FI70703C - Foerfarande foer framstaellning av 2,3,5-triklorpyridin och en foerfarandet anvaendbar mellanprodukt - Google Patents
Foerfarande foer framstaellning av 2,3,5-triklorpyridin och en foerfarandet anvaendbar mellanprodukt Download PDFInfo
- Publication number
- FI70703C FI70703C FI793783A FI793783A FI70703C FI 70703 C FI70703 C FI 70703C FI 793783 A FI793783 A FI 793783A FI 793783 A FI793783 A FI 793783A FI 70703 C FI70703 C FI 70703C
- Authority
- FI
- Finland
- Prior art keywords
- copper
- trichloropyridine
- trichloroacetaldehyde
- temperature
- acrylonitrile
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 16
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 claims description 48
- CNLIIAKAAMFCJG-UHFFFAOYSA-N 2,3,5-trichloropyridine Chemical compound ClC1=CN=C(Cl)C(Cl)=C1 CNLIIAKAAMFCJG-UHFFFAOYSA-N 0.000 claims description 41
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 26
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 24
- 229940029273 trichloroacetaldehyde Drugs 0.000 claims description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 21
- WIPMHAQXXYPIPT-UHFFFAOYSA-N 2,4,4-trichloro-5-oxopentanenitrile Chemical compound N#CC(Cl)CC(Cl)(Cl)C=O WIPMHAQXXYPIPT-UHFFFAOYSA-N 0.000 claims description 19
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 19
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 18
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 15
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 13
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 11
- OOWFYDWAMOKVSF-UHFFFAOYSA-N 3-methoxypropanenitrile Chemical compound COCCC#N OOWFYDWAMOKVSF-UHFFFAOYSA-N 0.000 claims description 8
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 7
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 7
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 claims description 6
- 229910021595 Copper(I) iodide Inorganic materials 0.000 claims description 5
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 claims description 5
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(II) bromide Substances [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 claims description 5
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 claims description 5
- 238000002955 isolation Methods 0.000 claims description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 230000003197 catalytic effect Effects 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 230000001351 cycling effect Effects 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000000843 powder Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 18
- -1 allyl halides Chemical class 0.000 description 15
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 238000007363 ring formation reaction Methods 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 210000003298 dental enamel Anatomy 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 238000001256 steam distillation Methods 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 150000004292 cyclic ethers Chemical class 0.000 description 3
- 150000001983 dialkylethers Chemical class 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 2
- VMHZXXPDUOVTHD-UHFFFAOYSA-N 2,3,4-trichloropyridine Chemical compound ClC1=CC=NC(Cl)=C1Cl VMHZXXPDUOVTHD-UHFFFAOYSA-N 0.000 description 2
- HXVNBWAKAOHACI-UHFFFAOYSA-N 2,4-dimethyl-3-pentanone Chemical compound CC(C)C(=O)C(C)C HXVNBWAKAOHACI-UHFFFAOYSA-N 0.000 description 2
- ZICOPWJJZSJEDL-UHFFFAOYSA-N 3,5-dichloro-1h-pyridin-2-one Chemical class OC1=NC=C(Cl)C=C1Cl ZICOPWJJZSJEDL-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001253 acrylic acids Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N anhydrous diethylene glycol Natural products OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- YLHUPYSUKYAIBW-UHFFFAOYSA-N 1-acetylpyrrolidin-2-one Chemical compound CC(=O)N1CCCC1=O YLHUPYSUKYAIBW-UHFFFAOYSA-N 0.000 description 1
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical group CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 1
- DNDPLEAVNVOOQZ-UHFFFAOYSA-N 2,3,4,5,6-pentachloropyridine Chemical class ClC1=NC(Cl)=C(Cl)C(Cl)=C1Cl DNDPLEAVNVOOQZ-UHFFFAOYSA-N 0.000 description 1
- MAKFMOSBBNKPMS-UHFFFAOYSA-N 2,3-dichloropyridine Chemical class ClC1=CC=CN=C1Cl MAKFMOSBBNKPMS-UHFFFAOYSA-N 0.000 description 1
- DZLUPKIRNOCKJB-UHFFFAOYSA-N 2-methoxy-n,n-dimethylacetamide Chemical compound COCC(=O)N(C)C DZLUPKIRNOCKJB-UHFFFAOYSA-N 0.000 description 1
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 1
- VZPRLNDQQBDCNZ-UHFFFAOYSA-N 3,5-dichloro-1-methylpyridin-2-one Chemical compound CN1C=C(Cl)C=C(Cl)C1=O VZPRLNDQQBDCNZ-UHFFFAOYSA-N 0.000 description 1
- OCWBGKZFOYMCCN-UHFFFAOYSA-N 3,5-dichloropyridin-2-amine Chemical compound NC1=NC=C(Cl)C=C1Cl OCWBGKZFOYMCCN-UHFFFAOYSA-N 0.000 description 1
- DCWQZPJHHVLHSV-UHFFFAOYSA-N 3-ethoxypropanenitrile Chemical compound CCOCCC#N DCWQZPJHHVLHSV-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical group COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- DRUIESSIVFYOMK-UHFFFAOYSA-N Trichloroacetonitrile Chemical compound ClC(Cl)(Cl)C#N DRUIESSIVFYOMK-UHFFFAOYSA-N 0.000 description 1
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000005753 chloropyridines Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 150000003950 cyclic amides Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- OUMFRZJDHOKSPJ-UHFFFAOYSA-N dimethylaminophosphonic acid Chemical compound CN(C)P(O)(O)=O OUMFRZJDHOKSPJ-UHFFFAOYSA-N 0.000 description 1
- QONGECDDDTYBGS-UHFFFAOYSA-N dimorpholin-4-ylmethanone Chemical group C1COCCN1C(=O)N1CCOCC1 QONGECDDDTYBGS-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- WCFDSGHAIGTEKL-UHFFFAOYSA-N n,n-dimethylmethanesulfonamide Chemical compound CN(C)S(C)(=O)=O WCFDSGHAIGTEKL-UHFFFAOYSA-N 0.000 description 1
- WIOVVBRSQYYSMV-UHFFFAOYSA-N n-(dimethylsulfamoyl)-n-methylmethanamine Chemical compound CN(C)S(=O)(=O)N(C)C WIOVVBRSQYYSMV-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 description 1
- 239000004304 potassium nitrite Substances 0.000 description 1
- 235000010289 potassium nitrite Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- QRYROSZXZPINDI-UHFFFAOYSA-N pyridine-3,5-disulfonic acid Chemical compound OS(=O)(=O)C1=CN=CC(S(O)(=O)=O)=C1 QRYROSZXZPINDI-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- YAYGSLOSTXKUBW-UHFFFAOYSA-N ruthenium(2+) Chemical compound [Ru+2] YAYGSLOSTXKUBW-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Substances C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1239578 | 1978-12-05 | ||
| CH1239478 | 1978-12-05 | ||
| CH1239478 | 1978-12-05 | ||
| CH1239578 | 1978-12-05 | ||
| CH948979 | 1979-10-23 | ||
| CH948979 | 1979-10-23 | ||
| CH948879 | 1979-10-23 | ||
| CH948879 | 1979-10-23 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI793783A7 FI793783A7 (fi) | 1980-06-06 |
| FI70703B FI70703B (fi) | 1986-06-26 |
| FI70703C true FI70703C (fi) | 1986-10-06 |
Family
ID=27429223
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI793783A FI70703C (fi) | 1978-12-05 | 1979-12-03 | Foerfarande foer framstaellning av 2,3,5-triklorpyridin och en foerfarandet anvaendbar mellanprodukt |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4245098A (pl) |
| EP (1) | EP0012117B1 (pl) |
| AR (1) | AR222846A1 (pl) |
| AU (1) | AU527950B2 (pl) |
| BR (1) | BR7907901A (pl) |
| CA (1) | CA1123836A (pl) |
| CS (1) | CS215035B2 (pl) |
| DD (1) | DD149065A5 (pl) |
| DE (1) | DE2962105D1 (pl) |
| ES (1) | ES486574A1 (pl) |
| FI (1) | FI70703C (pl) |
| GR (1) | GR73036B (pl) |
| HU (1) | HU184064B (pl) |
| IL (1) | IL58872A (pl) |
| NO (2) | NO154165C (pl) |
| PL (1) | PL122604B1 (pl) |
| SU (1) | SU942592A3 (pl) |
| TR (1) | TR21019A (pl) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4360676A (en) * | 1979-11-30 | 1982-11-23 | Ciba-Geigy Corporation | 3,3,5-Trichloroglutaric acid imide |
| ATE11533T1 (de) * | 1979-11-30 | 1985-02-15 | Ciba-Geigy Ag | Verfahren zur herstellung von 2,3,5,6tetrachlorpyridin und 3,5,6-trichlorpyridin-2-ol. |
| EP0046735B1 (de) * | 1980-08-27 | 1984-12-12 | Ciba-Geigy Ag | Verfahren zur Herstellung von durch Methyl- oder Trifluormethylgruppen substituierten Chlorpyridinen |
| EP0078234B1 (de) * | 1981-10-20 | 1990-07-04 | Ciba-Geigy Ag | 5-Halogenalkyl-pyridine |
| US4473696A (en) * | 1982-10-07 | 1984-09-25 | Ici Americas Inc. | Synthesis of 2-substituted-5-methyl-pyridines |
| US4435573A (en) * | 1982-10-25 | 1984-03-06 | The Dow Chemical Company | Process for the preparation of substituted pyridines |
| US4468354A (en) * | 1983-02-15 | 1984-08-28 | The Dow Chemical Company | Continuous process for preparing 5-oxo-2,4-dichloro-4-substituted pentanenitriles |
| AU571683B2 (en) * | 1984-05-23 | 1988-04-21 | Zeneca Ag Products Inc. | 2-substituted-5-methylpyridines from methylcyclobutane- carbonitrile, valeronitrile and pentenonitrile intermediates |
| US5106984A (en) * | 1985-12-20 | 1992-04-21 | The Dow Chemical Company | 2-hydrocarbyl-3,6-dichloropyridines and their preparation |
| DE3779756T2 (de) * | 1987-09-09 | 1992-12-10 | Dowelanco | 2-hydrocarbyl-3,6-dichlorpyridine und ihre herstellung. |
| IL86341A (en) * | 1988-05-11 | 1992-02-16 | Pamol Ltd | Preparation of polychloropyridine derivatives and intermediates therefor |
| US4996323A (en) * | 1989-05-12 | 1991-02-26 | The Dow Chemical Company | Process for the preparation of 3,5,6-trichloropyridin-2-ol |
| US5254712A (en) * | 1990-01-06 | 1993-10-19 | Stamicarbon B.V. | Process for the preparation of 5-oxohexane nitriles and the compound 2,4-dimethyl-5-oxohexane nitrile |
| NL9000034A (nl) * | 1990-01-06 | 1991-08-01 | Stamicarbon | Werkwijze voor de bereiding van 5-oxohexaannitrillen alsmede de stof 2,4-dimethyl-5-oxohexaannitril. |
| US5229519A (en) * | 1992-03-06 | 1993-07-20 | Reilly Industries, Inc. | Process for preparing 2-halo-5-halomethylpyridines |
| US5688953A (en) * | 1996-07-31 | 1997-11-18 | Dowelanco | Process for the preparation of 3,3,5-trichloroglutarimide |
| US6051714A (en) * | 1998-03-12 | 2000-04-18 | Reilly Industries, Inc. | Processes for dechlorinating pyridines |
| USD889872S1 (en) * | 2018-08-09 | 2020-07-14 | Niangao Zhao | Bench |
| CN113004193B (zh) * | 2021-02-07 | 2024-10-18 | 兰州康鹏威耳化工有限公司 | 硅化合物在环合反应中的用途 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3262964A (en) | 1963-08-12 | 1966-07-26 | Shell Oil Co | Halo-sulfone production |
| CH501623A (de) | 1967-12-18 | 1971-01-15 | Ruetgerswerke Ag | Verfahren zur Herstellung von 2-Chlorpyridin und seinen Derivaten |
| US3592817A (en) * | 1968-05-17 | 1971-07-13 | Dow Chemical Co | Preparation of perchloropyridine and perchlorocyanopyridine compounds by vapor phase chlorination of aliphatic nitriles |
| GB1334922A (en) * | 1971-05-04 | 1973-10-24 | Ici Ltd | Manufacture of halogenated pyridine derivatives |
| NL7207939A (pl) | 1972-06-12 | 1973-12-14 | ||
| CH620339A5 (pl) | 1976-03-05 | 1980-11-28 | Ciba Geigy Ag |
-
1979
- 1979-11-28 US US06/098,017 patent/US4245098A/en not_active Expired - Lifetime
- 1979-12-03 DD DD79217329A patent/DD149065A5/de not_active IP Right Cessation
- 1979-12-03 GR GR60656A patent/GR73036B/el unknown
- 1979-12-03 DE DE7979810171T patent/DE2962105D1/de not_active Expired
- 1979-12-03 FI FI793783A patent/FI70703C/fi not_active IP Right Cessation
- 1979-12-03 CA CA341,061A patent/CA1123836A/en not_active Expired
- 1979-12-03 EP EP79810171A patent/EP0012117B1/de not_active Expired
- 1979-12-03 AR AR279127A patent/AR222846A1/es active
- 1979-12-04 NO NO793953A patent/NO154165C/no unknown
- 1979-12-04 AU AU53460/79A patent/AU527950B2/en not_active Ceased
- 1979-12-04 CS CS798390A patent/CS215035B2/cs unknown
- 1979-12-04 HU HU79CI1994A patent/HU184064B/hu not_active IP Right Cessation
- 1979-12-04 SU SU792847570A patent/SU942592A3/ru active
- 1979-12-04 BR BR7907901A patent/BR7907901A/pt not_active IP Right Cessation
- 1979-12-04 IL IL58872A patent/IL58872A/xx not_active IP Right Cessation
- 1979-12-04 ES ES486574A patent/ES486574A1/es not_active Expired
- 1979-12-05 TR TR21019A patent/TR21019A/xx unknown
- 1979-12-05 PL PL1979220156A patent/PL122604B1/pl unknown
-
1984
- 1984-08-14 NO NO843244A patent/NO153847C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO793953L (no) | 1980-06-06 |
| EP0012117B1 (de) | 1982-02-10 |
| PL122604B1 (en) | 1982-08-31 |
| PL220156A1 (pl) | 1980-12-01 |
| SU942592A3 (ru) | 1982-07-07 |
| FI793783A7 (fi) | 1980-06-06 |
| DD149065A5 (de) | 1981-06-24 |
| AU5346079A (en) | 1980-06-12 |
| CS215035B2 (en) | 1982-06-25 |
| IL58872A0 (en) | 1980-03-31 |
| BR7907901A (pt) | 1980-07-22 |
| AU527950B2 (en) | 1983-03-31 |
| NO843244L (no) | 1980-06-06 |
| US4245098A (en) | 1981-01-13 |
| TR21019A (tr) | 1983-05-16 |
| DE2962105D1 (en) | 1982-03-18 |
| NO154165B (no) | 1986-04-21 |
| NO154165C (no) | 1986-07-30 |
| FI70703B (fi) | 1986-06-26 |
| EP0012117A1 (de) | 1980-06-11 |
| IL58872A (en) | 1982-11-30 |
| CA1123836A (en) | 1982-05-18 |
| GR73036B (pl) | 1984-01-26 |
| HU184064B (en) | 1984-06-28 |
| NO153847C (no) | 1986-06-04 |
| NO153847B (no) | 1986-02-24 |
| ES486574A1 (es) | 1980-10-01 |
| AR222846A1 (es) | 1981-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI70703C (fi) | Foerfarande foer framstaellning av 2,3,5-triklorpyridin och en foerfarandet anvaendbar mellanprodukt | |
| KR101364292B1 (ko) | 치환된 2-플루오로아크릴산 유도체의 제조 | |
| EP0186117A2 (en) | Process for the production of acylated diketonic compounds | |
| KR0153523B1 (ko) | 피리딘의 아미드화 방법 | |
| US4665186A (en) | 2,2,4,4-tetrasubstituted 4-formylbutyronitrile intermediates for the production of trisubstituted pyridines | |
| US4469896A (en) | Process for the production of chloropyridines substituted by methyl, trichloromethyl or trifluoromethyl groups | |
| JPH08512307A (ja) | 化学的方法 | |
| US4057583A (en) | Process for the preparation of pinacolone | |
| US4018771A (en) | Process for the production of 2-alkyl or 2-cycloalkyl-4-methyl-6-hydroxypyrimidines | |
| US6353126B1 (en) | Process for the production of malononitrile | |
| HU209916B (en) | Process for preparation of 2-aryl-5-/trifluoro-methyl/-pyrrole derivatives having insecticidal, acaricidal, nematocidal activity | |
| AU2003203479B2 (en) | Process for the preparation of bicyclic diketone salts | |
| US5637775A (en) | Process for the preparation of halogenated ethers | |
| US5663383A (en) | Process for the preparation of 3-hydroxyoxetanes | |
| JP5071795B2 (ja) | ベンゾオキサチイン化合物の製造方法 | |
| EP0137415B1 (en) | Addition of polyhalonitriles to functionalized olefins | |
| US4440947A (en) | Preparation of substituted alpha-halogeno-propionic acids and their derivatives | |
| Toyota et al. | Unexpected formation of 4, 7-dihalobenzo [b] thiophenes using Ohira-Bestmann reagent and reactivity of the halogen-substituted benzo [b] thiophenes in Suzuki-Miyaura coupling with phenylboronic acid | |
| US4122115A (en) | Preparation of chloro- and bromo-fluoroacetyl chloride | |
| JPH08239338A (ja) | メチル−1,1−ジクロロメチルエーテルまたはエチル−1,1−ジクロロメチルエーテルの合成方法 | |
| KR101140134B1 (ko) | 신규한 3-아릴부텐올라이드 유도체와 이의 제조방법 | |
| KR100201803B1 (ko) | 2,3,5,6-테트라클로로피리딘의 제조 방법 | |
| SU803857A3 (ru) | Способ получени -бензиловыхэфиРОВ , -диАлКилТиОКАРбАМи-НОВОй КиСлОТы | |
| SU961555A3 (ru) | Способ получени дигалоидвиниловых соединений | |
| Pinkus et al. | Synthesis of 2-chloro-and 2, 5-dichlorobenzophenones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: CIBA-GEIGY AG |