FI61483C - Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,-dihydropyridinkarboxylsyraaralkylestrar - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,-dihydropyridinkarboxylsyraaralkylestrar Download PDFInfo
- Publication number
- FI61483C FI61483C FI760475A FI760475A FI61483C FI 61483 C FI61483 C FI 61483C FI 760475 A FI760475 A FI 760475A FI 760475 A FI760475 A FI 760475A FI 61483 C FI61483 C FI 61483C
- Authority
- FI
- Finland
- Prior art keywords
- mmol
- ester
- formula
- yield
- theory
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 285
- 239000002253 acid Substances 0.000 claims description 206
- 150000002148 esters Chemical class 0.000 claims description 156
- -1 carboxyl ester ester Chemical class 0.000 claims description 60
- 238000000034 method Methods 0.000 claims description 39
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 239000003960 organic solvent Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000001412 amines Chemical class 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 101100496169 Arabidopsis thaliana CLH1 gene Proteins 0.000 claims description 6
- 101100044057 Mesocricetus auratus SYCP3 gene Proteins 0.000 claims description 6
- 101100080600 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nse6 gene Proteins 0.000 claims description 6
- 150000001299 aldehydes Chemical class 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 101150111293 cor-1 gene Proteins 0.000 claims description 6
- 229910052736 halogen Chemical group 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 101100297828 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) chol-2 gene Proteins 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000001733 carboxylic acid esters Chemical class 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 543
- 239000000243 solution Substances 0.000 description 276
- 238000010438 heat treatment Methods 0.000 description 267
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 192
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 116
- 229910021529 ammonia Inorganic materials 0.000 description 94
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 60
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 52
- 150000004702 methyl esters Chemical class 0.000 description 51
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 46
- XKORCTIIRYKLLG-ARJAWSKDSA-N methyl (z)-3-aminobut-2-enoate Chemical compound COC(=O)\C=C(\C)N XKORCTIIRYKLLG-ARJAWSKDSA-N 0.000 description 41
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 38
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 32
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 20
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 17
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropyl acetate Chemical compound CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 17
- YCKAGGHNUHZKCL-XQRVVYSFSA-N propan-2-yl (z)-3-aminobut-2-enoate Chemical compound CC(C)OC(=O)\C=C(\C)N YCKAGGHNUHZKCL-XQRVVYSFSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- LPYNWRPARGBJOL-CLFYSBASSA-N benzyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=CC=C1 LPYNWRPARGBJOL-CLFYSBASSA-N 0.000 description 13
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 11
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- UKVYVZLTGQVOPX-IHWYPQMZSA-N (z)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C\C(O)=O UKVYVZLTGQVOPX-IHWYPQMZSA-N 0.000 description 8
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 8
- WDCUPFMSLUIQBH-UHFFFAOYSA-N 4-Methylbenzyl alcohol acetate Chemical compound CC(=O)OCC1=CC=C(C)C=C1 WDCUPFMSLUIQBH-UHFFFAOYSA-N 0.000 description 8
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 7
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 7
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 7
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 7
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 7
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 7
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 7
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 7
- RGXMQOMQGUZTOV-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methyl acetate Chemical compound CC(=O)OCC1=CC=C(C(F)(F)F)C=C1 RGXMQOMQGUZTOV-UHFFFAOYSA-N 0.000 description 7
- AJZBDZTYAJVGNV-UHFFFAOYSA-N (2-chlorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1Cl AJZBDZTYAJVGNV-UHFFFAOYSA-N 0.000 description 6
- JHYSHNNTSZKACR-DAXSKMNVSA-N (3,4-dichlorophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(Cl)C(Cl)=C1 JHYSHNNTSZKACR-DAXSKMNVSA-N 0.000 description 6
- SLELAUJUNMIAJN-TWGQIWQCSA-N (3,4-dimethoxyphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound COC1=CC=C(COC(=O)\C=C(\C)N)C=C1OC SLELAUJUNMIAJN-TWGQIWQCSA-N 0.000 description 6
- VLGSCQIAPMTNQL-VURMDHGXSA-N (4-chlorophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(Cl)C=C1 VLGSCQIAPMTNQL-VURMDHGXSA-N 0.000 description 6
- MAGQINDMZBNWLG-UHFFFAOYSA-N (4-chlorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(Cl)C=C1 MAGQINDMZBNWLG-UHFFFAOYSA-N 0.000 description 6
- OWMRIFLGTOASEK-YFHOEESVSA-N (4-methylphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(C)C=C1 OWMRIFLGTOASEK-YFHOEESVSA-N 0.000 description 6
- KQWHHDCWLCCRLQ-UHFFFAOYSA-N 3,4-dimethoxybenzyl acetate Chemical compound COC1=CC=C(COC(C)=O)C=C1OC KQWHHDCWLCCRLQ-UHFFFAOYSA-N 0.000 description 6
- 125000003352 4-tert-butyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- 239000012429 reaction media Substances 0.000 description 6
- JDYTUYZRVGAEQD-UHFFFAOYSA-N (3,4-dichlorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(Cl)C(Cl)=C1 JDYTUYZRVGAEQD-UHFFFAOYSA-N 0.000 description 5
- XJOLYWNYMOPRKQ-WAYWQWQTSA-N 2-methoxyethyl (z)-3-aminobut-2-enoate Chemical compound COCCOC(=O)\C=C(\C)N XJOLYWNYMOPRKQ-WAYWQWQTSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229960005335 propanol Drugs 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- XLMVMSDHBQJNTL-UHFFFAOYSA-N (3-chlorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(Cl)=C1 XLMVMSDHBQJNTL-UHFFFAOYSA-N 0.000 description 4
- DJBFVOJTBWVMKW-UHFFFAOYSA-N (4-fluorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(F)C=C1 DJBFVOJTBWVMKW-UHFFFAOYSA-N 0.000 description 4
- QSCOAHKJRIJKQZ-UHFFFAOYSA-N (4-tert-butylphenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(C(C)(C)C)C=C1 QSCOAHKJRIJKQZ-UHFFFAOYSA-N 0.000 description 4
- WHFKYDMBUMLWDA-UHFFFAOYSA-N 2-phenoxyethyl acetate Chemical compound CC(=O)OCCOC1=CC=CC=C1 WHFKYDMBUMLWDA-UHFFFAOYSA-N 0.000 description 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 4
- HFNGYHHRRMSKEU-UHFFFAOYSA-N 4-Methoxybenzyl acetate Chemical compound COC1=CC=C(COC(C)=O)C=C1 HFNGYHHRRMSKEU-UHFFFAOYSA-N 0.000 description 4
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- KEUJDDUMMLYJOZ-VURMDHGXSA-N (2-chlorophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=CC=C1Cl KEUJDDUMMLYJOZ-VURMDHGXSA-N 0.000 description 3
- HEAXOXBJLTUVBX-UHFFFAOYSA-N (3,4,5-trimethoxyphenyl)methyl acetate Chemical compound COC1=CC(COC(C)=O)=CC(OC)=C1OC HEAXOXBJLTUVBX-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- YLYIZDJUFXCITF-KTKRTIGZSA-N 2-phenoxyethyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCCOC1=CC=CC=C1 YLYIZDJUFXCITF-KTKRTIGZSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- YPMPTULBFPFSEQ-PLNGDYQASA-N ethyl (z)-3-aminobut-2-enoate Chemical compound CCOC(=O)\C=C(\C)N YPMPTULBFPFSEQ-PLNGDYQASA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- VCDOXKMVZZSCQK-ARJAWSKDSA-N methyl (z)-2-aminobut-2-enoate Chemical compound COC(=O)C(\N)=C\C VCDOXKMVZZSCQK-ARJAWSKDSA-N 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- GDCVNZSYFVHTGP-UITAMQMPSA-N (3,4,5-trimethoxyphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound COC1=CC(COC(=O)\C=C(\C)N)=CC(OC)=C1OC GDCVNZSYFVHTGP-UITAMQMPSA-N 0.000 description 2
- HCIDZVMGBROSSS-UITAMQMPSA-N (3-chloro-4-methylphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(C)C(Cl)=C1 HCIDZVMGBROSSS-UITAMQMPSA-N 0.000 description 2
- SHGYJCHRGKLVGT-UHFFFAOYSA-N (3-chloro-4-methylphenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(C)C(Cl)=C1 SHGYJCHRGKLVGT-UHFFFAOYSA-N 0.000 description 2
- OVLYFPXVUTYZDJ-YVMONPNESA-N (3-chlorophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=CC(Cl)=C1 OVLYFPXVUTYZDJ-YVMONPNESA-N 0.000 description 2
- RBYNXSAFOSBQTH-VURMDHGXSA-N (4-fluorophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(F)C=C1 RBYNXSAFOSBQTH-VURMDHGXSA-N 0.000 description 2
- VBQLDIYVRFHBGQ-CLFYSBASSA-N (4-methoxyphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound COC1=CC=C(COC(=O)\C=C(\C)N)C=C1 VBQLDIYVRFHBGQ-CLFYSBASSA-N 0.000 description 2
- VYGMIONXHGKIJF-VURMDHGXSA-N (4-nitrophenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 VYGMIONXHGKIJF-VURMDHGXSA-N 0.000 description 2
- QNXQLPUEZYZYFC-UHFFFAOYSA-N (4-nitrophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 QNXQLPUEZYZYFC-UHFFFAOYSA-N 0.000 description 2
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 2
- QUMXDOLUJCHOAY-UHFFFAOYSA-N 1-Phenylethyl acetate Chemical compound CC(=O)OC(C)C1=CC=CC=C1 QUMXDOLUJCHOAY-UHFFFAOYSA-N 0.000 description 2
- MKLOISUJEXELIY-HJWRWDBZSA-N 1-phenylethyl (z)-3-aminobut-2-enoate Chemical compound C/C(N)=C/C(=O)OC(C)C1=CC=CC=C1 MKLOISUJEXELIY-HJWRWDBZSA-N 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 2
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 2
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- DFLRRTPSYIFGOC-DAXSKMNVSA-N 2-methylpropyl (z)-3-aminobut-2-enoate Chemical compound CC(C)COC(=O)\C=C(\C)N DFLRRTPSYIFGOC-DAXSKMNVSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- CIPWSFXRDGCQTO-JYOAFUTRSA-N C(C1=CC=CC=C1)OC(\C(=C\C)\NC)=O Chemical compound C(C1=CC=CC=C1)OC(\C(=C\C)\NC)=O CIPWSFXRDGCQTO-JYOAFUTRSA-N 0.000 description 2
- FVGLKSRJRBKYFE-UHFFFAOYSA-N COC(CC(C1=CC=CC=C1)C(C(=O)O)[N+](=O)[O-])=O Chemical compound COC(CC(C1=CC=CC=C1)C(C(=O)O)[N+](=O)[O-])=O FVGLKSRJRBKYFE-UHFFFAOYSA-N 0.000 description 2
- YYLLIJHXUHJATK-UHFFFAOYSA-N Cyclohexyl acetate Chemical compound CC(=O)OC1CCCCC1 YYLLIJHXUHJATK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- BVWANFUDIPSLIY-FPLPWBNLSA-N cyclohexyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OC1CCCCC1 BVWANFUDIPSLIY-FPLPWBNLSA-N 0.000 description 2
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 2
- YFPCLQKFNXUAAK-UHFFFAOYSA-N cyclopentyl acetate Chemical compound CC(=O)OC1CCCC1 YFPCLQKFNXUAAK-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- GJRQTCIYDGXPES-UHFFFAOYSA-N isobutyl acetate Chemical compound CC(C)COC(C)=O GJRQTCIYDGXPES-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- MDHYEMXUFSJLGV-UHFFFAOYSA-N phenethyl acetate Chemical compound CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000002048 spasmolytic effect Effects 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- QQIGYVJKMYOJGK-LUAWRHEFSA-N (4-tert-butylphenyl)methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(C(C)(C)C)C=C1 QQIGYVJKMYOJGK-LUAWRHEFSA-N 0.000 description 1
- PAWSVPVNIXFKOS-IHWYPQMZSA-N (Z)-2-aminobutenoic acid Chemical compound C\C=C(/N)C(O)=O PAWSVPVNIXFKOS-IHWYPQMZSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KQFZVTRQXBBBQF-UHFFFAOYSA-N 1-(4-chlorophenyl)ethyl acetate Chemical compound CC(=O)OC(C)C1=CC=C(Cl)C=C1 KQFZVTRQXBBBQF-UHFFFAOYSA-N 0.000 description 1
- KIRAMNZKGBLPTF-UHFFFAOYSA-N 2,4-dimethylcyclohexane-1-carboxylic acid Chemical compound CC1CCC(C(O)=O)C(C)C1 KIRAMNZKGBLPTF-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- LMLISKWDMAFIRR-UTCJRWHESA-N 2-methoxyethyl (z)-2-aminobut-2-enoate Chemical compound COCCOC(=O)C(\N)=C\C LMLISKWDMAFIRR-UTCJRWHESA-N 0.000 description 1
- DMLJMDUIBABXLN-KTKRTIGZSA-N 2-phenylethyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCCC1=CC=CC=C1 DMLJMDUIBABXLN-KTKRTIGZSA-N 0.000 description 1
- JBODLJZXSKPWRV-UHFFFAOYSA-N 3-o-(2-methoxyethyl) 5-o-[(3,4,5-trimethoxyphenyl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(OC)C(OC)=C(OC)C=2)C1C1=CC=CC([N+]([O-])=O)=C1 JBODLJZXSKPWRV-UHFFFAOYSA-N 0.000 description 1
- SLOZGYLUXISHKM-UHFFFAOYSA-N 3-o-(2-phenoxyethyl) 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCCOC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 SLOZGYLUXISHKM-UHFFFAOYSA-N 0.000 description 1
- XNBZFDAETMEUHW-UHFFFAOYSA-N 3-o-[(2-chlorophenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C(=CC=CC=2)Cl)C1C1=CC=CC([N+]([O-])=O)=C1 XNBZFDAETMEUHW-UHFFFAOYSA-N 0.000 description 1
- UFEFVJKRKPFTGX-UHFFFAOYSA-N 3-o-[(3,4-dimethoxyphenyl)methyl] 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound C1=C(OC)C(OC)=CC=C1COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 UFEFVJKRKPFTGX-UHFFFAOYSA-N 0.000 description 1
- MOXCQLYBHVITAM-UHFFFAOYSA-N 3-o-benzyl 5-o-(2-methylpropyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC=C1[N+]([O-])=O MOXCQLYBHVITAM-UHFFFAOYSA-N 0.000 description 1
- SOOHPFREDUOEIA-UHFFFAOYSA-N 3-o-methyl 5-o-(2-phenoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCCOC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 SOOHPFREDUOEIA-UHFFFAOYSA-N 0.000 description 1
- BFBQFUCPYXVYMO-UHFFFAOYSA-N 3-o-methyl 5-o-[(4-methylphenyl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(C)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 BFBQFUCPYXVYMO-UHFFFAOYSA-N 0.000 description 1
- MWHSWSMCZVFHPK-UHFFFAOYSA-N 3-o-methyl 5-o-[(4-nitrophenyl)methyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(=CC=2)[N+]([O-])=O)C1C1=CC=CC=C1[N+]([O-])=O MWHSWSMCZVFHPK-UHFFFAOYSA-N 0.000 description 1
- IGTNUCYFOBDUEF-UHFFFAOYSA-N 5-methoxycarbonyl-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid Chemical compound COC(=O)C1=C(C)NC(C)=C(C(O)=O)C1C1=CC=CC=C1[N+]([O-])=O IGTNUCYFOBDUEF-UHFFFAOYSA-N 0.000 description 1
- DYPLYYZPMCBBCW-UHFFFAOYSA-N 5-o-[(2-chlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C(=CC=CC=2)Cl)C1C1=CC=CC=C1[N+]([O-])=O DYPLYYZPMCBBCW-UHFFFAOYSA-N 0.000 description 1
- PEIUWQZBAJOFIT-UHFFFAOYSA-N 5-o-[(3,4-dichlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C(Cl)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O PEIUWQZBAJOFIT-UHFFFAOYSA-N 0.000 description 1
- UGKNFEMELKPIIS-UHFFFAOYSA-N 5-o-[(3,4-dichlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C(Cl)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 UGKNFEMELKPIIS-UHFFFAOYSA-N 0.000 description 1
- SRLRFCQJYHFIJZ-UHFFFAOYSA-N 5-o-[(3,4-dimethoxyphenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(OC)C(OC)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O SRLRFCQJYHFIJZ-UHFFFAOYSA-N 0.000 description 1
- XZXXOBGBMDWDFS-UHFFFAOYSA-N 5-o-[(3-chloro-4-methylphenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C(C)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O XZXXOBGBMDWDFS-UHFFFAOYSA-N 0.000 description 1
- VUAHTMHCIZYMEO-UHFFFAOYSA-N 5-o-[(3-chlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=C(Cl)C=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 VUAHTMHCIZYMEO-UHFFFAOYSA-N 0.000 description 1
- NLPFUYUSPBZVDK-UHFFFAOYSA-N 5-o-[(4-chlorophenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(Cl)=CC=2)C1C1=CC=CC=C1[N+]([O-])=O NLPFUYUSPBZVDK-UHFFFAOYSA-N 0.000 description 1
- WGBGXHMGSAULRA-UHFFFAOYSA-N 5-o-[(4-methoxyphenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(OC)=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 WGBGXHMGSAULRA-UHFFFAOYSA-N 0.000 description 1
- GKUYOCODKSJBTK-UHFFFAOYSA-N 5-o-[(4-tert-butylphenyl)methyl] 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(=CC=2)C(C)(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 GKUYOCODKSJBTK-UHFFFAOYSA-N 0.000 description 1
- IQGRGQXQSPSWNI-UHFFFAOYSA-N 5-o-benzyl 3-o-(2-methoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 IQGRGQXQSPSWNI-UHFFFAOYSA-N 0.000 description 1
- PBHGYSNKDSHWBN-UHFFFAOYSA-N 5-o-benzyl 3-o-methyl 1,2,6-trimethyl-4-(2-nitrophenyl)-4h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC=C1[N+]([O-])=O PBHGYSNKDSHWBN-UHFFFAOYSA-N 0.000 description 1
- XBIMVOAFFBILAE-UHFFFAOYSA-N 5-o-benzyl 3-o-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC=C1[N+]([O-])=O XBIMVOAFFBILAE-UHFFFAOYSA-N 0.000 description 1
- LEAXDOAMTDBJAR-UHFFFAOYSA-N 5-o-propan-2-yl 3-o-[[4-(trifluoromethyl)phenyl]methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CC(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC(=CC=2)C(F)(F)F)C1C1=CC=CC([N+]([O-])=O)=C1 LEAXDOAMTDBJAR-UHFFFAOYSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- WOFAGNLBCJWEOE-UHFFFAOYSA-N Benzyl acetoacetate Chemical compound CC(=O)CC(=O)OCC1=CC=CC=C1 WOFAGNLBCJWEOE-UHFFFAOYSA-N 0.000 description 1
- LRPDDTLUKDFUDJ-SNAWJCMRSA-N C(C)(C)(C)C1=CC=C(COC(\C=C\CN)=O)C=C1 Chemical compound C(C)(C)(C)C1=CC=C(COC(\C=C\CN)=O)C=C1 LRPDDTLUKDFUDJ-SNAWJCMRSA-N 0.000 description 1
- LKBINMHPWJTYKI-ZZXKWVIFSA-N ClC1=C(COC(\C=C\CN)=O)C=CC=C1 Chemical compound ClC1=C(COC(\C=C\CN)=O)C=CC=C1 LKBINMHPWJTYKI-ZZXKWVIFSA-N 0.000 description 1
- 206010069729 Collateral circulation Diseases 0.000 description 1
- 229920001076 Cutan Polymers 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- NBHQBAZZPJUKBC-UHFFFAOYSA-N FC1=CC=C(COC(=O)C=2C(C(=C(NC2C)C)C(=O)OC)C2=C(C=CC=C2)[N+](=O)[O-])C=C1 Chemical compound FC1=CC=C(COC(=O)C=2C(C(=C(NC2C)C)C(=O)OC)C2=C(C=CC=C2)[N+](=O)[O-])C=C1 NBHQBAZZPJUKBC-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- YMLQCOGTNWEQQJ-VURMDHGXSA-N [4-(trifluoromethyl)phenyl]methyl (z)-3-aminobut-2-enoate Chemical compound C\C(N)=C\C(=O)OCC1=CC=C(C(F)(F)F)C=C1 YMLQCOGTNWEQQJ-VURMDHGXSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 229940127088 antihypertensive drug Drugs 0.000 description 1
- 230000037007 arousal Effects 0.000 description 1
- QATDIDQCGZUTRW-QPJJXVBHSA-N benzyl (E)-4-aminobut-2-enoate Chemical compound NC\C=C\C(=O)OCC1=CC=CC=C1 QATDIDQCGZUTRW-QPJJXVBHSA-N 0.000 description 1
- DELPEVZSDFCVSF-SGAXSIHGSA-N benzyl (Z)-2-aminobut-2-enoate Chemical compound C\C=C(/N)C(=O)OCC1=CC=CC=C1 DELPEVZSDFCVSF-SGAXSIHGSA-N 0.000 description 1
- ZBJWNZBPXYUYNP-UHFFFAOYSA-N benzyl 4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate Chemical compound C(C1=CC=CC=C1)OC(=O)C=1C(C=CNC1)C1=C(C=CC=C1)C(F)(F)F ZBJWNZBPXYUYNP-UHFFFAOYSA-N 0.000 description 1
- FXOXDXFSLDITCW-UHFFFAOYSA-N benzyl 5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate Chemical compound CC(=O)C1=C(C)NC(C)=C(C(=O)OCC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 FXOXDXFSLDITCW-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- LHVDYMINHJAJGK-ZZXKWVIFSA-N cyclopentyl (E)-4-aminobut-2-enoate Chemical compound NC\C=C\C(=O)OC1CCCC1 LHVDYMINHJAJGK-ZZXKWVIFSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000006286 dichlorobenzyl group Chemical group 0.000 description 1
- VQZSDRXKLXBRHJ-UHFFFAOYSA-N diethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical class CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1 VQZSDRXKLXBRHJ-UHFFFAOYSA-N 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 230000010339 dilation Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- KBEBGUQPQBELIU-UHFFFAOYSA-N ethyl 3-phenylprop-2-enoate Chemical compound CCOC(=O)C=CC1=CC=CC=C1 KBEBGUQPQBELIU-UHFFFAOYSA-N 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000001435 haemodynamic effect Effects 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- PMVWCQUEDYFAPT-ONEGZZNKSA-N methyl (e)-4-(methylamino)but-2-enoate Chemical compound CNC\C=C\C(=O)OC PMVWCQUEDYFAPT-ONEGZZNKSA-N 0.000 description 1
- GLFAZZQWYRINJN-NSCUHMNNSA-N methyl (e)-4-aminobut-2-enoate Chemical compound COC(=O)\C=C\CN GLFAZZQWYRINJN-NSCUHMNNSA-N 0.000 description 1
- QQACQVIKWIMBKB-PLNGDYQASA-N methyl (z)-2-(methylamino)but-2-enoate Chemical compound CN\C(=C/C)C(=O)OC QQACQVIKWIMBKB-PLNGDYQASA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 210000002464 muscle smooth vascular Anatomy 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-N trans-cinnamic acid Chemical compound OC(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-N 0.000 description 1
- 125000006493 trifluoromethyl benzyl group Chemical group 0.000 description 1
- 210000000689 upper leg Anatomy 0.000 description 1
- 210000005166 vasculature Anatomy 0.000 description 1
- 208000003663 ventricular fibrillation Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2508181 | 1975-02-26 | ||
| DE19752508181 DE2508181A1 (de) | 1975-02-26 | 1975-02-26 | 1,4-dihydropyridincarbonsaeurearal- kylester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI760475A7 FI760475A7 (enExample) | 1976-08-27 |
| FI61483B FI61483B (fi) | 1982-04-30 |
| FI61483C true FI61483C (fi) | 1982-08-10 |
Family
ID=5939797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI760475A FI61483C (fi) | 1975-02-26 | 1976-02-24 | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,-dihydropyridinkarboxylsyraaralkylestrar |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4044141A (enExample) |
| JP (1) | JPS6025424B2 (enExample) |
| AT (1) | AT351024B (enExample) |
| BE (1) | BE838924A (enExample) |
| CA (1) | CA1069902A (enExample) |
| CH (1) | CH622506A5 (enExample) |
| CS (1) | CS188994B2 (enExample) |
| DD (1) | DD125483A5 (enExample) |
| DE (1) | DE2508181A1 (enExample) |
| DK (1) | DK78876A (enExample) |
| ES (1) | ES445508A1 (enExample) |
| FI (1) | FI61483C (enExample) |
| FR (1) | FR2302093A1 (enExample) |
| GB (1) | GB1477114A (enExample) |
| HU (1) | HU171717B (enExample) |
| IE (1) | IE42643B1 (enExample) |
| IL (1) | IL49095A (enExample) |
| IN (1) | IN142197B (enExample) |
| LU (1) | LU74424A1 (enExample) |
| NL (1) | NL7601823A (enExample) |
| NO (1) | NO146393C (enExample) |
| PL (1) | PL100906B1 (enExample) |
| PT (1) | PT64840B (enExample) |
| RO (1) | RO68479A (enExample) |
| SE (1) | SE7602317L (enExample) |
| SU (1) | SU574150A3 (enExample) |
| ZA (1) | ZA761118B (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2747513A1 (de) * | 1977-10-22 | 1979-05-03 | Bayer Ag | Dihydropyridine mit schwefelhaltigen estergruppierungen |
| DE2837477A1 (de) * | 1978-08-28 | 1980-03-13 | Bayer Ag | Sila-substituierte 1,4-dihydropyridin- derivate |
| DE2841667A1 (de) * | 1978-09-25 | 1980-04-10 | Bayer Ag | Fluorhaltige 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2847236A1 (de) * | 1978-10-31 | 1980-05-14 | Bayer Ag | Neue dihydropyridine mit substituierten estergruppierungen, mehrer verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2935451A1 (de) * | 1979-09-01 | 1981-03-19 | Bayer Ag, 5090 Leverkusen | Optisch aktive 1,4-dihydropyridine, verfahren zu ihrer herstellung und ihre verwendung als arneimittel |
| BE886259A (fr) * | 1979-11-23 | 1981-05-20 | Sandoz Sa | Nouveaux medicament a base de derives de la 1,4-dihydropyridine, pour le traitement de l'insuffisance cerebrovasculaire ou a action spamolytique |
| DE3018259A1 (de) * | 1980-05-13 | 1981-11-19 | Bayer Ag, 5090 Leverkusen | 1,4-dihydropyridine mit unterschiedlichen substituenten in 2- und 6-position, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln |
| JPS57171968A (en) * | 1981-04-17 | 1982-10-22 | Kyowa Hakko Kogyo Co Ltd | 1,4-dihydropyridine derivative |
| JPS57200364A (en) * | 1981-06-04 | 1982-12-08 | Yoshitomi Pharmaceut Ind Ltd | 1,4-dihydropyridine-3,5-dicarboxylic ester derivative and its salt |
| CH655110A5 (de) * | 1982-09-03 | 1986-03-27 | Otsuka Pharma Co Ltd | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. |
| US4656181A (en) * | 1982-11-24 | 1987-04-07 | Cermol S.A. | Esters of 1,4-dihydropyridines, processes for the preparation of the new esters, and medicaments containing the same |
| JPS60120861A (ja) * | 1983-12-02 | 1985-06-28 | Otsuka Pharmaceut Co Ltd | ジヒドロピリジン誘導体 |
| US5137889A (en) * | 1983-12-02 | 1992-08-11 | Otsuka Pharmaceutical Co., Ltd. | Dihydropyridine derivatives and process for preparing the same |
| DE4342196A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Neue 4-Phenyl-substituierte 1,4-Dihydropyridine |
| JPS60248693A (ja) * | 1984-04-19 | 1985-12-09 | Nippon Shinyaku Co Ltd | ピリジン誘導体及び製法 |
| US4672068A (en) * | 1984-05-04 | 1987-06-09 | Fujirebio Kabushiki Kaisha | Antihypertensive 1,4-dihydropyridines having a conjugated ester |
| DE3424342A1 (de) * | 1984-07-03 | 1986-01-09 | Bayer Ag, 5090 Leverkusen | 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-pyridin-3,5-dicarbonsaeure-isopropyl-(2-(3-trifluormethylphenoxy)-ethyl)-ester, mehrere verfahren zu seiner herstellung sowie seine verwendung in arzneimitteln |
| JPS6143165A (ja) * | 1984-08-07 | 1986-03-01 | Otsuka Pharmaceut Co Ltd | ジヒドロピリジン誘導体の製造法 |
| US4994476A (en) * | 1984-10-31 | 1991-02-19 | Bristol-Myers Company | Dihydropyridin-3,5-dicarboxylates incorporating aryloxypropanolamine moieties |
| US4757071A (en) * | 1984-12-14 | 1988-07-12 | Nisshin Flour Milling Co., Ltd. | 1,4-dihydropyridine derivatives, and pharmaceutical compositions containing same, useful for treating cardiovascular diseases |
| IL77843A (en) * | 1985-02-11 | 1989-07-31 | Syntex Inc | Dihydropyridine derivatives,process and novel intermediates for their preparation and pharmaceutical compositions containing them |
| US4595690A (en) * | 1985-02-11 | 1986-06-17 | Syntex (U.S.A.) Inc. | Antihypertensive dihydropyridine derivatives |
| US4593033A (en) * | 1985-04-24 | 1986-06-03 | Merck & Co., Inc. | Substituted indeno[2,1-c] pyridines useful as calcium channel blockers |
| US4605660A (en) * | 1985-06-03 | 1986-08-12 | Merck & Co., Inc. | Indeno[2,1-c]pyridine compounds, and their use as calcium channel blockers |
| US4670443A (en) * | 1985-07-02 | 1987-06-02 | Merck & Co., Inc. | Benzo(f)isoquinoline compounds useful as calcium entry blockers |
| US4721708A (en) * | 1985-11-26 | 1988-01-26 | Merck & Co., Inc. | Cyclized N-substituted-tetrahydropyridine compounds and cardiovascular use |
| US4788203A (en) * | 1985-11-26 | 1988-11-29 | Merck & Co., Inc. | Cyclized N-substituted-tetrahydropyridine compounds, useful in the treatment of cardiovascular disorders |
| DE3601196A1 (de) * | 1986-01-17 | 1987-07-23 | Merck Patent Gmbh | 1,4-dihydropyridine |
| DK114587A (da) * | 1986-03-12 | 1987-09-13 | Byk Gulden Lomberg Chem Fab | Monocycliske esterderivater |
| US4761420A (en) * | 1986-06-13 | 1988-08-02 | Laboratoires Syntex S.A. | Antihypertensive dihydropyridine derivatives |
| JPH0688973B2 (ja) * | 1987-03-12 | 1994-11-09 | 京都薬品工業株式会社 | 1,4−ジヒドロピリジン誘導体 |
| ZA889252B (en) * | 1987-12-11 | 1990-08-29 | Syntex Lab | Neuroprotective compounds |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
| KR940003492B1 (ko) * | 1988-10-27 | 1994-04-23 | 주식회사 유한양행 | 1,4-디하이드로피리딘유도체 및 그의 제조방법 |
| JPH01151557A (ja) * | 1988-11-15 | 1989-06-14 | Otsuka Pharmaceut Co Ltd | 降圧剤 |
| DE4125271A1 (de) * | 1991-07-31 | 1993-02-11 | Bayer Ag | Neue n-alkylierte 1,4-dihydropyridindicarbonsaeureester |
| GB9119983D0 (en) * | 1991-09-19 | 1991-11-06 | Erba Carlo Spa | Dihydropyridine derivatives useful in antitumor therapy |
| DE4342193A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Arylsubstituierte Alkoxycarbonyl-1,4-dihydropyridin-5-carbonsäureester |
| EE03192B1 (et) * | 1993-12-10 | 1999-06-15 | Bayer Aktiengesellschaft | Isopropüül-(2-metoksüetüül)-4-(2-kloro-3-tsüanofenüül)-1,4-dihüdro-2,6-dimetüülpüri diin-3,5-dikarboksülaat, selle enantiomeerid ja vaheühend, meetodid nimetatud ühendite valmistamiseks ja kasutamine |
| SE9600086D0 (sv) * | 1996-01-10 | 1996-01-10 | Astra Ab | New manufacturing process |
| CN106380405B (zh) * | 2016-08-24 | 2019-01-29 | 郑州瑞康制药有限公司 | 一种2-(3-硝基亚苄基)乙酰乙酸异丙酯的合成方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL77955C (enExample) * | 1948-11-17 | |||
| DE1670824C3 (de) * | 1967-03-20 | 1978-08-03 | Bayer Ag, 5090 Leverkusen | 1,4-Dihydropyridin-33-dicarbonsäurealkylester |
| DE1670827C3 (de) * | 1967-03-20 | 1974-10-24 | Bayer Ag, 5090 Leverkusen | 4-(2'-Nitrophenyl)-2,6-dimethyl-3,5-dicarbmethoxy-1,4-dihydropyridin |
| DE2117571C3 (de) * | 1971-04-10 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2218644C3 (de) * | 1972-04-18 | 1982-08-19 | Bayer Ag, 5090 Leverkusen | Basische Ester von 1,4-Dihydropyridinen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| US3996234A (en) * | 1972-04-18 | 1976-12-07 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
| JPS5649909B2 (enExample) | 1973-05-02 | 1981-11-25 |
-
1975
- 1975-02-26 DE DE19752508181 patent/DE2508181A1/de active Granted
- 1975-10-24 GB GB4376375A patent/GB1477114A/en not_active Expired
-
1976
- 1976-01-29 IN IN163/CAL/76A patent/IN142197B/en unknown
- 1976-02-02 US US05/654,278 patent/US4044141A/en not_active Expired - Lifetime
- 1976-02-04 CA CA245,000A patent/CA1069902A/en not_active Expired
- 1976-02-13 NO NO76760470A patent/NO146393C/no unknown
- 1976-02-20 CH CH214876A patent/CH622506A5/de not_active IP Right Cessation
- 1976-02-20 JP JP51017182A patent/JPS6025424B2/ja not_active Expired
- 1976-02-20 SU SU7602324514A patent/SU574150A3/ru active
- 1976-02-23 CS CS761175A patent/CS188994B2/cs unknown
- 1976-02-23 NL NL7601823A patent/NL7601823A/xx not_active Application Discontinuation
- 1976-02-24 PT PT64840A patent/PT64840B/pt unknown
- 1976-02-24 AT AT132976A patent/AT351024B/de not_active IP Right Cessation
- 1976-02-24 FI FI760475A patent/FI61483C/fi not_active IP Right Cessation
- 1976-02-24 LU LU74424A patent/LU74424A1/xx unknown
- 1976-02-24 IL IL7649095A patent/IL49095A/xx unknown
- 1976-02-24 DD DD191458A patent/DD125483A5/xx unknown
- 1976-02-25 IE IE369/76A patent/IE42643B1/en unknown
- 1976-02-25 DK DK78876*#A patent/DK78876A/da unknown
- 1976-02-25 ES ES445508A patent/ES445508A1/es not_active Expired
- 1976-02-25 RO RO7684916A patent/RO68479A/ro unknown
- 1976-02-25 ZA ZA761118A patent/ZA761118B/xx unknown
- 1976-02-25 PL PL1976187499A patent/PL100906B1/pl unknown
- 1976-02-25 BE BE164628A patent/BE838924A/xx unknown
- 1976-02-25 SE SE7602317A patent/SE7602317L/xx unknown
- 1976-02-25 HU HU76BA00003374A patent/HU171717B/hu not_active IP Right Cessation
- 1976-02-26 FR FR7605383A patent/FR2302093A1/fr active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI61483C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,-dihydropyridinkarboxylsyraaralkylestrar | |
| FI81090C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,4-dihydropyridiner och daervid anvaendbara mellanprodukter. | |
| DE3751978T2 (de) | Dihydropyridin-Derivate, ihre Herstellung und ihre Anwendung | |
| FI83954B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara asymmetriska 1,4-dihydro-2,6-dimetylpyridin-3,5 -dikarboxylsyraestrar. | |
| EP0176956B1 (de) | Neue Diarylverbindungen | |
| KR920005742B1 (ko) | 약제학상 유용한 디하이드로피리디닐디카르복실레이트 아마이드 및 에스테르의 제조방법 | |
| JPS6131100B2 (enExample) | ||
| HK1005727B (en) | Dihydropyridine derivatives, their preparation and their use | |
| AU642992B2 (en) | Use of N-alkylated 1, 4-dihydropyridinedicarboxylic acid esters as medicaments, new compounds and processes for their preparation | |
| US4894460A (en) | Basic esters exhibiting an antagonistic activity to calcium, process for the preparation thereof and pharmaceutical compositions therefrom | |
| PL94266B1 (enExample) | ||
| CA1175438A (en) | 1,4-dihydropyridine compounds having different substituents in the 2-position and 6-position, their production, and their medicinal use | |
| KR960009427B1 (ko) | 1,4-디히드로피리딘 유도체, 그의 약학적 조성물 및 그 제조방법 | |
| US4895846A (en) | Pharmaceutically useful dihydropyridinyldicarboxylate amides and esters incorporating arylpiperazinylalkyl moieties | |
| FI60704B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbar 2,6-dimetyl-3-metoxikarbonyl-4-(2'-nitrofenyl)-1,4-dihydropyridin-5-karboxylsyraisobutylester | |
| EP0234196A1 (de) | Substituierte 1,4-Dihydropyridin-3-carbonsäurepiperazide, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| Amini et al. | Synthesis and calcium channel antagonist activity of new 1, 4-dihydropyridine derivatives containing dichloroimidazolyl substituents | |
| US4994476A (en) | Dihydropyridin-3,5-dicarboxylates incorporating aryloxypropanolamine moieties | |
| FI60705C (fi) | Foerfarande foer framstaellning av 1,4-dihydro-2,6-dimetyl-4-(3-nitrofenyl)-3,5-pyridinkarboxylsyraisopropyl-(2-propoxi-etyl)-ester som anvaendes som perifer vasodilatator | |
| Shaflee et al. | Synthesis and calcium channel antagonist activity of 1, 4-dihydropyridine derivatives containing 4-nitroimidazolyl substituents | |
| JPH02169572A (ja) | ジヒドロピリジンアミド及びその生理学的に許容し得る塩 | |
| JPH0155268B2 (enExample) | ||
| FI80678C (fi) | Foerfarande foer framstaellning av en terapeutiskt anvaendbar ester av 1,4-dihydro-2,6-dimetyl-3-(alkoxi karbonyl eller elkoxialkoxikarbonyl)-4-substituerad fenyl)pyridin- 5-karboxylsyra. | |
| JPS61233666A (ja) | ジヒドロピリジン、その製造法及びこれを含有し心ぞう病又は高血圧を治療する製薬組成物 | |
| JPH0717645B2 (ja) | 新規な1,4―ジヒドロピリジン誘導体及びその塩並びにこれらの化合物を有効成分とする循環器系作用剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: BAYER AKTIENGESELLSCHAFT |