FI82241C - Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl -2-nitro-1,1-etendiamin. - Google Patents
Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl -2-nitro-1,1-etendiamin. Download PDFInfo
- Publication number
- FI82241C FI82241C FI814215A FI814215A FI82241C FI 82241 C FI82241 C FI 82241C FI 814215 A FI814215 A FI 814215A FI 814215 A FI814215 A FI 814215A FI 82241 C FI82241 C FI 82241C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- formula
- ethyl
- thio
- furanylmethyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 17
- 125000000446 sulfanediyl group Chemical group *S* 0.000 title claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 title claims description 16
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 24
- -1 cyclic acetals Chemical class 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 9
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 9
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 8
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 7
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 claims description 7
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 claims description 6
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000012279 sodium borohydride Substances 0.000 claims description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- DLBGAZZFLXBNJA-UHFFFAOYSA-N CN(C)CC1=CC=C(CSCCN(C)C(N)C[N+]([O-])=O)O1 Chemical compound CN(C)CC1=CC=C(CSCCN(C)C(N)C[N+]([O-])=O)O1 DLBGAZZFLXBNJA-UHFFFAOYSA-N 0.000 claims 1
- 210000005036 nerve Anatomy 0.000 claims 1
- 235000020357 syrup Nutrition 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OUAQKVIBEFYQDD-UHFFFAOYSA-N ethanamine;oxalic acid Chemical compound CCN.OC(=O)C(O)=O OUAQKVIBEFYQDD-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- VMXUWOKSQNHOCA-LCYFTJDESA-N ranitidine Chemical compound [O-][N+](=O)/C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-LCYFTJDESA-N 0.000 description 4
- 229960000620 ranitidine Drugs 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000011549 crystallization solution Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LARJDTRRRDBHNV-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-n-methyl-2-nitroethane-1,1-diamine Chemical compound [O-][N+](=O)CC(NC)NCCSCC1=CC=C(CN(C)C)O1 LARJDTRRRDBHNV-UHFFFAOYSA-N 0.000 description 2
- 241000252203 Clupea harengus Species 0.000 description 2
- 125000004036 acetal group Chemical group 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 235000019514 herring Nutrition 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 2
- 229940011051 isopropyl acetate Drugs 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 125000005543 phthalimide group Chemical group 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RBPMGSWTAMFXNZ-UHFFFAOYSA-N 1-nitroethanamine Chemical class CC(N)[N+]([O-])=O RBPMGSWTAMFXNZ-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZQOTTYITLAZYMR-UHFFFAOYSA-N 5-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanylmethyl]furan-2-carbaldehyde Chemical compound O1C(C=O)=CC=C1CSCCN1C(=O)C2=CC=CC=C2C1=O ZQOTTYITLAZYMR-UHFFFAOYSA-N 0.000 description 1
- 241001135931 Anolis Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 150000002240 furans Chemical class 0.000 description 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/46—Doubly bound oxygen atoms, or two oxygen atoms singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8041493 | 1980-12-30 | ||
| GB8041493 | 1980-12-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI814215L FI814215L (fi) | 1982-07-01 |
| FI82241B FI82241B (fi) | 1990-10-31 |
| FI82241C true FI82241C (fi) | 1991-02-11 |
Family
ID=10518248
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI814215A FI82241C (fi) | 1980-12-30 | 1981-12-30 | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl -2-nitro-1,1-etendiamin. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4399294A (enExample) |
| EP (1) | EP0055625B1 (enExample) |
| JP (1) | JPS57134475A (enExample) |
| KR (1) | KR850001935B1 (enExample) |
| AR (2) | AR230442A1 (enExample) |
| AT (1) | ATE13057T1 (enExample) |
| DE (1) | DE3170346D1 (enExample) |
| DK (1) | DK153841C (enExample) |
| ES (1) | ES8301955A1 (enExample) |
| FI (1) | FI82241C (enExample) |
| PT (1) | PT74235B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5988458A (ja) * | 1982-11-12 | 1984-05-22 | Toyama Chem Co Ltd | アミン誘導体およびその塩 |
| YU45634B (sh) * | 1983-07-15 | 1992-07-20 | Richter Gedeon Vegyeszeti Gyar R.T. | Postupak za dobijanje hidrohlorida 1-/2-/5-dimetilaminometil-2-(furilmetiltio)-etil /-amino-1-metilamino-2-nitroetilena |
| DK153758C (da) * | 1985-09-27 | 1995-10-02 | Gea Farmaceutisk Fabrik As | Fremgangsmåde til fremstilling af ranitidin eller syreadditionssalte deraf samt derivat af 5-((2-aminoethyl)thiomethyl)-2-furanmethanol til brug som udgangsmateriale for fremgangsmåden |
| AU7235287A (en) * | 1986-03-28 | 1987-10-20 | Janus Farmaceutici S.R.L | Synthesis of antiulcer compounds |
| YU52598A (sh) * | 1998-11-19 | 2001-05-28 | D.D. Zdravlje- sektor za istraživanje i razvoj | POSTUPAK ZA sintezu N-[2[[[5=[(DIALKILAMINO)METIL]-2= FURANIL]METIL]TIO]ETIL]-N'-ALKIL-2-NITRO 1,1 ALKENDIAMINA I NJIHOVIH HIDROHLORIDA |
| CN108864001A (zh) * | 2018-06-30 | 2018-11-23 | 郑州明泽医药科技有限公司 | 一种合成雷尼替丁的新方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1565966A (en) * | 1976-08-04 | 1980-04-23 | Allen & Hanburys Ltd | Aminoalkyl furan derivatives |
| AR228941A1 (es) * | 1978-04-26 | 1983-05-13 | Glaxo Group Ltd | Procedimiento para preparar nuevos derivados de 3,5-diamino-1,2,4-triazol que son activos contra receptores histaminicos |
| JPS56103171A (en) * | 1980-01-08 | 1981-08-18 | Glaxo Group Ltd | Manufacture of furan derivative |
-
1981
- 1981-12-30 AR AR288011A patent/AR230442A1/es active
- 1981-12-30 AT AT81306164T patent/ATE13057T1/de not_active IP Right Cessation
- 1981-12-30 DK DK582081A patent/DK153841C/da not_active IP Right Cessation
- 1981-12-30 JP JP56216182A patent/JPS57134475A/ja active Granted
- 1981-12-30 KR KR1019810005251A patent/KR850001935B1/ko not_active Expired
- 1981-12-30 PT PT74235A patent/PT74235B/pt unknown
- 1981-12-30 ES ES508474A patent/ES8301955A1/es not_active Expired
- 1981-12-30 AR AR288012A patent/AR230275A1/es active
- 1981-12-30 EP EP81306164A patent/EP0055625B1/en not_active Expired
- 1981-12-30 DE DE8181306164T patent/DE3170346D1/de not_active Expired
- 1981-12-30 FI FI814215A patent/FI82241C/fi not_active IP Right Cessation
- 1981-12-30 US US06/335,686 patent/US4399294A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AR230275A1 (es) | 1984-03-01 |
| JPS57134475A (en) | 1982-08-19 |
| DE3170346D1 (en) | 1985-06-05 |
| KR850001935B1 (ko) | 1985-12-31 |
| PT74235B (en) | 1984-01-04 |
| DK153841C (da) | 1989-02-20 |
| EP0055625A1 (en) | 1982-07-07 |
| ES508474A0 (es) | 1983-01-01 |
| EP0055625B1 (en) | 1985-05-02 |
| FI82241B (fi) | 1990-10-31 |
| DK582081A (da) | 1982-07-01 |
| PT74235A (en) | 1982-01-02 |
| DK153841B (da) | 1988-09-12 |
| KR830007614A (ko) | 1983-11-04 |
| JPH038349B2 (enExample) | 1991-02-05 |
| ES8301955A1 (es) | 1983-01-01 |
| ATE13057T1 (de) | 1985-05-15 |
| FI814215L (fi) | 1982-07-01 |
| AR230442A1 (es) | 1984-04-30 |
| US4399294A (en) | 1983-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU737552B2 (en) | Oxadiazoles, processes for preparing them and their use as pharmaceutical compositions | |
| DE2954639C2 (enExample) | ||
| KR890000377B1 (ko) | 아졸류의 제조방법 | |
| FI82241C (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl -2-nitro-1,1-etendiamin. | |
| DE3688937T2 (de) | Herstellung optisch aktiver aryloxypropanolamine und arylaethanolamine. | |
| HU198479B (en) | Process for producing 1-substituted imidazole derivatives and pharmaceutical compositions comprising same as active ingredient | |
| EP0121753A2 (de) | 1-(1,3-Dioxolan-2-ylmethyl)-azole, ihre Salze, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| CH641757A5 (en) | O-Alkylated hydroxylamines and process for the preparation thereof | |
| DE2401374A1 (de) | Tetrahydronaphthyloxyaminderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| US4665197A (en) | Process for preparing azetidine derivatives and intermediates thereof | |
| KR840002007B1 (ko) | 푸란유도체의 제조방법 | |
| US4381305A (en) | Ethylenediamine derivatives and pharmaceutical compositions containing same | |
| SE410606B (sv) | Analogiforfarande for framstellning av normorfinonderivat | |
| US4012414A (en) | 2-(5-Phenyl-2-furyl)imidazoles | |
| Shutalev et al. | Utilization of the amidoalkylation reaction in the synthesis of hydrogenated pyrimidine-2-thiones | |
| US4012415A (en) | 2-[5-(3,4-Dimethoxyphenyl)-2-furyl]imidazole hydrochloride | |
| FI80450B (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/-tio/etyl/-n'metyl-2- nitro-1,1-etendiamin. | |
| FI84060B (fi) | Foerfarande foer framstaellning av n-/2-//5-/(dimetylamino)metyl/-2-furanylmetyl/tio/etyl/-n'-metyl-2- nitro-1,1-etendiamin. | |
| US4460506A (en) | Nitrovinyl aziridine derivative | |
| US3115499A (en) | 1-(2-hydroxyethyl)-3-amino-2-imidazolidine-thione | |
| US4208338A (en) | Cyano dihydro furanones | |
| US4873343A (en) | Process for the preparation of N-(2-chlorobenzyl)-2-(2-thienyl) ethylamine | |
| US4335241A (en) | 4-α-Amino-arylmethyl-6-methyl-1,3-dihydro-furo[3,4-c]pyridin-7-ols | |
| FI63028B (fi) | Nytt foerfarande foer framstaellning av som laekemedel anvaenda n-(furyl-metyl)-bensomorfaner | |
| SU920056A1 (ru) | Способ получени R,S-2,3,5,6-тетрагидро-6-фенилимидазо /2.1-в/-тиазола |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired |
Owner name: GLAXO GROUP LIMITED |