FI63219C - Foerfarande foer framstaellning av 4-klor-2-butynyl-n-(3-klorfenyl)-karbamat - Google Patents
Foerfarande foer framstaellning av 4-klor-2-butynyl-n-(3-klorfenyl)-karbamat Download PDFInfo
- Publication number
- FI63219C FI63219C FI763383A FI763383A FI63219C FI 63219 C FI63219 C FI 63219C FI 763383 A FI763383 A FI 763383A FI 763383 A FI763383 A FI 763383A FI 63219 C FI63219 C FI 63219C
- Authority
- FI
- Finland
- Prior art keywords
- carbamate
- butynyl
- chlorophenyl
- hydroxy
- weight
- Prior art date
Links
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 title description 20
- 238000000034 method Methods 0.000 title description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 32
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 14
- ACYQQFWLJXHFND-UHFFFAOYSA-N 4-hydroxybut-2-ynyl n-(3-chlorophenyl)carbamate Chemical compound OCC#CCOC(=O)NC1=CC=CC(Cl)=C1 ACYQQFWLJXHFND-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000000047 product Substances 0.000 description 10
- 238000005660 chlorination reaction Methods 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000012320 chlorinating reagent Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 5
- VSKFADHADUWCCL-UHFFFAOYSA-N carbamoperoxoic acid Chemical compound NC(=O)OO VSKFADHADUWCCL-UHFFFAOYSA-N 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- -1 acetylene alcohol Chemical compound 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- RPUJAOFSZSEVPC-UHFFFAOYSA-N 4-chlorobut-2-yn-1-ol Chemical compound OCC#CCCl RPUJAOFSZSEVPC-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- DLDJFQGPPSQZKI-UHFFFAOYSA-N but-2-yne-1,4-diol Chemical compound OCC#CCO DLDJFQGPPSQZKI-UHFFFAOYSA-N 0.000 description 1
- HDHXNQZPJLXWJK-UHFFFAOYSA-N carbonyl dichloride;n,n-dimethylformamide Chemical compound ClC(Cl)=O.CN(C)C=O HDHXNQZPJLXWJK-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- AWLUSOLTCFEHNE-UHFFFAOYSA-N sodium;urea Chemical compound [Na].NC(N)=O AWLUSOLTCFEHNE-UHFFFAOYSA-N 0.000 description 1
- WCLDITPGPXSPGV-UHFFFAOYSA-N tricamba Chemical compound COC1=C(Cl)C=C(Cl)C(Cl)=C1C(O)=O WCLDITPGPXSPGV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/12—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C269/00—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C269/06—Preparation of derivatives of carbamic acid, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups by reactions not involving the formation of carbamate groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/28—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/634,575 US4012433A (en) | 1975-11-24 | 1975-11-24 | Process for manufacturing 4-chloro-2-butynyl m-chlorocarbanilate |
| US63457575 | 1975-11-24 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI763383A7 FI763383A7 (oth) | 1977-05-25 |
| FI63219B FI63219B (fi) | 1983-01-31 |
| FI63219C true FI63219C (fi) | 1983-05-10 |
Family
ID=24544360
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI763383A FI63219C (fi) | 1975-11-24 | 1976-11-24 | Foerfarande foer framstaellning av 4-klor-2-butynyl-n-(3-klorfenyl)-karbamat |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4012433A (oth) |
| JP (1) | JPS5817458B2 (oth) |
| AT (1) | AT346358B (oth) |
| AU (1) | AU499597B2 (oth) |
| BE (1) | BE848698A (oth) |
| CA (1) | CA1074809A (oth) |
| CH (1) | CH616405A5 (oth) |
| DE (1) | DE2653150C2 (oth) |
| DK (1) | DK526676A (oth) |
| FI (1) | FI63219C (oth) |
| FR (1) | FR2332262A1 (oth) |
| GB (1) | GB1499311A (oth) |
| GR (1) | GR61819B (oth) |
| IE (1) | IE44314B1 (oth) |
| IN (1) | IN143578B (oth) |
| MX (1) | MX4020E (oth) |
| NL (1) | NL7613112A (oth) |
| PT (1) | PT65878B (oth) |
| SE (1) | SE433611B (oth) |
| TR (1) | TR19454A (oth) |
| ZA (1) | ZA766998B (oth) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02118051U (oth) * | 1989-03-07 | 1990-09-21 | ||
| US7346643B1 (en) * | 1999-07-30 | 2008-03-18 | Mips Technologies, Inc. | Processor with improved accuracy for multiply-add operations |
| WO2016202894A1 (en) | 2015-06-17 | 2016-12-22 | Universitaet Des Saarlandes | Method of converting alcohol to halide |
| CN110655446A (zh) * | 2019-10-22 | 2020-01-07 | 邹平铭兴化工有限公司 | 氯代异丁烷的化学合成方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE113716C (oth) * | ||||
| ZA591098B (oth) * | 1958-03-24 | |||
| DE1133716B (de) * | 1960-11-26 | 1962-07-26 | Basf Ag | Verfahren zur Herstellung von aliphatischen Di- und Polychlor-verbindungen |
| DE1135893B (de) * | 1961-05-19 | 1962-09-06 | Basf Ag | Verfahren zur Herstellung von Chlorkohlenwasserstoffen der Acetylenreihe |
-
1975
- 1975-11-24 US US05/634,575 patent/US4012433A/en not_active Expired - Lifetime
-
1976
- 1976-11-23 DE DE2653150A patent/DE2653150C2/de not_active Expired
- 1976-11-23 ZA ZA766998A patent/ZA766998B/xx unknown
- 1976-11-23 CA CA266,358A patent/CA1074809A/en not_active Expired
- 1976-11-23 DK DK526676A patent/DK526676A/da not_active Application Discontinuation
- 1976-11-24 IE IE2585/76A patent/IE44314B1/en unknown
- 1976-11-24 NL NL7613112A patent/NL7613112A/xx not_active Application Discontinuation
- 1976-11-24 PT PT65878A patent/PT65878B/pt unknown
- 1976-11-24 FI FI763383A patent/FI63219C/fi not_active IP Right Cessation
- 1976-11-24 IN IN2106/CAL/76A patent/IN143578B/en unknown
- 1976-11-24 MX MX765151U patent/MX4020E/es unknown
- 1976-11-24 FR FR7635337A patent/FR2332262A1/fr active Granted
- 1976-11-24 AT AT871876A patent/AT346358B/de not_active IP Right Cessation
- 1976-11-24 BE BE172655A patent/BE848698A/xx not_active IP Right Cessation
- 1976-11-24 GR GR52253A patent/GR61819B/el unknown
- 1976-11-24 AU AU19982/76A patent/AU499597B2/en not_active Expired
- 1976-11-24 JP JP51140273A patent/JPS5817458B2/ja not_active Expired
- 1976-11-24 GB GB49044/76A patent/GB1499311A/en not_active Expired
- 1976-11-24 TR TR19454A patent/TR19454A/xx unknown
- 1976-11-24 SE SE7613122A patent/SE433611B/xx unknown
- 1976-11-24 CH CH1479876A patent/CH616405A5/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1499311A (en) | 1978-02-01 |
| ATA871876A (de) | 1978-03-15 |
| US4012433A (en) | 1977-03-15 |
| IN143578B (oth) | 1977-12-31 |
| DE2653150C2 (de) | 1985-02-07 |
| JPS5278850A (en) | 1977-07-02 |
| IE44314B1 (en) | 1981-10-21 |
| PT65878A (en) | 1976-12-01 |
| SE7613122L (sv) | 1977-05-25 |
| AU1998276A (en) | 1978-06-01 |
| FR2332262B1 (oth) | 1980-11-21 |
| AU499597B2 (en) | 1979-04-26 |
| MX4020E (es) | 1981-11-03 |
| GR61819B (en) | 1979-01-22 |
| FI63219B (fi) | 1983-01-31 |
| AT346358B (de) | 1978-11-10 |
| DK526676A (da) | 1977-05-25 |
| DE2653150A1 (de) | 1977-06-02 |
| IE44314L (en) | 1977-05-24 |
| JPS5817458B2 (ja) | 1983-04-07 |
| TR19454A (tr) | 1979-02-27 |
| NL7613112A (nl) | 1977-05-26 |
| ZA766998B (en) | 1977-10-26 |
| BE848698A (fr) | 1977-05-24 |
| PT65878B (en) | 1978-05-18 |
| FR2332262A1 (fr) | 1977-06-17 |
| CH616405A5 (oth) | 1980-03-31 |
| FI763383A7 (oth) | 1977-05-25 |
| SE433611B (sv) | 1984-06-04 |
| CA1074809A (en) | 1980-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Isobe et al. | 2-Chloro-1, 3-dimethylimidazolinium chloride. 1. A powerful dehydrating equivalent to DCC | |
| Nair et al. | Novel, stable congeners of the antiretroviral compound 2', 3'-dideoxyadenosine | |
| Len et al. | Synthesis of carbamic esters derivatives of itols: antifungal activity against various crop diseases | |
| NL8202626A (nl) | Derivaten van 9-(2-hydroxyethoxymethyl)guanine. | |
| Dangroo et al. | An efficient synthesis of phosphoramidates from halides in aqueous ethanol | |
| EP0165422B1 (de) | Neue substituierte Bis(4-aminophenyl)sulfone, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| FI63219C (fi) | Foerfarande foer framstaellning av 4-klor-2-butynyl-n-(3-klorfenyl)-karbamat | |
| DE69126446T2 (de) | Verfahren zur Herstellung von E-Isomeren von Methoxyiminoacetamidverbindungen | |
| US4041075A (en) | Phenoxy-alkanolamine derivatives | |
| EP0256400B1 (de) | Pyrimidinderivate, ihre Herstellung und Medikamente die diese Derivate enthalten | |
| EP0268820A2 (en) | Process for producing 2-acylfuran derivatives | |
| JPH0450315B2 (oth) | ||
| US2981739A (en) | Certain alpha-haloaldehyde addition products of ethylenethioureas and process | |
| US5481008A (en) | Process for the preparation of optically active compounds | |
| Dods et al. | Reaction of arsenic trihalides with nucleosides. Halomethylene (dimethyl) ammonium halide. New halogenating agent for nucleosides | |
| Catasús et al. | Sulphur ylide-mediated stereoselective synthesis of a stable ferrocenyl epoxide | |
| Podestá et al. | Organotin hydride additions to E-And Z-trisubstituted ethylenes synthesis of some new functionally substituted organotin compounds | |
| JPH0692945A (ja) | 環状ウレタン化合物の製造法 | |
| DE69623117T2 (de) | Verfahren zur herstellung von 4-hydroxy-2-pyrrolidon | |
| JPS6360977A (ja) | オキサゾリンカルボン酸誘導体及びその製造法 | |
| CN109608295A (zh) | 一种三组分合成的异硫氰酸酯及其制备方法 | |
| Jindal et al. | Synthesis and β1-, β2-Adrenergic Receptor Binding Studies of 4-Acylaminosubstituted Phenoxypropanolamine and 5-Acylamino-substituted Naphthyloxypropanolamine Derivatives | |
| US3852287A (en) | Preparation of thionamides | |
| CH615670A5 (oth) | ||
| KR102881983B1 (ko) | 초원자가 아이오딘(ⅲ)을 사용한 시클로프로필 에스터 활성화를 통해 아실 플루오라이드 중간체의 제조 방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: VELSICOL CHEMICAL CORPORATION |