FI57398C - Foerfarande foer framstaellning av trombocyt aggregation foerhindrande (2,3-dihydroxi)propoxikinolin eller -isokinolinderivat - Google Patents
Foerfarande foer framstaellning av trombocyt aggregation foerhindrande (2,3-dihydroxi)propoxikinolin eller -isokinolinderivat Download PDFInfo
- Publication number
- FI57398C FI57398C FI3107/74A FI310774A FI57398C FI 57398 C FI57398 C FI 57398C FI 3107/74 A FI3107/74 A FI 3107/74A FI 310774 A FI310774 A FI 310774A FI 57398 C FI57398 C FI 57398C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- glycerol
- group
- optically active
- give
- Prior art date
Links
- 238000004220 aggregation Methods 0.000 title description 6
- 230000002776 aggregation Effects 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 38
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 25
- CQBPOPVKDNHISM-UHFFFAOYSA-N propane-1,2,3-triol;propan-2-one Chemical compound CC(C)=O.OCC(O)CO CQBPOPVKDNHISM-UHFFFAOYSA-N 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 11
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 11
- -1 p-toluenesulfonyl Chemical group 0.000 claims description 11
- 150000007514 bases Chemical class 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- DHGDNDUPFCKHED-UHFFFAOYSA-N 3-quinolin-2-yloxypropane-1,2-diol Chemical compound C1=CC=CC2=NC(OCC(O)CO)=CC=C21 DHGDNDUPFCKHED-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 230000003301 hydrolyzing effect Effects 0.000 claims description 5
- 229940127218 antiplatelet drug Drugs 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 2
- 101150065749 Churc1 gene Proteins 0.000 claims description 2
- 102100038239 Protein Churchill Human genes 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000004043 oxo group Chemical group O=* 0.000 claims description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 238000009472 formulation Methods 0.000 claims 2
- 125000002183 isoquinolinyl group Chemical class C1(=NC=CC2=CC=CC=C12)* 0.000 claims 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 230000033444 hydroxylation Effects 0.000 claims 1
- 238000005805 hydroxylation reaction Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 239000013078 crystal Substances 0.000 description 39
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 30
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 29
- 238000002844 melting Methods 0.000 description 29
- 230000008018 melting Effects 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000002904 solvent Substances 0.000 description 18
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 150000002314 glycerols Chemical class 0.000 description 11
- 210000004623 platelet-rich plasma Anatomy 0.000 description 10
- 102000008186 Collagen Human genes 0.000 description 9
- 108010035532 Collagen Proteins 0.000 description 9
- 229920001436 collagen Polymers 0.000 description 9
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 239000000370 acceptor Substances 0.000 description 8
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 8
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 8
- 229950006790 adenosine phosphate Drugs 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 238000009825 accumulation Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 5
- 241000283973 Oryctolagus cuniculus Species 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- UTTJAIFHRUAFED-UHFFFAOYSA-N 5-hydroxy-3,4-dihydro-2(1h)-quinolinone Chemical compound N1C(=O)CCC2=C1C=CC=C2O UTTJAIFHRUAFED-UHFFFAOYSA-N 0.000 description 4
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 4
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229960001138 acetylsalicylic acid Drugs 0.000 description 4
- 229960005305 adenosine Drugs 0.000 description 4
- 230000000702 anti-platelet effect Effects 0.000 description 4
- 239000003146 anticoagulant agent Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- FVXYRXMYPXVHNY-UHFFFAOYSA-N 3-propoxy-3,4-dihydro-1H-quinolin-2-one Chemical compound C(CC)OC1C(NC2=CC=CC=C2C1)=O FVXYRXMYPXVHNY-UHFFFAOYSA-N 0.000 description 3
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 150000002537 isoquinolines Chemical class 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 3
- ZXZKYYHTWHJHFT-UHFFFAOYSA-N quinoline-2,8-diol Chemical compound C1=CC(=O)NC2=C1C=CC=C2O ZXZKYYHTWHJHFT-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- WQGPPVFYCBHXQQ-UHFFFAOYSA-N 1-benzyl-5-(2,3-dihydroxypropoxy)-3,4-dihydroquinolin-2-one Chemical compound O=C1CCC=2C(OCC(O)CO)=CC=CC=2N1CC1=CC=CC=C1 WQGPPVFYCBHXQQ-UHFFFAOYSA-N 0.000 description 2
- SSZWWUDQMAHNAQ-UHFFFAOYSA-N 3-chloropropane-1,2-diol Chemical compound OCC(O)CCl SSZWWUDQMAHNAQ-UHFFFAOYSA-N 0.000 description 2
- FTOAOBMCPZCFFF-UHFFFAOYSA-N 5,5-diethylbarbituric acid Chemical compound CCC1(CC)C(=O)NC(=O)NC1=O FTOAOBMCPZCFFF-UHFFFAOYSA-N 0.000 description 2
- BUVAUGAWSZUBLI-UHFFFAOYSA-N 5-(2,3-dihydroxypropoxy)-1-ethyl-3,4-dihydroquinolin-2-one Chemical compound C1=CC=C2N(CC)C(=O)CCC2=C1OCC(O)CO BUVAUGAWSZUBLI-UHFFFAOYSA-N 0.000 description 2
- BCOFVTRDLVQWCP-UHFFFAOYSA-N 5-(2,3-dihydroxypropoxy)-1-methyl-3,4-dihydroquinolin-2-one Chemical compound C1=CC=C2N(C)C(=O)CCC2=C1OCC(O)CO BCOFVTRDLVQWCP-UHFFFAOYSA-N 0.000 description 2
- GADHFDBWFZZSRB-UHFFFAOYSA-N 6-(2,3-dihydroxypropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(OCC(O)CO)=CC=C21 GADHFDBWFZZSRB-UHFFFAOYSA-N 0.000 description 2
- LKLSFDWYIBUGNT-UHFFFAOYSA-N 7-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(O)=CC=C21 LKLSFDWYIBUGNT-UHFFFAOYSA-N 0.000 description 2
- UDKMDIKMJWOSJP-UHFFFAOYSA-N 8-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C=CC=C2O UDKMDIKMJWOSJP-UHFFFAOYSA-N 0.000 description 2
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002876 beta blocker Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- LFUJIPVWTMGYDG-UHFFFAOYSA-N isoquinoline-1,5-diol Chemical compound N1=CC=C2C(O)=CC=CC2=C1O LFUJIPVWTMGYDG-UHFFFAOYSA-N 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CJRDLWNEMZAWTC-UHFFFAOYSA-N 1-benzyl-5-hydroxy-3,4-dihydroquinolin-2-one Chemical compound O=C1CCC=2C(O)=CC=CC=2N1CC1=CC=CC=C1 CJRDLWNEMZAWTC-UHFFFAOYSA-N 0.000 description 1
- RLMKVSQXWVJYEO-UHFFFAOYSA-N 1-ethyl-5-hydroxy-3,4-dihydroquinolin-2-one Chemical compound C1=CC=C2N(CC)C(=O)CCC2=C1O RLMKVSQXWVJYEO-UHFFFAOYSA-N 0.000 description 1
- NJGLSXGFEIVCNM-UHFFFAOYSA-N 3,4,8-trihydroxy-1H-quinolin-2-one Chemical compound OC=1C=CC=C2C(=C(C(NC=12)=O)O)O NJGLSXGFEIVCNM-UHFFFAOYSA-N 0.000 description 1
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical group C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 description 1
- YWPMKTWUFVOFPL-UHFFFAOYSA-N 3,4-dihydro-2h-isoquinolin-1-one Chemical group C1=CC=C2C(=O)NCCC2=C1 YWPMKTWUFVOFPL-UHFFFAOYSA-N 0.000 description 1
- RFXGIRLHEACEHX-UHFFFAOYSA-N 3-quinolin-8-yloxypropane-1,2-diol Chemical compound C1=CN=C2C(OCC(O)CO)=CC=CC2=C1 RFXGIRLHEACEHX-UHFFFAOYSA-N 0.000 description 1
- LIKNJFBVHCKBOY-UHFFFAOYSA-N 5-(2,3-dihydroxypropoxy)-2h-isoquinolin-1-one Chemical compound C1=CNC(=O)C2=C1C(OCC(O)CO)=CC=C2 LIKNJFBVHCKBOY-UHFFFAOYSA-N 0.000 description 1
- PXWAZDGOXQPIGF-UHFFFAOYSA-N 5-hydroxy-1-methyl-3,4-dihydroquinolin-2-one Chemical compound C1=CC=C2N(C)C(=O)CCC2=C1O PXWAZDGOXQPIGF-UHFFFAOYSA-N 0.000 description 1
- XOXGLLQTNQBDKL-UHFFFAOYSA-N 5-hydroxyquinolin-2(1H)-one Chemical class N1C(=O)C=CC2=C1C=CC=C2O XOXGLLQTNQBDKL-UHFFFAOYSA-N 0.000 description 1
- 150000004332 5-hydroxyquinolines Chemical class 0.000 description 1
- 150000004333 6-hydroxyquinolines Chemical class 0.000 description 1
- DBSPUDKBNOZFMX-UHFFFAOYSA-N 7-hydroxyquinolin-2(1H)-one Chemical compound C1=CC(=O)NC2=CC(O)=CC=C21 DBSPUDKBNOZFMX-UHFFFAOYSA-N 0.000 description 1
- 150000004335 7-hydroxyquinolines Chemical class 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- PQQROSCVXRSNNB-UHFFFAOYSA-N 8-(2,3-dihydroxypropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C=CC=C2OCC(O)CO PQQROSCVXRSNNB-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- GXVQMSXDTPRITK-UHFFFAOYSA-N 8-hydroxy-3,4-dihydro-2h-isoquinolin-1-one Chemical compound C1CNC(=O)C2=C1C=CC=C2O GXVQMSXDTPRITK-UHFFFAOYSA-N 0.000 description 1
- 150000004325 8-hydroxyquinolines Chemical class 0.000 description 1
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical class O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 241001590997 Moolgarda engeli Species 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 229960002319 barbital Drugs 0.000 description 1
- 229940030611 beta-adrenergic blocking agent Drugs 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- MWEQTWJABOLLOS-UHFFFAOYSA-L disodium;[[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate;trihydrate Chemical compound O.O.O.[Na+].[Na+].C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP([O-])(=O)OP(O)([O-])=O)C(O)C1O MWEQTWJABOLLOS-UHFFFAOYSA-L 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000036267 drug metabolism Effects 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- AWJUIBRHMBBTKR-UHFFFAOYSA-N iso-quinoline Natural products C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 1
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical compound C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229940090181 propyl acetate Drugs 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- AQLYZDRHNHZHIS-UHFFFAOYSA-N quinoline-2,6-diol Chemical compound N1C(=O)C=CC2=CC(O)=CC=C21 AQLYZDRHNHZHIS-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/753—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups
- C07C49/755—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups a keto group being part of a condensed ring system with two or three rings, at least one ring being a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/24—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/18—Ethylenedioxybenzenes, not substituted on the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48120237A JPS5231873B2 (da) | 1973-10-24 | 1973-10-24 | |
| JP12023773 | 1973-10-24 | ||
| JP12099473 | 1973-10-26 | ||
| JP48120994A JPS5241272B2 (da) | 1973-10-26 | 1973-10-26 | |
| JP9098574A JPS5119774A (ja) | 1974-08-07 | 1974-08-07 | Kogakukatsuseiojusuru shinkinaguriseroorujudotaino seizohoho |
| JP9098674 | 1974-08-07 | ||
| JP49090986A JPS5119775A (en) | 1974-08-07 | 1974-08-07 | Kogakukatsuseiojusuru shinkinaguriseroorujudotaino seizohoho |
| JP9098574 | 1974-08-07 | ||
| JP11641974 | 1974-10-09 | ||
| JP49116419A JPS51125056A (en) | 1974-10-09 | 1974-10-09 | A process for preparing glycerol derivatives |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI310774A7 FI310774A7 (da) | 1975-04-25 |
| FI57398B FI57398B (fi) | 1980-04-30 |
| FI57398C true FI57398C (fi) | 1980-08-11 |
Family
ID=27525510
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI3107/74A FI57398C (fi) | 1973-10-24 | 1974-10-24 | Foerfarande foer framstaellning av trombocyt aggregation foerhindrande (2,3-dihydroxi)propoxikinolin eller -isokinolinderivat |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4065456A (da) |
| CA (1) | CA1047038A (da) |
| CH (1) | CH593939A5 (da) |
| DE (1) | DE2450658C2 (da) |
| DK (1) | DK147159C (da) |
| FI (1) | FI57398C (da) |
| FR (1) | FR2282869A1 (da) |
| GB (1) | GB1459559A (da) |
| NL (1) | NL179275C (da) |
| SE (1) | SE431451B (da) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2651581A1 (de) * | 1976-11-12 | 1978-05-18 | Merck Patent Gmbh | Chinolonderivate und verfahren zu ihrer herstellung |
| NZ187452A (en) * | 1977-06-10 | 1980-05-27 | Otsuka Pharma Co Ltd | N- substituted-aminocarbonylpropoxy-carbostyrils and their preparation |
| MTP848B (en) * | 1978-06-27 | 1980-06-24 | Hoechst Ag | Sulfonyl ureas process for their manufacture pharmaceutical preparation on the basis of there compounds and their use |
| US4291050A (en) * | 1979-06-21 | 1981-09-22 | Merck & Co., Inc. | 6,7-Disubstituted-2 or 2,2-substituted-5-substituted-1-indanones |
| US4473501A (en) * | 1981-05-04 | 1984-09-25 | G. D. Searle & Co. | Dihydro azino isoquinolines |
| US4794079A (en) * | 1984-03-27 | 1988-12-27 | Miles Inc. | Determination of hydrogen peroxide using fluorogenic dihydroquinolone and dihydrocoumarin indicators |
| US4558130A (en) * | 1984-03-27 | 1985-12-10 | Miles Laboratories, Inc. | Fluorogenic dihydroquinolone and dihydrocoumarin indicators for hydrogen peroxide |
| US5177075A (en) * | 1988-08-19 | 1993-01-05 | Warner-Lambert Company | Substituted dihydroisoquinolinones and related compounds as potentiators of the lethal effects of radiation and certain chemotherapeutic agents; selected compounds, analogs and process |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH67A (de) * | 1889-01-08 | Kapler C G W | Seitliche Abführung zur Ermöglichung zweier getrennter Mahlwege vermittelst dreier Walzen | |
| US2448767A (en) * | 1942-12-05 | 1948-09-07 | Mellon Inst Of Ind Res | Process of hydroxyethylation |
| US3424681A (en) * | 1965-11-03 | 1969-01-28 | Nalco Chemical Co | Corrosion inhibition |
| US3862951A (en) * | 1971-09-02 | 1975-01-28 | Syva Co | 2{40 Quinoldinyl glycerol compounds |
| DE2331223C2 (de) * | 1972-06-19 | 1984-11-22 | Kohjin Co., Ltd., Tokio / Tokyo | S-substituierte-2-Thioadenosine, deren 5'-Monophosphate, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten |
-
1974
- 1974-10-23 SE SE7413358A patent/SE431451B/xx not_active IP Right Cessation
- 1974-10-23 NL NLAANVRAGE7413858,A patent/NL179275C/xx not_active IP Right Cessation
- 1974-10-24 FR FR7435717A patent/FR2282869A1/fr active Granted
- 1974-10-24 DK DK558774A patent/DK147159C/da not_active IP Right Cessation
- 1974-10-24 CH CH1422474A patent/CH593939A5/xx not_active IP Right Cessation
- 1974-10-24 FI FI3107/74A patent/FI57398C/fi active
- 1974-10-24 CA CA212,169A patent/CA1047038A/en not_active Expired
- 1974-10-24 GB GB4611374A patent/GB1459559A/en not_active Expired
- 1974-10-24 DE DE2450658A patent/DE2450658C2/de not_active Expired
- 1974-10-24 US US05/517,730 patent/US4065456A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FI310774A7 (da) | 1975-04-25 |
| DK147159B (da) | 1984-04-30 |
| GB1459559A (en) | 1976-12-22 |
| NL7413858A (nl) | 1975-04-28 |
| CH593939A5 (da) | 1977-12-30 |
| FR2282869A1 (fr) | 1976-03-26 |
| NL179275C (nl) | 1986-08-18 |
| DE2450658C2 (de) | 1985-03-21 |
| DE2450658A1 (de) | 1975-05-07 |
| FR2282869B1 (da) | 1978-07-21 |
| SE431451B (sv) | 1984-02-06 |
| FI57398B (fi) | 1980-04-30 |
| NL179275B (nl) | 1986-03-17 |
| DK558774A (da) | 1975-07-07 |
| US4065456A (en) | 1977-12-27 |
| SE7413358L (da) | 1975-04-25 |
| CA1047038A (en) | 1979-01-23 |
| DK147159C (da) | 1984-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI82693B (fi) | Foerfarande foer framstaellning av som laekemedel anvaendbara substituerade kromanderivat av tiazolidin. | |
| FI58920B (fi) | Foerfarande foer framstaellning av blodkaerlsutvidgande (omega-1)-oxoalkyl-dialkylxantiner | |
| SU1597100A3 (ru) | Способ получени производных бензимидазола | |
| FI57398C (fi) | Foerfarande foer framstaellning av trombocyt aggregation foerhindrande (2,3-dihydroxi)propoxikinolin eller -isokinolinderivat | |
| KR100819575B1 (ko) | 플라본, 잔톤 및 쿠마린의 신규 유도체 | |
| HU211339A9 (en) | Antiatherosclerotic and antithrombotic 1-benzopyran-4-ones and 2-amino-1,3-benzoxazine-4-ones | |
| EP0456835A1 (en) | Quinazoline-3-alkanoic acid derivative, salt thereof, and production thereof | |
| US2500131A (en) | Di-nu-oxides of amino-substituted acridines and quinolines | |
| Metwally et al. | Structure–activity relationship investigation of methoxy substitution on anticancer pyrimido [4, 5-c] quinolin-1 (2 H)-ones | |
| JPS62126180A (ja) | 7−アシルベンゾオキサジノン及びその誘導体並びにそれらの製法及びそれらを含有する薬剤 | |
| Moshkin et al. | 1, 3-Dipolar cycloadditions of nonstabilised azomethine ylides at 3-substituted coumarins: Synthesis of 1-benzopyrano [3, 4-c] pyrrolidines | |
| SU428602A3 (ru) | Способ получения основпозамещенных производных 1 | |
| Bazanov et al. | Synthesis of Covalent Conjugates of Dichloroacetic Acid with Polyfunctional Compounds | |
| Rakhimov et al. | Syntheses Based on Triacanthine | |
| EP1555264A1 (en) | Five-membered heterocyclic compounds as inhibitors of SRC family protein kinase. | |
| Adams et al. | The structure of leucenol. I | |
| US6610738B2 (en) | N-disubstituted carbamoyloxy flavones | |
| US2823207A (en) | 4-hydroxymethyl- and 4-acetoxymethyl-2-methyl-delta 2-thiazolines and preparation thereof | |
| Buu-Hoï et al. | Carcinogenic nitrogen compounds. Part XVII. The synthesis of angular benzacridines | |
| Tikhomirov et al. | Heterocyclic analogs of 5, 12-naphthacene-quinone. 11*. A new method for preparing 4, 11-dimethoxyanthra [2, 3-b] furan-5, 10-dione | |
| Glibov et al. | Synthesis and Recyclization of Methylenebisflavonoids Based on Heterocyclic Analogs of Umbelliferone and Formononetin | |
| CN108467363B (zh) | 具有生物活性的苯并[h]喹啉取代希夫碱衍生物及其合成方法和应用 | |
| US3197478A (en) | 1, 3-diphenyl-2-benzoyl-imidazolidines and process | |
| Platonova et al. | Synthesis and Biological Activity of Azidomethyl Derivatives of Pyridoxine and 3-Hydroxypyridine | |
| Basyouni et al. | Synthesis and Antioxidant Activity of Some Thiazoles, Thiazolidinone, and Thiazolo [5, 4-d] pyrimidine Derivatives |