FI66901C - Tvaett- och rengoeringsmedel innehaollande smaeltfosfat - Google Patents
Tvaett- och rengoeringsmedel innehaollande smaeltfosfat Download PDFInfo
- Publication number
- FI66901C FI66901C FI791480A FI791480A FI66901C FI 66901 C FI66901 C FI 66901C FI 791480 A FI791480 A FI 791480A FI 791480 A FI791480 A FI 791480A FI 66901 C FI66901 C FI 66901C
- Authority
- FI
- Finland
- Prior art keywords
- weight
- detergent
- acid
- alkali
- phosphate
- Prior art date
Links
- 239000003599 detergent Substances 0.000 claims description 50
- 229910019142 PO4 Inorganic materials 0.000 claims description 31
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 26
- 239000010452 phosphate Substances 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 14
- 239000003513 alkali Substances 0.000 claims description 11
- -1 aminoalkylene phosphonic acid Chemical compound 0.000 claims description 11
- 239000000654 additive Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000004094 surface-active agent Substances 0.000 claims description 10
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 9
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 8
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 8
- 239000012459 cleaning agent Substances 0.000 claims description 7
- 239000003760 tallow Substances 0.000 claims description 7
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 6
- 239000000344 soap Substances 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 229910021536 Zeolite Inorganic materials 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 claims description 5
- 239000010457 zeolite Substances 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims description 4
- 235000011180 diphosphates Nutrition 0.000 claims description 4
- 239000002736 nonionic surfactant Substances 0.000 claims description 4
- 125000000129 anionic group Chemical group 0.000 claims description 3
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 claims description 3
- 150000001447 alkali salts Chemical class 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- 239000008139 complexing agent Substances 0.000 claims description 2
- 150000002191 fatty alcohols Chemical class 0.000 claims description 2
- 239000002563 ionic surfactant Substances 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 238000001694 spray drying Methods 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 2
- 125000002947 alkylene group Chemical class 0.000 claims 1
- 150000003863 ammonium salts Chemical class 0.000 claims 1
- 239000007844 bleaching agent Substances 0.000 claims 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical class OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims 1
- 239000004327 boric acid Chemical class 0.000 claims 1
- 150000002978 peroxides Chemical class 0.000 claims 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical class O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 description 40
- 238000005406 washing Methods 0.000 description 36
- 235000021317 phosphate Nutrition 0.000 description 27
- 239000000243 solution Substances 0.000 description 10
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 8
- 239000011574 phosphorus Substances 0.000 description 8
- 229910052698 phosphorus Inorganic materials 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 4
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 229920000388 Polyphosphate Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000001205 polyphosphate Substances 0.000 description 3
- 235000011176 polyphosphates Nutrition 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 229940048084 pyrophosphate Drugs 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 229910052919 magnesium silicate Inorganic materials 0.000 description 2
- 235000019792 magnesium silicate Nutrition 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 2
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Chemical class C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 240000008100 Brassica rapa Species 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 101001096355 Homo sapiens Replication factor C subunit 3 Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 101100045754 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) rtf-1 gene Proteins 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 102100037855 Replication factor C subunit 3 Human genes 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Chemical class O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical class CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- JZKFHQMONDVVNF-UHFFFAOYSA-N dodecyl sulfate;tris(2-hydroxyethyl)azanium Chemical compound OCCN(CCO)CCO.CCCCCCCCCCCCOS(O)(=O)=O JZKFHQMONDVVNF-UHFFFAOYSA-N 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- LPTIRUACFKQDHZ-UHFFFAOYSA-N hexadecyl sulfate;hydron Chemical compound CCCCCCCCCCCCCCCCOS(O)(=O)=O LPTIRUACFKQDHZ-UHFFFAOYSA-N 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 235000021049 nutrient content Nutrition 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 238000011056 performance test Methods 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001444 polymaleic acid Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000011268 retreatment Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- IWMMSZLFZZPTJY-UHFFFAOYSA-M sodium;3-(dodecylamino)propane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCNCCCS([O-])(=O)=O IWMMSZLFZZPTJY-UHFFFAOYSA-M 0.000 description 1
- HWCHICTXVOMIIF-UHFFFAOYSA-M sodium;3-(dodecylamino)propanoate Chemical compound [Na+].CCCCCCCCCCCCNCCC([O-])=O HWCHICTXVOMIIF-UHFFFAOYSA-M 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000002352 surface water Substances 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Chemical class OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/06—Phosphates, including polyphosphates
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782820554 DE2820554A1 (de) | 1978-05-11 | 1978-05-11 | Wasch- und reinigungsmittel |
| DE2820554 | 1978-05-11 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI791480A7 FI791480A7 (fi) | 1979-11-12 |
| FI66901B FI66901B (fi) | 1984-08-31 |
| FI66901C true FI66901C (fi) | 1984-12-10 |
Family
ID=6039100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI791480A FI66901C (fi) | 1978-05-11 | 1979-05-09 | Tvaett- och rengoeringsmedel innehaollande smaeltfosfat |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4308158A (de) |
| JP (1) | JPS54148803A (de) |
| AT (1) | AT375389B (de) |
| BE (1) | BE876146A (de) |
| CA (1) | CA1113826A (de) |
| CH (1) | CH641834A5 (de) |
| DE (1) | DE2820554A1 (de) |
| DK (1) | DK195479A (de) |
| ES (1) | ES8101115A1 (de) |
| FI (1) | FI66901C (de) |
| FR (1) | FR2425473A1 (de) |
| GB (1) | GB2023164B (de) |
| IT (1) | IT7948983A0 (de) |
| LU (1) | LU81239A1 (de) |
| NL (1) | NL7903403A (de) |
| NO (1) | NO791567L (de) |
| SE (1) | SE7904128L (de) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PH15686A (en) * | 1979-03-06 | 1983-03-11 | Unilever Nv | Detergent compositions |
| AU6418880A (en) * | 1979-11-12 | 1981-05-21 | Unilever Ltd. | Detergent compositions |
| ATE7511T1 (de) * | 1981-01-14 | 1984-06-15 | Unilever Nv | Verfahren zum waschen von gewebe und detergenszusammensetzung hierfuer. |
| DE3424299A1 (de) * | 1984-07-02 | 1986-01-09 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung eines spruehgetrockneten nichtionischen waschhilfsmittels |
| US4915862A (en) * | 1988-08-11 | 1990-04-10 | The Procter & Gamble Company | Granular detergent compositions containing crutched and admixed phosphate builder system |
| US5180515A (en) * | 1989-07-27 | 1993-01-19 | The Procter & Gamble Company | Granular detergent compositions having low levels of potassium salt to provide improved solubility |
| ZA9458B (en) * | 1993-01-11 | 1995-08-07 | Colgate Palmolive Co | Soap composition containing sodium pyrophosphate |
| NL1012895C2 (nl) * | 1999-07-22 | 2001-01-23 | Innocleaning Concepts Holding | Werkwijze en inrichting voor het verwijderen van vuil met behulp van stoom en reinigingsmiddel. |
| US7125833B2 (en) * | 2003-03-24 | 2006-10-24 | Wacker Chemie Ag | Cyclodextrin laundry detergent additive complexes and compositions containing same |
| DE102010023790A1 (de) | 2010-06-15 | 2011-12-15 | Heinrich-Heine-Universität Düsseldorf | Waschaktive Zusammensetzung |
| JP2015091992A (ja) * | 2015-01-27 | 2015-05-14 | 三浦工業株式会社 | 殺菌性洗浄剤 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2568110A (en) * | 1951-09-18 | Method of making glassy phosphate | ||
| US2594431A (en) * | 1950-04-01 | 1952-04-29 | Monsanto Chemicals | Detergent compositions |
| NL211065A (de) * | 1955-10-03 | |||
| DE1080722B (de) * | 1957-07-18 | 1960-04-28 | Kurt Lindner Dr | Lagerbestaendiges, selbsttaetiges Waschmittelkonzentrat |
| US3015540A (en) * | 1960-11-23 | 1962-01-02 | Tennessce Valley Authority | Manufacture of superphosphoric acid |
| BE621716A (de) * | 1961-08-25 | |||
| NL302725A (de) | 1963-01-14 | |||
| US3361523A (en) * | 1963-03-19 | 1968-01-02 | Monsanto Co | Method for producing phosphates |
| US3403974A (en) * | 1964-03-25 | 1968-10-01 | Armour Agricult Chem | Method and apparatus for concentrating phosphoric acids containing impurities |
| US3507614A (en) * | 1966-03-14 | 1970-04-21 | Tennessee Valley Authority | Process for production of phosphoric acid |
| CA941705A (en) * | 1971-04-21 | 1974-02-12 | Walter J. Evett | Sequestrant composition and method of use |
| US4115307A (en) * | 1974-12-13 | 1978-09-19 | Erco Industries Limited | Phosphate composition |
| US4116852A (en) * | 1975-02-14 | 1978-09-26 | The Procter & Gamble Company | Builders and built detergent compositions |
| US4101455A (en) * | 1975-06-16 | 1978-07-18 | The Procter & Gamble Company | Low phosphate content glassy phosphate detergent compositions having optimum detergency |
| DE2751354A1 (de) * | 1977-11-17 | 1979-05-23 | Hoechst Ag | Verfahren zur herstellung von gemischen aus kristallinem zeolith und natriumtriphosphat |
-
1978
- 1978-05-11 DE DE19782820554 patent/DE2820554A1/de not_active Withdrawn
-
1979
- 1979-04-24 CA CA326,229A patent/CA1113826A/en not_active Expired
- 1979-05-01 NL NL7903403A patent/NL7903403A/xx not_active Application Discontinuation
- 1979-05-01 GB GB7915068A patent/GB2023164B/en not_active Expired
- 1979-05-07 US US06/036,403 patent/US4308158A/en not_active Expired - Lifetime
- 1979-05-08 CH CH432679A patent/CH641834A5/de not_active IP Right Cessation
- 1979-05-09 FI FI791480A patent/FI66901C/fi not_active IP Right Cessation
- 1979-05-09 BE BE0/195076A patent/BE876146A/xx not_active IP Right Cessation
- 1979-05-09 LU LU81239A patent/LU81239A1/de unknown
- 1979-05-09 IT IT7948983A patent/IT7948983A0/it unknown
- 1979-05-09 AT AT0345379A patent/AT375389B/de not_active IP Right Cessation
- 1979-05-10 SE SE7904128A patent/SE7904128L/ not_active Application Discontinuation
- 1979-05-10 DK DK195479A patent/DK195479A/da not_active Application Discontinuation
- 1979-05-10 JP JP5637879A patent/JPS54148803A/ja active Pending
- 1979-05-10 NO NO791567A patent/NO791567L/no unknown
- 1979-05-10 ES ES480443A patent/ES8101115A1/es not_active Expired
- 1979-05-11 FR FR7912103A patent/FR2425473A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4308158A (en) | 1981-12-29 |
| DE2820554A1 (de) | 1979-11-22 |
| SE7904128L (sv) | 1979-11-12 |
| CA1113826A (en) | 1981-12-08 |
| FR2425473B1 (de) | 1983-09-02 |
| ES480443A0 (es) | 1980-12-16 |
| IT7948983A0 (it) | 1979-05-09 |
| LU81239A1 (de) | 1979-12-07 |
| NO791567L (no) | 1979-11-13 |
| DK195479A (da) | 1979-11-12 |
| BE876146A (fr) | 1979-11-09 |
| JPS54148803A (en) | 1979-11-21 |
| FR2425473A1 (fr) | 1979-12-07 |
| NL7903403A (nl) | 1979-11-13 |
| CH641834A5 (de) | 1984-03-15 |
| ATA345379A (de) | 1983-12-15 |
| GB2023164B (en) | 1982-10-13 |
| ES8101115A1 (es) | 1981-03-01 |
| FI791480A7 (fi) | 1979-11-12 |
| GB2023164A (en) | 1979-12-28 |
| AT375389B (de) | 1984-07-25 |
| FI66901B (fi) | 1984-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4605509A (en) | Detergent compositions containing sodium aluminosilicate builders | |
| EP0581857B1 (de) | KöRNIGE WASCHMITTELZUSAMMENSETZUNGEN MIT VERBESSERTER LöSLICHKEIT | |
| US4274975A (en) | Detergent composition | |
| FI58652C (fi) | Foerfarande foer tvaettning eller blekning av textilier samt medel foer genomfoerande av foerfarandet | |
| JPS6052194B2 (ja) | 洗剤組成物 | |
| EP0456315A2 (de) | Niedrig-pH-Waschmittelgranulate enthaltend Aluminiumsilikat, Zitronensäure und Carbonatbuilder | |
| JPH0377238B2 (de) | ||
| US4283299A (en) | Production of detergent compositions | |
| FI66901C (fi) | Tvaett- och rengoeringsmedel innehaollande smaeltfosfat | |
| DE2412839B2 (de) | Verfahren zum Waschen von Textilien, sowie Mittel zur Durchführung des Verfahrens | |
| US4028262A (en) | Citrate-carbonate built detergent | |
| US3798168A (en) | Detergent composition | |
| US4576727A (en) | Phosphate-free detergent composition for washing of textiles in hard water | |
| US4116852A (en) | Builders and built detergent compositions | |
| US4839075A (en) | Fabric-softening detergent | |
| DE2544242A1 (de) | Verfahren zum waschen von textilien, sowie mittel zur durchfuehrung des verfahrens | |
| US4588515A (en) | Granular automatic dishwasher detergent compositions containing smectite clay | |
| US2376096A (en) | Detergent composition | |
| FI62556B (fi) | Builderaemnehaltiga tvaett- och rengoeringsmedel | |
| EP0028143B1 (de) | Verfahren zum Waschen von Textilmaterialien und Waschmittelzusammensetzung dafür | |
| JPS62273300A (ja) | 洗浄剤組成物 | |
| CA1089737A (en) | Builders and built detergent compositions | |
| US4257906A (en) | Method of protecting nitrilotriacetate salts | |
| CA1076914A (en) | Process for washing textiles | |
| JPH0198700A (ja) | 洗剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: HOECHST AKTIENGESELLSCHAFT |