FI56378C - Foerfarande foer framstaellning av terapeutiskt aktiva 1-(4-bromfenyl)-1-pyridyl-3-dimetylamino-prop-1-enderivat - Google Patents
Foerfarande foer framstaellning av terapeutiskt aktiva 1-(4-bromfenyl)-1-pyridyl-3-dimetylamino-prop-1-enderivat Download PDFInfo
- Publication number
- FI56378C FI56378C FI858/72A FI85872A FI56378C FI 56378 C FI56378 C FI 56378C FI 858/72 A FI858/72 A FI 858/72A FI 85872 A FI85872 A FI 85872A FI 56378 C FI56378 C FI 56378C
- Authority
- FI
- Finland
- Prior art keywords
- pyridyl
- bromophenyl
- dimethylamino
- tyramine
- compound
- Prior art date
Links
- -1 4-BROMOPHENYL Chemical class 0.000 title claims description 24
- 230000001225 therapeutic effect Effects 0.000 title description 5
- 230000004913 activation Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 61
- 239000000203 mixture Substances 0.000 claims description 32
- 238000002360 preparation method Methods 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 238000009472 formulation Methods 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 5
- 101150065749 Churc1 gene Proteins 0.000 claims description 5
- 102100038239 Protein Churchill Human genes 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 68
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 48
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 239000000126 substance Substances 0.000 description 30
- 230000000694 effects Effects 0.000 description 29
- 230000001430 anti-depressive effect Effects 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 23
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 20
- 229960002748 norepinephrine Drugs 0.000 description 18
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- 210000004556 brain Anatomy 0.000 description 14
- ZPDWHORJHVKVPL-UHFFFAOYSA-N 5-(2-aminobutyl)-2-methylphenol Chemical compound CCC(N)CC1=CC=C(C)C(O)=C1 ZPDWHORJHVKVPL-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 12
- 239000000935 antidepressant agent Substances 0.000 description 12
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 11
- 239000004480 active ingredient Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- XWLXNPMITZDCHL-UHFFFAOYSA-N 5-(2-aminopropyl)-2-methylphenol Chemical compound CC(N)CC1=CC=C(C)C(O)=C1 XWLXNPMITZDCHL-UHFFFAOYSA-N 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 10
- 239000013543 active substance Substances 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- 239000007924 injection Substances 0.000 description 10
- 238000002347 injection Methods 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 9
- 229940005513 antidepressants Drugs 0.000 description 9
- 230000018044 dehydration Effects 0.000 description 9
- 238000006297 dehydration reaction Methods 0.000 description 9
- 229920001223 polyethylene glycol Polymers 0.000 description 9
- 239000002775 capsule Substances 0.000 description 8
- 229920000159 gelatin Polymers 0.000 description 8
- 235000019322 gelatine Nutrition 0.000 description 8
- 108010010803 Gelatin Proteins 0.000 description 7
- 239000008273 gelatin Substances 0.000 description 7
- 235000011852 gelatine desserts Nutrition 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 7
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- 229940123445 Tricyclic antidepressant Drugs 0.000 description 6
- 229960003914 desipramine Drugs 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- 238000010998 test method Methods 0.000 description 6
- 239000003029 tricyclic antidepressant agent Substances 0.000 description 6
- CXGURXWCQYHDIR-ULPVBNQHSA-N (z)-3-(4-bromophenyl)-n,n-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;dihydrochloride Chemical compound Cl.Cl.C=1C=CN=CC=1C(=C/CN(C)C)\C1=CC=C(Br)C=C1 CXGURXWCQYHDIR-ULPVBNQHSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000008107 starch Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000001993 wax Substances 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 230000001078 anti-cholinergic effect Effects 0.000 description 4
- 206010003119 arrhythmia Diseases 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 235000011187 glycerol Nutrition 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000013558 reference substance Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- GKSPIZSKQWTXQG-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 4-[1-(pyridin-2-yldisulfanyl)ethyl]benzoate Chemical compound C=1C=C(C(=O)ON2C(CCC2=O)=O)C=CC=1C(C)SSC1=CC=CC=N1 GKSPIZSKQWTXQG-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 229930195725 Mannitol Natural products 0.000 description 3
- PHVGLTMQBUFIQQ-UHFFFAOYSA-N Nortryptiline Chemical compound C1CC2=CC=CC=C2C(=CCCNC)C2=CC=CC=C21 PHVGLTMQBUFIQQ-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- 229960000836 amitriptyline Drugs 0.000 description 3
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 3
- 239000000739 antihistaminic agent Substances 0.000 description 3
- 230000002763 arrhythmic effect Effects 0.000 description 3
- 230000033228 biological regulation Effects 0.000 description 3
- 238000004061 bleaching Methods 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 229960000725 brompheniramine Drugs 0.000 description 3
- 230000000747 cardiac effect Effects 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000994 depressogenic effect Effects 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229960004801 imipramine Drugs 0.000 description 3
- 239000000411 inducer Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 239000000594 mannitol Substances 0.000 description 3
- 235000010355 mannitol Nutrition 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229960001158 nortriptyline Drugs 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229920001592 potato starch Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 229960004793 sucrose Drugs 0.000 description 3
- 229960003732 tyramine Drugs 0.000 description 3
- 208000003663 ventricular fibrillation Diseases 0.000 description 3
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 2
- MOWLUBGHVYJYTK-UHFFFAOYSA-N 3-(2-aminoethyl)indol-3-ol Chemical compound C1=CC=C2C(CCN)(O)C=NC2=C1 MOWLUBGHVYJYTK-UHFFFAOYSA-N 0.000 description 2
- NYPYPOZNGOXYSU-UHFFFAOYSA-N 3-bromopyridine Chemical compound BrC1=CC=CN=C1 NYPYPOZNGOXYSU-UHFFFAOYSA-N 0.000 description 2
- BSDGZUDFPKIYQG-UHFFFAOYSA-N 4-bromopyridine Chemical compound BrC1=CC=NC=C1 BSDGZUDFPKIYQG-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 229920000945 Amylopectin Polymers 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 230000001387 anti-histamine Effects 0.000 description 2
- 229940125715 antihistaminic agent Drugs 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- ZDIGNSYAACHWNL-UHFFFAOYSA-N brompheniramine Chemical compound C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Br)C=C1 ZDIGNSYAACHWNL-UHFFFAOYSA-N 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- JDOZOOBCADNBIJ-UHFFFAOYSA-N lithium;2h-pyridin-2-ide Chemical compound [Li+].C1=CC=N[C-]=C1 JDOZOOBCADNBIJ-UHFFFAOYSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- GBCKRQRXNXQQPW-UHFFFAOYSA-N n,n-dimethylprop-2-en-1-amine Chemical compound CN(C)CC=C GBCKRQRXNXQQPW-UHFFFAOYSA-N 0.000 description 2
- 239000005416 organic matter Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000002746 orthostatic effect Effects 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- 238000000611 regression analysis Methods 0.000 description 2
- 230000033764 rhythmic process Effects 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101500021172 Aplysia californica Myomodulin-C Proteins 0.000 description 1
- 241000238421 Arthropoda Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 101100506443 Danio rerio helt gene Proteins 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010061216 Infarction Diseases 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical group [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 101100506445 Mus musculus Helt gene Proteins 0.000 description 1
- SNIXRMIHFOIVBB-UHFFFAOYSA-N N-Hydroxyl-tryptamine Chemical compound C1=CC=C2C(CCNO)=CNC2=C1 SNIXRMIHFOIVBB-UHFFFAOYSA-N 0.000 description 1
- RYXPMWYHEBGTRV-UHFFFAOYSA-N Omeprazole sodium Chemical compound [Na+].N=1C2=CC(OC)=CC=C2[N-]C=1S(=O)CC1=NC=C(C)C(OC)=C1C RYXPMWYHEBGTRV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- DZGWFCGJZKJUFP-UHFFFAOYSA-N Tyramine Natural products NCCC1=CC=C(O)C=C1 DZGWFCGJZKJUFP-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- XKMRRTOUMJRJIA-UHFFFAOYSA-N ammonia nh3 Chemical compound N.N XKMRRTOUMJRJIA-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 230000003126 arrythmogenic effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000007012 clinical effect Effects 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000000881 depressing effect Effects 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000007574 infarction Effects 0.000 description 1
- 206010022000 influenza Diseases 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 150000002641 lithium Chemical group 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 229940057948 magnesium stearate Drugs 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910000372 mercury(II) sulfate Inorganic materials 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940100691 oral capsule Drugs 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 230000000399 orthopedic effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 230000001020 rhythmical effect Effects 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229940114926 stearate Drugs 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- DZGWFCGJZKJUFP-UHFFFAOYSA-O tyraminium Chemical compound [NH3+]CCC1=CC=C(O)C=C1 DZGWFCGJZKJUFP-UHFFFAOYSA-O 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI791621A FI60706C (fi) | 1971-04-28 | 1979-05-22 | Foerfarande foer framstaellning av terapeutiskt aktiva 1-fenyl-1-pyridyl-3-dimetylamino-prop-1-en-derivat |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE549671 | 1971-04-28 | ||
| SE05496/71A SE361663B (enExample) | 1971-04-28 | 1971-04-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI56378B FI56378B (fi) | 1979-09-28 |
| FI56378C true FI56378C (fi) | 1980-01-10 |
Family
ID=20266610
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI858/72A FI56378C (fi) | 1971-04-28 | 1972-03-28 | Foerfarande foer framstaellning av terapeutiskt aktiva 1-(4-bromfenyl)-1-pyridyl-3-dimetylamino-prop-1-enderivat |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS5512424B1 (enExample) |
| AT (1) | AT319242B (enExample) |
| AU (1) | AU469519B2 (enExample) |
| BE (1) | BE781105A (enExample) |
| BR (1) | BR7202598D0 (enExample) |
| CA (1) | CA974999A (enExample) |
| CH (1) | CH577474A5 (enExample) |
| CY (1) | CY876A (enExample) |
| DE (1) | DE2220333C3 (enExample) |
| DK (1) | DK138987B (enExample) |
| ES (1) | ES401908A1 (enExample) |
| FI (1) | FI56378C (enExample) |
| FR (1) | FR2134379B1 (enExample) |
| GB (1) | GB1366241A (enExample) |
| HK (1) | HK69576A (enExample) |
| IE (1) | IE36330B1 (enExample) |
| IT (1) | IT1188904B (enExample) |
| NL (1) | NL170731C (enExample) |
| NO (1) | NO135590C (enExample) |
| SE (1) | SE361663B (enExample) |
| SU (1) | SU422146A3 (enExample) |
| ZA (1) | ZA721503B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE409706B (sv) * | 1976-05-21 | 1979-09-03 | Astra Pharma Prod | Forfarande for framstellning av n,n-dimetyl-3-(4-bromfenyl)-3-3(3-pyridyl)-allylamin dihydroklorid monohydrat |
| SE7909514L (sv) | 1979-11-16 | 1981-05-17 | Astra Laekemedel Ab | Nya halofenyl-pyridyl-allylaminderivat |
| CA1327795C (en) * | 1987-08-14 | 1994-03-15 | Jules Freedman | Antidepressants which are aryloxy inadanamines |
| US5585388A (en) * | 1995-04-07 | 1996-12-17 | Sibia Neurosciences, Inc. | Substituted pyridines useful as modulators of acetylcholine receptors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2712020A (en) * | 1948-07-20 | 1955-06-28 | Burroughs Wellcome Co | Heterocyclic allylamines |
-
1971
- 1971-04-28 SE SE05496/71A patent/SE361663B/xx unknown
-
1972
- 1972-03-06 ZA ZA721503A patent/ZA721503B/xx unknown
- 1972-03-23 BE BE781105A patent/BE781105A/xx not_active IP Right Cessation
- 1972-03-28 FI FI858/72A patent/FI56378C/fi active
- 1972-04-05 NO NO1147/72A patent/NO135590C/no unknown
- 1972-04-10 AU AU40965/72A patent/AU469519B2/en not_active Expired
- 1972-04-12 FR FR7212835A patent/FR2134379B1/fr not_active Expired
- 1972-04-19 ES ES401908A patent/ES401908A1/es not_active Expired
- 1972-04-21 CH CH593872A patent/CH577474A5/xx not_active IP Right Cessation
- 1972-04-24 SU SU1777511A patent/SU422146A3/ru active
- 1972-04-24 AT AT357372A patent/AT319242B/de not_active IP Right Cessation
- 1972-04-26 DK DK205772AA patent/DK138987B/da unknown
- 1972-04-26 DE DE2220333A patent/DE2220333C3/de not_active Expired
- 1972-04-27 CA CA140,717A patent/CA974999A/en not_active Expired
- 1972-04-27 BR BR2598/72A patent/BR7202598D0/pt unknown
- 1972-04-27 GB GB1958872A patent/GB1366241A/en not_active Expired
- 1972-04-27 IE IE555/72A patent/IE36330B1/xx unknown
- 1972-04-27 CY CY876A patent/CY876A/xx unknown
- 1972-04-28 JP JP4602272A patent/JPS5512424B1/ja active Pending
- 1972-04-28 NL NLAANVRAGE7205850,A patent/NL170731C/xx not_active IP Right Cessation
-
1976
- 1976-11-04 HK HK695/76*UA patent/HK69576A/xx unknown
-
1980
- 1980-02-15 IT IT47915/80A patent/IT1188904B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5512424B1 (enExample) | 1980-04-02 |
| DK138987C (enExample) | 1979-05-14 |
| HK69576A (en) | 1976-11-12 |
| NL170731B (nl) | 1982-07-16 |
| GB1366241A (en) | 1974-09-11 |
| SU422146A3 (enExample) | 1974-03-30 |
| DE2220333B2 (de) | 1979-03-01 |
| ZA721503B (en) | 1972-11-29 |
| BR7202598D0 (pt) | 1973-07-17 |
| IT8047915A0 (it) | 1980-02-15 |
| IE36330B1 (en) | 1976-10-13 |
| IE36330L (en) | 1972-10-28 |
| FI56378B (fi) | 1979-09-28 |
| CY876A (en) | 1977-03-18 |
| IT8047915A1 (it) | 1981-08-15 |
| AU469519B2 (en) | 1972-10-18 |
| BE781105A (fr) | 1972-07-17 |
| CA974999A (en) | 1975-09-23 |
| ES401908A1 (es) | 1975-03-16 |
| DE2220333A1 (de) | 1974-01-31 |
| NL7205850A (enExample) | 1972-10-31 |
| CH577474A5 (enExample) | 1976-07-15 |
| NL170731C (nl) | 1982-12-16 |
| NO135590B (enExample) | 1977-01-17 |
| AU4096572A (en) | 1972-10-18 |
| SE361663B (enExample) | 1973-11-12 |
| DK138987B (da) | 1978-11-27 |
| AT319242B (de) | 1974-12-10 |
| FR2134379A1 (enExample) | 1972-12-08 |
| FR2134379B1 (enExample) | 1976-09-17 |
| IT1188904B (it) | 1988-01-28 |
| DE2220333C3 (de) | 1979-11-22 |
| NO135590C (enExample) | 1977-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2022203486B2 (en) | Salt of an aminopyridine derivative compound, a crystalline form thereof, and a process for preparing the same | |
| AU2017298421B2 (en) | Substituted diazahetero-bicyclic compounds and their use | |
| CZ224195A3 (en) | The use of pyrrolopyridine derivatives for preparing pharmaceutical preparations | |
| WO2001083481A1 (en) | Imidazopyridine derivatives | |
| JPWO1999020620A1 (ja) | イソキノリン誘導体及び医薬 | |
| PL113208B1 (en) | Process for preparing novel phthalazine derivatives | |
| DK148795B (da) | Anologifremgangsmaade til fremstilling af 3-(2-morpholino-ethyl-amino)-5-phenyl-pyridazin eller farmaceutisk acceptable syreadditionssalte deraf | |
| KR910005708B1 (ko) | 1,5-벤조티아제핀 유도체의 제조방법 | |
| CN113831338A (zh) | 一种组蛋白去乙酰化酶抑制剂及其制备方法和应用 | |
| FI56378C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 1-(4-bromfenyl)-1-pyridyl-3-dimetylamino-prop-1-enderivat | |
| NO179515B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive 3,4-dihydroisokinolinderivater | |
| HU193523B (en) | Process for preparing 2-/2'-hydroxy-3'-/1,1-dimethyl-propyl-amino /-propoxy/-beta-phenyl-propiophenone | |
| JP5486008B2 (ja) | 1‐ブチル‐2‐ヒドロキシアラルキルピペラジン誘導体およびその抗鬱剤としての使用 | |
| JP6463874B2 (ja) | 医学的適用用の3−(1,2,4−トリアゾロ[4,3−a]ピリジン−3−イルエチニル)−4−メチル−N−(4−((4−メチルピペラジン−1−イル)メチル)−3−トリフルオロメチルフェニル)ベンズアミドの新規な結晶性塩形態 | |
| CZ321095A3 (en) | Heterocyclic compounds | |
| Stepanovs et al. | Preparation and crystal structure of sildenafil salicylate | |
| FI61484C (fi) | Foerfarande foer framstaellning av z-3-(4-bromfenyl)-n-metyl-3-(3-pyridyl)-allylamin med antidepressiv och aongestdaempande verkan | |
| CN106795148A (zh) | 1,4‑苯并硫氮杂*‑1‑氧化物衍生物的光学异构体及使用它的医药组合物 | |
| FI60706C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 1-fenyl-1-pyridyl-3-dimetylamino-prop-1-en-derivat | |
| WO2011065905A1 (en) | Solid forms of 4-{(r)-(3-aminophenyl)[4-(4-fluorobenzyl)-piperazin-1-yl]methyl}-n,n-diethylbenzamide, compositions thereof, and uses therewith | |
| AU2017341020A2 (en) | Urea derivative | |
| JPH0259126B2 (enExample) | ||
| TWI909563B (zh) | 一種化合物、及其藥物組合物和應用 | |
| JPH0346472B2 (enExample) | ||
| ES2672326T3 (es) | Analogos de tiazolidinona deuterados como agonistas para el receptor de la hormona folículo estimulante |