) * | 1987-03-02 | 1990-06-26 | The Goodyear Tire & Rubber Company | Meta-tetramethyl xylene diamine polyurethane compositions and process of making the same |
| US4786682A (en) * | 1987-06-25 | 1988-11-22 | Ppg Industries, Inc. | Coating compositions prepared from Michael adducts |
| US5037864A (en) * | 1989-07-11 | 1991-08-06 | The Dow Chemical Company | Semi-continuous process for the preparation of polyurethane-urea aqueous dispersions |
| US5124400A (en) * | 1989-09-25 | 1992-06-23 | Miles Inc. | Aqueous polyurethane dispersions and adhesives based thereon |
| US5137967A (en) * | 1990-07-06 | 1992-08-11 | Reichhold Chemicals, Inc. | Hydrazine extended aqueous polyurethane |
| NO930188L (no) * | 1992-01-21 | 1993-07-22 | Sherwin Williams Co | Beleggblandinger som omfatter en dispersjon av polyuretanurea i et vandig medium |
| DE4213527A1 (de) * | 1992-04-24 | 1993-10-28 | Bayer Ag | Wäßrige Überzugsmittel für elastische Einbrennlackierungen |
| DE4218184A1 (de) * | 1992-06-02 | 1993-12-09 | Bayer Ag | Wäßriges Bindemittelgemisch und seine Verwendung |
| US5770264A (en) * | 1992-07-31 | 1998-06-23 | Bayer Aktiengesellschaft | Anionically modified polyurethane ureas having reduced tackiness for the coating of leather |
| ES2102558T3 (es) * | 1992-07-31 | 1997-08-01 | Bayer Ag | Poliuretanoureas anionicamente modificadas con pegajosidad reducida para el recubrimiento del cuero. |
| GB2304069B (en) * | 1995-08-11 | 2000-03-15 | Advance Enterprises Ltd | A process for manufacturing, by moulding non resinous organic and inorganic compositions |
| GB9516490D0 (en) * | 1995-08-11 | 1995-10-11 | Advance Enterprises Ltd | Moulded compositions |
| US6162863A (en) * | 1997-12-04 | 2000-12-19 | Henkel Kommanditgesellschaft Auf Aktien | Waterborne polyurethanes with urea-urethane linkages |
| DE19914882A1 (de) | 1999-04-01 | 2000-10-05 | Bayer Ag | Selbstvernetzende Polyurethan-, Polyurethan-Polyharnstoff- bzw. Polyharnstoff-Dispersionen für Schlichten |
| JP2002128851A (ja) * | 2000-10-30 | 2002-05-09 | Dai Ichi Kogyo Seiyaku Co Ltd | 熱架橋性水系ポリウレタン樹脂組成物及び該組成物を含有する不織布補強剤 |
| DE10208027B4 (de) * | 2002-02-26 | 2008-03-13 | Lord Germany Gmbh | Wässriger reaktiver Beflockungsklebstoff für polymere Substrate und seine Verwendung |
| US7026428B2 (en) * | 2002-06-17 | 2006-04-11 | Bayer Aktiengesellschaft | Blocked polyisocyanates |
| US6702694B1 (en) * | 2002-09-05 | 2004-03-09 | Bridgestone Sports Co., Ltd. | Multi-piece solid golf ball |
| DE102004017436A1 (de) * | 2004-04-08 | 2005-10-27 | Bayer Materialscience Ag | Verfahren zur kontinuierlichen Herstellung einer wässrigen Polyurethandispersion |
| US7240371B2 (en) * | 2005-02-11 | 2007-07-10 | Invista North America S.A.R.L. | Solvent free aqueous polyurethane dispersions and adhesive films therefrom for stretch fabrics |
| US20060183850A1 (en) * | 2005-02-11 | 2006-08-17 | Invista North America S.A.R.L. | Solvent free aqueous polyurethane dispersions and shaped articles therefrom |
| US20080004395A1 (en) * | 2005-02-11 | 2008-01-03 | Invista North America S.A.R.L. | Aqueous polyurethaneurea compositions including dispersions and films |
| US20060183849A1 (en) * | 2005-02-11 | 2006-08-17 | Invista North America S.A R.L. | Solvent free aqueous polyurethane dispersions and adhesive films therefrom for stretch fabrics |
| US20070256789A1 (en) * | 2005-06-24 | 2007-11-08 | Invista North Americal S.A.R.L. | Guide for bonding tapes or films |
| KR100783054B1 (ko) | 2006-12-29 | 2007-12-07 | (주)디피아이 홀딩스 | 수용성 우레탄 수지, 그 제조 방법 및 이를 갖는 도료조성물 |
| WO2009011694A1 (en) * | 2007-07-13 | 2009-01-22 | Idea Paint Inc. | Coatings having writable-erasable surfaces and methods of making the same |
| DE102008014211A1 (de) | 2008-03-14 | 2009-09-17 | Bayer Materialscience Ag | Wässrige Dispersion aus anionisch modifizierten Polyurethanharnstoffen zur Beschichtung eines textilen Flächengebildes |
| JP2009249470A (ja) * | 2008-04-04 | 2009-10-29 | Daido Kasei Kogyo Kk | ポリウレタン多孔性構造体及びその製造方法 |
| AU2009270809B2 (en) * | 2008-07-18 | 2016-02-25 | Ideapaint, Inc. | Ambient cure solvent-based coatings for writable-erasable surfaces |
| RU2520454C2 (ru) * | 2009-01-09 | 2014-06-27 | Айдиапэйнт Инк. | Отверждающиеся в условиях окружающей среды покрытия на водной основе для поверхностей, допускающих запись и стирание |
| EP2319876A1 (de) | 2009-10-16 | 2011-05-11 | Bayer MaterialScience AG | Aromatsiche Polyurethanharnstoffdispersionen |
| US9617453B2 (en) | 2009-12-14 | 2017-04-11 | Air Products And Chemicals, Inc. | Solvent free aqueous polyurethane dispersions and methods of making and using the same |
| JP2015134911A (ja) * | 2013-12-20 | 2015-07-27 | 三洋化成工業株式会社 | ブロック化ウレタンプレポリマー組成物及びそれに用いられるポリオール組成物 |
| WO2016094809A1 (en) * | 2014-12-12 | 2016-06-16 | Carrier Corporation | Heat transfer system with coated fluid conduit |
| US11149158B2 (en) | 2016-05-20 | 2021-10-19 | Icp Construction, Inc. | Dry-erase compositions and methods of making and using thereof |
| KR102402240B1 (ko) | 2016-08-17 | 2022-05-26 | 더 라이크라 컴퍼니 유케이 리미티드 | 수성 폴리우레탄 분산액, 예비중합체, 이로부터 제조된 성형품 |
| CN111492105A (zh) | 2017-11-03 | 2020-08-04 | 莱卡英国有限公司 | 水性聚氨酯分散液的使用方法和由其制成的物品 |
| EP4063418A1 (en) * | 2021-03-26 | 2022-09-28 | Asahi Kasei Kabushiki Kaisha | Polyisocyanate composition, coating composition and coated substrate |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3412054A (en) * | 1966-10-31 | 1968-11-19 | Union Carbide Corp | Water-dilutable polyurethanes |
| US4016122A (en) * | 1975-07-31 | 1977-04-05 | Kao Soap Co., Ltd. | Anionic aqueous polyurethane having blocked NCO groups and process |
| US4066591A (en) * | 1975-06-02 | 1978-01-03 | Ppg Industries, Inc. | Water-reduced urethane coating compositions |
| FR2355879A1 (fr) * | 1975-06-02 | 1978-01-20 | Ppg Industries Inc | Compositions de revetement a base d'une dispersion aqueuse de polyurethane |
| FR2366319A1 (fr) * | 1976-10-04 | 1978-04-28 | Textron Inc | Procede d'obtention d'une dispersion aqueuse d'un polymere d'uree-urethanne diluable a l'eau et produits obtenus |
| US4203883A (en) * | 1976-10-04 | 1980-05-20 | Textron, Inc. | Aqueous colloidal dispersions of tertiary amine salts of urea-urethane polymers and method for manufacture |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1495745C3 (de) * | 1963-09-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung wäßriger, emulgatorfreier Polyurethan-Latices |
| DE1570615C3 (de) * | 1965-10-16 | 1975-05-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von dispergierbaren Polyurethanen |
| DE1644813A1 (de) * | 1967-10-06 | 1971-01-21 | Bayer Ag | Herstellung von thermisch haertenden UEberzuegen bzw. Herstellung von Einbrennlacken |
| US3640924A (en) * | 1968-12-20 | 1972-02-08 | American Cyanamid Co | Textile adhesive from polyurethane containing carboxylate groups |
| US3655627A (en) * | 1969-06-19 | 1972-04-11 | Textron Inc | Process for preparing solid particles of urea-urethane polymers |
| US3870684A (en) * | 1970-04-29 | 1975-03-11 | Bayer Ag | Preparation of cross-linked particles of polyurethane or polyurea containing ionic groups |
| DE2041550A1 (de) * | 1970-08-21 | 1972-02-24 | Bayer Ag | Verfahren zum Behandeln von Flaechengebilden mit anionischen waessrigen Polyurethandispersionen |
| US3849360A (en) * | 1970-09-03 | 1974-11-19 | Textron Inc | Polyurea-urethanes produced from a mixture of two polyamines |
| US3781238A (en) * | 1971-08-04 | 1973-12-25 | Textron Inc | Aqueous chain extension of nco prepolymer with tertiary amino polyol using nonionic surfactant,and aqueous dispersion produced |
| USRE29711E (en) | 1972-05-12 | 1978-07-25 | W. R. Grace & Co. | Polyureas and preparation thereof |
| US3835081A (en) * | 1972-07-26 | 1974-09-10 | American Cyanamid Co | Textile adhesive from polyurethane |
| JPS5824445B2 (ja) * | 1974-09-24 | 1983-05-21 | 保土谷化学工業株式会社 | ポリウレタンエマルジヨン ノ セイゾウホウ |
| US4046729A (en) * | 1975-06-02 | 1977-09-06 | Ppg Industries, Inc. | Water-reduced urethane coating compositions |
| IT1068004B (it) * | 1976-11-09 | 1985-03-21 | Hoechst Sara Spa | Processo per la fabbricazione di prepolimeri poliuretanici carbossilati contenenti gruppi isocianici bloccati |
| DE2814079A1 (de) * | 1978-04-01 | 1979-10-11 | Bayer Ag | Beschichtungsmassen |
| DE2902090A1 (de) * | 1979-01-19 | 1980-07-24 | Bayer Ag | Hitzehaertbare beschichtungsmassen und verfahren zur beschichtung von substraten |
-
1980
- 1980-04-09 US US06/138,750 patent/US4387181A/en not_active Expired - Lifetime
-
1981
- 1981-04-08 IT IT67491/81A patent/IT1144328B/it active
- 1981-04-08 FR FR8107077A patent/FR2483433A1/fr active Granted
- 1981-04-08 CA CA000375012A patent/CA1183992A/en not_active Expired
- 1981-04-09 GB GB8135601A patent/GB2083485B/en not_active Expired
- 1981-04-09 DE DE813142255T patent/DE3142255T1/de active Granted
- 1981-04-09 AU AU70788/81A patent/AU544399B2/en not_active Ceased
- 1981-04-09 NL NLAANVRAGE8120138,A patent/NL186577B/xx not_active Application Discontinuation
- 1981-04-09 WO PCT/US1981/000466 patent/WO1981002894A1/en not_active Ceased
- 1981-04-09 JP JP56501443A patent/JPS6336328B2/ja not_active Expired
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3412054A (en) * | 1966-10-31 | 1968-11-19 | Union Carbide Corp | Water-dilutable polyurethanes |
| US4066591A (en) * | 1975-06-02 | 1978-01-03 | Ppg Industries, Inc. | Water-reduced urethane coating compositions |
| FR2355879A1 (fr) * | 1975-06-02 | 1978-01-20 | Ppg Industries Inc | Compositions de revetement a base d'une dispersion aqueuse de polyurethane |
| US4016122A (en) * | 1975-07-31 | 1977-04-05 | Kao Soap Co., Ltd. | Anionic aqueous polyurethane having blocked NCO groups and process |
| FR2366319A1 (fr) * | 1976-10-04 | 1978-04-28 | Textron Inc | Procede d'obtention d'une dispersion aqueuse d'un polymere d'uree-urethanne diluable a l'eau et produits obtenus |
| US4203883A (en) * | 1976-10-04 | 1980-05-20 | Textron, Inc. | Aqueous colloidal dispersions of tertiary amine salts of urea-urethane polymers and method for manufacture |
Also Published As
| Publication number | Publication date |
|---|---|
| US4387181A (en) | 1983-06-07 |
| CA1183992A (en) | 1985-03-12 |
| GB2083485A (en) | 1982-03-24 |
| DE3142255T1 (de) | 1982-07-15 |
| JPS6336328B2 (enExample) | 1988-07-20 |
| AU544399B2 (en) | 1985-05-23 |
| JPS57500566A (enExample) | 1982-04-01 |
| GB2083485B (en) | 1984-07-11 |
| AU7078881A (en) | 1981-10-26 |
| WO1981002894A1 (en) | 1981-10-15 |
| NL8120138A (nl) | 1982-03-01 |
| FR2483433B1 (enExample) | 1983-06-03 |
| NL186577B (nl) | 1990-08-01 |
| IT8167491A0 (it) | 1981-04-08 |
| DE3142255C2 (enExample) | 1992-01-09 |
| IT1144328B (it) | 1986-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR2483433A1 (fr) | Dispersions aqueuses de prepolymeres de polyisocyanantes aromatiques, et procedes pour les fabriquer | |
| US4335029A (en) | Aqueous polyurethane compositions | |
| CA1334231C (en) | Water soluble or dispersible polyurethanes, a process for their preparation and their use for coating substrates | |
| US4801644A (en) | Coating compositions | |
| US4203883A (en) | Aqueous colloidal dispersions of tertiary amine salts of urea-urethane polymers and method for manufacture | |
| EP0663412B1 (fr) | Compositions aqueuses de polyuréthanes | |
| US4183836A (en) | Aqueous polyurethane dispersions | |
| JP7422761B2 (ja) | 揮発性有機化合物を実質的に含まず、高固形分を有する水性ポリウレタン分散体を調製する方法 | |
| EP0000381A1 (de) | Verfahren zur Herstellung von seitenständige Hydroxylgruppen aufweisenden Isocyanat-Polyadditionsprodukten und die nach diesem Verfahren erhaltenen Produkte. | |
| CS214790B2 (en) | Method of preparation of waterous solutions or polyurethan dispersions | |
| LU81722A1 (fr) | Dispersions de polyurethanne reticule et leur procede de production | |
| JPS6227092B2 (enExample) | ||
| BRPI0720519A2 (pt) | Dispersões de pur autorreticulantes, livres de cossolvente. | |
| GB1575637A (en) | Aqueous colloidal polyurea-urethane ionomer dispersions | |
| FR2514770A1 (fr) | Procede de preparation de polyurethanes anioniques ayant une coloration stabilisee a l'oxydation a chaud | |
| Yen et al. | PCL–PEG–PCL triblock ester–ether copolydiol‐based waterborne polyurethane. II. Effect of NCO/OH mole ratio and DMPA content on the physical properties | |
| EP0071834A1 (de) | Verfahren zur Herstellung von Polyaminen und deren Verwendung zur Herstellung von Polyurethanen | |
| JPH03190981A (ja) | 熱硬化性塗料 | |
| EP0150427A2 (de) | Einphasig lagerstabile, salzhaltige Gemische und ihre Verwendung zur Herstellung von Polyurethanen | |
| EP0195899A1 (de) | Verfahren zur Herstellung matter, nichtblockender, dünnwandiger Formkörper aus linearen, thermoplastischen, Polyaddukt-haltigen Polyurethanelastomeren und ihre Verwendung | |
| DE1694136A1 (de) | Verfahren zur Herstellung von Polyurethanen | |
| JPS5883018A (ja) | 粘度の安定なポリウレタン溶液を製造する方法 | |
| EP0097869B1 (de) | Primäre aromatische Aminogruppen, Urethangruppen und Polyestergruppierungen aufweisende Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Baukomponente von Polyurethanen | |
| EP0079536B1 (de) | Verfahren zur Herstellung modifizierter Polyamine | |
| DE60006287T2 (de) | Blockierte polyisocyanate mit phenolischen gruppen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| TP | Transmission of property | ||
| ST | Notification of lapse | ||
| AR | Application made for restoration | ||
| BR | Restoration of rights | ||
| ST | Notification of lapse |