FI62093C - Foerfarande foer framstaellning av terapeutiskt anvaendbara 4,0-dihydro-10-oxotieno(3,2-c)benzoxepin-8-aettiksyror samt dras esterderivat - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara 4,0-dihydro-10-oxotieno(3,2-c)benzoxepin-8-aettiksyror samt dras esterderivat Download PDFInfo
- Publication number
- FI62093C FI62093C FI762422A FI762422A FI62093C FI 62093 C FI62093 C FI 62093C FI 762422 A FI762422 A FI 762422A FI 762422 A FI762422 A FI 762422A FI 62093 C FI62093 C FI 62093C
- Authority
- FI
- Finland
- Prior art keywords
- dihydro
- formula
- acetic
- halogen
- therapeutic
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 13
- 230000001225 therapeutic effect Effects 0.000 title description 3
- 101100148710 Clarkia breweri SAMT gene Proteins 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- RWQMNIYXUUOSEB-UHFFFAOYSA-N 2-(10-oxo-4h-thieno[3,2-c][1]benzoxepin-8-yl)acetic acid Chemical class O=C1C2=CC(CC(=O)O)=CC=C2OCC2=C1SC=C2 RWQMNIYXUUOSEB-UHFFFAOYSA-N 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims 1
- 238000007363 ring formation reaction Methods 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 230000003110 anti-inflammatory effect Effects 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002260 anti-inflammatory agent Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- UFVAMULWEWSKFU-UHFFFAOYSA-N 2-(1-benzoxepin-8-yl)acetic acid Chemical class C1=CC=COC2=CC(CC(=O)O)=CC=C21 UFVAMULWEWSKFU-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- ATOWXRKBPWNXOS-UHFFFAOYSA-N 3-[[4-(carboxymethyl)phenoxy]methyl]thiophene-2-carboxylic acid Chemical compound C1=CC(CC(=O)O)=CC=C1OCC1=C(C(O)=O)SC=C1 ATOWXRKBPWNXOS-UHFFFAOYSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 230000001760 anti-analgesic effect Effects 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229960000905 indomethacin Drugs 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- -1 thionyl halide Chemical class 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- CCVYRRGZDBSHFU-UHFFFAOYSA-N (2-hydroxyphenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1O CCVYRRGZDBSHFU-UHFFFAOYSA-N 0.000 description 1
- LTEOHQLUJPPHMP-UHFFFAOYSA-N C(C)O.[P] Chemical compound C(C)O.[P] LTEOHQLUJPPHMP-UHFFFAOYSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- HYUPPKVFCGIMDB-UHFFFAOYSA-N ethyl 2-(4-hydroxyphenyl)acetate Chemical compound CCOC(=O)CC1=CC=C(O)C=C1 HYUPPKVFCGIMDB-UHFFFAOYSA-N 0.000 description 1
- RROVZFZRFXXELX-UHFFFAOYSA-N ethyl 3-(bromomethyl)thiophene-2-carboxylate Chemical compound CCOC(=O)C=1SC=CC=1CBr RROVZFZRFXXELX-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- VSDYPXFLUNDKOR-UHFFFAOYSA-N propan-2-yl 2-(10-oxo-4h-thieno[3,2-c][1]benzoxepin-8-yl)acetate Chemical compound O=C1C2=CC(CC(=O)OC(C)C)=CC=C2OCC2=C1SC=C2 VSDYPXFLUNDKOR-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyridine Compounds (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US60792675 | 1975-08-26 | ||
| US05/607,926 US4025640A (en) | 1975-08-26 | 1975-08-26 | Oxothienobenzoxepin-acetic acids, precursors and derivatives thereof |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI762422A7 FI762422A7 (de) | 1977-02-27 |
| FI62093B FI62093B (fi) | 1982-07-30 |
| FI62093C true FI62093C (fi) | 1982-11-10 |
Family
ID=24434282
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI762422A FI62093C (fi) | 1975-08-26 | 1976-08-24 | Foerfarande foer framstaellning av terapeutiskt anvaendbara 4,0-dihydro-10-oxotieno(3,2-c)benzoxepin-8-aettiksyror samt dras esterderivat |
Country Status (25)
| Country | Link |
|---|---|
| US (7) | US4025640A (de) |
| JP (1) | JPS5227764A (de) |
| AT (1) | AT359505B (de) |
| AU (1) | AU504461B2 (de) |
| BE (1) | BE845551A (de) |
| CA (1) | CA1068275A (de) |
| CH (1) | CH624408A5 (de) |
| DE (1) | DE2637110C3 (de) |
| DK (1) | DK384576A (de) |
| ES (1) | ES450881A1 (de) |
| FI (1) | FI62093C (de) |
| FR (2) | FR2346004A1 (de) |
| GB (2) | GB1563841A (de) |
| GR (1) | GR60832B (de) |
| HU (2) | HU174164B (de) |
| IE (1) | IE43940B1 (de) |
| IL (2) | IL50347A (de) |
| IT (1) | IT1064977B (de) |
| LU (1) | LU75650A1 (de) |
| MX (1) | MX4236E (de) |
| NL (1) | NL7609292A (de) |
| NO (1) | NO145139C (de) |
| PT (1) | PT65513B (de) |
| SE (1) | SE430161B (de) |
| ZA (1) | ZA765112B (de) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4025640A (en) * | 1975-08-26 | 1977-05-24 | American Hoechst Corporation | Oxothienobenzoxepin-acetic acids, precursors and derivatives thereof |
| US4104280A (en) * | 1977-02-04 | 1978-08-01 | Syntex (U.S.A.) Inc. | Dibenzo [b.f]thiepin and dibenzo[b.f]oxepin derivatives |
| US4130654A (en) * | 1978-01-30 | 1978-12-19 | Syntex (U.S.A.) Inc. | Novel 4-(8X-6,11-dihydrodibenzo-[b.e.]-thiepin-11-one-3-yl)-4-oxobutyric acids, methods of preparation, compositions and uses thereof |
| JPS54115388A (en) * | 1978-03-01 | 1979-09-07 | Nippon Chemiphar Co Ltd | Acetic acid derivative and its preparation |
| JPS54147304U (de) * | 1978-04-04 | 1979-10-13 | ||
| US4211877A (en) * | 1979-02-13 | 1980-07-08 | American Hoechst Corporation | Method of preparation of isopropyl 4,10-dihydro-10-oxothieno[3,2-c][1]benzoxepin-8-acetate |
| DE3125374A1 (de) * | 1981-06-27 | 1983-01-13 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von heteroaryl- und dibenzoxepinalkansaeuren |
| AU8509882A (en) * | 1981-06-30 | 1983-01-06 | Merck & Co., Inc. | Tricyclic derivatives of substituted pyrrole acids |
| US4496580A (en) * | 1981-07-23 | 1985-01-29 | Hoechst-Roussel Pharmaceuticals Inc. | Oxothienobenzoxepins |
| US4560701A (en) * | 1981-07-23 | 1985-12-24 | Hoechst-Roussel Pharmaceuticals Inc. | Oxothienobenzoxepins, medicinal use, and process for the preparation thereof |
| US4751238A (en) * | 1983-03-10 | 1988-06-14 | Hoechst-Roussel Pharmaceuticals, Inc. | Substituted alkyl amine derivatives of 6,11-dihydro-11-oxodibenz[b,e]oxepins |
| EP0118867A3 (de) * | 1983-03-10 | 1984-12-05 | Hoechst-Roussel Pharmaceuticals Incorporated | Substituierte 4,10-Dihydro-10-oxothienobenzodiazepine, Methode zu ihrer Herstellung, Zwischenprodukte und ihre Anwendung als Arzneimittel |
| US4477465A (en) * | 1983-03-10 | 1984-10-16 | Hoechst-Roussel Pharmaceuticals Inc. | Substituted 4,10-dihydro-10-oxothieno benzoxepins |
| US4514411A (en) * | 1983-03-10 | 1985-04-30 | Hoechst-Roussel Pharmaceuticals Inc. | Substituted 4,10-dihydro-10-oxothieno benzoxepins |
| US5260319A (en) * | 1989-12-26 | 1993-11-09 | Hoechst-Roussel Pharmaceuticals Incorporated | Thienobenzoxepins and naphthothiophenes |
| US5139796A (en) * | 1991-06-28 | 1992-08-18 | Wm. Wrigley Jr. Company | Tocopherol mixture for use as a mint oil antioxidant in chewing gum |
| US5132121A (en) * | 1991-08-12 | 1992-07-21 | Wm. Wrigley Jr. Company | Gum base containing tocopherol |
| US5200213A (en) * | 1991-08-12 | 1993-04-06 | Wm. Wrigley Jr. Company | Gum base containing tocopherol |
| JP4202250B2 (ja) | 2001-07-25 | 2008-12-24 | バイオマリン ファーマシューティカル インコーポレイテッド | 血液脳関門輸送を調節するための組成物および方法 |
| CA2789262C (en) | 2005-04-28 | 2016-10-04 | Proteus Digital Health, Inc. | Pharma-informatics system |
| US8795627B2 (en) | 2007-03-21 | 2014-08-05 | Raptor Pharmaceuticals Inc. | Treatment of liver disorders by administration of RAP conjugates |
| ES2919563T3 (es) | 2009-02-20 | 2022-07-27 | Enhanx Biopharm Inc | Sistema de administración de medicamentos a base de glutatión |
| CN110075069A (zh) | 2009-05-06 | 2019-08-02 | 实验室护肤股份有限公司 | 包含活性剂-磷酸钙颗粒复合物的皮肤递送组合物及其应用 |
| US20120077778A1 (en) | 2010-09-29 | 2012-03-29 | Andrea Bourdelais | Ladder-Frame Polyether Conjugates |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH83A (fr) * | 1888-11-17 | 1889-01-10 | Fontainemelon Horlogerie | Perfectionnements apportés à la construction des montres de tous calibres |
| CH469729A (de) * | 1963-08-31 | 1969-03-15 | Spofa Vereinigte Pharma Werke | Verfahren zur Herstellung von neuen 4,9-Dihydrothieno-(2,3-b)-benzo-(e)-thiepinderivaten |
| US3883551A (en) * | 1969-08-25 | 1975-05-13 | Little Inc A | Thienobenzopyrans and thiopyranobenzopyrans |
| US3888946A (en) * | 1971-03-17 | 1975-06-10 | Little Inc A | Pyrano benzopyrans |
| US3991194A (en) * | 1971-12-27 | 1976-11-09 | Sharps Associates | Heterocyclic esters of benzopyranopyridines |
| US3960871A (en) * | 1971-12-27 | 1976-06-01 | Sharps Associates | Esters of thienobenzopyrans and thiopyranobenzopyrans |
| DK131631C (da) * | 1972-04-07 | 1976-01-12 | Sandoz Ag | Analogifremgangsmade til fremstilling af 4-oxo-benzo(4,5)cyclohepta(1,2-b)thiophen-2-eddikesyreforbindelser |
| GB1403487A (en) * | 1972-07-21 | 1975-08-28 | Yoshitomi Pharmaceutical | Heterocyclic substituted alkanoic acids and derivatives |
| US3862143A (en) * | 1972-12-04 | 1975-01-21 | Warner Lambert Co | Substituted chromone-3-carbonitriles, carboxamides and carboxylic acids |
| US3825574A (en) * | 1972-12-04 | 1974-07-23 | Warner Lambert Co | Process for preparing substituted chromone-3-carbonitriles,carboxamides and carboxylic acids |
| US3946111A (en) * | 1973-08-29 | 1976-03-23 | Sharps Associates | Pharmaceutical compositions containing 1 or 2-mono and dialkyl substituted thienobenzopyrans and pharmacological uses thereof |
| US3895034A (en) * | 1973-08-29 | 1975-07-15 | Sharps Ass | 1 OR 2-Mono and dialkyl substituted thienobenzopyrans |
| CH597228A5 (de) * | 1973-09-04 | 1978-03-31 | Yoshitomi Pharmaceutical | |
| DK467274A (de) * | 1973-09-13 | 1975-05-12 | Sandoz Ag | |
| US3952025A (en) * | 1974-08-26 | 1976-04-20 | American Hoechst Corporation | Substituted 2-phenyl-4,6,7,8-tetrahydrofuro and 1,4,5,6,7,8-hexahydropyrrolo[3,2,-c]azepines |
| US4025640A (en) * | 1975-08-26 | 1977-05-24 | American Hoechst Corporation | Oxothienobenzoxepin-acetic acids, precursors and derivatives thereof |
| US4028383A (en) * | 1975-09-08 | 1977-06-07 | Warner-Lambert Company | Indolopyrones having antiallergic activity |
-
1975
- 1975-08-26 US US05/607,926 patent/US4025640A/en not_active Expired - Lifetime
-
1976
- 1976-08-18 DE DE2637110A patent/DE2637110C3/de not_active Expired
- 1976-08-20 NL NL7609292A patent/NL7609292A/xx not_active Application Discontinuation
- 1976-08-20 ES ES450881A patent/ES450881A1/es not_active Expired
- 1976-08-23 CH CH1067076A patent/CH624408A5/de not_active IP Right Cessation
- 1976-08-24 IT IT26507/76A patent/IT1064977B/it active
- 1976-08-24 GR GR51534A patent/GR60832B/el unknown
- 1976-08-24 IL IL50347A patent/IL50347A/xx unknown
- 1976-08-24 FI FI762422A patent/FI62093C/fi not_active IP Right Cessation
- 1976-08-24 LU LU75650A patent/LU75650A1/xx unknown
- 1976-08-25 SE SE7609390A patent/SE430161B/xx unknown
- 1976-08-25 PT PT65513A patent/PT65513B/pt unknown
- 1976-08-25 ZA ZA765112A patent/ZA765112B/xx unknown
- 1976-08-25 DK DK384576A patent/DK384576A/da not_active Application Discontinuation
- 1976-08-25 NO NO762929A patent/NO145139C/no unknown
- 1976-08-25 CA CA259,785A patent/CA1068275A/en not_active Expired
- 1976-08-25 AT AT630876A patent/AT359505B/de not_active IP Right Cessation
- 1976-08-25 AU AU17151/76A patent/AU504461B2/en not_active Expired
- 1976-08-25 IE IE1895/76A patent/IE43940B1/en unknown
- 1976-08-25 MX MX764855U patent/MX4236E/es unknown
- 1976-08-25 FR FR7625728A patent/FR2346004A1/fr active Granted
- 1976-08-26 JP JP51101181A patent/JPS5227764A/ja active Pending
- 1976-08-26 BE BE170106A patent/BE845551A/xx not_active IP Right Cessation
- 1976-08-26 GB GB35542/76A patent/GB1563841A/en not_active Expired
- 1976-08-26 GB GB12883/79A patent/GB1563842A/en not_active Expired
- 1976-08-26 HU HU76HO2082A patent/HU174164B/hu unknown
- 1976-08-26 HU HU76HO1923A patent/HU173465B/hu unknown
-
1977
- 1977-04-19 US US05/788,787 patent/US4107321A/en not_active Expired - Lifetime
- 1977-04-19 US US05/788,958 patent/US4107177A/en not_active Expired - Lifetime
- 1977-04-19 US US05/788,753 patent/US4081457A/en not_active Expired - Lifetime
- 1977-04-19 US US05/788,786 patent/US4117152A/en not_active Expired - Lifetime
- 1977-04-19 US US05/788,788 patent/US4101559A/en not_active Expired - Lifetime
- 1977-04-19 US US05/788,782 patent/US4124713A/en not_active Expired - Lifetime
- 1977-05-18 FR FR7715359A patent/FR2351972A1/fr active Granted
-
1979
- 1979-12-04 IL IL58864A patent/IL58864A0/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI62093C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 4,0-dihydro-10-oxotieno(3,2-c)benzoxepin-8-aettiksyror samt dras esterderivat | |
| GB1592996A (en) | Acylated pyrrole carboxylic acids and derivatives thereof | |
| FI77227B (fi) | Foerfarande foer framstaellning farmakologiskt aktiva 1-metyl-5-p-toluoylpyrrol-2-aettiksyra amider. | |
| FI72970C (fi) | Foerfarande foer framstaellning av 2-aminosubstituerade pyridazinderivat med inverkan pao det centrala nervsystemet. | |
| CA1191140A (en) | 2-quinolone derivatives | |
| SK278142B6 (en) | 2-(aminoalkyl)-5-(arylalkyl)-1,3-dioxanes derivatives, method of their preparation and their use in therapy | |
| DK149230B (da) | Analogifremgangsmaade til fremstilling af 5-benzoyl-6-hydroxy-indan-1-carboxylsyrederivater eller farmaceutisk acceptable salte deraf | |
| FI66857C (fi) | Foerfarande foer framstaellning av nya farmaceutiskt anvaendbara 3-substituerade dibensofuranderivat | |
| US4176194A (en) | Oxyalkanoic acid derivatives | |
| US4175130A (en) | Oxazole- and thiazole-alkanoic acid compounds | |
| US3872108A (en) | Novel chromone derivatives and the production thereof | |
| JPS5877849A (ja) | ビフエニルアルキルカルボン酸エステル誘導体、その製造法及びこれを含む医薬 | |
| US3818090A (en) | Novel quinolines in the treatment of pain and inflammation | |
| US4701466A (en) | Dibenz[be]oxepin-acetic acid derivatives, the preparation thereof and their application in therapy | |
| US4116972A (en) | Anti-inflammatory 1-oxo-isoindoline derivatives and processes for their preparation | |
| CH628014A5 (en) | Gamma-aryl-gamma-oxoisovaleric acids having antiphlogistic and antalgic properties | |
| US4649153A (en) | 5,6-Dihydro-4H-cyclopenta(b)thiophene-6-carboxylic acids, preparation processes and medicines containing them | |
| US3963758A (en) | 2-(Benzofuroyl)phenyl acetic acids | |
| NL7906339A (nl) | Hydroxyalkaanzuurderivaten en werkwijzen voor het bereiden en toepassen van deze derivaten. | |
| US3287459A (en) | Carbostyrils, coumarines and thiocoumarines | |
| FI63569B (fi) | Foerfarande foer framstaellning av farmaceutiskt anvaendbara 6,11-dihydro-11-oxodibenz(b,e)oxepinalkylkarboxylsyror och deas estrar | |
| US4189607A (en) | Anilionotropone derivatives | |
| EP0132814A1 (de) | Esterderivate substituierter Essigsäuren und deren Herstellung | |
| US5292751A (en) | 5,7-dihydroxy-2-methyl-8-(4-(3-hydroxy-1-(1-propyl))piperidinyl)-4H-1-benzopyran-4-one, its preparation and its use | |
| US3631064A (en) | Thiophenochromene compounds and process for producing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: HOECHST AKTIENGESELLSCHAFT |