FI84060C - Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl-2- nitro-1,1-etendiamin. - Google Patents
Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl-2- nitro-1,1-etendiamin. Download PDFInfo
- Publication number
- FI84060C FI84060C FI814214A FI814214A FI84060C FI 84060 C FI84060 C FI 84060C FI 814214 A FI814214 A FI 814214A FI 814214 A FI814214 A FI 814214A FI 84060 C FI84060 C FI 84060C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- furanylmethyl
- dimethylamino
- formula
- thio
- Prior art date
Links
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical class CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 title description 4
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 14
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims abstract description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 238000009472 formulation Methods 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract description 3
- VMXUWOKSQNHOCA-LCYFTJDESA-N ranitidine Chemical compound [O-][N+](=O)/C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-LCYFTJDESA-N 0.000 abstract description 2
- 229960000620 ranitidine Drugs 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 5
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 5
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000004149 thio group Chemical group *S* 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- LARJDTRRRDBHNV-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-n-methyl-2-nitroethane-1,1-diamine Chemical compound [O-][N+](=O)CC(NC)NCCSCC1=CC=C(CN(C)C)O1 LARJDTRRRDBHNV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 150000002240 furans Chemical class 0.000 description 2
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- -1 nitrovinyl group Chemical group 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 2
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- MHZGKXUYDGKKIU-UHFFFAOYSA-N Decylamine Chemical compound CCCCCCCCCCN MHZGKXUYDGKKIU-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- GSBZLLKFLFKHLX-UHFFFAOYSA-N methyl n-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-n'-methylcarbamimidothioate Chemical compound CSC(=NC)NCCSCC1=CC=C(CN(C)C)O1 GSBZLLKFLFKHLX-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Seasonings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Magnetic Record Carriers (AREA)
- Photoreceptors In Electrophotography (AREA)
- Peptides Or Proteins (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Steroid Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8041492 | 1980-12-30 | ||
| GB8041492 | 1980-12-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI814214L FI814214L (fi) | 1982-07-01 |
| FI84060B FI84060B (fi) | 1991-06-28 |
| FI84060C true FI84060C (fi) | 1991-10-10 |
Family
ID=10518247
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI814214A FI84060C (fi) | 1980-12-30 | 1981-12-30 | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl-2- nitro-1,1-etendiamin. |
Country Status (9)
| Country | Link |
|---|---|
| EP (1) | EP0055626B1 (enExample) |
| JP (1) | JPS57134476A (enExample) |
| KR (1) | KR860000063B1 (enExample) |
| AT (1) | ATE13058T1 (enExample) |
| DE (1) | DE3170348D1 (enExample) |
| DK (1) | DK153481C (enExample) |
| ES (1) | ES8300733A1 (enExample) |
| FI (1) | FI84060C (enExample) |
| PT (1) | PT74234B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| YU45634B (sh) * | 1983-07-15 | 1992-07-20 | Richter Gedeon Vegyeszeti Gyar R.T. | Postupak za dobijanje hidrohlorida 1-/2-/5-dimetilaminometil-2-(furilmetiltio)-etil /-amino-1-metilamino-2-nitroetilena |
| JPS60146886A (ja) * | 1984-01-06 | 1985-08-02 | ラボラトワ−ル・フアルメデイカル・エス・ア | Ν−{2−〔({5−〔(ジメチルアミノ)−メチル〕−2−フラニル}メチル)チオ〕エチル}ν’−アルキル−2−ニトロ−1,1−エテンジアミン類の製造方法 |
| DE3546858C2 (de) * | 1984-06-15 | 1995-04-20 | Glaxo Group Ltd | Verfahren zur Herstellung von Ranitidin |
| IT1178026B (it) * | 1984-10-05 | 1987-09-03 | Medosan Ind Biochimi | Derivati del 2-amino-tiazolo |
| US5498179A (en) * | 1994-05-04 | 1996-03-12 | Woodhead Industries, Inc. | Electrical connector |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1565966A (en) * | 1976-08-04 | 1980-04-23 | Allen & Hanburys Ltd | Aminoalkyl furan derivatives |
| JPS56103171A (en) * | 1980-01-08 | 1981-08-18 | Glaxo Group Ltd | Manufacture of furan derivative |
-
1981
- 1981-12-30 KR KR1019810005250A patent/KR860000063B1/ko not_active Expired
- 1981-12-30 DK DK581981A patent/DK153481C/da active
- 1981-12-30 JP JP56216183A patent/JPS57134476A/ja active Granted
- 1981-12-30 AT AT81306165T patent/ATE13058T1/de not_active IP Right Cessation
- 1981-12-30 DE DE8181306165T patent/DE3170348D1/de not_active Expired
- 1981-12-30 PT PT74234A patent/PT74234B/pt unknown
- 1981-12-30 FI FI814214A patent/FI84060C/fi not_active IP Right Cessation
- 1981-12-30 EP EP81306165A patent/EP0055626B1/en not_active Expired
- 1981-12-30 ES ES508473A patent/ES8300733A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK153481C (da) | 1989-06-05 |
| EP0055626B1 (en) | 1985-05-02 |
| DK581981A (da) | 1982-07-01 |
| ES508473A0 (es) | 1982-11-16 |
| KR860000063B1 (ko) | 1986-02-06 |
| EP0055626A1 (en) | 1982-07-07 |
| ATE13058T1 (de) | 1985-05-15 |
| KR830007613A (ko) | 1983-11-04 |
| FI84060B (fi) | 1991-06-28 |
| ES8300733A1 (es) | 1982-11-16 |
| JPS57134476A (en) | 1982-08-19 |
| DE3170348D1 (en) | 1985-06-05 |
| FI814214L (fi) | 1982-07-01 |
| PT74234A (en) | 1982-01-02 |
| JPH0256354B2 (enExample) | 1990-11-29 |
| DK153481B (da) | 1988-07-18 |
| PT74234B (en) | 1984-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI84060C (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl-2- nitro-1,1-etendiamin. | |
| KR940010179B1 (ko) | 니트로 에텐 유도체의 제조방법 | |
| FI76080C (fi) | Foerfarande foer framstaellning av furanderivat. | |
| FI81571B (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)-metyl/-2-furanylmetyl/tio/-etyl/-n'-metyl- 2-nitro-1,1-etendiamin. | |
| US4584407A (en) | Preparation of thiazolidine derivatives | |
| KR840002007B1 (ko) | 푸란유도체의 제조방법 | |
| FI63753C (fi) | Foerfarande foer framstaellning av kristallint simetidin. | |
| EP0057564A1 (en) | Process for preparing 3,5-diamino-1,2,4-triazoles | |
| SU472506A3 (ru) | Способ получени производных морфолина | |
| FI80450C (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/-tio/etyl/-n'metyl-2- nitro-1,1-etendiamin. | |
| FI82241B (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl -2-nitro-1,1-etendiamin. | |
| EP0310186B1 (en) | Oximino ether compounds | |
| US4497961A (en) | Process for the preparation of ranitidine | |
| US4535164A (en) | Process for preparing certain substituted 4-thiazolidinones | |
| Degani et al. | 1-(2, 5-Dichlorophenyl)-2, 2-bis (methylsulfanyl) vinyl Esters as Highly Efficient Chemoselective Acylating Reagents | |
| US4394383A (en) | N-Alkoxysulfenylcarbamates useful as insecticides | |
| US4460506A (en) | Nitrovinyl aziridine derivative | |
| FI84059C (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl-2- nitro-1,1-etendiamin. | |
| US4670567A (en) | Process for the preparation of 5,6-dihydro-2H-thiopyran-3-carboxaldehyde derivatives wherein the reactions are conducted in a high boiling mineral oil without a catalyst | |
| SK23199A3 (en) | Process for the preparation of nizatidine | |
| SE8502973D0 (sv) | Framstellning av aminderivat | |
| CA1293263C (en) | Process for the preparation of substituted sulfonamidobenzamides and a novel intermediate thereto | |
| EP0216423A2 (en) | Pesticidal benzoylurea compounds | |
| CH593010A5 (en) | Pesticidal compsns. contg. carbamoyloxy-trichloroethyl-imidazoles - for systemic control of phytopathogenic fungi |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired |
Owner name: GLAXO GROUP LIMITED |