FI79710C - Foerfarande och mellanprodukter foer framstaellning av sultamicillin och dess analoger. - Google Patents
Foerfarande och mellanprodukter foer framstaellning av sultamicillin och dess analoger. Download PDFInfo
- Publication number
- FI79710C FI79710C FI834456A FI834456A FI79710C FI 79710 C FI79710 C FI 79710C FI 834456 A FI834456 A FI 834456A FI 834456 A FI834456 A FI 834456A FI 79710 C FI79710 C FI 79710C
- Authority
- FI
- Finland
- Prior art keywords
- alkoxy
- formula
- benzoyloxy
- compound
- hydrogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 27
- 238000002360 preparation method Methods 0.000 title claims abstract description 11
- OPYGFNJSCUDTBT-PMLPCWDUSA-N sultamicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(=O)OCOC(=O)[C@H]2C(S(=O)(=O)[C@H]3N2C(C3)=O)(C)C)(C)C)=CC=CC=C1 OPYGFNJSCUDTBT-PMLPCWDUSA-N 0.000 title abstract description 7
- 229960001326 sultamicillin Drugs 0.000 title abstract description 6
- 239000000543 intermediate Substances 0.000 title description 6
- 238000006243 chemical reaction Methods 0.000 claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 11
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000006795 (C2-C7) alkoxycarbonyloxy group Chemical group 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- -1 benzyloxycarbonylamino, triphenylmethylamino, 2-methoxycarbonyl-1-methylvinyl Chemical group 0.000 description 20
- 239000003054 catalyst Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 11
- 239000010410 layer Substances 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 229910000510 noble metal Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- OSORMYZMWHVFOZ-UHFFFAOYSA-N phenethyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCCC1=CC=CC=C1 OSORMYZMWHVFOZ-UHFFFAOYSA-N 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229960000723 ampicillin Drugs 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229960003311 ampicillin trihydrate Drugs 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- PJGJQVRXEUVAFT-UHFFFAOYSA-N chloroiodomethane Chemical compound ClCI PJGJQVRXEUVAFT-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- CKFGINPQOCXMAZ-UHFFFAOYSA-N formaldehyde hydrate Natural products OCO CKFGINPQOCXMAZ-UHFFFAOYSA-N 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- UMFCIIBZHQXRCJ-NSCUHMNNSA-N trans-anol Chemical compound C\C=C\C1=CC=C(O)C=C1 UMFCIIBZHQXRCJ-NSCUHMNNSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cephalosporin Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Measuring Or Testing Involving Enzymes Or Micro-Organisms (AREA)
- Iron Core Of Rotating Electric Machines (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Peptides Or Proteins (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44689582A | 1982-12-06 | 1982-12-06 | |
| US44689582 | 1982-12-06 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI834456A0 FI834456A0 (fi) | 1983-12-05 |
| FI834456L FI834456L (fi) | 1984-06-07 |
| FI79710B FI79710B (fi) | 1989-10-31 |
| FI79710C true FI79710C (fi) | 1990-02-12 |
Family
ID=23774227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI834456A FI79710C (fi) | 1982-12-06 | 1983-12-05 | Foerfarande och mellanprodukter foer framstaellning av sultamicillin och dess analoger. |
Country Status (17)
| Country | Link |
|---|---|
| EP (1) | EP0112087B1 (index.php) |
| JP (2) | JPS59112992A (index.php) |
| KR (1) | KR870000610B1 (index.php) |
| AT (1) | ATE26985T1 (index.php) |
| AU (1) | AU545390B2 (index.php) |
| CA (1) | CA1212104A (index.php) |
| DE (1) | DE3371340D1 (index.php) |
| DK (1) | DK163926C (index.php) |
| ES (1) | ES8504824A1 (index.php) |
| FI (1) | FI79710C (index.php) |
| GR (1) | GR78768B (index.php) |
| HU (1) | HU191902B (index.php) |
| IE (1) | IE56326B1 (index.php) |
| PH (1) | PH20068A (index.php) |
| PL (1) | PL142142B1 (index.php) |
| PT (1) | PT77733B (index.php) |
| YU (1) | YU43332B (index.php) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2039299B1 (es) * | 1991-10-04 | 1994-05-16 | Asturpharma S A | Procedimiento de obtencion de esteres de acido 1,1-dioxopenicilanico y sus sales. |
| ES2100125B1 (es) * | 1995-06-02 | 1998-04-01 | Asturpharma S A | Procedimiento de preparacion de esteres de metanodiol de acido dioxopenicilanico. |
| ES2161602B1 (es) * | 1999-04-08 | 2003-02-16 | Asturpharma S A | Sintesis de 6-(d-alfa-(bencilidenaminofenilacetamido))penicilanato de 1,1-dioxopenicilanoiloximetilo y analogos. nuevos intermedios para la sintesis de sultamicilina. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA80796B (en) * | 1979-02-13 | 1981-02-25 | Leo Pharm Prod Ltd | Chemical compounds |
| IL64009A (en) * | 1980-10-31 | 1984-09-30 | Rech Applications Therap | Crystalline 1,1-dioxopenicillanoyloxymethyl 6-(d-alpha-amino-alpha-phenylacetamido)penicillanate tosylate hydrates,their production and pharmaceutical compositions containing them |
| IN159362B (index.php) * | 1981-03-23 | 1987-05-09 | Pfizer | |
| US4419284A (en) * | 1981-03-23 | 1983-12-06 | Pfizer Inc. | Preparation of halomethyl esters (and related esters) of penicillanic acid 1,1-dioxide |
-
1983
- 1983-10-21 PH PH29753A patent/PH20068A/en unknown
- 1983-11-25 PT PT77733A patent/PT77733B/pt unknown
- 1983-11-29 EP EP83307258A patent/EP0112087B1/en not_active Expired
- 1983-11-29 DE DE8383307258T patent/DE3371340D1/de not_active Expired
- 1983-11-29 AT AT83307258T patent/ATE26985T1/de not_active IP Right Cessation
- 1983-12-01 GR GR73127A patent/GR78768B/el unknown
- 1983-12-02 CA CA000442455A patent/CA1212104A/en not_active Expired
- 1983-12-02 ES ES527729A patent/ES8504824A1/es not_active Expired
- 1983-12-02 YU YU2360/83A patent/YU43332B/xx unknown
- 1983-12-05 KR KR1019830005745A patent/KR870000610B1/ko not_active Expired
- 1983-12-05 HU HU834160A patent/HU191902B/hu unknown
- 1983-12-05 PL PL1983244922A patent/PL142142B1/pl unknown
- 1983-12-05 IE IE2853/83A patent/IE56326B1/en not_active IP Right Cessation
- 1983-12-05 AU AU21967/83A patent/AU545390B2/en not_active Expired
- 1983-12-05 FI FI834456A patent/FI79710C/fi not_active IP Right Cessation
- 1983-12-05 DK DK558883A patent/DK163926C/da not_active IP Right Cessation
- 1983-12-06 JP JP58230485A patent/JPS59112992A/ja active Granted
-
1988
- 1988-02-08 JP JP63027393A patent/JPS63211289A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| PH20068A (en) | 1986-09-18 |
| GR78768B (index.php) | 1984-10-02 |
| EP0112087A1 (en) | 1984-06-27 |
| ES527729A0 (es) | 1985-05-01 |
| PL142142B1 (en) | 1987-09-30 |
| JPH026758B2 (index.php) | 1990-02-13 |
| JPH0119396B2 (index.php) | 1989-04-11 |
| ATE26985T1 (de) | 1987-05-15 |
| EP0112087B1 (en) | 1987-05-06 |
| YU236083A (en) | 1986-02-28 |
| IE832853L (en) | 1984-06-06 |
| DK558883D0 (da) | 1983-12-05 |
| IE56326B1 (en) | 1991-06-19 |
| YU43332B (en) | 1989-06-30 |
| KR840007010A (ko) | 1984-12-04 |
| FI834456A0 (fi) | 1983-12-05 |
| AU545390B2 (en) | 1985-07-11 |
| KR870000610B1 (ko) | 1987-03-25 |
| JPS63211289A (ja) | 1988-09-02 |
| PL244922A1 (en) | 1985-03-12 |
| PT77733A (en) | 1983-12-01 |
| JPS59112992A (ja) | 1984-06-29 |
| DK163926B (da) | 1992-04-21 |
| ES8504824A1 (es) | 1985-05-01 |
| DE3371340D1 (en) | 1987-06-11 |
| DK163926C (da) | 1992-09-14 |
| AU2196783A (en) | 1984-06-14 |
| DK558883A (da) | 1984-06-07 |
| FI834456L (fi) | 1984-06-07 |
| CA1212104A (en) | 1986-09-30 |
| HU191902B (en) | 1987-04-28 |
| FI79710B (fi) | 1989-10-31 |
| PT77733B (en) | 1986-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL129534B1 (en) | Process for preparing novel derivatives of 6-beta-hydroxyalkylpenicillanic acid | |
| JP2002514649A (ja) | エポチロン誘導体、それらの製造方法、並びにそれらの使用 | |
| KR900007199B1 (ko) | 페남 유도체의 제조방법 | |
| FI79710C (fi) | Foerfarande och mellanprodukter foer framstaellning av sultamicillin och dess analoger. | |
| EP1228074B1 (en) | Method of preparing highly pure cefpodoxime proxetil | |
| US4778921A (en) | Novel process of alkoxy and aryloxy isothiocyanate preparation | |
| US3957794A (en) | 3-Amino-2,3,3a,6,7,7a-hexahydro-thieno[3,2-b]pyridin-(4H)5-one | |
| PL131618B1 (en) | Process for preparing novel inhibitors of dipeptase | |
| FI75165B (fi) | Foerbaettrat foerfarande foer framstaellning av penicillansyraklormetylestrar. | |
| US3951954A (en) | Novel oxofuryl ester derivatives of penicillin and cephalosporin | |
| US5700945A (en) | Process for preparing nizatidine | |
| US3996236A (en) | Methoxymethyl D-6-(2,2-dimethyl-5-oxo-4-phenyl-1-imidazolidinyl)penicillanate | |
| US4417047A (en) | Novel tetrazole-5-thiol ester and process for preparing cefamandole using same | |
| US5288860A (en) | Process for preparing thiazolino azetidinone and 2-exo-methylenepenam derivative | |
| US4375434A (en) | Process for 6'-amino-penicillanoyloxymethyl penicillanate 1,1-dioxide | |
| EP0014566A1 (en) | Halogenated beta-lactam compounds and process for their preparation | |
| PL143943B1 (en) | Method of obtaining novel beta-lactam esters of 6-alpha- and 6-beta-/aminomethyl/penicillanic acid 1,1-dioxide | |
| US4868297A (en) | Process for preparing sultamicillin and analogs | |
| KR870000313B1 (ko) | 6-(아미노메틸)페니실란산 1,1-다이옥사이드 및 이의 유도체의 제조방법 | |
| US4148995A (en) | Process for preparing cephem lactones for cephalosporin-type antibiotics | |
| KR100388108B1 (ko) | 세팔로스포린계 항생제 중간체 신규 제조방법 | |
| KR860001369B1 (ko) | 페니실란산 에스테르류의 제조 방법 | |
| KR840002046B1 (ko) | 세팔로스포린의 제조방법 | |
| EP0122002A1 (en) | Process for preparing azetidinone derivatives | |
| JPH0446958B2 (index.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired |
Owner name: PFIZER INC. |