FI62533C - Foerfarande foer framstaellning av allergiska reaktioner foerhindrade 2-fenyl-5-(5-1h-tetrazolyl)pyrimidin-4-(3h)-onderivat - Google Patents
Foerfarande foer framstaellning av allergiska reaktioner foerhindrade 2-fenyl-5-(5-1h-tetrazolyl)pyrimidin-4-(3h)-onderivat Download PDFInfo
- Publication number
- FI62533C FI62533C FI770427A FI770427A FI62533C FI 62533 C FI62533 C FI 62533C FI 770427 A FI770427 A FI 770427A FI 770427 A FI770427 A FI 770427A FI 62533 C FI62533 C FI 62533C
- Authority
- FI
- Finland
- Prior art keywords
- mixture
- dihydro
- oxo
- solution
- pyrimidine
- Prior art date
Links
- -1 5-1H-TETRAZOLYL Chemical class 0.000 title claims description 85
- 206010020751 Hypersensitivity Diseases 0.000 title claims description 8
- 208000030961 allergic reaction Diseases 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims description 111
- 238000002360 preparation method Methods 0.000 claims description 105
- 238000000034 method Methods 0.000 claims description 50
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 24
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 235000019270 ammonium chloride Nutrition 0.000 claims description 8
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical class O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- KTMGNAIGXYODKQ-UHFFFAOYSA-N ethyl 2-cyano-3-ethoxyprop-2-enoate Chemical compound CCOC=C(C#N)C(=O)OCC KTMGNAIGXYODKQ-UHFFFAOYSA-N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 6
- 125000005336 allyloxy group Chemical group 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 150000003937 benzamidines Chemical class 0.000 claims description 4
- 159000000000 sodium salts Chemical class 0.000 claims description 4
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical class NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 150000002169 ethanolamines Chemical class 0.000 claims 1
- 210000003608 fece Anatomy 0.000 claims 1
- 239000010871 livestock manure Substances 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 184
- 239000000203 mixture Substances 0.000 description 129
- 239000000243 solution Substances 0.000 description 125
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 93
- 238000004458 analytical method Methods 0.000 description 70
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 64
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 56
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 50
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 45
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 31
- 239000005457 ice water Substances 0.000 description 31
- 238000010992 reflux Methods 0.000 description 31
- 239000007787 solid Substances 0.000 description 31
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 229960000583 acetic acid Drugs 0.000 description 23
- 239000000047 product Substances 0.000 description 23
- 238000003756 stirring Methods 0.000 description 19
- 239000000725 suspension Substances 0.000 description 18
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 17
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 17
- 239000002904 solvent Substances 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000011734 sodium Substances 0.000 description 15
- 108010058846 Ovalbumin Proteins 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 13
- 239000000427 antigen Substances 0.000 description 13
- 102000036639 antigens Human genes 0.000 description 13
- 108091007433 antigens Proteins 0.000 description 13
- 239000012362 glacial acetic acid Substances 0.000 description 13
- 229910052708 sodium Inorganic materials 0.000 description 13
- 238000001953 recrystallisation Methods 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 11
- 241000700159 Rattus Species 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 11
- 238000010790 dilution Methods 0.000 description 11
- 239000012895 dilution Substances 0.000 description 11
- 229910021529 ammonia Inorganic materials 0.000 description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- 239000003814 drug Substances 0.000 description 9
- 239000011780 sodium chloride Substances 0.000 description 9
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- SBNKFTQSBPKMBZ-UHFFFAOYSA-N ethenzamide Chemical compound CCOC1=CC=CC=C1C(N)=O SBNKFTQSBPKMBZ-UHFFFAOYSA-N 0.000 description 8
- 239000007924 injection Substances 0.000 description 8
- 238000002347 injection Methods 0.000 description 8
- 210000002966 serum Anatomy 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 7
- 208000006673 asthma Diseases 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- LZCZIHQBSCVGRD-UHFFFAOYSA-N benzenecarboximidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])C1=CC=CC=C1 LZCZIHQBSCVGRD-UHFFFAOYSA-N 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 239000002002 slurry Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 239000012258 stirred mixture Substances 0.000 description 7
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000000499 gel Substances 0.000 description 6
- MBXNQZHITVCSLJ-UHFFFAOYSA-N methyl fluorosulfonate Chemical compound COS(F)(=O)=O MBXNQZHITVCSLJ-UHFFFAOYSA-N 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- HNTRYPFDBNXKOS-UHFFFAOYSA-N 2-(2-methylpropoxy)benzenecarboximidamide Chemical compound CC(C)COC1=CC=CC=C1C(N)=N HNTRYPFDBNXKOS-UHFFFAOYSA-N 0.000 description 5
- OIEYSUXLJYFFPI-UHFFFAOYSA-N 2-ethoxybenzenecarboximidamide;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.CCOC1=CC=CC=C1C(N)=N OIEYSUXLJYFFPI-UHFFFAOYSA-N 0.000 description 5
- XZHKVYYQQVEUBZ-UHFFFAOYSA-N [amino-(2-propoxyphenyl)methylidene]azanium;chloride Chemical compound Cl.CCCOC1=CC=CC=C1C(N)=N XZHKVYYQQVEUBZ-UHFFFAOYSA-N 0.000 description 5
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 5
- NHBDYNVEEOSTIH-UHFFFAOYSA-N chembl14922 Chemical compound CCCOC1=CC=CC=C1C(NC1=O)=NC=C1C1=NN=NN1 NHBDYNVEEOSTIH-UHFFFAOYSA-N 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- NTOYIGNATVNWOU-UHFFFAOYSA-N ethyl 2-(2-ethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OCC NTOYIGNATVNWOU-UHFFFAOYSA-N 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- NWELOPILLFFSFZ-UHFFFAOYSA-N 2-(cyclopropylmethoxy)benzenecarboximidamide;hydrochloride Chemical compound Cl.NC(=N)C1=CC=CC=C1OCC1CC1 NWELOPILLFFSFZ-UHFFFAOYSA-N 0.000 description 4
- FAVIQMSTEFBUJX-UHFFFAOYSA-N 2-propoxybenzamide Chemical compound CCCOC1=CC=CC=C1C(N)=O FAVIQMSTEFBUJX-UHFFFAOYSA-N 0.000 description 4
- JQCXHLMDSPVRLE-UHFFFAOYSA-N 5-methoxy-2-propoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCOC1=CC=C(OC)C=C1C(N)=N JQCXHLMDSPVRLE-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- KHLKWMAHIJEMOS-UHFFFAOYSA-N ethyl 2-[2-(2-methylpropoxy)phenyl]-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OCC(C)C KHLKWMAHIJEMOS-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 230000003053 immunization Effects 0.000 description 4
- 238000002649 immunization Methods 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- PCIWGHJCGMRZDJ-UHFFFAOYSA-N methyl hydrogen sulfate;2-propoxybenzenecarboximidamide Chemical compound COS(O)(=O)=O.CCCOC1=CC=CC=C1C(N)=N PCIWGHJCGMRZDJ-UHFFFAOYSA-N 0.000 description 4
- 229940066827 pertussis vaccine Drugs 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- QDXGKRWDQCEABB-UHFFFAOYSA-N pyrimidine-5-carboxamide Chemical compound NC(=O)C1=CN=CN=C1 QDXGKRWDQCEABB-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000012216 screening Methods 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- NGMHLSBQVIXGNZ-UHFFFAOYSA-N (2-ethoxybenzenecarboximidoyl)azanium;chloride Chemical compound Cl.CCOC1=CC=CC=C1C(N)=N NGMHLSBQVIXGNZ-UHFFFAOYSA-N 0.000 description 3
- YGSJZZHYXOPQFQ-UHFFFAOYSA-N 2-(cyclopropylmethoxy)benzamide Chemical compound NC(=O)C1=CC=CC=C1OCC1CC1 YGSJZZHYXOPQFQ-UHFFFAOYSA-N 0.000 description 3
- VPTQXJGFCHOGAN-UHFFFAOYSA-N 2-butoxybenzamide Chemical compound CCCCOC1=CC=CC=C1C(N)=O VPTQXJGFCHOGAN-UHFFFAOYSA-N 0.000 description 3
- YNJQOVDUKUWUQT-UHFFFAOYSA-N 2-butoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCOC1=CC=CC=C1C(N)=N YNJQOVDUKUWUQT-UHFFFAOYSA-N 0.000 description 3
- OEXRGFMNBITBTE-UHFFFAOYSA-N 2-ethoxybenzenecarboximidamide;methyl hydrogen sulfate Chemical compound COS(O)(=O)=O.CCOC1=CC=CC=C1C(N)=N OEXRGFMNBITBTE-UHFFFAOYSA-N 0.000 description 3
- KNOPIPOLVBCPEN-UHFFFAOYSA-N 2-ethylsulfanylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CCSC1=CC=CC=C1C(N)=N KNOPIPOLVBCPEN-UHFFFAOYSA-N 0.000 description 3
- UXVZNLSQKHVKBJ-UHFFFAOYSA-N 2-propan-2-yloxybenzenecarboximidamide Chemical compound CC(C)OC1=CC=CC=C1C(N)=N UXVZNLSQKHVKBJ-UHFFFAOYSA-N 0.000 description 3
- IOJAQFYHZXUYDH-UHFFFAOYSA-N 2-propan-2-yloxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CC(C)OC1=CC=CC=C1C(N)=N IOJAQFYHZXUYDH-UHFFFAOYSA-N 0.000 description 3
- UPDIZRAYBADYSG-UHFFFAOYSA-N 6-oxo-2-(2-propan-2-yloxyphenyl)-1h-pyrimidine-5-carbonitrile Chemical compound CC(C)OC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 UPDIZRAYBADYSG-UHFFFAOYSA-N 0.000 description 3
- YHGNZQGATDHUHG-UHFFFAOYSA-N 6-oxo-2-phenyl-1h-pyrimidine-5-carboxamide Chemical class N1C(=O)C(C(=O)N)=CN=C1C1=CC=CC=C1 YHGNZQGATDHUHG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- MJBWDEQAUQTVKK-IAGOWNOFSA-N aflatoxin M1 Chemical compound C=1([C@]2(O)C=CO[C@@H]2OC=1C=C(C1=2)OC)C=2OC(=O)C2=C1CCC2=O MJBWDEQAUQTVKK-IAGOWNOFSA-N 0.000 description 3
- 239000000538 analytical sample Substances 0.000 description 3
- VPSOCYILUWQTLX-UHFFFAOYSA-N benzenecarboximidamide;methyl hydrogen sulfate Chemical compound COS(O)(=O)=O.NC(=N)C1=CC=CC=C1 VPSOCYILUWQTLX-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 150000003857 carboxamides Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- IVBFHLYXRBKTMG-UHFFFAOYSA-N ethyl 6-oxo-2-(2-propoxyphenyl)-1h-pyrimidine-5-carboxylate Chemical compound CCCOC1=CC=CC=C1C1=NC=C(C(=O)OCC)C(=O)N1 IVBFHLYXRBKTMG-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- XVIAPHVAGFEFFN-UHFFFAOYSA-N pyrimidine-5-carbonitrile Chemical compound N#CC1=CN=CN=C1 XVIAPHVAGFEFFN-UHFFFAOYSA-N 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 239000003656 tris buffered saline Substances 0.000 description 3
- OVOJUAKDTOOXRF-UHFFFAOYSA-N 2,4-dinitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O OVOJUAKDTOOXRF-UHFFFAOYSA-N 0.000 description 2
- SBZSBHNPMBQOJQ-UHFFFAOYSA-N 2-(2-methoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound COC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 SBZSBHNPMBQOJQ-UHFFFAOYSA-N 0.000 description 2
- NDBMNHFFDSSFHG-UHFFFAOYSA-N 2-butan-2-yloxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCC(C)OC1=CC=CC=C1C(N)=N NDBMNHFFDSSFHG-UHFFFAOYSA-N 0.000 description 2
- JNYOMPUIZRNERF-UHFFFAOYSA-N 2-ethoxy-5-methoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCOC1=CC=C(OC)C=C1C(N)=N JNYOMPUIZRNERF-UHFFFAOYSA-N 0.000 description 2
- BTHLVVULQLRTBK-UHFFFAOYSA-N 2-propan-2-yloxybenzamide Chemical compound CC(C)OC1=CC=CC=C1C(N)=O BTHLVVULQLRTBK-UHFFFAOYSA-N 0.000 description 2
- CLXPJHFVNFNTAR-UHFFFAOYSA-N 2-propoxybenzenecarboximidamide Chemical compound CCCOC1=CC=CC=C1C(N)=N CLXPJHFVNFNTAR-UHFFFAOYSA-N 0.000 description 2
- AEDNEIUPKSLIDZ-UHFFFAOYSA-N 5-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one Chemical class O=C1NC=NC=C1C1=NN=NN1 AEDNEIUPKSLIDZ-UHFFFAOYSA-N 0.000 description 2
- CBGLJVDZNPPGKJ-UHFFFAOYSA-N 5-chloro-2-ethoxybenzamide Chemical compound CCOC1=CC=C(Cl)C=C1C(N)=O CBGLJVDZNPPGKJ-UHFFFAOYSA-N 0.000 description 2
- PKHNMHLTBWZQCA-UHFFFAOYSA-N 5-chloro-2-ethoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCOC1=CC=C(Cl)C=C1C(N)=N PKHNMHLTBWZQCA-UHFFFAOYSA-N 0.000 description 2
- VTEHZGVDOYGWFI-UHFFFAOYSA-N 5-methoxy-2-propoxybenzamide Chemical compound CCCOC1=CC=C(OC)C=C1C(N)=O VTEHZGVDOYGWFI-UHFFFAOYSA-N 0.000 description 2
- DVOXGRRTZRKEFQ-UHFFFAOYSA-N 6-oxo-2-(2-propoxyphenyl)-1h-pyrimidine-5-carbonitrile Chemical compound CCCOC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 DVOXGRRTZRKEFQ-UHFFFAOYSA-N 0.000 description 2
- HADBIMYTRIMUAO-UHFFFAOYSA-N 6-oxo-2-phenyl-1h-pyrimidine-5-carboxylic acid Chemical class N1C(=O)C(C(=O)O)=CN=C1C1=CC=CC=C1 HADBIMYTRIMUAO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- 206010002198 Anaphylactic reaction Diseases 0.000 description 2
- 241000588832 Bordetella pertussis Species 0.000 description 2
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 206010039085 Rhinitis allergic Diseases 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 201000009961 allergic asthma Diseases 0.000 description 2
- 201000010105 allergic rhinitis Diseases 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 230000036783 anaphylactic response Effects 0.000 description 2
- 208000003455 anaphylaxis Diseases 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- 230000003266 anti-allergic effect Effects 0.000 description 2
- 239000000043 antiallergic agent Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- AVXQMQQYGHZGQA-UHFFFAOYSA-N benzenecarboximidamide;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.NC(=N)C1=CC=CC=C1 AVXQMQQYGHZGQA-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- BXQHTVRZNJXKFX-UHFFFAOYSA-N chembl276927 Chemical compound CC(C)OC1=CC=CC=C1C(NC1=O)=NC=C1C1=NN=NN1 BXQHTVRZNJXKFX-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000000502 dialysis Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- MFTDNOFYYUJVQN-UHFFFAOYSA-N ethyl 2-(2,4-dimethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=C(OC)C=C1OC MFTDNOFYYUJVQN-UHFFFAOYSA-N 0.000 description 2
- QCQYODARJSKOCU-UHFFFAOYSA-N ethyl 2-(2-butoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound CCCCOC1=CC=CC=C1C1=NC=C(C(=O)OCC)C(=O)N1 QCQYODARJSKOCU-UHFFFAOYSA-N 0.000 description 2
- HHCBTMADUMSFOZ-UHFFFAOYSA-N ethyl 2-(2-ethoxy-5-nitrophenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC([N+]([O-])=O)=CC=C1OCC HHCBTMADUMSFOZ-UHFFFAOYSA-N 0.000 description 2
- BCXUQKLCLIQWQM-UHFFFAOYSA-N ethyl 2-(2-nitrophenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1[N+]([O-])=O BCXUQKLCLIQWQM-UHFFFAOYSA-N 0.000 description 2
- MJJUQSNYKBJGIC-UHFFFAOYSA-N ethyl 2-(5-methoxy-2-propoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound CCCOC1=CC=C(OC)C=C1C1=NC=C(C(=O)OCC)C(=O)N1 MJJUQSNYKBJGIC-UHFFFAOYSA-N 0.000 description 2
- IZSAXSKPGGVDKQ-UHFFFAOYSA-N ethyl 6-oxo-2-(2-prop-2-enoxyphenyl)-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OCC=C IZSAXSKPGGVDKQ-UHFFFAOYSA-N 0.000 description 2
- JSIHCFJCICVJHJ-UHFFFAOYSA-N ethyl 6-oxo-2-phenyl-1h-pyrimidine-5-carboxylate Chemical class N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1 JSIHCFJCICVJHJ-UHFFFAOYSA-N 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 229960003699 evans blue Drugs 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000002163 immunogen Effects 0.000 description 2
- 239000007927 intramuscular injection Substances 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Chemical class 0.000 description 2
- 239000002184 metal Chemical class 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- WYTKHSAZZPUCPK-UHFFFAOYSA-N methyl 3-carbamimidoyl-4-ethoxybenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C=C1C(N)=N WYTKHSAZZPUCPK-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002858 neurotransmitter agent Substances 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 239000008024 pharmaceutical diluent Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000010356 sorbitol Nutrition 0.000 description 2
- 238000013223 sprague-dawley female rat Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 1
- 229930182837 (R)-adrenaline Natural products 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- OHDVRMGJIHLLMB-UHFFFAOYSA-N 2,4-dimethoxybenzenecarboximidamide Chemical compound COC1=CC=C(C(N)=N)C(OC)=C1 OHDVRMGJIHLLMB-UHFFFAOYSA-N 0.000 description 1
- KLYZILOJVQMYSK-UHFFFAOYSA-N 2,5-dimethoxybenzamide Chemical compound COC1=CC=C(OC)C(C(N)=O)=C1 KLYZILOJVQMYSK-UHFFFAOYSA-N 0.000 description 1
- MLVYVEAUXWOKLK-UHFFFAOYSA-N 2,5-dimethoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.COC1=CC=C(OC)C(C(N)=N)=C1 MLVYVEAUXWOKLK-UHFFFAOYSA-N 0.000 description 1
- ICFDGFXITVNHRK-UHFFFAOYSA-N 2-(2,4-dimethoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound COC1=CC(OC)=CC=C1C1=NC=C(C#N)C(=O)N1 ICFDGFXITVNHRK-UHFFFAOYSA-N 0.000 description 1
- UACKEROANJJXAG-UHFFFAOYSA-N 2-(2-butan-2-yloxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CCC(C)OC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 UACKEROANJJXAG-UHFFFAOYSA-N 0.000 description 1
- YSMRUTXKPGKANZ-UHFFFAOYSA-N 2-(2-butan-2-yloxyphenyl)-6-oxo-1h-pyrimidine-5-carboxamide Chemical compound CCC(C)OC1=CC=CC=C1C1=NC=C(C(N)=O)C(=O)N1 YSMRUTXKPGKANZ-UHFFFAOYSA-N 0.000 description 1
- NTSMEITWGNDZDR-UHFFFAOYSA-N 2-(2-butoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CCCCOC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 NTSMEITWGNDZDR-UHFFFAOYSA-N 0.000 description 1
- DIOIUBFOJHVCEV-UHFFFAOYSA-N 2-(2-chlorophenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound ClC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 DIOIUBFOJHVCEV-UHFFFAOYSA-N 0.000 description 1
- HYIDHORPUFPCDY-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-1h-pyrimidin-6-one Chemical compound CCOC1=CC=CC=C1C1=NC=CC(=O)N1 HYIDHORPUFPCDY-UHFFFAOYSA-N 0.000 description 1
- ARRHAFFWXFQZSR-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CCOC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 ARRHAFFWXFQZSR-UHFFFAOYSA-N 0.000 description 1
- ARWIMWVZVXLKBU-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxamide Chemical compound CCOC1=CC=CC=C1C1=NC=C(C(N)=O)C(=O)N1 ARWIMWVZVXLKBU-UHFFFAOYSA-N 0.000 description 1
- JDMAVDMBAAYFMV-UHFFFAOYSA-N 2-(2-fluorophenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound FC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 JDMAVDMBAAYFMV-UHFFFAOYSA-N 0.000 description 1
- FVPWCKBAQIZSFS-UHFFFAOYSA-N 2-(2-methylpropoxy)benzamide Chemical compound CC(C)COC1=CC=CC=C1C(N)=O FVPWCKBAQIZSFS-UHFFFAOYSA-N 0.000 description 1
- HCKPJFSKECFIMT-UHFFFAOYSA-N 2-(2-methylpropoxy)benzenecarboximidamide;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.CC(C)COC1=CC=CC=C1C(N)=N HCKPJFSKECFIMT-UHFFFAOYSA-N 0.000 description 1
- QGKKTMWKXYUJPL-UHFFFAOYSA-N 2-(2-methylsulfanylphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CSC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 QGKKTMWKXYUJPL-UHFFFAOYSA-N 0.000 description 1
- GCSGRYMRVIGNHY-UHFFFAOYSA-N 2-(3-methoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound COC1=CC=CC(C=2NC(=O)C(C#N)=CN=2)=C1 GCSGRYMRVIGNHY-UHFFFAOYSA-N 0.000 description 1
- SGHARSMKWKRMJE-UHFFFAOYSA-N 2-(4-methoxyphenyl)-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound C1=CC(OC)=CC=C1C1=NC=C(C#N)C(=O)N1 SGHARSMKWKRMJE-UHFFFAOYSA-N 0.000 description 1
- HWVVPEAEQRWODQ-UHFFFAOYSA-N 2-(5-nitro-2-propoxyphenyl)-5-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one 2-(2-propoxyphenyl)-5-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one Chemical compound C(CC)OC1=C(C=CC=C1)C1=NC=C(C(N1)=O)C1=NN=NN1.[N+](=O)([O-])C=1C=CC(=C(C1)C1=NC=C(C(N1)=O)C1=NN=NN1)OCCC HWVVPEAEQRWODQ-UHFFFAOYSA-N 0.000 description 1
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 1
- AYCLFVLPXDMBEB-UHFFFAOYSA-N 2-[2-(2-methylpropoxy)phenyl]-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound CC(C)COC1=CC=CC=C1C1=NC=C(C#N)C(=O)N1 AYCLFVLPXDMBEB-UHFFFAOYSA-N 0.000 description 1
- WVJYIBLJGJMIHO-UHFFFAOYSA-N 2-[2-(2-methylpropoxy)phenyl]-6-oxo-1h-pyrimidine-5-carboxamide Chemical compound CC(C)COC1=CC=CC=C1C1=NC=C(C(N)=O)C(=O)N1 WVJYIBLJGJMIHO-UHFFFAOYSA-N 0.000 description 1
- AQRHWKVALGBWIN-UHFFFAOYSA-N 2-[2-(2-methylpropoxy)phenyl]pyrimidine-5-carbonitrile Chemical compound C(C(C)C)OC1=C(C=CC=C1)C1=NC=C(C=N1)C#N AQRHWKVALGBWIN-UHFFFAOYSA-N 0.000 description 1
- KGPFOGVEFASGOW-UHFFFAOYSA-N 2-[2-(cyclopropylmethoxy)phenyl]-6-oxo-1h-pyrimidine-5-carbonitrile Chemical compound C1=C(C#N)C(=O)NC(C=2C(=CC=CC=2)OCC2CC2)=N1 KGPFOGVEFASGOW-UHFFFAOYSA-N 0.000 description 1
- YIJHCIJQRPWMKH-UHFFFAOYSA-N 2-[2-(cyclopropylmethoxy)phenyl]-6-oxo-1h-pyrimidine-5-carboxamide Chemical compound N1C(=O)C(C(=O)N)=CN=C1C1=CC=CC=C1OCC1CC1 YIJHCIJQRPWMKH-UHFFFAOYSA-N 0.000 description 1
- JZQLRTAGAUZWRH-UHFFFAOYSA-N 2-aminoethanol;hydrate Chemical compound [OH-].[NH3+]CCO JZQLRTAGAUZWRH-UHFFFAOYSA-N 0.000 description 1
- XWPPEESBKICTHP-UHFFFAOYSA-N 2-butan-2-yloxybenzamide Chemical compound CCC(C)OC1=CC=CC=C1C(N)=O XWPPEESBKICTHP-UHFFFAOYSA-N 0.000 description 1
- SKBBTJRELGBSSI-UHFFFAOYSA-N 2-butan-2-yloxybenzenecarboximidamide Chemical compound CCC(C)OC1=CC=CC=C1C(N)=N SKBBTJRELGBSSI-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- DERAACKMMNJAFU-UHFFFAOYSA-N 2-ethoxy-1,3-dioxane-4,6-dione Chemical compound CCOC1OC(=O)CC(=O)O1 DERAACKMMNJAFU-UHFFFAOYSA-N 0.000 description 1
- BAFPIVSUZRAYKE-UHFFFAOYSA-N 2-ethoxy-5-methoxybenzamide Chemical compound CCOC1=CC=C(OC)C=C1C(N)=O BAFPIVSUZRAYKE-UHFFFAOYSA-N 0.000 description 1
- GOSDGLKRVHPJEV-UHFFFAOYSA-N 2-ethoxybenzenecarboximidamide Chemical compound CCOC1=CC=CC=C1C(N)=N GOSDGLKRVHPJEV-UHFFFAOYSA-N 0.000 description 1
- BFLMZPFXXUVDMO-UHFFFAOYSA-N 2-ethylsulfanylbenzonitrile Chemical compound CCSC1=CC=CC=C1C#N BFLMZPFXXUVDMO-UHFFFAOYSA-N 0.000 description 1
- UYPHFBKQVOALNA-UHFFFAOYSA-N 2-methoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C(N)=N UYPHFBKQVOALNA-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- IFHHVUXPFHPHBQ-UHFFFAOYSA-N 2-methylsulfanylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CSC1=CC=CC=C1C(N)=N IFHHVUXPFHPHBQ-UHFFFAOYSA-N 0.000 description 1
- AUXXZZHQJXFJTC-UHFFFAOYSA-N 2-nitrobenzenecarboximidamide;hydrochloride Chemical compound Cl.NC(=N)C1=CC=CC=C1[N+]([O-])=O AUXXZZHQJXFJTC-UHFFFAOYSA-N 0.000 description 1
- HNUKTDKISXPDPA-UHFFFAOYSA-N 2-oxopropyl Chemical group [CH2]C(C)=O HNUKTDKISXPDPA-UHFFFAOYSA-N 0.000 description 1
- XGKJSRLZDQBDHT-UHFFFAOYSA-N 2-pentoxybenzenecarboximidamide Chemical compound CCCCCOC1=CC=CC=C1C(N)=N XGKJSRLZDQBDHT-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- XZVHBDLWUCTDFI-UHFFFAOYSA-N 6-oxo-2-(2-phenylmethoxyphenyl)-1h-pyrimidine-5-carbonitrile Chemical compound C1=C(C#N)C(=O)NC(C=2C(=CC=CC=2)OCC=2C=CC=CC=2)=N1 XZVHBDLWUCTDFI-UHFFFAOYSA-N 0.000 description 1
- JKHROBFSYBALSG-UHFFFAOYSA-N 6-oxo-2-[3-(trifluoromethyl)phenyl]-1h-pyrimidine-5-carbonitrile Chemical compound FC(F)(F)C1=CC=CC(C=2NC(=O)C(C#N)=CN=2)=C1 JKHROBFSYBALSG-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- PBQSZMVTCJDJQF-UHFFFAOYSA-N C(=O)(OC)C=1C=CC(=C(C(=O)N)C1)OCC.C(=O)(OC)C=1C=CC(=C(C(=O)N)C1)OCC Chemical compound C(=O)(OC)C=1C=CC(=C(C(=O)N)C1)OCC.C(=O)(OC)C=1C=CC(=C(C(=O)N)C1)OCC PBQSZMVTCJDJQF-UHFFFAOYSA-N 0.000 description 1
- WWDLZCWWSIHBME-UHFFFAOYSA-N C(C)(C)C1=C(C=CC=C1)C1=NC=C(C(N1)=O)C1=NN=NN1 Chemical compound C(C)(C)C1=C(C=CC=C1)C1=NC=C(C(N1)=O)C1=NN=NN1 WWDLZCWWSIHBME-UHFFFAOYSA-N 0.000 description 1
- CWXXLSOBNHADQM-UHFFFAOYSA-N C(C)OC1=C(C=CC=C1)C1=NC=C(C=N1)C#N Chemical compound C(C)OC1=C(C=CC=C1)C1=NC=C(C=N1)C#N CWXXLSOBNHADQM-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- QKJURGKJOSUQIY-UHFFFAOYSA-N COC1=CC=C(C(C(=O)N)=C1)O.COC=1C=CC(=C(C(=O)N)C1)OCCC Chemical compound COC1=CC=C(C(C(=O)N)=C1)O.COC=1C=CC(=C(C(=O)N)C1)OCCC QKJURGKJOSUQIY-UHFFFAOYSA-N 0.000 description 1
- 101100495531 Caenorhabditis elegans cgh-1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- XOOXNLXRDZRFII-UHFFFAOYSA-N Cl.COC1=C(C(=N)N)C=CC=C1.COC1=C(C(=O)N)C=CC=C1 Chemical compound Cl.COC1=C(C(=N)N)C=CC=C1.COC1=C(C(=O)N)C=CC=C1 XOOXNLXRDZRFII-UHFFFAOYSA-N 0.000 description 1
- UYCVYTWZVMCQCX-UHFFFAOYSA-N ClC1=CC=C(C(C(=O)N)=C1)O.ClC=1C=CC(=C(C(=O)N)C1)OCC Chemical compound ClC1=CC=C(C(C(=O)N)=C1)O.ClC=1C=CC(=C(C(=O)N)C1)OCC UYCVYTWZVMCQCX-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical class NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- BCALRLQHBIDGME-UHFFFAOYSA-N N1=CN=CC(=C1)C(=O)N.N1=CN=CC=C1 Chemical compound N1=CN=CC(=C1)C(=O)N.N1=CN=CC=C1 BCALRLQHBIDGME-UHFFFAOYSA-N 0.000 description 1
- LVLHAWVOEKXNIJ-UHFFFAOYSA-N O.O.C(CN)N.C(CC)OC1=C(C=CC=C1)C1=NC=C(C(N1)=O)C1=NN=NN1 Chemical compound O.O.C(CN)N.C(CC)OC1=C(C=CC=C1)C1=NC=C(C(N1)=O)C1=NN=NN1 LVLHAWVOEKXNIJ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- VZYODSVPYBMUKY-UHFFFAOYSA-N S(=O)(=O)(OC)O.C(CC)OC1=C(C(O)=N)C=CC=C1 Chemical compound S(=O)(=O)(OC)O.C(CC)OC1=C(C(O)=N)C=CC=C1 VZYODSVPYBMUKY-UHFFFAOYSA-N 0.000 description 1
- OPVHCLGARAKNRQ-UHFFFAOYSA-N S(=O)(=O)(OC)OC.C(C1=CC=CC=C1)(=O)N Chemical compound S(=O)(=O)(OC)OC.C(C1=CC=CC=C1)(=O)N OPVHCLGARAKNRQ-UHFFFAOYSA-N 0.000 description 1
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical compound NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 230000003187 abdominal effect Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- GPEHQHXBPDGGDP-UHFFFAOYSA-N acetonitrile;propan-2-one Chemical compound CC#N.CC(C)=O GPEHQHXBPDGGDP-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229940024546 aluminum hydroxide gel Drugs 0.000 description 1
- SMYKVLBUSSNXMV-UHFFFAOYSA-K aluminum;trihydroxide;hydrate Chemical compound O.[OH-].[OH-].[OH-].[Al+3] SMYKVLBUSSNXMV-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-M benzenecarboximidate Chemical compound [NH-]C(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-M 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- BQJUBIRRKUYMQG-UHFFFAOYSA-N chembl14909 Chemical compound CCCCCOC1=CC=CC=C1C(N=C1O)=NC=C1C1=NNN=N1 BQJUBIRRKUYMQG-UHFFFAOYSA-N 0.000 description 1
- ALXDNQNBMITZNJ-UHFFFAOYSA-N chembl14993 Chemical compound CCCCOC1=CC=CC=C1C(NC1=O)=NC=C1C1=NN=NN1 ALXDNQNBMITZNJ-UHFFFAOYSA-N 0.000 description 1
- FXYFCHIWHHJQLC-UHFFFAOYSA-N chembl15044 Chemical compound CCC(C)OC1=CC=CC=C1C(N=C1O)=NC=C1C1=NNN=N1 FXYFCHIWHHJQLC-UHFFFAOYSA-N 0.000 description 1
- XWPXWCKFSQPZAL-UHFFFAOYSA-N chembl15358 Chemical compound O=C1NC(C=2C(=CC=CC=2)OCC2CC2)=NC=C1C1=NN=NN1 XWPXWCKFSQPZAL-UHFFFAOYSA-N 0.000 description 1
- LZTFTAOBSRLIRY-UHFFFAOYSA-N chembl15494 Chemical compound C=CCOC1=CC=CC=C1C(NC1=O)=NC=C1C1=NN=NN1 LZTFTAOBSRLIRY-UHFFFAOYSA-N 0.000 description 1
- HFQLJWUYNGLOOJ-UHFFFAOYSA-N chembl15586 Chemical compound CCOC1=CC=CC=C1C(NC1=O)=NC=C1C1=NN=NN1 HFQLJWUYNGLOOJ-UHFFFAOYSA-N 0.000 description 1
- ZXWFWNPZBJUFHU-UHFFFAOYSA-N chembl277963 Chemical compound CCCOC1=CC=C(N)C=C1C(NC1=O)=NC=C1C1=NN=NN1 ZXWFWNPZBJUFHU-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 229960000265 cromoglicic acid Drugs 0.000 description 1
- IMZMKUWMOSJXDT-UHFFFAOYSA-N cromoglycic acid Chemical compound O1C(C(O)=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C(O)=O)O2 IMZMKUWMOSJXDT-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 201000006549 dyspepsia Diseases 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229960005139 epinephrine Drugs 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- MUSLILXDERNVDN-UHFFFAOYSA-N ethyl 2-(2-aminophenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1N MUSLILXDERNVDN-UHFFFAOYSA-N 0.000 description 1
- DIPAIWICPIVAIU-UHFFFAOYSA-N ethyl 2-(2-methylpropoxy)benzenecarboximidate Chemical compound CCOC(=N)C1=CC=CC=C1OCC(C)C DIPAIWICPIVAIU-UHFFFAOYSA-N 0.000 description 1
- IKKKBBJLLAAYDF-UHFFFAOYSA-N ethyl 2-(5-amino-2-ethoxyphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC(N)=CC=C1OCC IKKKBBJLLAAYDF-UHFFFAOYSA-N 0.000 description 1
- NXRODQNBHNHXBY-UHFFFAOYSA-N ethyl 2-[2-(cyclopropylmethoxy)phenyl]-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OCC1CC1 NXRODQNBHNHXBY-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- IPRYNYNRDPUWCT-UHFFFAOYSA-N ethyl 2-ethoxybenzenecarboximidate Chemical compound CCOC(=N)C1=CC=CC=C1OCC IPRYNYNRDPUWCT-UHFFFAOYSA-N 0.000 description 1
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 1
- HJJTUMWNCSKZNW-UHFFFAOYSA-N ethyl 6-oxo-2-(2-propan-2-yloxyphenyl)-1h-pyrimidine-5-carboxylate Chemical compound N1C(=O)C(C(=O)OCC)=CN=C1C1=CC=CC=C1OC(C)C HJJTUMWNCSKZNW-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- VQGDVXIMWWGBNY-UHFFFAOYSA-N methyl 2-carbamimidoylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C(N)=N VQGDVXIMWWGBNY-UHFFFAOYSA-N 0.000 description 1
- NZCNQOPLKTYKQB-UHFFFAOYSA-N methyl 2-ethoxy-5-methoxybenzenecarboximidate;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.CCOC1=CC=C(OC)C=C1C(=N)OC NZCNQOPLKTYKQB-UHFFFAOYSA-N 0.000 description 1
- YXOZOCRLGICTPN-UHFFFAOYSA-N methyl 2-ethoxybenzenecarboximidate;methyl hydrogen sulfate Chemical compound COS(O)(=O)=O.CCOC1=CC=CC=C1C(=N)OC YXOZOCRLGICTPN-UHFFFAOYSA-N 0.000 description 1
- KBVGDNOKQIRHSD-UHFFFAOYSA-N methyl 3-carbamimidoyl-4-ethoxybenzoate Chemical compound C(=O)(OC)C=1C=CC(=C(C(=N)N)C1)OCC.C(=O)(OC)C=1C=CC(=C(C(=N)N)C1)OCC KBVGDNOKQIRHSD-UHFFFAOYSA-N 0.000 description 1
- NSNDIPJPWIDPBY-UHFFFAOYSA-N methyl 3-carbamoyl-4-ethoxybenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C=C1C(N)=O NSNDIPJPWIDPBY-UHFFFAOYSA-N 0.000 description 1
- OHSWRVNWUHUSSN-UHFFFAOYSA-N methyl 3-carbamoyl-4-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(O)C(C(N)=O)=C1 OHSWRVNWUHUSSN-UHFFFAOYSA-N 0.000 description 1
- BLHOGOSXQVNCCS-UHFFFAOYSA-N methyl 5-methoxy-2-propoxybenzenecarboximidate;sulfurofluoridic acid Chemical compound OS(F)(=O)=O.CCCOC1=CC=C(OC)C=C1C(=N)OC BLHOGOSXQVNCCS-UHFFFAOYSA-N 0.000 description 1
- FGFLVXMKWVVLRQ-UHFFFAOYSA-N methyl hydrogen sulfate;methyl 2-propoxybenzenecarboximidate Chemical compound COS(O)(=O)=O.CCCOC1=CC=CC=C1C(=N)OC FGFLVXMKWVVLRQ-UHFFFAOYSA-N 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 235000014786 phosphorus Nutrition 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- DSNYFFJTZPIKFZ-UHFFFAOYSA-N propoxybenzene Chemical group CCCOC1=CC=CC=C1 DSNYFFJTZPIKFZ-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229960000581 salicylamide Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 235000001508 sulfur Nutrition 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
- C07D239/36—One oxygen atom as doubly bound oxygen atom or as unsubstituted hydroxy radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pulmonology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Immunology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65778776A | 1976-02-13 | 1976-02-13 | |
| US65778776 | 1976-02-13 | ||
| US74885176 | 1976-12-08 | ||
| US05/748,851 US4082751A (en) | 1976-02-13 | 1976-12-08 | Therapeutic agents |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI770427A7 FI770427A7 (OSRAM) | 1977-08-14 |
| FI62533B FI62533B (fi) | 1982-09-30 |
| FI62533C true FI62533C (fi) | 1983-01-10 |
Family
ID=27097492
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI770427A FI62533C (fi) | 1976-02-13 | 1977-02-09 | Foerfarande foer framstaellning av allergiska reaktioner foerhindrade 2-fenyl-5-(5-1h-tetrazolyl)pyrimidin-4-(3h)-onderivat |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS52118481A (OSRAM) |
| AU (1) | AU508970B2 (OSRAM) |
| CA (1) | CA1083152A (OSRAM) |
| CH (1) | CH635339A5 (OSRAM) |
| DE (1) | DE2705609A1 (OSRAM) |
| DK (1) | DK149044C (OSRAM) |
| FI (1) | FI62533C (OSRAM) |
| FR (1) | FR2340943A1 (OSRAM) |
| GB (1) | GB1541351A (OSRAM) |
| IE (1) | IE44603B1 (OSRAM) |
| LU (1) | LU76722A1 (OSRAM) |
| NL (1) | NL173055C (OSRAM) |
| SE (1) | SE433494B (OSRAM) |
| YU (1) | YU41567B (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4419357A (en) * | 1982-01-18 | 1983-12-06 | The Dow Chemical Company | 3-(1H-Tetrazol-5-yl)-4(3H)-quinazolinones |
| CN101747282A (zh) | 2008-12-10 | 2010-06-23 | 上海特化医药科技有限公司 | 一类含有嘧啶酮苯基的化合物、其药物组合物及其制备方法和用途 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3883653A (en) * | 1972-10-24 | 1975-05-13 | Pfizer | Method of preventing asthmatic symptoms |
-
1977
- 1977-02-03 AU AU21895/77A patent/AU508970B2/en not_active Expired
- 1977-02-08 LU LU76722A patent/LU76722A1/xx unknown
- 1977-02-09 FI FI770427A patent/FI62533C/fi not_active IP Right Cessation
- 1977-02-09 GB GB5437/77A patent/GB1541351A/en not_active Expired
- 1977-02-09 FR FR7703650A patent/FR2340943A1/fr active Granted
- 1977-02-09 CA CA271,406A patent/CA1083152A/en not_active Expired
- 1977-02-10 DE DE19772705609 patent/DE2705609A1/de active Granted
- 1977-02-10 DK DK57377A patent/DK149044C/da not_active IP Right Cessation
- 1977-02-11 SE SE7701552A patent/SE433494B/xx not_active IP Right Cessation
- 1977-02-11 NL NLAANVRAGE7701483,A patent/NL173055C/xx not_active IP Right Cessation
- 1977-02-11 IE IE297/77A patent/IE44603B1/en unknown
- 1977-02-11 CH CH173477A patent/CH635339A5/de not_active IP Right Cessation
- 1977-02-11 YU YU354/77A patent/YU41567B/xx unknown
- 1977-02-14 JP JP1433577A patent/JPS52118481A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52118481A (en) | 1977-10-04 |
| SE7701552L (sv) | 1977-09-23 |
| DK149044C (da) | 1986-06-02 |
| DK149044B (da) | 1985-12-30 |
| LU76722A1 (OSRAM) | 1977-08-18 |
| NL7701483A (nl) | 1977-08-16 |
| YU41567B (en) | 1987-10-31 |
| YU35477A (en) | 1982-10-31 |
| CA1083152A (en) | 1980-08-05 |
| DK57377A (da) | 1977-08-14 |
| IE44603B1 (en) | 1982-01-27 |
| IE44603L (en) | 1977-08-13 |
| FR2340943A1 (fr) | 1977-09-09 |
| FI770427A7 (OSRAM) | 1977-08-14 |
| FR2340943B1 (OSRAM) | 1981-01-09 |
| SE433494B (sv) | 1984-05-28 |
| DE2705609C2 (OSRAM) | 1988-12-15 |
| CH635339A5 (en) | 1983-03-31 |
| NL173055C (nl) | 1983-12-01 |
| GB1541351A (en) | 1979-02-28 |
| DE2705609A1 (de) | 1977-08-25 |
| AU508970B2 (en) | 1980-04-17 |
| AU2189577A (en) | 1978-08-10 |
| JPS6139947B2 (OSRAM) | 1986-09-06 |
| FI62533B (fi) | 1982-09-30 |
| NL173055B (nl) | 1983-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK160279B (da) | Analogifremgangsmaade til fremstilling af 3-(1h-tetrazol-5-yl)-4h-pyrido(1,2-a)pyrimidin-4-on-derivater | |
| US9724346B2 (en) | Substituted pyrimidines for treatment of a cough selected from chronic pathological cough, sub-acute pathological cough, acute pathological cough, neuronal hypersensitivity underlying chronic cough, neuronal hypersensitivity underlying sub-acute cough and neuronal hypersensitivity underlying acute cough | |
| US3622584A (en) | Certain 1-pyridyl 2-mercapto-imidazole derivatives | |
| NO153927B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 8-substituerte 4-amino-3-kinolinsyrederivater. | |
| US4405635A (en) | 4-Aroylimidazol-2-ones and their use as pharmaceuticals | |
| US4829058A (en) | Substituted bis-(4-aminophenyl)-sulfones | |
| JPH09301958A (ja) | 新規ピリミジン化合物及び抗ロタウイルス剤 | |
| US4041163A (en) | N-(5-Tetrazolyl)-4-oxo-4H-pyrimido(2,1-b)benzothiazole-3-carboxamide antiallergy agents | |
| JPS6225150B2 (OSRAM) | ||
| FI69836B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 4-fenyl-1,3-bensodiazepinderivat | |
| EP0625143A1 (en) | Pyridine derivatives, their preparation and use as medicines | |
| FI61688B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara oxminsyraderivat | |
| FI62533C (fi) | Foerfarande foer framstaellning av allergiska reaktioner foerhindrade 2-fenyl-5-(5-1h-tetrazolyl)pyrimidin-4-(3h)-onderivat | |
| US4082751A (en) | Therapeutic agents | |
| US3948894A (en) | 3-Amino-5,6-diaryl-1,2,4-triazines | |
| NO158739B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-piperazinopyrimidinderivater. | |
| US4008232A (en) | 3-Amino-5,6-diaryl-1,2,4-triazines | |
| AU600378B2 (en) | Piperidine derivatives, their preparation and their application in therapy | |
| US4159380A (en) | Imidazolylethoxy derivatives of pyrazolo[3,4-b]pyridine-5-methanols | |
| CS207785B2 (en) | Method of making the derivatives of the n-phenylalanine or n-phenylglycine | |
| US3968213A (en) | Method of preventing asthmatic symptoms | |
| US3927214A (en) | Method of preventing asthmatic symptoms | |
| US3303095A (en) | Compositions and methods for producing tranquilizing activity | |
| NO139786B (no) | Analogifremgangsmaate for fremstilling av farmasoeytisk aktive n-(5-tetrazolyl)-pyrimido-(1,2-a)kinolin-2-karboksamid-derivater | |
| US3957784A (en) | Bis(4-[4'-hydroxy-5'-carboxy-2'-pyrimidinyl]phenoxy)alkanes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: BRISTOL-MYERS CO |