EA038164B1 - 3-замещенные пропановые кислоты в качестве ингибиторов интегрина v - Google Patents
3-замещенные пропановые кислоты в качестве ингибиторов интегрина v Download PDFInfo
- Publication number
- EA038164B1 EA038164B1 EA201991122A EA201991122A EA038164B1 EA 038164 B1 EA038164 B1 EA 038164B1 EA 201991122 A EA201991122 A EA 201991122A EA 201991122 A EA201991122 A EA 201991122A EA 038164 B1 EA038164 B1 EA 038164B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- tetrahydro
- propanoic acid
- propyl
- naphthyridin
- mmol
- Prior art date
Links
- 102000006495 integrins Human genes 0.000 title claims abstract description 27
- 108010044426 integrins Proteins 0.000 title claims abstract description 27
- -1 3-substituted propionic acids Chemical class 0.000 title claims description 355
- 239000003112 inhibitor Substances 0.000 title description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 194
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 59
- 208000035475 disorder Diseases 0.000 claims abstract description 37
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 22
- 201000010099 disease Diseases 0.000 claims abstract description 21
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 19
- 206010016654 Fibrosis Diseases 0.000 claims abstract description 16
- 230000004761 fibrosis Effects 0.000 claims abstract description 16
- 201000011510 cancer Diseases 0.000 claims abstract description 13
- 208000027866 inflammatory disease Diseases 0.000 claims abstract description 9
- 230000001575 pathological effect Effects 0.000 claims abstract description 6
- 230000008482 dysregulation Effects 0.000 claims abstract description 5
- 208000001132 Osteoporosis Diseases 0.000 claims abstract description 3
- 206010052779 Transplant rejections Diseases 0.000 claims abstract 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 151
- 235000019260 propionic acid Nutrition 0.000 claims description 132
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 claims description 118
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 85
- 229910052739 hydrogen Inorganic materials 0.000 claims description 49
- 150000003839 salts Chemical class 0.000 claims description 46
- 125000000217 alkyl group Chemical group 0.000 claims description 36
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 30
- 239000001257 hydrogen Substances 0.000 claims description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 22
- 125000004321 azepin-2-yl group Chemical group [H]N1C([H])=C([H])C([H])=C([H])C([H])=C1* 0.000 claims description 20
- 208000008338 non-alcoholic fatty liver disease Diseases 0.000 claims description 19
- 208000036971 interstitial lung disease 2 Diseases 0.000 claims description 14
- 201000009794 Idiopathic Pulmonary Fibrosis Diseases 0.000 claims description 13
- 206010053219 non-alcoholic steatohepatitis Diseases 0.000 claims description 11
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 10
- 239000010802 sludge Substances 0.000 claims description 10
- 210000004185 liver Anatomy 0.000 claims description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 201000009594 Systemic Scleroderma Diseases 0.000 claims description 6
- 206010042953 Systemic sclerosis Diseases 0.000 claims description 6
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical class CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 210000004072 lung Anatomy 0.000 claims description 5
- 125000004353 pyrazol-1-yl group Chemical group [H]C1=NN(*)C([H])=C1[H] 0.000 claims description 5
- 208000007342 Diabetic Nephropathies Diseases 0.000 claims description 4
- 210000001072 colon Anatomy 0.000 claims description 4
- 208000033679 diabetic kidney disease Diseases 0.000 claims description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- 210000003734 kidney Anatomy 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 210000000496 pancreas Anatomy 0.000 claims description 4
- 210000003491 skin Anatomy 0.000 claims description 4
- CGNMIYRIWLHATI-QHCPKHFHSA-N (3S)-3-[1-(cyclopropylmethyl)-6-oxopyridin-3-yl]-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)C[C@H](N1C=CC(CCCC2=CC=C3CCCNC3=N2)=N1)C1=CN(CC2CC2)C(=O)C=C1 CGNMIYRIWLHATI-QHCPKHFHSA-N 0.000 claims description 3
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 3
- WETNDFFONPZIGS-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-3-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)C(CC(O)=O)C1=NN(CCCC2=CC=C3CCCNC3=N2)C=C1 WETNDFFONPZIGS-UHFFFAOYSA-N 0.000 claims description 3
- VXWFWYADNINHES-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound C1CNC2=C(C=CC(=N2)CCCC2=NN(C=C2)C(CC(=O)O)C2=CC=C(OC)N=C2)C1 VXWFWYADNINHES-UHFFFAOYSA-N 0.000 claims description 3
- PDJKPMYZSAIHDN-UHFFFAOYSA-N CC(C(O)=O)C1=NC(CCCCC2=NC(NCCC3)=C3C=C2)=CS1 Chemical compound CC(C(O)=O)C1=NC(CCCCC2=NC(NCCC3)=C3C=C2)=CS1 PDJKPMYZSAIHDN-UHFFFAOYSA-N 0.000 claims description 3
- 210000004369 blood Anatomy 0.000 claims description 3
- 239000008280 blood Substances 0.000 claims description 3
- 210000002784 stomach Anatomy 0.000 claims description 3
- ZKJMYZGFBDUOAC-HXUWFJFHSA-N (3R)-3-(2-methylpyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound Cc1ncc(cn1)[C@@H](CC(O)=O)n1ccc(CCCc2ccc3CCCNc3n2)n1 ZKJMYZGFBDUOAC-HXUWFJFHSA-N 0.000 claims description 2
- IABHYNPYOQIKNL-HXUWFJFHSA-N (3R)-3-(6-methoxypyridin-3-yl)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]propanoic acid Chemical compound COc1ccc(cn1)[C@@H](CC(O)=O)c1cnn(CCCc2ccc3CCCNc3n2)c1 IABHYNPYOQIKNL-HXUWFJFHSA-N 0.000 claims description 2
- VUCPJDQRPNKODR-IBGZPJMESA-N (3S)-3-(6-oxo-1H-pyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)C[C@@H](c1ccc(=O)[nH]c1)n1ccc(CCCc2ccc3CCCNc3n2)n1 VUCPJDQRPNKODR-IBGZPJMESA-N 0.000 claims description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- UBYJRGAFVQXRIU-UHFFFAOYSA-N 3-(2-methoxypyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COc1ncc(cn1)C(CC(O)=O)n1ccc(CCCc2ccc3CCCNc3n2)n1 UBYJRGAFVQXRIU-UHFFFAOYSA-N 0.000 claims description 2
- JUEJISWKTFLIGZ-KKFHFHRHSA-N 3-(2-methoxypyrimidin-5-yl)-3-[5-[3-[(2S)-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]propyl]pyrazol-1-yl]propanoic acid Chemical compound COc1ncc(cn1)C(CC(O)=O)n1nccc1CCC[C@H]1CCc2cccnc2N1 JUEJISWKTFLIGZ-KKFHFHRHSA-N 0.000 claims description 2
- ZKJMYZGFBDUOAC-UHFFFAOYSA-N 3-(2-methylpyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound Cc1ncc(cn1)C(CC(O)=O)n1ccc(CCCc2ccc3CCCNc3n2)n1 ZKJMYZGFBDUOAC-UHFFFAOYSA-N 0.000 claims description 2
- GTSPHCCFRVTHLR-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]pyrazol-4-yl]propanoic acid Chemical compound N1(C=C(C(C2=CN=C(OC)C=C2)CC(=O)O)C=N1)CCCCC1=CC=C2CCCNC2=N1 GTSPHCCFRVTHLR-UHFFFAOYSA-N 0.000 claims description 2
- RNBMPWCNANEMEQ-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)phenyl]pyrazol-1-yl]propanoic acid Chemical compound COc1ccc(cn1)C(CC(O)=O)n1ccc(n1)-c1cccc(c1)-c1ccc2CCCNc2n1 RNBMPWCNANEMEQ-UHFFFAOYSA-N 0.000 claims description 2
- SQWANXBQZBKBBP-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]pyrazol-1-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)C(CC(O)=O)N1C=CC(OCCCC2=CC=C3CCCNC3=N2)=N1 SQWANXBQZBKBBP-UHFFFAOYSA-N 0.000 claims description 2
- VZKVXHYXNXGQDU-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]pyrazol-1-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)C(CC(=O)O)N1N=C(C=C1)CCCCC1=NC=2NCCCC=2C=C1 VZKVXHYXNXGQDU-UHFFFAOYSA-N 0.000 claims description 2
- 210000000988 bone and bone Anatomy 0.000 claims description 2
- 210000004556 brain Anatomy 0.000 claims description 2
- 210000000481 breast Anatomy 0.000 claims description 2
- 210000003169 central nervous system Anatomy 0.000 claims description 2
- 210000003679 cervix uteri Anatomy 0.000 claims description 2
- 210000004696 endometrium Anatomy 0.000 claims description 2
- 210000003238 esophagus Anatomy 0.000 claims description 2
- 210000001508 eye Anatomy 0.000 claims description 2
- 210000000232 gallbladder Anatomy 0.000 claims description 2
- 210000004392 genitalia Anatomy 0.000 claims description 2
- 210000003128 head Anatomy 0.000 claims description 2
- 210000002216 heart Anatomy 0.000 claims description 2
- 210000000867 larynx Anatomy 0.000 claims description 2
- 210000002200 mouth mucosa Anatomy 0.000 claims description 2
- 210000003205 muscle Anatomy 0.000 claims description 2
- 210000002850 nasal mucosa Anatomy 0.000 claims description 2
- 210000003739 neck Anatomy 0.000 claims description 2
- 210000001672 ovary Anatomy 0.000 claims description 2
- 210000002307 prostate Anatomy 0.000 claims description 2
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 claims description 2
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 claims description 2
- 210000000813 small intestine Anatomy 0.000 claims description 2
- 210000000952 spleen Anatomy 0.000 claims description 2
- 210000001550 testis Anatomy 0.000 claims description 2
- 210000001685 thyroid gland Anatomy 0.000 claims description 2
- 210000001635 urinary tract Anatomy 0.000 claims description 2
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 claims 3
- LUNGOZZVVOHVRP-PKOBYXMFSA-N COC1=CC=C(C=N1)[C@@H](CC(=O)O)C=1SC=C(N=1)CCC[C@@H]1NC2=NC=CC=C2CC1 Chemical compound COC1=CC=C(C=N1)[C@@H](CC(=O)O)C=1SC=C(N=1)CCC[C@@H]1NC2=NC=CC=C2CC1 LUNGOZZVVOHVRP-PKOBYXMFSA-N 0.000 claims 2
- LUNGOZZVVOHVRP-IEBWSBKVSA-N COC1=CC=C(C=N1)[C@@H](CC(=O)O)C=1SC=C(N=1)CCC[C@H]1NC2=NC=CC=C2CC1 Chemical compound COC1=CC=C(C=N1)[C@@H](CC(=O)O)C=1SC=C(N=1)CCC[C@H]1NC2=NC=CC=C2CC1 LUNGOZZVVOHVRP-IEBWSBKVSA-N 0.000 claims 2
- LUNGOZZVVOHVRP-HKUYNNGSSA-N COC1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCC[C@@H]1NC2=NC=CC=C2CC1 Chemical compound COC1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCC[C@@H]1NC2=NC=CC=C2CC1 LUNGOZZVVOHVRP-HKUYNNGSSA-N 0.000 claims 2
- LUNGOZZVVOHVRP-MJGOQNOKSA-N COC1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCC[C@H]1NC2=NC=CC=C2CC1 Chemical compound COC1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCC[C@H]1NC2=NC=CC=C2CC1 LUNGOZZVVOHVRP-MJGOQNOKSA-N 0.000 claims 2
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- JEWVDLUACRWTEW-HXUWFJFHSA-N (3R)-3-(2-ethoxypyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound CCOC1=NC=C(C=N1)[C@@H](CC(O)=O)N1C=CC(CCCC2=CC=C3CCCNC3=N2)=N1 JEWVDLUACRWTEW-HXUWFJFHSA-N 0.000 claims 1
- QMBVMQULMAFHDB-HXUWFJFHSA-N (3R)-3-(2-ethoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CCOC1=NC=C(C=N1)[C@@H](CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 QMBVMQULMAFHDB-HXUWFJFHSA-N 0.000 claims 1
- UBYJRGAFVQXRIU-LJQANCHMSA-N (3R)-3-(2-methoxypyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COc1ncc(cn1)[C@@H](CC(O)=O)n1ccc(CCCc2ccc3CCCNc3n2)n1 UBYJRGAFVQXRIU-LJQANCHMSA-N 0.000 claims 1
- CBEDCDMHOQWJRM-HXUWFJFHSA-N (3R)-3-(2-methoxypyrimidin-5-yl)-3-[3-[3-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COC1=NC=C(C=N1)[C@@H](CC(=O)O)N1N=C(C=C1)CCCC=1C=CC2=C(NCCCC2)N=1 CBEDCDMHOQWJRM-HXUWFJFHSA-N 0.000 claims 1
- IFPMYGLSHXXRFZ-LJQANCHMSA-N (3R)-3-(2-methoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=NC=C(C=N1)[C@@H](CC(=O)O)C=1SC=C(N=1)CCCCC1=NC=2NCCCC=2C=C1 IFPMYGLSHXXRFZ-LJQANCHMSA-N 0.000 claims 1
- BCBRXDHPNAOLSW-LJQANCHMSA-N (3R)-3-(2-methylpyrimidin-5-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound Cc1ncc(cn1)[C@@H](CC(O)=O)c1nc(CCCc2ccc3CCCNc3n2)cs1 BCBRXDHPNAOLSW-LJQANCHMSA-N 0.000 claims 1
- HVDGUXVTAKZNCH-LJQANCHMSA-N (3R)-3-(3,5-dimethylpyrazol-1-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CC1=NN(C(=C1)C)[C@H](CC(=O)O)C=1SC=C(N=1)CCCC1=NC=2NCCCC=2C=C1 HVDGUXVTAKZNCH-LJQANCHMSA-N 0.000 claims 1
- IRRAOOUFBQNPFO-GOSISDBHSA-N (3R)-3-(3-fluoro-4-methoxyphenyl)-3-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]propanoic acid Chemical compound COC1=C(F)C=C(C=C1)[C@@H](CC(O)=O)C1=CSC(CCCC2=CC=C3CCCNC3=N2)=N1 IRRAOOUFBQNPFO-GOSISDBHSA-N 0.000 claims 1
- LVZQWYRNDVVBAH-RUZDIDTESA-N (3R)-3-(3-morpholin-4-ylphenyl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound OC(=O)C[C@@H](C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1)C1=CC(=CC=C1)N1CCOCC1 LVZQWYRNDVVBAH-RUZDIDTESA-N 0.000 claims 1
- REHWTMUCNPCVOK-HXUWFJFHSA-N (3R)-3-(5-methylpyridin-3-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CC1=CN=CC(=C1)[C@@H](CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 REHWTMUCNPCVOK-HXUWFJFHSA-N 0.000 claims 1
- VXWFWYADNINHES-HXUWFJFHSA-N (3R)-3-(6-methoxypyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)[C@@H](CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC=2C=C1 VXWFWYADNINHES-HXUWFJFHSA-N 0.000 claims 1
- WWVUBEGMDOTPPR-LJQANCHMSA-N (3R)-3-(6-methoxypyridin-3-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COc1ccc(cn1)[C@@H](CC(O)=O)c1nc(CCCc2ccc3CCCNc3n2)cs1 WWVUBEGMDOTPPR-LJQANCHMSA-N 0.000 claims 1
- CGAASNMVFHAXRP-HXUWFJFHSA-N (3R)-3-(6-methoxypyridin-3-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)[C@@H](CC(=O)O)C=1SC=C(N=1)CCCCC1=NC=2NCCCC=2C=C1 CGAASNMVFHAXRP-HXUWFJFHSA-N 0.000 claims 1
- SXFILBGBIGGRAC-LJQANCHMSA-N (3R)-3-(6-methoxypyridin-3-yl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COc1ccc(cn1)[C@@H](CC(O)=O)c1ncc(CCCc2ccc3CCCNc3n2)s1 SXFILBGBIGGRAC-LJQANCHMSA-N 0.000 claims 1
- GUDIIKKLVLPESU-HSZRJFAPSA-N (3R)-3-[3-(dimethylcarbamoyl)phenyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)C1=CC=CC(=C1)[C@@H](CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 GUDIIKKLVLPESU-HSZRJFAPSA-N 0.000 claims 1
- AABSHUYBOADMEL-OAQYLSRUSA-N (3R)-3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)C1=C(F)C=C(C=C1)[C@@H](CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 AABSHUYBOADMEL-OAQYLSRUSA-N 0.000 claims 1
- JKZIDGVTCMWTAT-JOCHJYFZSA-N (3R)-3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)C1=C(F)C=C(C=C1)[C@@H](CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 JKZIDGVTCMWTAT-JOCHJYFZSA-N 0.000 claims 1
- VSDHMCYRFWUCLN-HSZRJFAPSA-N (3R)-3-[4-(dimethylcarbamoyl)phenyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)C1=CC=C(C=C1)[C@@H](CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 VSDHMCYRFWUCLN-HSZRJFAPSA-N 0.000 claims 1
- PMFSDJYOISLEPP-HXUWFJFHSA-N (3R)-3-[6-(dimethylamino)pyridin-3-yl]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C1=CC=C(C=N1)[C@@H](CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 PMFSDJYOISLEPP-HXUWFJFHSA-N 0.000 claims 1
- CNBKWJCVGKLONT-FQEVSTJZSA-N (3S)-3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)C[C@@H](c1cnc2OCCOc2c1)n1ccc(CCCc2ccc3CCCNc3n2)n1 CNBKWJCVGKLONT-FQEVSTJZSA-N 0.000 claims 1
- JEWVDLUACRWTEW-FQEVSTJZSA-N (3S)-3-(2-ethoxypyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound CCOc1ncc(cn1)[C@H](CC(O)=O)n1ccc(CCCc2ccc3CCCNc3n2)n1 JEWVDLUACRWTEW-FQEVSTJZSA-N 0.000 claims 1
- QMBVMQULMAFHDB-FQEVSTJZSA-N (3S)-3-(2-ethoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound C(C)OC1=NC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCCCC1=NC=2NCCCC=2C=C1 QMBVMQULMAFHDB-FQEVSTJZSA-N 0.000 claims 1
- YGUFEJBKMLSYAH-MJGOQNOKSA-N (3S)-3-(2-methoxypyrimidin-5-yl)-3-[3-[3-[(2R)-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]propyl]pyrazol-1-yl]propanoic acid Chemical compound COC1=NC=C(C=N1)[C@H](CC(=O)O)N1N=C(C=C1)CCC[C@H]1NC2=NC=CC=C2CC1 YGUFEJBKMLSYAH-MJGOQNOKSA-N 0.000 claims 1
- DAJVJLDTALOMRU-SFHVURJKSA-N (3S)-3-(2-methoxypyrimidin-5-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COc1ncc(cn1)[C@H](CC(O)=O)c1nc(CCCc2ccc3CCCNc3n2)cs1 DAJVJLDTALOMRU-SFHVURJKSA-N 0.000 claims 1
- IFPMYGLSHXXRFZ-IBGZPJMESA-N (3S)-3-(2-methoxypyrimidin-5-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=NC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCCCC1=NC=2NCCCC=2C=C1 IFPMYGLSHXXRFZ-IBGZPJMESA-N 0.000 claims 1
- ZKJMYZGFBDUOAC-FQEVSTJZSA-N (3S)-3-(2-methylpyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound CC1=NC=C(C=N1)[C@H](CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC=2C=C1 ZKJMYZGFBDUOAC-FQEVSTJZSA-N 0.000 claims 1
- BCBRXDHPNAOLSW-IBGZPJMESA-N (3S)-3-(2-methylpyrimidin-5-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CC1=NC=C(C=N1)[C@H](CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 BCBRXDHPNAOLSW-IBGZPJMESA-N 0.000 claims 1
- HVDGUXVTAKZNCH-IBGZPJMESA-N (3S)-3-(3,5-dimethylpyrazol-1-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CC1=NN([C@@H](CC(O)=O)C2=NC(CCCC3=CC=C4CCCNC4=N3)=CS2)C(C)=C1 HVDGUXVTAKZNCH-IBGZPJMESA-N 0.000 claims 1
- IRRAOOUFBQNPFO-SFHVURJKSA-N (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]propanoic acid Chemical compound COC1=C(F)C=C(C=C1)[C@H](CC(O)=O)C1=CSC(CCCC2=CC=C3CCCNC3=N2)=N1 IRRAOOUFBQNPFO-SFHVURJKSA-N 0.000 claims 1
- ZDRWXUHIAQJLBM-IBGZPJMESA-N (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=C(F)C=C(C=C1)[C@H](CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 ZDRWXUHIAQJLBM-IBGZPJMESA-N 0.000 claims 1
- YXDUBNYLAAIZFB-FQEVSTJZSA-N (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=C(F)C=C(C=C1)[C@H](CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 YXDUBNYLAAIZFB-FQEVSTJZSA-N 0.000 claims 1
- QMQQAYAICVRTEQ-IBGZPJMESA-N (3S)-3-(3-fluoro-4-methoxyphenyl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=C(F)C=C(C=C1)[C@H](CC(O)=O)C1=NC=C(CCCC2=CC=C3CCCNC3=N2)S1 QMQQAYAICVRTEQ-IBGZPJMESA-N 0.000 claims 1
- LVZQWYRNDVVBAH-VWLOTQADSA-N (3S)-3-(3-morpholin-4-ylphenyl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound OC(=O)C[C@H](c1nc(CCCCc2ccc3CCCNc3n2)cs1)c1cccc(c1)N1CCOCC1 LVZQWYRNDVVBAH-VWLOTQADSA-N 0.000 claims 1
- DDEPDVDAXZTTNI-NRFANRHFSA-N (3S)-3-(5-methylpyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound CC=1C=C(C=NC=1)[C@H](CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC=2C=C1 DDEPDVDAXZTTNI-NRFANRHFSA-N 0.000 claims 1
- IABHYNPYOQIKNL-FQEVSTJZSA-N (3S)-3-(6-methoxypyridin-3-yl)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]propanoic acid Chemical compound COc1ccc(cn1)[C@H](CC(O)=O)c1cnn(CCCc2ccc3CCCNc3n2)c1 IABHYNPYOQIKNL-FQEVSTJZSA-N 0.000 claims 1
- VXWFWYADNINHES-FQEVSTJZSA-N (3S)-3-(6-methoxypyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COc1ccc(cn1)[C@H](CC(O)=O)n1ccc(CCCc2ccc3CCCNc3n2)n1 VXWFWYADNINHES-FQEVSTJZSA-N 0.000 claims 1
- WWVUBEGMDOTPPR-IBGZPJMESA-N (3S)-3-(6-methoxypyridin-3-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)[C@H](CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 WWVUBEGMDOTPPR-IBGZPJMESA-N 0.000 claims 1
- CGAASNMVFHAXRP-FQEVSTJZSA-N (3S)-3-(6-methoxypyridin-3-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCCCC1=NC=2NCCCC=2C=C1 CGAASNMVFHAXRP-FQEVSTJZSA-N 0.000 claims 1
- SXFILBGBIGGRAC-IBGZPJMESA-N (3S)-3-(6-methoxypyridin-3-yl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC(=CN=1)CCCC1=NC=2NCCCC=2C=C1 SXFILBGBIGGRAC-IBGZPJMESA-N 0.000 claims 1
- KWQAOJZTPSJWFI-FQEVSTJZSA-N (3S)-3-(6-methoxypyridin-3-yl)-3-[5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC(=CN=1)CCCCC1=NC=2NCCCC=2C=C1 KWQAOJZTPSJWFI-FQEVSTJZSA-N 0.000 claims 1
- GUDIIKKLVLPESU-QHCPKHFHSA-N (3S)-3-[3-(dimethylcarbamoyl)phenyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)C1=CC=CC(=C1)[C@H](CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 GUDIIKKLVLPESU-QHCPKHFHSA-N 0.000 claims 1
- AABSHUYBOADMEL-NRFANRHFSA-N (3S)-3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)C1=C(F)C=C(C=C1)[C@H](CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 AABSHUYBOADMEL-NRFANRHFSA-N 0.000 claims 1
- JKZIDGVTCMWTAT-QFIPXVFZSA-N (3S)-3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)C1=C(F)C=C(C=C1)[C@H](CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 JKZIDGVTCMWTAT-QFIPXVFZSA-N 0.000 claims 1
- PMFSDJYOISLEPP-FQEVSTJZSA-N (3S)-3-[6-(dimethylamino)pyridin-3-yl]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C1=CC=C(C=N1)[C@H](CC(=O)O)C=1SC=C(N=1)CCCC1=NC=2NCCCC=2C=C1)C PMFSDJYOISLEPP-FQEVSTJZSA-N 0.000 claims 1
- CNBKWJCVGKLONT-UHFFFAOYSA-N 3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)CC(c1cnc2OCCOc2c1)n1ccc(CCCc2ccc3CCCNc3n2)n1 CNBKWJCVGKLONT-UHFFFAOYSA-N 0.000 claims 1
- JUEJISWKTFLIGZ-DUSLRRAJSA-N 3-(2-methoxypyrimidin-5-yl)-3-[5-[3-[(2R)-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]propyl]pyrazol-1-yl]propanoic acid Chemical compound COC1=NC=C(C=N1)C(CC(=O)O)N1N=CC=C1CCC[C@H]1NC2=NC=CC=C2CC1 JUEJISWKTFLIGZ-DUSLRRAJSA-N 0.000 claims 1
- BCBRXDHPNAOLSW-UHFFFAOYSA-N 3-(2-methylpyrimidin-5-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CC1=NC=C(C=N1)C(CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 BCBRXDHPNAOLSW-UHFFFAOYSA-N 0.000 claims 1
- PBWFOTQLLPUBFH-QSVWIEALSA-N 3-(2-methylpyrimidin-5-yl)-3-[5-[3-[(2R)-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]propyl]pyrazol-1-yl]propanoic acid Chemical compound Cc1ncc(cn1)C(CC(O)=O)n1nccc1CCC[C@@H]1CCc2cccnc2N1 PBWFOTQLLPUBFH-QSVWIEALSA-N 0.000 claims 1
- PBWFOTQLLPUBFH-LROBGIAVSA-N 3-(2-methylpyrimidin-5-yl)-3-[5-[3-[(2S)-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]propyl]pyrazol-1-yl]propanoic acid Chemical compound CC1=NC=C(C=N1)C(CC(O)=O)N1N=CC=C1CCC[C@H]1CCC2=CC=CN=C2N1 PBWFOTQLLPUBFH-LROBGIAVSA-N 0.000 claims 1
- BKTHKHWQJWMNPX-UHFFFAOYSA-N 3-(3-morpholin-4-ylphenyl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound O1CCN(CC1)C=1C=C(C=CC=1)C(CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC=2C=C1 BKTHKHWQJWMNPX-UHFFFAOYSA-N 0.000 claims 1
- SPDUOUZUENXLAW-UHFFFAOYSA-N 3-(5-methoxypyrazin-2-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound C1CNC2=C(C1)C=CC(=N2)CCCC1=NN(C=C1)C(CC(=O)O)C1=CN=C(OC)C=N1 SPDUOUZUENXLAW-UHFFFAOYSA-N 0.000 claims 1
- LZTDUTCUYWTIAU-UHFFFAOYSA-N 3-(6-methoxypyridazin-3-yl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COc1ccc(nn1)C(CC(O)=O)n1nccc1CCCc1ccc2CCCNc2n1 LZTDUTCUYWTIAU-UHFFFAOYSA-N 0.000 claims 1
- IABHYNPYOQIKNL-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]propanoic acid Chemical compound COc1ccc(cn1)C(CC(O)=O)c1cnn(CCCc2ccc3CCCNc3n2)c1 IABHYNPYOQIKNL-UHFFFAOYSA-N 0.000 claims 1
- AYPNJPWKECOGBM-UHFFFAOYSA-N 3-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound CC1=NN(C(=C1)C)C=1C=C(C=CC=1)C(CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC=2C=C1 AYPNJPWKECOGBM-UHFFFAOYSA-N 0.000 claims 1
- ZVUWHFQRZDKPAU-UHFFFAOYSA-N 3-[5-(2-methoxyethoxy)pyridin-3-yl]-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COCCOC=1C=C(C=NC=1)C(CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC=2C=C1 ZVUWHFQRZDKPAU-UHFFFAOYSA-N 0.000 claims 1
- HISGHTPIEZQYSO-UHFFFAOYSA-N 4-[[4-[2-carboxy-1-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]ethyl]pyridin-2-yl]amino]butanoic acid Chemical compound OC(=O)CCCNC1=NC=CC(=C1)C(CC(O)=O)N1C=CC(CCCC2=CC=C3CCCNC3=N2)=N1 HISGHTPIEZQYSO-UHFFFAOYSA-N 0.000 claims 1
- FBLYTHMNJSRVGI-UHFFFAOYSA-N 4-[[4-[2-carboxy-1-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]ethyl]pyridin-2-yl]amino]butanoic acid Chemical compound OC(=O)CCCNC1=NC=CC(=C1)C(CC(O)=O)N1N=CC=C1CCCC1=CC=C2CCCNC2=N1 FBLYTHMNJSRVGI-UHFFFAOYSA-N 0.000 claims 1
- WBZRMZBFNZCTNF-UHFFFAOYSA-N N1=C(C=CC=2CCCNC12)CCCC1=NN(C=C1)C(C(=O)O)C Chemical compound N1=C(C=CC=2CCCNC12)CCCC1=NN(C=C1)C(C(=O)O)C WBZRMZBFNZCTNF-UHFFFAOYSA-N 0.000 claims 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims 1
- 208000020832 chronic kidney disease Diseases 0.000 claims 1
- 239000005557 antagonist Substances 0.000 abstract description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 258
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 225
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 206
- 239000011541 reaction mixture Substances 0.000 description 189
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 186
- 229910052796 boron Inorganic materials 0.000 description 157
- 239000012071 phase Substances 0.000 description 157
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 156
- 239000000243 solution Substances 0.000 description 149
- 238000005481 NMR spectroscopy Methods 0.000 description 133
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 110
- 239000000203 mixture Substances 0.000 description 107
- 235000019439 ethyl acetate Nutrition 0.000 description 103
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 93
- 238000005160 1H NMR spectroscopy Methods 0.000 description 78
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 68
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 68
- 238000001514 detection method Methods 0.000 description 66
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 62
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 61
- 239000012043 crude product Substances 0.000 description 60
- 238000000034 method Methods 0.000 description 59
- 230000014759 maintenance of location Effects 0.000 description 58
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 55
- 239000003921 oil Substances 0.000 description 50
- 235000019198 oils Nutrition 0.000 description 50
- 239000007787 solid Substances 0.000 description 48
- 239000002904 solvent Substances 0.000 description 48
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 47
- 239000012044 organic layer Substances 0.000 description 46
- 238000003818 flash chromatography Methods 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- 239000000706 filtrate Substances 0.000 description 41
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 41
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 37
- 238000002953 preparative HPLC Methods 0.000 description 37
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 36
- 239000003814 drug Substances 0.000 description 36
- 238000000746 purification Methods 0.000 description 36
- 239000011734 sodium Substances 0.000 description 36
- 239000000460 chlorine Substances 0.000 description 35
- 125000004432 carbon atom Chemical group C* 0.000 description 33
- 229910052757 nitrogen Inorganic materials 0.000 description 33
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 33
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 32
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 32
- 239000012267 brine Substances 0.000 description 31
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 29
- 238000006243 chemical reaction Methods 0.000 description 29
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 29
- 238000004587 chromatography analysis Methods 0.000 description 28
- 239000005695 Ammonium acetate Substances 0.000 description 27
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 27
- 235000019257 ammonium acetate Nutrition 0.000 description 27
- 229940043376 ammonium acetate Drugs 0.000 description 27
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 26
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 25
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 24
- 125000000623 heterocyclic group Chemical group 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- 239000002253 acid Substances 0.000 description 23
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 22
- 230000002829 reductive effect Effects 0.000 description 22
- 229940124597 therapeutic agent Drugs 0.000 description 22
- 229910004298 SiO 2 Inorganic materials 0.000 description 20
- 125000003118 aryl group Chemical group 0.000 description 20
- 238000010828 elution Methods 0.000 description 20
- 125000001424 substituent group Chemical group 0.000 description 20
- 229910052799 carbon Inorganic materials 0.000 description 19
- 150000002148 esters Chemical class 0.000 description 19
- 239000012453 solvate Substances 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000002245 particle Substances 0.000 description 18
- 239000000651 prodrug Substances 0.000 description 18
- 229940002612 prodrug Drugs 0.000 description 18
- 239000012298 atmosphere Substances 0.000 description 17
- 239000001913 cellulose Substances 0.000 description 17
- 229920002678 cellulose Polymers 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 16
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 16
- 239000007788 liquid Substances 0.000 description 16
- 239000000463 material Substances 0.000 description 16
- 239000003208 petroleum Substances 0.000 description 16
- 238000004808 supercritical fluid chromatography Methods 0.000 description 16
- 238000003756 stirring Methods 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- 125000003545 alkoxy group Chemical group 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 14
- 150000001721 carbon Chemical group 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 13
- 229910052786 argon Inorganic materials 0.000 description 13
- 125000000753 cycloalkyl group Chemical group 0.000 description 13
- 238000004128 high performance liquid chromatography Methods 0.000 description 13
- 229920006395 saturated elastomer Polymers 0.000 description 13
- 229910052717 sulfur Inorganic materials 0.000 description 13
- 238000003786 synthesis reaction Methods 0.000 description 13
- NXMFJCRMSDRXLD-UHFFFAOYSA-N 2-aminopyridine-3-carbaldehyde Chemical compound NC1=NC=CC=C1C=O NXMFJCRMSDRXLD-UHFFFAOYSA-N 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 239000003937 drug carrier Substances 0.000 description 12
- 239000012299 nitrogen atmosphere Substances 0.000 description 12
- 125000004429 atom Chemical group 0.000 description 11
- 125000005842 heteroatom Chemical group 0.000 description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- 125000003710 aryl alkyl group Chemical group 0.000 description 9
- 210000004027 cell Anatomy 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 230000003176 fibrotic effect Effects 0.000 description 9
- 125000001188 haloalkyl group Chemical group 0.000 description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 9
- 125000002950 monocyclic group Chemical group 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 239000004475 Arginine Substances 0.000 description 8
- 241000937413 Axia Species 0.000 description 8
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 8
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 8
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 8
- 239000013058 crude material Substances 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 125000001072 heteroaryl group Chemical group 0.000 description 8
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 230000002062 proliferating effect Effects 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 7
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 7
- 125000002837 carbocyclic group Chemical group 0.000 description 7
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000004404 heteroalkyl group Chemical group 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 229910052763 palladium Inorganic materials 0.000 description 7
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 7
- QJPQVXSHYBGQGM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QJPQVXSHYBGQGM-UHFFFAOYSA-N 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 239000000377 silicon dioxide Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 6
- 125000003282 alkyl amino group Chemical group 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 235000011114 ammonium hydroxide Nutrition 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 208000019425 cirrhosis of liver Diseases 0.000 description 6
- 229910052681 coesite Inorganic materials 0.000 description 6
- 229910052906 cristobalite Inorganic materials 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 229910052731 fluorine Inorganic materials 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 229910052682 stishovite Inorganic materials 0.000 description 6
- 125000001544 thienyl group Chemical group 0.000 description 6
- 230000009466 transformation Effects 0.000 description 6
- 238000000844 transformation Methods 0.000 description 6
- 229910052905 tridymite Inorganic materials 0.000 description 6
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 5
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 206010023421 Kidney fibrosis Diseases 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical group CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 5
- 102000004887 Transforming Growth Factor beta Human genes 0.000 description 5
- 108090001012 Transforming Growth Factor beta Proteins 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- 239000000556 agonist Substances 0.000 description 5
- 125000004414 alkyl thio group Chemical group 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 125000002619 bicyclic group Chemical group 0.000 description 5
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 5
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 5
- 229910000024 caesium carbonate Inorganic materials 0.000 description 5
- 229910002091 carbon monoxide Inorganic materials 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 125000002757 morpholinyl group Chemical group 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 125000003367 polycyclic group Chemical group 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 238000004007 reversed phase HPLC Methods 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 description 5
- 238000002560 therapeutic procedure Methods 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 5
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 5
- ZPSSHXXWTPHCDU-UHFFFAOYSA-N 3-(3-fluoro-4-methoxyphenyl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1H-pyrazol-3-yl]propanoic acid Chemical compound COC1=C(F)C=C(C=C1)C(CC(O)=O)C1=NNC(CCCC2=CC=C3CCCNC3=N2)=C1 ZPSSHXXWTPHCDU-UHFFFAOYSA-N 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- 101150041968 CDC13 gene Proteins 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000007832 Na2SO4 Substances 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 4
- 230000003042 antagnostic effect Effects 0.000 description 4
- 125000004104 aryloxy group Chemical group 0.000 description 4
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 125000004452 carbocyclyl group Chemical group 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 125000004438 haloalkoxy group Chemical group 0.000 description 4
- 208000006454 hepatitis Diseases 0.000 description 4
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 4
- 125000002883 imidazolyl group Chemical group 0.000 description 4
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 4
- 208000002551 irritable bowel syndrome Diseases 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 230000001404 mediated effect Effects 0.000 description 4
- 125000002971 oxazolyl group Chemical group 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 125000004076 pyridyl group Chemical group 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- 238000013268 sustained release Methods 0.000 description 4
- 239000012730 sustained-release form Substances 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- IIHPVYJPDKJYOU-UHFFFAOYSA-N triphenylcarbethoxymethylenephosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OCC)C1=CC=CC=C1 IIHPVYJPDKJYOU-UHFFFAOYSA-N 0.000 description 4
- 239000003039 volatile agent Substances 0.000 description 4
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 3
- UXHDQFHDTDGMRO-LBPRGKRZSA-N (2S)-2-[3-(1H-pyrazol-5-yl)propyl]-1,2,3,4-tetrahydro-1,8-naphthyridine Chemical compound C(C[C@H]1CCC2=CC=CN=C2N1)CC1=NNC=C1 UXHDQFHDTDGMRO-LBPRGKRZSA-N 0.000 description 3
- MKTIJHIWUFURQA-UHFFFAOYSA-N 1-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]pyrazole-3-carbaldehyde Chemical compound CC1(CCCN2C=CC(C=O)=N2)OCCO1 MKTIJHIWUFURQA-UHFFFAOYSA-N 0.000 description 3
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical compound CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 3
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 3
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 3
- LYQUDXXKICQOJO-UHFFFAOYSA-N 5-[2-(1,3-dioxolan-2-yl)-1,3-thiazol-4-yl]pentan-2-ol Chemical compound O1C(OCC1)C=1SC=C(N=1)CCCC(C)O LYQUDXXKICQOJO-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- YFEMLWSJXURDIH-UHFFFAOYSA-N BrC1=NN(C=C1)C(=O)OC(C)(C)C Chemical compound BrC1=NN(C=C1)C(=O)OC(C)(C)C YFEMLWSJXURDIH-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 102000003816 Interleukin-13 Human genes 0.000 description 3
- 108090000176 Interleukin-13 Proteins 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 3
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- 101150003085 Pdcl gene Proteins 0.000 description 3
- 206010035226 Plasma cell myeloma Diseases 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- KDZMCHYOHSEAEJ-UHFFFAOYSA-N [Rh+].[Cl+].C1=CCCC=CCC1 Chemical class [Rh+].[Cl+].C1=CCCC=CCC1 KDZMCHYOHSEAEJ-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 3
- 125000005110 aryl thio group Chemical group 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 238000005966 aza-Michael addition reaction Methods 0.000 description 3
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 3
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 3
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 3
- YSHOWEKUVWPFNR-UHFFFAOYSA-N burgess reagent Chemical compound CC[N+](CC)(CC)S(=O)(=O)N=C([O-])OC YSHOWEKUVWPFNR-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 230000009787 cardiac fibrosis Effects 0.000 description 3
- 239000006184 cosolvent Substances 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 description 3
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 239000012634 fragment Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 125000002632 imidazolidinyl group Chemical group 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000000842 isoxazolyl group Chemical group 0.000 description 3
- 208000017169 kidney disease Diseases 0.000 description 3
- 208000032839 leukemia Diseases 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L magnesium sulphate Substances [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- IBIKHMZPHNKTHM-RDTXWAMCSA-N merck compound 25 Chemical compound C1C[C@@H](C(O)=O)[C@H](O)CN1C(C1=C(F)C=CC=C11)=NN1C(=O)C1=C(Cl)C=CC=C1C1CC1 IBIKHMZPHNKTHM-RDTXWAMCSA-N 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000010502 orange oil Substances 0.000 description 3
- 125000001715 oxadiazolyl group Chemical group 0.000 description 3
- 239000000123 paper Substances 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- JTHLRRZARWSHBE-UHFFFAOYSA-N pent-4-yn-2-ol Chemical compound CC(O)CC#C JTHLRRZARWSHBE-UHFFFAOYSA-N 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 125000003373 pyrazinyl group Chemical group 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000037390 scarring Effects 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 238000010189 synthetic method Methods 0.000 description 3
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 3
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 3
- PDJQCHVMABBNQW-MIXQCLKLSA-L (1z,5z)-cycloocta-1,5-diene;rhodium;dichloride Chemical compound [Cl-].[Cl-].[Rh].[Rh].C\1C\C=C/CC\C=C/1.C\1C\C=C/CC\C=C/1 PDJQCHVMABBNQW-MIXQCLKLSA-L 0.000 description 2
- IILGLPAJXQMKGQ-UHFFFAOYSA-N (3-fluoro-4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1F IILGLPAJXQMKGQ-UHFFFAOYSA-N 0.000 description 2
- VSXGLLXIAOAFJK-HXUWFJFHSA-N (3R)-3-[4-fluoro-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]-3-(2-methylpyrimidin-5-yl)propanoic acid Chemical compound FC=1C(=NN(C=1)[C@H](CC(=O)O)C=1C=NC(=NC=1)C)CCCC1=NC=2NCCCC=2C=C1 VSXGLLXIAOAFJK-HXUWFJFHSA-N 0.000 description 2
- ZBYRRNDJUHIXRU-SANMLTNESA-N (3S)-3-(1-benzyl-6-oxopyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)C[C@H](N1C=CC(CCCC2=CC=C3CCCNC3=N2)=N1)C1=CN(CC2=CC=CC=C2)C(=O)C=C1 ZBYRRNDJUHIXRU-SANMLTNESA-N 0.000 description 2
- DHADXDMPEUWEAS-UHFFFAOYSA-N (6-methoxypyridin-3-yl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=N1 DHADXDMPEUWEAS-UHFFFAOYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- ZCZVGQCBSJLDDS-UHFFFAOYSA-N 1,2,3,4-tetrahydro-1,8-naphthyridine Chemical compound C1=CC=C2CCCNC2=N1 ZCZVGQCBSJLDDS-UHFFFAOYSA-N 0.000 description 2
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- DFPYXQYWILNVAU-UHFFFAOYSA-N 1-hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1.C1=CC=C2N(O)N=NC2=C1 DFPYXQYWILNVAU-UHFFFAOYSA-N 0.000 description 2
- OIRJZETZODTGOD-UHFFFAOYSA-N 2-(1,3-dioxolan-2-yl)-1,3-thiazole Chemical compound O1CCOC1C1=NC=CS1 OIRJZETZODTGOD-UHFFFAOYSA-N 0.000 description 2
- JCPVPDIHKYQHRX-UHFFFAOYSA-N 2-(1,3-dioxolan-2-yl)-4-[3-(1,8-naphthyridin-2-yl)propyl]-1,3-thiazole Chemical compound N1=C(C=CC2=CC=CN=C12)CCCC=1N=C(SC=1)C1OCCO1 JCPVPDIHKYQHRX-UHFFFAOYSA-N 0.000 description 2
- QVVDAKOVTYIGJZ-UHFFFAOYSA-N 2-(1,3-dioxolan-2-yl)-4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazole Chemical compound C(CC1=CSC(=N1)C1OCCO1)CC1=CC=C2CCCNC2=N1 QVVDAKOVTYIGJZ-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 2
- NEHRVHAYHCDYSB-UHFFFAOYSA-N 2-but-3-enyl-1,8-naphthyridine Chemical compound C(CC=C)C1=NC2=NC=CC=C2C=C1 NEHRVHAYHCDYSB-UHFFFAOYSA-N 0.000 description 2
- IJBONYUNKRDIFC-UHFFFAOYSA-N 2-methylpyrimidine-5-carbaldehyde Chemical compound CC1=NC=C(C=O)C=N1 IJBONYUNKRDIFC-UHFFFAOYSA-N 0.000 description 2
- GDBNGKQEPUAMCI-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COc1ccc(cc1OC)C(CC(O)=O)c1nc(CCCCc2ccc3CCCNc3n2)cs1 GDBNGKQEPUAMCI-UHFFFAOYSA-N 0.000 description 2
- ZDRWXUHIAQJLBM-UHFFFAOYSA-N 3-(3-fluoro-4-methoxyphenyl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COc1ccc(cc1F)C(CC(O)=O)c1nc(CCCc2ccc3CCCNc3n2)cs1 ZDRWXUHIAQJLBM-UHFFFAOYSA-N 0.000 description 2
- YXDUBNYLAAIZFB-UHFFFAOYSA-N 3-(3-fluoro-4-methoxyphenyl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COc1ccc(cc1F)C(CC(O)=O)c1nc(CCCCc2ccc3CCCNc3n2)cs1 YXDUBNYLAAIZFB-UHFFFAOYSA-N 0.000 description 2
- QMQQAYAICVRTEQ-UHFFFAOYSA-N 3-(3-fluoro-4-methoxyphenyl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COc1ccc(cc1F)C(CC(O)=O)c1ncc(CCCc2ccc3CCCNc3n2)s1 QMQQAYAICVRTEQ-UHFFFAOYSA-N 0.000 description 2
- VSDHMCYRFWUCLN-UHFFFAOYSA-N 3-[4-(dimethylcarbamoyl)phenyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)c1ccc(cc1)C(CC(O)=O)c1nc(CCCCc2ccc3CCCNc3n2)cs1 VSDHMCYRFWUCLN-UHFFFAOYSA-N 0.000 description 2
- ZUKKANKIFDHVIL-UHFFFAOYSA-N 4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazole-2-carbaldehyde Chemical compound O=CC1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 ZUKKANKIFDHVIL-UHFFFAOYSA-N 0.000 description 2
- JDUXMFGFGCJNGO-UHFFFAOYSA-N 4-bromo-1,3-thiazole-2-carbaldehyde Chemical compound BrC1=CSC(C=O)=N1 JDUXMFGFGCJNGO-UHFFFAOYSA-N 0.000 description 2
- YZRDYZDUQYXDNG-UHFFFAOYSA-N 5-[2-(1,3-dioxolan-2-yl)-1,3-thiazol-4-yl]pent-4-yn-2-ol Chemical compound O1C(OCC1)C=1SC=C(N=1)C#CCC(C)O YZRDYZDUQYXDNG-UHFFFAOYSA-N 0.000 description 2
- XHZWFUVEKDDQPF-UHFFFAOYSA-N 5-bromo-1h-pyrazole Chemical compound BrC1=CC=NN1 XHZWFUVEKDDQPF-UHFFFAOYSA-N 0.000 description 2
- LPNANKDXVBMDKE-UHFFFAOYSA-N 5-bromopent-1-ene Chemical compound BrCCCC=C LPNANKDXVBMDKE-UHFFFAOYSA-N 0.000 description 2
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- IYMAXBFPHPZYIK-BQBZGAKWSA-N Arg-Gly-Asp Chemical compound NC(N)=NCCC[C@H](N)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(O)=O IYMAXBFPHPZYIK-BQBZGAKWSA-N 0.000 description 2
- 241000599985 Beijerinckia mobilis Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- JMUCNZYOCFHTJH-MDZDMXLPSA-N C(C)(C)(C)OC(/C=C/C1=NN(C(=C1)C(=O)OCC)COCC[Si](C)(C)C)=O Chemical compound C(C)(C)(C)OC(/C=C/C1=NN(C(=C1)C(=O)OCC)COCC[Si](C)(C)C)=O JMUCNZYOCFHTJH-MDZDMXLPSA-N 0.000 description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 206010008909 Chronic Hepatitis Diseases 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- 108050007372 Fibroblast Growth Factor Proteins 0.000 description 2
- 102000018233 Fibroblast Growth Factor Human genes 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 208000010412 Glaucoma Diseases 0.000 description 2
- 229910004373 HOAc Inorganic materials 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 102000004388 Interleukin-4 Human genes 0.000 description 2
- 108090000978 Interleukin-4 Proteins 0.000 description 2
- 208000029523 Interstitial Lung disease Diseases 0.000 description 2
- 108010055717 JNK Mitogen-Activated Protein Kinases Proteins 0.000 description 2
- 102400000401 Latency-associated peptide Human genes 0.000 description 2
- 101800001155 Latency-associated peptide Proteins 0.000 description 2
- 239000012448 Lithium borohydride Substances 0.000 description 2
- 102100027159 Membrane primary amine oxidase Human genes 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 208000002158 Proliferative Vitreoretinopathy Diseases 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- 206010038934 Retinopathy proliferative Diseases 0.000 description 2
- 206010050207 Skin fibrosis Diseases 0.000 description 2
- 238000003477 Sonogashira cross-coupling reaction Methods 0.000 description 2
- 102000011016 Type 5 Cyclic Nucleotide Phosphodiesterases Human genes 0.000 description 2
- 108010037581 Type 5 Cyclic Nucleotide Phosphodiesterases Proteins 0.000 description 2
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 2
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 2
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 231100000354 acute hepatitis Toxicity 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 2
- 206010064930 age-related macular degeneration Diseases 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000004450 alkenylene group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000004419 alkynylene group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 description 2
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 2
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 2
- 125000002393 azetidinyl group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004935 benzoxazolinyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000005512 benztetrazolyl group Chemical group 0.000 description 2
- AFXDRFORSSWVHP-UHFFFAOYSA-N benzyl 2-prop-2-ynyl-2H-1,8-naphthyridine-1-carboxylate Chemical compound O=C(OCC1=CC=CC=C1)N1C(CC#C)C=CC2=CC=CN=C12 AFXDRFORSSWVHP-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 125000005884 carbocyclylalkyl group Chemical group 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 239000011111 cardboard Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004296 chiral HPLC Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000002299 complementary DNA Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 229940121360 farnesoid X receptor (fxr) agonists Drugs 0.000 description 2
- 229940126864 fibroblast growth factor Drugs 0.000 description 2
- 206010016629 fibroma Diseases 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 239000003102 growth factor Substances 0.000 description 2
- 125000005553 heteroaryloxy group Chemical group 0.000 description 2
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 229940028885 interleukin-4 Drugs 0.000 description 2
- 210000000936 intestine Anatomy 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- 208000002780 macular degeneration Diseases 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- RMNJNEUWTBBZPT-UHFFFAOYSA-N methyl 4-nitrobenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 RMNJNEUWTBBZPT-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 201000000050 myeloid neoplasm Diseases 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 208000021971 neovascular inflammatory vitreoretinopathy Diseases 0.000 description 2
- 229960004378 nintedanib Drugs 0.000 description 2
- XZXHXSATPCNXJR-ZIADKAODSA-N nintedanib Chemical compound O=C1NC2=CC(C(=O)OC)=CC=C2\C1=C(C=1C=CC=CC=1)\NC(C=C1)=CC=C1N(C)C(=O)CN1CCN(C)CC1 XZXHXSATPCNXJR-ZIADKAODSA-N 0.000 description 2
- 201000004071 non-specific interstitial pneumonia Diseases 0.000 description 2
- 239000012457 nonaqueous media Substances 0.000 description 2
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 125000004095 oxindolyl group Chemical group N1(C(CC2=CC=CC=C12)=O)* 0.000 description 2
- 125000004043 oxo group Chemical group O=* 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- HYAFETHFCAUJAY-UHFFFAOYSA-N pioglitazone Chemical compound N1=CC(CC)=CC=C1CCOC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 HYAFETHFCAUJAY-UHFFFAOYSA-N 0.000 description 2
- 229960003073 pirfenidone Drugs 0.000 description 2
- ISWRGOKTTBVCFA-UHFFFAOYSA-N pirfenidone Chemical compound C1=C(C)C=CC(=O)N1C1=CC=CC=C1 ISWRGOKTTBVCFA-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 230000006785 proliferative vitreoretinopathy Effects 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- ZDYVRSLAEXCVBX-UHFFFAOYSA-N pyridinium p-toluenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 ZDYVRSLAEXCVBX-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 239000012363 selectfluor Substances 0.000 description 2
- PEGQOIGYZLJMIB-UHFFFAOYSA-N setogepram Chemical compound CCCCCC1=CC=CC(CC(O)=O)=C1 PEGQOIGYZLJMIB-UHFFFAOYSA-N 0.000 description 2
- BNRNXUUZRGQAQC-UHFFFAOYSA-N sildenafil Chemical compound CCCC1=NN(C)C(C(N2)=O)=C1N=C2C(C(=CC=1)OCC)=CC=1S(=O)(=O)N1CCN(C)CC1 BNRNXUUZRGQAQC-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 230000008685 targeting Effects 0.000 description 2
- AHRBGHXLOWICAX-UHFFFAOYSA-N tert-butyl 2-(4,4-diethoxybutyl)-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate Chemical compound C(C)OC(CCCC=1C=CC2=C(N(CCCC2)C(=O)OC(C)(C)C)N=1)OCC AHRBGHXLOWICAX-UHFFFAOYSA-N 0.000 description 2
- DHIYLIZRJYDHOF-UHFFFAOYSA-N tert-butyl 2-(4-oxobutyl)-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCCc2ccc(CCCC=O)nc12 DHIYLIZRJYDHOF-UHFFFAOYSA-N 0.000 description 2
- FOFCRONSHMHMQC-UHFFFAOYSA-N tert-butyl 2-[3-[1-[3-[(2-methylpropan-2-yl)oxy]-1-(2-methylpyrimidin-5-yl)-3-oxopropyl]pyrazol-3-yl]propyl]-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate Chemical compound Cc1ncc(cn1)C(CC(=O)OC(C)(C)C)n1ccc(CCCc2ccc3CCCCN(C(=O)OC(C)(C)C)c3n2)n1 FOFCRONSHMHMQC-UHFFFAOYSA-N 0.000 description 2
- IRSVDPRIUKSVFH-UHFFFAOYSA-N tert-butyl 2-chloro-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCCC2=CC=C(Cl)N=C12 IRSVDPRIUKSVFH-UHFFFAOYSA-N 0.000 description 2
- SJYGWABFWPMOQL-UHFFFAOYSA-N tert-butyl 3-[3-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=CC(CCCC2CCC3=CC=CN=C3N2)=N1 SJYGWABFWPMOQL-UHFFFAOYSA-N 0.000 description 2
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 2
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 2
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- 125000004306 triazinyl group Chemical group 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 238000004704 ultra performance liquid chromatography Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- 230000029663 wound healing Effects 0.000 description 2
- XFQNWPYGEGCIMF-HCUGAJCMSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].[Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 XFQNWPYGEGCIMF-HCUGAJCMSA-N 0.000 description 1
- VYXHVRARDIDEHS-QGTKBVGQSA-N (1z,5z)-cycloocta-1,5-diene Chemical compound C\1C\C=C/CC\C=C/1 VYXHVRARDIDEHS-QGTKBVGQSA-N 0.000 description 1
- UXHDQFHDTDGMRO-GFCCVEGCSA-N (2R)-2-[3-(1H-pyrazol-5-yl)propyl]-1,2,3,4-tetrahydro-1,8-naphthyridine Chemical compound C(C[C@@H]1CCC2=CC=CN=C2N1)CC1=NNC=C1 UXHDQFHDTDGMRO-GFCCVEGCSA-N 0.000 description 1
- OUPXSLGGCPUZJJ-SARDKLJWSA-N (2s)-2-[[(2s)-1-[(2s)-6-amino-2-[[(2s)-1-[(2s)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-n-[(2s)-5-amino-1-[[(2s)-1-[[(2s)-1-[[2-[[(2s)-1-[[(2s)-1-amino-4-methylsulfonyl-1-oxobutan-2-y Chemical compound C([C@@H](C(=O)N(C)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCS(C)(=O)=O)C(N)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CCCN=C(N)N)C1=CC=CC=C1 OUPXSLGGCPUZJJ-SARDKLJWSA-N 0.000 description 1
- HSINOMROUCMIEA-FGVHQWLLSA-N (2s,4r)-4-[(3r,5s,6r,7r,8s,9s,10s,13r,14s,17r)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid Chemical compound C([C@@]12C)C[C@@H](O)C[C@H]1[C@@H](CC)[C@@H](O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)C[C@H](C)C(O)=O)CC[C@H]21 HSINOMROUCMIEA-FGVHQWLLSA-N 0.000 description 1
- UBYJRGAFVQXRIU-IBGZPJMESA-N (3S)-3-(2-methoxypyrimidin-5-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound COc1ncc(cn1)[C@H](CC(O)=O)n1ccc(CCCc2ccc3CCCNc3n2)n1 UBYJRGAFVQXRIU-IBGZPJMESA-N 0.000 description 1
- QUAIYNWNKTYYGL-ICSRJNTNSA-N (3S)-3-(2-methylpyrimidin-5-yl)-3-[3-[3-[(2S)-1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl]propyl]pyrazol-1-yl]propanoic acid Chemical compound CC1=NC=C(C=N1)[C@H](CC(O)=O)N1C=CC(CCC[C@H]2CCC3=CC=CN=C3N2)=N1 QUAIYNWNKTYYGL-ICSRJNTNSA-N 0.000 description 1
- ZVPFAVSYSYIDJI-LFABVHOISA-N (3S)-3-(6-methoxypyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)[C@H](CC(O)=O)N1CCC(CCCC2=CC=C3CCCNC3=N2)C1 ZVPFAVSYSYIDJI-LFABVHOISA-N 0.000 description 1
- ZGCLOBSDNFKPOK-SANMLTNESA-N (3S)-3-(6-phenylmethoxypyridin-3-yl)-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)C[C@H](N1C=CC(CCCC2=CC=C3CCCNC3=N2)=N1)C1=CC=C(OCC2=CC=CC=C2)N=C1 ZGCLOBSDNFKPOK-SANMLTNESA-N 0.000 description 1
- SUMPEFHMPYZTQH-QHCPKHFHSA-N (3S)-3-[6-(cyclopropylmethoxy)pyridin-3-yl]-3-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)C[C@H](N1C=CC(CCCC2=CC=C3CCCNC3=N2)=N1)C1=CC=C(OCC2CC2)N=C1 SUMPEFHMPYZTQH-QHCPKHFHSA-N 0.000 description 1
- SCVHJVCATBPIHN-SJCJKPOMSA-N (3s)-3-[[(2s)-2-[[2-(2-tert-butylanilino)-2-oxoacetyl]amino]propanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid Chemical compound N([C@@H](C)C(=O)N[C@@H](CC(O)=O)C(=O)COC=1C(=C(F)C=C(F)C=1F)F)C(=O)C(=O)NC1=CC=CC=C1C(C)(C)C SCVHJVCATBPIHN-SJCJKPOMSA-N 0.000 description 1
- CXVJGBWVLDSEJE-UHFFFAOYSA-N (6-methoxypyridin-3-yl)-[1-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]pyrazol-3-yl]methanol Chemical compound COC1=CC=C(C=N1)C(O)C1=NN(CCCC2(C)OCCO2)C=C1 CXVJGBWVLDSEJE-UHFFFAOYSA-N 0.000 description 1
- YCHYFHOSGQABSW-RTBURBONSA-N (6ar,10ar)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid Chemical compound C1C(C(O)=O)=CC[C@H]2C(C)(C)OC3=CC(C(C)(C)CCCCCC)=CC(O)=C3[C@@H]21 YCHYFHOSGQABSW-RTBURBONSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 1
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 description 1
- 125000006716 (C1-C6) heteroalkyl group Chemical group 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 1
- ONDSBJMLAHVLMI-UHFFFAOYSA-N (trimethylsilyl)diazomethane Substances C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 1
- COLOHWPRNRVWPI-UHFFFAOYSA-N 1,1,1-trifluoroethane Chemical compound [CH2]C(F)(F)F COLOHWPRNRVWPI-UHFFFAOYSA-N 0.000 description 1
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000004607 1,2,3,4-tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-Bis(diphenylphosphino)propane Substances C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- ZGTFNNUASMWGTM-UHFFFAOYSA-N 1,3-thiazole-2-carbaldehyde Chemical compound O=CC1=NC=CS1 ZGTFNNUASMWGTM-UHFFFAOYSA-N 0.000 description 1
- MICMHFIQSAMEJG-UHFFFAOYSA-N 1-bromopyrrolidine-2,5-dione Chemical compound BrN1C(=O)CCC1=O.BrN1C(=O)CCC1=O MICMHFIQSAMEJG-UHFFFAOYSA-N 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- LRGBDJBDJXZTTD-UHFFFAOYSA-N 1h-pyrazole-4-carbaldehyde Chemical compound O=CC=1C=NNC=1 LRGBDJBDJXZTTD-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- VMAKIQSICJHVNP-UHFFFAOYSA-N 2-(3-bromopropyl)-2-methyl-1,3-dioxolane Chemical compound BrCCCC1(C)OCCO1 VMAKIQSICJHVNP-UHFFFAOYSA-N 0.000 description 1
- OFERIRWCHSOJJT-UHFFFAOYSA-N 2-(3-chloropropyl)-2-methyl-1,3-dioxolane Chemical compound ClCCCC1(C)OCCO1 OFERIRWCHSOJJT-UHFFFAOYSA-N 0.000 description 1
- OVKIQOIDVMYBNJ-UHFFFAOYSA-N 2-(phenylmethoxycarbonylamino)-3-[1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazol-4-yl]propanoic acid Chemical compound OC(=O)C(Cc1cnn(CCc2ccc3CCCNc3n2)c1)NC(=O)OCc1ccccc1 OVKIQOIDVMYBNJ-UHFFFAOYSA-N 0.000 description 1
- DQBMEHRAQGEFNA-UHFFFAOYSA-N 2-(phenylmethoxycarbonylamino)-3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]propanoic acid Chemical compound OC(=O)C(CC1=CN(CCCC2=CC=C3CCCNC3=N2)N=C1)NC(=O)OCC1=CC=CC=C1 DQBMEHRAQGEFNA-UHFFFAOYSA-N 0.000 description 1
- ZZWWXIBKLBMSCS-FQEVSTJZSA-N 2-[1-[(2r)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]-2-methylpropanoic acid Chemical compound COC1=CC=CC=C1[C@@H](OC1CCOCC1)CN1C(=O)N(C(C)(C)C(O)=O)C(=O)C2=C1SC(C=1OC=CN=1)=C2C ZZWWXIBKLBMSCS-FQEVSTJZSA-N 0.000 description 1
- UXHDQFHDTDGMRO-UHFFFAOYSA-N 2-[3-(1H-pyrazol-5-yl)propyl]-1,2,3,4-tetrahydro-1,8-naphthyridine Chemical compound C(CC1CCC2=CC=CN=C2N1)CC1=NNC=C1 UXHDQFHDTDGMRO-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- BVAHPPKGOOJSPU-UHFFFAOYSA-N 2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]pyridin-4-yl]amino]-n-methoxybenzamide Chemical compound CONC(=O)C1=CC=CC=C1NC1=CC(NC=2N(N=C(C)C=2)C(C)C)=NC=C1Cl BVAHPPKGOOJSPU-UHFFFAOYSA-N 0.000 description 1
- 101710186725 2-acylglycerol O-acyltransferase 2 Proteins 0.000 description 1
- MLONYBFKXHEPCD-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(N)(CO)CO.OCC(N)(CO)CO MLONYBFKXHEPCD-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- KRTGJZMJJVEKRX-UHFFFAOYSA-N 2-phenylethan-1-yl Chemical group [CH2]CC1=CC=CC=C1 KRTGJZMJJVEKRX-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- VSCBATMPTLKTOV-UHFFFAOYSA-N 2-tert-butylimino-n,n-diethyl-1,3-dimethyl-1,3,2$l^{5}-diazaphosphinan-2-amine Chemical compound CCN(CC)P1(=NC(C)(C)C)N(C)CCCN1C VSCBATMPTLKTOV-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- YZJQEJHDCYMNMO-UHFFFAOYSA-N 3-(2-methylpyrimidin-5-yl)-3-[3-[3-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound Cc1ncc(cn1)C(CC(O)=O)n1ccc(CCCc2ccc3CCCCNc3n2)n1 YZJQEJHDCYMNMO-UHFFFAOYSA-N 0.000 description 1
- LVZQWYRNDVVBAH-UHFFFAOYSA-N 3-(3-morpholin-4-ylphenyl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound OC(=O)CC(c1nc(CCCCc2ccc3CCCNc3n2)cs1)c1cccc(c1)N1CCOCC1 LVZQWYRNDVVBAH-UHFFFAOYSA-N 0.000 description 1
- WEUQFTALWGFGGZ-UHFFFAOYSA-N 3-(5-morpholin-4-ylpyridin-3-yl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-1-yl]propanoic acid Chemical compound OC(=O)CC(c1cncc(c1)N1CCOCC1)n1nccc1CCCc1ccc2CCCNc2n1 WEUQFTALWGFGGZ-UHFFFAOYSA-N 0.000 description 1
- WWVUBEGMDOTPPR-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)C(CC(O)=O)C1=NC(CCCC2=CC=C3CCCNC3=N2)=CS1 WWVUBEGMDOTPPR-UHFFFAOYSA-N 0.000 description 1
- CGAASNMVFHAXRP-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)C(CC(O)=O)C1=NC(CCCCC2=CC=C3CCCNC3=N2)=CS1 CGAASNMVFHAXRP-UHFFFAOYSA-N 0.000 description 1
- SXFILBGBIGGRAC-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)C(CC(O)=O)C1=NC=C(CCCC2=CC=C3CCCNC3=N2)S1 SXFILBGBIGGRAC-UHFFFAOYSA-N 0.000 description 1
- KWQAOJZTPSJWFI-UHFFFAOYSA-N 3-(6-methoxypyridin-3-yl)-3-[5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound COC1=CC=C(C=N1)C(CC(O)=O)C1=NC=C(CCCCC2=CC=C3CCCNC3=N2)S1 KWQAOJZTPSJWFI-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- ZSPTYLOMNJNZNG-UHFFFAOYSA-N 3-Buten-1-ol Chemical compound OCCC=C ZSPTYLOMNJNZNG-UHFFFAOYSA-N 0.000 description 1
- HAIXUIZXXXRQSC-UHFFFAOYSA-N 3-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazol-4-yl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid Chemical compound CC1=CC(C)=C(C(C)=C1)S(=O)(=O)NC(CC1=CN(CCCC2=CC=C3CCCNC3=N2)N=C1)C(O)=O HAIXUIZXXXRQSC-UHFFFAOYSA-N 0.000 description 1
- JKZIDGVTCMWTAT-UHFFFAOYSA-N 3-[4-(dimethylcarbamoyl)-3-fluorophenyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid Chemical compound CN(C)C(=O)c1ccc(cc1F)C(CC(O)=O)c1nc(CCCCc2ccc3CCCNc3n2)cs1 JKZIDGVTCMWTAT-UHFFFAOYSA-N 0.000 description 1
- SJGGDZCTGBKBCK-UHFFFAOYSA-N 3-acetylphenylboronic acid Chemical compound CC(=O)C1=CC=CC(B(O)O)=C1 SJGGDZCTGBKBCK-UHFFFAOYSA-N 0.000 description 1
- FZWUIWQMJFAWJW-UHFFFAOYSA-N 3-bromo-5-methoxypyridine Chemical compound COC1=CN=CC(Br)=C1 FZWUIWQMJFAWJW-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- OQDQIFQRNZIEEJ-UHFFFAOYSA-N 4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]butanoic acid Chemical compound C1=C2N=CSC2=CC(S(=O)(=O)N2C3=CC=C(Cl)C=C3C=C2CCCC(=O)O)=C1 OQDQIFQRNZIEEJ-UHFFFAOYSA-N 0.000 description 1
- RFQYNGQAZZSGFM-UHFFFAOYSA-N 4-bromo-1h-pyrrole-2-carbaldehyde Chemical compound BrC1=CNC(C=O)=C1 RFQYNGQAZZSGFM-UHFFFAOYSA-N 0.000 description 1
- LUUMLYXKTPBTQR-UHFFFAOYSA-N 4-chloro-n-[5-methyl-2-(7h-pyrrolo[2,3-d]pyrimidine-4-carbonyl)pyridin-3-yl]-3-(trifluoromethyl)benzenesulfonamide Chemical compound C=1C(C)=CN=C(C(=O)C=2C=3C=CNC=3N=CN=2)C=1NS(=O)(=O)C1=CC=C(Cl)C(C(F)(F)F)=C1 LUUMLYXKTPBTQR-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- 125000004608 5,6,7,8-tetrahydroquinolinyl group Chemical group N1=C(C=CC=2CCCCC12)* 0.000 description 1
- XADICJHFELMBGX-UHFFFAOYSA-N 5-bromo-2-methoxypyridine Chemical compound COC1=CC=C(Br)C=N1 XADICJHFELMBGX-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- CMDIDTNMHQUVPE-UHFFFAOYSA-N 6-chlorohexan-2-one Chemical compound CC(=O)CCCCCl CMDIDTNMHQUVPE-UHFFFAOYSA-N 0.000 description 1
- CTAIEPPAOULMFY-UHFFFAOYSA-N 6-methoxypyridine-3-carbaldehyde Chemical compound COC1=CC=C(C=O)C=N1 CTAIEPPAOULMFY-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- 208000007082 Alcoholic Fatty Liver Diseases 0.000 description 1
- 102100024296 Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Human genes 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CKLJMWTZIZZHCS-UHFFFAOYSA-N Aspartic acid Chemical compound OC(=O)C(N)CC(O)=O CKLJMWTZIZZHCS-UHFFFAOYSA-N 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 206010061692 Benign muscle neoplasm Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 208000008439 Biliary Liver Cirrhosis Diseases 0.000 description 1
- 206010004659 Biliary cirrhosis Diseases 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- LEOTYHJWLTVCRS-UHFFFAOYSA-N C(C)(C)(C)OC(CC(C1=CC(=C(C=C1)OC)F)C1=NN(C(=C1)C(=O)OCC)COCC[Si](C)(C)C)=O Chemical compound C(C)(C)(C)OC(CC(C1=CC(=C(C=C1)OC)F)C1=NN(C(=C1)C(=O)OCC)COCC[Si](C)(C)C)=O LEOTYHJWLTVCRS-UHFFFAOYSA-N 0.000 description 1
- 102100031151 C-C chemokine receptor type 2 Human genes 0.000 description 1
- 101710149815 C-C chemokine receptor type 2 Proteins 0.000 description 1
- DJBAPPWTXJMWDZ-UHFFFAOYSA-N C1=CC2=C(N=CC=C2)N(C=C1)C(=O)O Chemical compound C1=CC2=C(N=CC=C2)N(C=C1)C(=O)O DJBAPPWTXJMWDZ-UHFFFAOYSA-N 0.000 description 1
- YHIRJPBKYKAJTE-UHFFFAOYSA-N C1CC2=C(NC1)N=C(C=C2)CCCC3=CSC(=N3)CCC(=O)O Chemical compound C1CC2=C(NC1)N=C(C=C2)CCCC3=CSC(=N3)CCC(=O)O YHIRJPBKYKAJTE-UHFFFAOYSA-N 0.000 description 1
- GCUGNYOYFSJRIQ-UHFFFAOYSA-N C1CC2=C(NC1)N=C(C=C2)CCCCC3=CSC(=N3)CCC(=O)O Chemical compound C1CC2=C(NC1)N=C(C=C2)CCCCC3=CSC(=N3)CCC(=O)O GCUGNYOYFSJRIQ-UHFFFAOYSA-N 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 description 1
- 102000001902 CC Chemokines Human genes 0.000 description 1
- 108010040471 CC Chemokines Proteins 0.000 description 1
- LIIQJDJCGWSRRX-UHFFFAOYSA-N CC(C)(C)OC(N1C2=NC(CCCC3=CSC(C4OCCO4)=N3)=CC=C2CCC1)=O Chemical compound CC(C)(C)OC(N1C2=NC(CCCC3=CSC(C4OCCO4)=N3)=CC=C2CCC1)=O LIIQJDJCGWSRRX-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- 102000011727 Caspases Human genes 0.000 description 1
- 108010076667 Caspases Proteins 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- 206010008111 Cerebral haemorrhage Diseases 0.000 description 1
- 208000008964 Chemical and Drug Induced Liver Injury Diseases 0.000 description 1
- 102000006383 Chemokine CCL24 Human genes 0.000 description 1
- 108010083647 Chemokine CCL24 Proteins 0.000 description 1
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 1
- AEMZEDNMNLIDSL-YGCVIUNWSA-N Cl.CC(C)(C)NC(=O)C1=CC=C(OC\C(CN)=C\F)C=C1 Chemical compound Cl.CC(C)(C)NC(=O)C1=CC=C(OC\C(CN)=C\F)C=C1 AEMZEDNMNLIDSL-YGCVIUNWSA-N 0.000 description 1
- 108020004635 Complementary DNA Proteins 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- JVHXJTBJCFBINQ-ADAARDCZSA-N Dapagliflozin Chemical compound C1=CC(OCC)=CC=C1CC1=CC([C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)=CC=C1Cl JVHXJTBJCFBINQ-ADAARDCZSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- 206010012689 Diabetic retinopathy Diseases 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 101100170601 Drosophila melanogaster Tet gene Proteins 0.000 description 1
- 206010072268 Drug-induced liver injury Diseases 0.000 description 1
- 208000032928 Dyslipidaemia Diseases 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 102100021977 Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Human genes 0.000 description 1
- 108050004000 Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Proteins 0.000 description 1
- 229940118365 Endothelin receptor antagonist Drugs 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 1
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 1
- 229940124783 FAK inhibitor Drugs 0.000 description 1
- NWYHXNGWDKXNFA-FJSYBICCSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.CN1C=C(C=CC1=O)[C@H](CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC2C=C1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.CN1C=C(C=CC1=O)[C@H](CC(=O)O)N1N=C(C=C1)CCCC1=NC=2NCCCC2C=C1 NWYHXNGWDKXNFA-FJSYBICCSA-N 0.000 description 1
- 229940125634 FPR2 agonist Drugs 0.000 description 1
- 108090000376 Fibroblast growth factor 21 Proteins 0.000 description 1
- 102000003973 Fibroblast growth factor 21 Human genes 0.000 description 1
- 102100037362 Fibronectin Human genes 0.000 description 1
- 108010067306 Fibronectins Proteins 0.000 description 1
- 208000007212 Foot-and-Mouth Disease Diseases 0.000 description 1
- 241000710198 Foot-and-mouth disease virus Species 0.000 description 1
- 101710198884 GATA-type zinc finger protein 1 Proteins 0.000 description 1
- DTHNMHAUYICORS-KTKZVXAJSA-N Glucagon-like peptide 1 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1N=CNC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 DTHNMHAUYICORS-KTKZVXAJSA-N 0.000 description 1
- 102400000322 Glucagon-like peptide 1 Human genes 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000966782 Homo sapiens Lysophosphatidic acid receptor 1 Proteins 0.000 description 1
- 101001043352 Homo sapiens Lysyl oxidase homolog 2 Proteins 0.000 description 1
- 101000694615 Homo sapiens Membrane primary amine oxidase Proteins 0.000 description 1
- 101001092910 Homo sapiens Serum amyloid P-component Proteins 0.000 description 1
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- HOVZGRMJNKYNMR-UHFFFAOYSA-N IC1=NN(C(=C1)C(=O)OCC)COCC[Si](C)(C)C Chemical compound IC1=NN(C(=C1)C(=O)OCC)COCC[Si](C)(C)C HOVZGRMJNKYNMR-UHFFFAOYSA-N 0.000 description 1
- 108010023610 IL13-PE38 Proteins 0.000 description 1
- 208000010159 IgA glomerulonephritis Diseases 0.000 description 1
- 206010021263 IgA nephropathy Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 229940123038 Integrin antagonist Drugs 0.000 description 1
- 102000008070 Interferon-gamma Human genes 0.000 description 1
- 108010074328 Interferon-gamma Proteins 0.000 description 1
- 208000003618 Intervertebral Disc Displacement Diseases 0.000 description 1
- 206010050296 Intervertebral disc protrusion Diseases 0.000 description 1
- 239000003810 Jones reagent Substances 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- 208000002260 Keloid Diseases 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- PWKSKIMOESPYIA-BYPYZUCNSA-N L-N-acetyl-Cysteine Chemical compound CC(=O)N[C@@H](CS)C(O)=O PWKSKIMOESPYIA-BYPYZUCNSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- YSDQQAXHVYUZIW-QCIJIYAXSA-N Liraglutide Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCNC(=O)CC[C@H](NC(=O)CCCCCCCCCCCCCCC)C(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=C(O)C=C1 YSDQQAXHVYUZIW-QCIJIYAXSA-N 0.000 description 1
- 108010019598 Liraglutide Proteins 0.000 description 1
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical compound [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 description 1
- 208000005777 Lupus Nephritis Diseases 0.000 description 1
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 1
- 206010025323 Lymphomas Diseases 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 102100040607 Lysophosphatidic acid receptor 1 Human genes 0.000 description 1
- 102100021948 Lysyl oxidase homolog 2 Human genes 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 101710132836 Membrane primary amine oxidase Proteins 0.000 description 1
- 206010027406 Mesothelioma Diseases 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 102100033127 Mitogen-activated protein kinase kinase kinase 5 Human genes 0.000 description 1
- 101710164337 Mitogen-activated protein kinase kinase kinase 5 Proteins 0.000 description 1
- UCHDWCPVSPXUMX-TZIWLTJVSA-N Montelukast Chemical compound CC(C)(O)C1=CC=CC=C1CC[C@H](C=1C=C(\C=C\C=2N=C3C=C(Cl)C=CC3=CC=2)C=CC=1)SCC1(CC(O)=O)CC1 UCHDWCPVSPXUMX-TZIWLTJVSA-N 0.000 description 1
- 208000034578 Multiple myelomas Diseases 0.000 description 1
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 1
- 201000004458 Myoma Diseases 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Substances BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 1
- PJJBRSKTEFCRLC-UHFFFAOYSA-N N1=C(C=CC=2CCCNC12)CCCCC=1N=CSC1 Chemical compound N1=C(C=CC=2CCCNC12)CCCCC=1N=CSC1 PJJBRSKTEFCRLC-UHFFFAOYSA-N 0.000 description 1
- 108010082699 NADPH Oxidase 4 Proteins 0.000 description 1
- 102100021872 NADPH oxidase 4 Human genes 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 208000000693 Neurogenic Urinary Bladder Diseases 0.000 description 1
- 206010029279 Neurogenic bladder Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- VYLOOGHLKSNNEK-PIIMJCKOSA-N OC(=O)c1cc(F)c2nc(sc2c1)N1[C@H]2CC[C@@H]1C[C@@H](C2)OCc1c(onc1-c1ccccc1OC(F)(F)F)C1CC1 Chemical compound OC(=O)c1cc(F)c2nc(sc2c1)N1[C@H]2CC[C@@H]1C[C@@H](C2)OCc1c(onc1-c1ccccc1OC(F)(F)F)C1CC1 VYLOOGHLKSNNEK-PIIMJCKOSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- 101100272976 Panax ginseng CYP716A53v2 gene Proteins 0.000 description 1
- 208000037273 Pathologic Processes Diseases 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 description 1
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 description 1
- 239000005922 Phosphane Substances 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 229910019020 PtO2 Inorganic materials 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229940127472 RNA Synthetase Inhibitors Drugs 0.000 description 1
- 208000032056 Radiation Fibrosis Syndrome Diseases 0.000 description 1
- 108091005682 Receptor kinases Proteins 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 206010039710 Scleroderma Diseases 0.000 description 1
- 208000034189 Sclerosis Diseases 0.000 description 1
- DLSWIYLPEUIQAV-UHFFFAOYSA-N Semaglutide Chemical compound CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CCC(O)=O)NC(=O)C(CCCCNC(=O)COCCOCCNC(=O)COCCOCCNC(=O)CCC(NC(=O)CCCCCCCCCCCCCCCCC(O)=O)C(O)=O)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(CCC(O)=O)NC(=O)C(CC(C)C)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(NC(=O)C(CC(O)=O)NC(=O)C(CO)NC(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)CNC(=O)C(CCC(O)=O)NC(=O)C(C)(C)NC(=O)C(N)Cc1cnc[nH]1)C(C)O)C(C)O)C(C)C)C(=O)NC(C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CCCNC(N)=N)C(=O)NCC(O)=O DLSWIYLPEUIQAV-UHFFFAOYSA-N 0.000 description 1
- 201000010208 Seminoma Diseases 0.000 description 1
- GIIZNNXWQWCKIB-UHFFFAOYSA-N Serevent Chemical compound C1=C(O)C(CO)=CC(C(O)CNCCCCCCOCCCCC=2C=CC=CC=2)=C1 GIIZNNXWQWCKIB-UHFFFAOYSA-N 0.000 description 1
- 102100036202 Serum amyloid P-component Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229940123518 Sodium/glucose cotransporter 2 inhibitor Drugs 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QJJXYPPXXYFBGM-LFZNUXCKSA-N Tacrolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1\C=C(/C)[C@@H]1[C@H](C)[C@@H](O)CC(=O)[C@H](CC=C)/C=C(C)/C[C@H](C)C[C@H](OC)[C@H]([C@H](C[C@H]2C)OC)O[C@@]2(O)C(=O)C(=O)N2CCCC[C@H]2C(=O)O1 QJJXYPPXXYFBGM-LFZNUXCKSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- KPWYNAGOBXLMSE-UHFFFAOYSA-N Tipelukast Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1SCCCOC1=CC=C(C(C)=O)C(OCCCC(O)=O)=C1CCC KPWYNAGOBXLMSE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 102100035140 Vitronectin Human genes 0.000 description 1
- 108010031318 Vitronectin Proteins 0.000 description 1
- 229920004482 WACKER® Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- OEXHQOGQTVQTAT-BZQJJPTISA-N [(1s,5r)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate Chemical compound C([C@H]1CC[C@@H](C2)[N+]1(C)C(C)C)C2OC(=O)C(CO)C1=CC=CC=C1 OEXHQOGQTVQTAT-BZQJJPTISA-N 0.000 description 1
- QJYYVSIRDJVQJW-UHFFFAOYSA-N [4-(dimethylcarbamoyl)phenyl]boronic acid Chemical compound CN(C)C(=O)C1=CC=C(B(O)O)C=C1 QJYYVSIRDJVQJW-UHFFFAOYSA-N 0.000 description 1
- CKUAXEQHGKSLHN-UHFFFAOYSA-N [C].[N] Chemical group [C].[N] CKUAXEQHGKSLHN-UHFFFAOYSA-N 0.000 description 1
- NBDWSVFZTMZZLM-UHFFFAOYSA-M [Cl-].COC1=CC=C([Mg+])C=N1 Chemical compound [Cl-].COC1=CC=C([Mg+])C=N1 NBDWSVFZTMZZLM-UHFFFAOYSA-M 0.000 description 1
- WEVYAHXRMPXWCK-FIBGUPNXSA-N acetonitrile-d3 Chemical compound [2H]C([2H])([2H])C#N WEVYAHXRMPXWCK-FIBGUPNXSA-N 0.000 description 1
- 229940121373 acetyl-coa carboxylase inhibitor Drugs 0.000 description 1
- 229960004308 acetylcysteine Drugs 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000614 adrenergic beta-2 receptor agonist Substances 0.000 description 1
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 1
- 208000026594 alcoholic fatty liver disease Diseases 0.000 description 1
- 229960000548 alemtuzumab Drugs 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminum chloride Substances Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000003510 anti-fibrotic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 125000005100 aryl amino carbonyl group Chemical group 0.000 description 1
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 1
- 125000004657 aryl sulfonyl amino group Chemical group 0.000 description 1
- 125000005164 aryl thioalkyl group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 229960003852 atezolizumab Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- YCZVMESBBDMVGY-UHFFFAOYSA-N benzyl 2-[3-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazol-3-yl]prop-2-ynyl]-2H-1,8-naphthyridine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=CC(=N1)C#CCC1C=CC2=CC=CN=C2N1C(=O)OCC1=CC=CC=C1 YCZVMESBBDMVGY-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- RQBJDYBQTYEVEG-UHFFFAOYSA-N benzylphosphane Chemical compound PCC1=CC=CC=C1 RQBJDYBQTYEVEG-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 239000003613 bile acid Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Substances BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- OTJZCIYGRUNXTP-UHFFFAOYSA-N but-3-yn-1-ol Chemical compound OCCC#C OTJZCIYGRUNXTP-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010804 cDNA synthesis Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 208000035269 cancer or benign tumor Diseases 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229950000771 carlumab Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000021164 cell adhesion Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000012292 cell migration Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 238000001023 centrifugal evaporation Methods 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 206010008118 cerebral infarction Diseases 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- ARQRPTNYUOLOGH-UHFFFAOYSA-N chcl3 chloroform Chemical compound ClC(Cl)Cl.ClC(Cl)Cl ARQRPTNYUOLOGH-UHFFFAOYSA-N 0.000 description 1
- IBGLGMOPHJQDJB-IHRRRGAJSA-N chembl1950289 Chemical compound C1C[C@@H](O)CC[C@@H]1NC1=NC=C(N=C(NC=2C(=CC(F)=CC=2F)F)N2[C@@H]3COCC3)C2=N1 IBGLGMOPHJQDJB-IHRRRGAJSA-N 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 229950010810 cintredekin besudotox Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000013066 combination product Substances 0.000 description 1
- 229940127555 combination product Drugs 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- XSYZCZPCBXYQTE-UHFFFAOYSA-N cyclodecylcyclodecane Chemical compound C1CCCCCCCCC1C1CCCCCCCCC1 XSYZCZPCBXYQTE-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 229960003834 dapagliflozin Drugs 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006567 deketalization reaction Methods 0.000 description 1
- 230000005595 deprotonation Effects 0.000 description 1
- 238000010537 deprotonation reaction Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- 229940111685 dibasic potassium phosphate Drugs 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 102000038379 digestive enzymes Human genes 0.000 description 1
- 108091007734 digestive enzymes Proteins 0.000 description 1
- NZZFYRREKKOMAT-UHFFFAOYSA-N diiodomethane Chemical compound ICI NZZFYRREKKOMAT-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- VHILMKFSCRWWIJ-UHFFFAOYSA-N dimethyl acetylenedicarboxylate Chemical compound COC(=O)C#CC(=O)OC VHILMKFSCRWWIJ-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- UZZWBUYVTBPQIV-UHFFFAOYSA-N dme dimethoxyethane Chemical compound COCCOC.COCCOC UZZWBUYVTBPQIV-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 201000008865 drug-induced hepatitis Diseases 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 229950000234 emricasan Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 239000002308 endothelin receptor antagonist Substances 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- OLAMWIPURJGSKE-UHFFFAOYSA-N et2o diethylether Chemical compound CCOCC.CCOCC OLAMWIPURJGSKE-UHFFFAOYSA-N 0.000 description 1
- UMYZHWLYICNGRQ-UHFFFAOYSA-N ethanol;heptane Chemical compound CCO.CCCCCCC UMYZHWLYICNGRQ-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- CGKLGLBFTLEQDH-UHFFFAOYSA-N ethyl 1-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]pyrazole-3-carboxylate Chemical compound CCOC(=O)c1ccn(CCCC2(C)OCCO2)n1 CGKLGLBFTLEQDH-UHFFFAOYSA-N 0.000 description 1
- MSPOSRHJXMILNK-UHFFFAOYSA-N ethyl 1h-pyrazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=NN1 MSPOSRHJXMILNK-UHFFFAOYSA-N 0.000 description 1
- CPQKGGOPHDHAMN-UHFFFAOYSA-N ethyl 3-amino-1h-pyrazole-5-carboxylate Chemical compound CCOC(=O)C1=CC(N)=NN1 CPQKGGOPHDHAMN-UHFFFAOYSA-N 0.000 description 1
- CQPDVIRUWZWRJE-UHFFFAOYSA-N ethyl 5-iodo-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate Chemical compound IC1=CC(=NN1COCC[Si](C)(C)C)C(=O)OCC CQPDVIRUWZWRJE-UHFFFAOYSA-N 0.000 description 1
- PKGRSCADNBDVRY-UHFFFAOYSA-N ethyl 5-iodo-1h-pyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(I)=NN1 PKGRSCADNBDVRY-UHFFFAOYSA-N 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 210000002950 fibroblast Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229940126374 fipaxalparant Drugs 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003709 fluoroalkyl group Chemical group 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 201000005206 focal segmental glomerulosclerosis Diseases 0.000 description 1
- 231100000854 focal segmental glomerulosclerosis Toxicity 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 150000002238 fumaric acids Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000006343 heptafluoro propyl group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004447 heteroarylalkenyl group Chemical group 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000005368 heteroarylthio group Chemical group 0.000 description 1
- 125000004366 heterocycloalkenyl group Chemical group 0.000 description 1
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000004896 high resolution mass spectrometry Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Substances OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- 150000004680 hydrogen peroxides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 239000003018 immunosuppressive agent Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 230000008611 intercellular interaction Effects 0.000 description 1
- 229960003130 interferon gamma Drugs 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- SYJRVVFAAIUVDH-UHFFFAOYSA-N ipa isopropanol Chemical compound CC(C)O.CC(C)O SYJRVVFAAIUVDH-UHFFFAOYSA-N 0.000 description 1
- 229960005386 ipilimumab Drugs 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000004936 isatinoyl group Chemical group N1(C(=O)C(=O)C2=CC=CC=C12)C(=O)* 0.000 description 1
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 210000001117 keloid Anatomy 0.000 description 1
- 208000011379 keloid formation Diseases 0.000 description 1
- 230000003907 kidney function Effects 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229950002183 lebrikizumab Drugs 0.000 description 1
- 229940065725 leukotriene receptor antagonists for obstructive airway diseases Drugs 0.000 description 1
- 239000003199 leukotriene receptor blocking agent Substances 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229960002701 liraglutide Drugs 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- 230000003908 liver function Effects 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000018977 lysine Nutrition 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 150000002691 malonic acids Chemical class 0.000 description 1
- 238000007726 management method Methods 0.000 description 1
- MMIPFLVOWGHZQD-UHFFFAOYSA-N manganese(3+) Chemical compound [Mn+3] MMIPFLVOWGHZQD-UHFFFAOYSA-N 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 210000004379 membrane Anatomy 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 210000003584 mesangial cell Anatomy 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical compound COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960005127 montelukast Drugs 0.000 description 1
- 239000003149 muscarinic antagonist Substances 0.000 description 1
- 206010028537 myelofibrosis Diseases 0.000 description 1
- ZUHZZVMEUAUWHY-UHFFFAOYSA-N n,n-dimethylpropan-1-amine Chemical compound CCCN(C)C ZUHZZVMEUAUWHY-UHFFFAOYSA-N 0.000 description 1
- PEECTLLHENGOKU-UHFFFAOYSA-N n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=NC=C1 PEECTLLHENGOKU-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 208000004296 neuralgia Diseases 0.000 description 1
- 208000021722 neuropathic pain Diseases 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 229960003301 nivolumab Drugs 0.000 description 1
- PSACHCMMPFMFAJ-UHFFFAOYSA-N nmm n-methylmorpholine Chemical compound CN1CCOCC1.CN1CCOCC1 PSACHCMMPFMFAJ-UHFFFAOYSA-N 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 238000002414 normal-phase solid-phase extraction Methods 0.000 description 1
- 238000005016 nuclear Overhauser enhanced spectroscopy Methods 0.000 description 1
- 230000000414 obstructive effect Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960002450 ofatumumab Drugs 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- ACSQLTBPYZSGBA-GMXVVIOVSA-N olorinab Chemical compound C([C@@H]1C[C@@H]1C=12)C=1C(C(=O)N[C@H](CO)C(C)(C)C)=NN2C1=C[N+]([O-])=CC=N1 ACSQLTBPYZSGBA-GMXVVIOVSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 210000002997 osteoclast Anatomy 0.000 description 1
- 125000005963 oxadiazolidinyl group Chemical group 0.000 description 1
- 150000002913 oxalic acids Chemical class 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000009054 pathological process Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 229960002621 pembrolizumab Drugs 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- ZHZCYWWNFQUZOR-UHFFFAOYSA-N pent-4-en-2-ol Chemical compound CC(O)CC=C ZHZCYWWNFQUZOR-UHFFFAOYSA-N 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 210000003668 pericyte Anatomy 0.000 description 1
- 208000033808 peripheral neuropathy Diseases 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 229910000064 phosphane Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- KASDHRXLYQOAKZ-ZPSXYTITSA-N pimecrolimus Chemical compound C/C([C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H]([C@H](C[C@H]2C)OC)[C@@H](OC)C[C@@H](C)C/C(C)=C/[C@H](C(C[C@H](O)[C@H]1C)=O)CC)=C\[C@@H]1CC[C@@H](Cl)[C@H](OC)C1 KASDHRXLYQOAKZ-ZPSXYTITSA-N 0.000 description 1
- 229960005330 pimecrolimus Drugs 0.000 description 1
- 229960005095 pioglitazone Drugs 0.000 description 1
- 125000004928 piperidonyl group Chemical group 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 description 1
- LYKMMUBOEFYJQG-UHFFFAOYSA-N piperoxan Chemical compound C1OC2=CC=CC=C2OC1CN1CCCCC1 LYKMMUBOEFYJQG-UHFFFAOYSA-N 0.000 description 1
- 210000000557 podocyte Anatomy 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 125000006684 polyhaloalkyl group Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 150000004033 porphyrin derivatives Chemical class 0.000 description 1
- 208000007232 portal hypertension Diseases 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 108010042589 prolyl T RNA synthetase Proteins 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 208000005069 pulmonary fibrosis Diseases 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000003908 quality control method Methods 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- ZAHRKKWIAAJSAO-UHFFFAOYSA-N rapamycin Natural products COCC(O)C(=C/C(C)C(=O)CC(OC(=O)C1CCCCN1C(=O)C(=O)C2(O)OC(CC(OC)C(=CC=CC=CC(C)CC(C)C(=O)C)C)CCC2C)C(C)CC3CCC(O)C(C3)OC)C ZAHRKKWIAAJSAO-UHFFFAOYSA-N 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 229960004641 rituximab Drugs 0.000 description 1
- 229960002052 salbutamol Drugs 0.000 description 1
- 229960004017 salmeterol Drugs 0.000 description 1
- MRWFZSLZNUJVQW-DEOSSOPVSA-N saroglitazar Chemical compound C1=CC(C[C@H](OCC)C(O)=O)=CC=C1OCCN1C(C=2C=CC(SC)=CC=2)=CC=C1C MRWFZSLZNUJVQW-DEOSSOPVSA-N 0.000 description 1
- 229950006544 saroglitazar Drugs 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 229950011186 semaglutide Drugs 0.000 description 1
- 108010060325 semaglutide Proteins 0.000 description 1
- 239000008299 semisolid dosage form Substances 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- RGYQPQARIQKJKH-UHFFFAOYSA-N setanaxib Chemical compound CN(C)C1=CC=CC(C2=C3C(=O)N(C=4C(=CC=CC=4)Cl)NC3=CC(=O)N2C)=C1 RGYQPQARIQKJKH-UHFFFAOYSA-N 0.000 description 1
- 229960003310 sildenafil Drugs 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 229950009513 simtuzumab Drugs 0.000 description 1
- QFJCIRLUMZQUOT-HPLJOQBZSA-N sirolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 QFJCIRLUMZQUOT-HPLJOQBZSA-N 0.000 description 1
- 229960002930 sirolimus Drugs 0.000 description 1
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- JEZLFWXSKCTMPN-ILCIQDJASA-M sodium;2-[(2s,3r,4e,6e,10e,12s)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate Chemical compound [Na+].[O-]C(=O)COC[C@H](O)[C@H](O)/C=C/C=C/C#C/C=C/[C@H](O)COC1=CC=C(F)C=C1 JEZLFWXSKCTMPN-ILCIQDJASA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 206010062261 spinal cord neoplasm Diseases 0.000 description 1
- 208000005198 spinal stenosis Diseases 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 229910000080 stannane Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000002466 tachykinin receptor agonist Substances 0.000 description 1
- 229960001967 tacrolimus Drugs 0.000 description 1
- QJJXYPPXXYFBGM-SHYZHZOCSA-N tacrolimus Natural products CO[C@H]1C[C@H](CC[C@@H]1O)C=C(C)[C@H]2OC(=O)[C@H]3CCCCN3C(=O)C(=O)[C@@]4(O)O[C@@H]([C@H](C[C@H]4C)OC)[C@@H](C[C@H](C)CC(=C[C@@H](CC=C)C(=O)C[C@H](O)[C@H]2C)C)OC QJJXYPPXXYFBGM-SHYZHZOCSA-N 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- JJXOIFHXNBFRNV-UHFFFAOYSA-N tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C JJXOIFHXNBFRNV-UHFFFAOYSA-N 0.000 description 1
- ZVGFXFJUAFCPLW-UHFFFAOYSA-N tert-butyl 2-[3-(1H-pyrazol-5-yl)propyl]-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate Chemical compound N1N=C(C=C1)CCCC=1C=CC2=C(N(CCCC2)C(=O)OC(C)(C)C)N=1 ZVGFXFJUAFCPLW-UHFFFAOYSA-N 0.000 description 1
- YRRDCNZLFGSVLN-UHFFFAOYSA-N tert-butyl 2-[3-[2-[3-[(2-methylpropan-2-yl)oxy]-1-(2-methylpyrimidin-5-yl)-3-oxopropyl]pyrazol-3-yl]propyl]-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate Chemical compound Cc1ncc(cn1)C(CC(=O)OC(C)(C)C)n1nccc1CCCc1ccc2CCCCN(C(=O)OC(C)(C)C)c2n1 YRRDCNZLFGSVLN-UHFFFAOYSA-N 0.000 description 1
- NFEGNISFSSLEGU-UHFFFAOYSA-N tert-butyl 2-diethoxyphosphorylacetate Chemical compound CCOP(=O)(OCC)CC(=O)OC(C)(C)C NFEGNISFSSLEGU-UHFFFAOYSA-N 0.000 description 1
- CVBRMQQRHHCMKV-UHFFFAOYSA-N tert-butyl 4-formylpyrazole-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=C(C=O)C=N1 CVBRMQQRHHCMKV-UHFFFAOYSA-N 0.000 description 1
- IJHJVBXIXJMORX-UHFFFAOYSA-N tert-butyl 7-(2-methoxy-2-oxoethyl)-3,4-dihydro-2h-1,8-naphthyridine-1-carboxylate Chemical compound C1CCN(C(=O)OC(C)(C)C)C2=NC(CC(=O)OC)=CC=C21 IJHJVBXIXJMORX-UHFFFAOYSA-N 0.000 description 1
- UVCCWXJGWMGZAB-UHFFFAOYSA-N tert-butyl-(1-methoxyethenoxy)-dimethylsilane Chemical compound COC(=C)O[Si](C)(C)C(C)(C)C UVCCWXJGWMGZAB-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- PHCBRBWANGJMHS-UHFFFAOYSA-J tetrasodium;disulfate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PHCBRBWANGJMHS-UHFFFAOYSA-J 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 125000004525 thiadiazinyl group Chemical group S1NN=C(C=C1)* 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- LERNTVKEWCAPOY-DZZGSBJMSA-N tiotropium Chemical compound O([C@H]1C[C@@H]2[N+]([C@H](C1)[C@@H]1[C@H]2O1)(C)C)C(=O)C(O)(C=1SC=CC=1)C1=CC=CS1 LERNTVKEWCAPOY-DZZGSBJMSA-N 0.000 description 1
- 229940110309 tiotropium Drugs 0.000 description 1
- 229950004996 tipelukast Drugs 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 229950000835 tralokinumab Drugs 0.000 description 1
- 108010008268 transforming growth factor type e Proteins 0.000 description 1
- 102000035160 transmembrane proteins Human genes 0.000 description 1
- 108091005703 transmembrane proteins Proteins 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- 229960005294 triamcinolone Drugs 0.000 description 1
- GFNANZIMVAIWHM-OBYCQNJPSA-N triamcinolone Chemical compound O=C1C=C[C@]2(C)[C@@]3(F)[C@@H](O)C[C@](C)([C@@]([C@H](O)C4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 GFNANZIMVAIWHM-OBYCQNJPSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical group CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 1
- 235000019798 tripotassium phosphate Nutrition 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- REQQVBGILUTQNN-UHFFFAOYSA-N ziritaxestat Chemical compound CCC=1N=C2C(C)=CC(N3CCN(CC(=O)N4CC(O)C4)CC3)=CN2C=1N(C)C(SC=1C#N)=NC=1C1=CC=C(F)C=C1 REQQVBGILUTQNN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/4353—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems
- A61K31/4375—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems the heterocyclic ring system containing a six-membered ring having nitrogen as a ring heteroatom, e.g. quinolizines, naphthyridines, berberine, vincamine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/16—Drugs for disorders of the alimentary tract or the digestive system for liver or gallbladder disorders, e.g. hepatoprotective agents, cholagogues, litholytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/18—Drugs for disorders of the alimentary tract or the digestive system for pancreatic disorders, e.g. pancreatic enzymes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
- A61P19/10—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease for osteoporosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Physical Education & Sports Medicine (AREA)
- Immunology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Rheumatology (AREA)
- Epidemiology (AREA)
- Pulmonology (AREA)
- Transplantation (AREA)
- Gastroenterology & Hepatology (AREA)
- Dermatology (AREA)
- Ophthalmology & Optometry (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Urology & Nephrology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201662418848P | 2016-11-08 | 2016-11-08 | |
| PCT/US2017/060376 WO2018089353A1 (en) | 2016-11-08 | 2017-11-07 | 3-substituted propionic acids as alpha v integrin inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA201991122A1 EA201991122A1 (ru) | 2019-10-31 |
| EA038164B1 true EA038164B1 (ru) | 2021-07-16 |
Family
ID=60409432
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA201991122A EA038164B1 (ru) | 2016-11-08 | 2017-11-07 | 3-замещенные пропановые кислоты в качестве ингибиторов интегрина v |
Country Status (30)
| Country | Link |
|---|---|
| US (2) | US10968219B2 (enExample) |
| EP (1) | EP3538525B1 (enExample) |
| JP (1) | JP7097358B2 (enExample) |
| KR (1) | KR102505629B1 (enExample) |
| CN (1) | CN110167935B (enExample) |
| AR (1) | AR110153A1 (enExample) |
| AU (1) | AU2017359023B2 (enExample) |
| CL (1) | CL2019001264A1 (enExample) |
| CO (1) | CO2019005824A2 (enExample) |
| CY (1) | CY1125496T1 (enExample) |
| DK (1) | DK3538525T3 (enExample) |
| EA (1) | EA038164B1 (enExample) |
| ES (1) | ES2925173T3 (enExample) |
| HR (1) | HRP20220990T1 (enExample) |
| HU (1) | HUE059708T2 (enExample) |
| IL (1) | IL266473B (enExample) |
| LT (1) | LT3538525T (enExample) |
| MA (1) | MA46743A (enExample) |
| MX (1) | MX380799B (enExample) |
| MY (1) | MY199931A (enExample) |
| NZ (1) | NZ754207A (enExample) |
| PE (1) | PE20191647A1 (enExample) |
| PL (1) | PL3538525T3 (enExample) |
| PT (1) | PT3538525T (enExample) |
| RS (1) | RS63483B1 (enExample) |
| SI (1) | SI3538525T1 (enExample) |
| SM (1) | SMT202200338T1 (enExample) |
| TW (1) | TWI763733B (enExample) |
| WO (1) | WO2018089353A1 (enExample) |
| ZA (1) | ZA201903665B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3509590A4 (en) | 2016-09-07 | 2020-12-02 | Pliant Therapeutics, Inc. | N-ACYL AMINO ACID COMPOUNDS AND METHODS OF USE |
| BR112019009245A2 (pt) * | 2016-11-08 | 2019-07-16 | Bristol-Myers Squibb Company | azol amidas e aminas como inibidores de alfav integrina |
| AU2017359023B2 (en) * | 2016-11-08 | 2021-12-09 | Bristol-Myers Squibb Company | 3-substituted propionic acids as alpha v integrin inhibitors |
| ES2984394T3 (es) * | 2016-11-08 | 2024-10-29 | Bristol Myers Squibb Co | Compuestos mono y espirocíclicos que contienen ciclobutano y azetidina como inhibidores de la integrina alfa v |
| US11306084B2 (en) | 2016-12-29 | 2022-04-19 | Saint Louis University | Integrin antagonists |
| MA52117A (fr) | 2017-02-28 | 2022-04-06 | Morphic Therapeutic Inc | Inhibiteurs de l'intégrine (alpha-v) (bêta-6) |
| MX394210B (es) | 2017-02-28 | 2025-03-04 | Morphic Therapeutic Inc | INHIBIDORES DE INTEGRINA AVß6. |
| SI3844162T1 (sl) | 2018-08-29 | 2025-06-30 | Morphic Therapeutic, Inc. | Zaviralci integrina alfa v beta6 |
| WO2020047239A1 (en) | 2018-08-29 | 2020-03-05 | Morphic Therapeutic, Inc. | INHIBITING αV β6 INTEGRIN |
| WO2020047208A1 (en) | 2018-08-29 | 2020-03-05 | Morphic Therapeutic, Inc. | Inhibitors of (alpha-v)(beta-6) integrin |
| EP3873605B1 (en) | 2018-10-30 | 2024-10-23 | Gilead Sciences, Inc. | Compounds for inhibition of alpha4beta7 integrin |
| ES3013256T3 (en) | 2018-10-30 | 2025-04-11 | Gilead Sciences Inc | Imidazo[1,2-a]pyridine derivatives as alpha4beta7 integrin inhibitors for the treatment of inflammatory diseases |
| FI3873884T3 (fi) | 2018-10-30 | 2025-02-24 | Gilead Sciences Inc | 3-(kinolin-8-yyli)-1,4-dihydropyrido[3,4-d]pyrimidiini-2,4-dionijohdannaisia alfa-4-beta-7-integriinin estäjinä tulehdussairauksien hoidossa |
| JP7189368B2 (ja) | 2018-10-30 | 2022-12-13 | ギリアード サイエンシーズ, インコーポレイテッド | アルファ4ベータ7インテグリンの阻害のための化合物 |
| CN109824495B (zh) * | 2019-02-02 | 2022-12-09 | 盐城师范学院 | 一种新型偶联反应在制备碳-碳键结构化合物中的应用 |
| WO2021030438A1 (en) | 2019-08-14 | 2021-02-18 | Gilead Sciences, Inc. | Compounds for inhibition of alpha 4 beta 7 integrin |
| GB202010626D0 (en) | 2020-07-10 | 2020-08-26 | Univ Nottingham | Compound |
| TW202513065A (zh) * | 2023-09-21 | 2025-04-01 | 美商莫菲克醫療股份有限公司 | 抑制人類整合素α5β1 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999030709A1 (en) * | 1997-12-17 | 1999-06-24 | Merck & Co., Inc. | Integrin receptor antagonists |
| US6090944A (en) * | 1998-08-13 | 2000-07-18 | Merck & Co., Inc. | Alkanoic acid derivatives as αv integrin receptor antagonists |
| US20080045521A1 (en) * | 2006-06-09 | 2008-02-21 | Astrazeneca Ab | Phenylalanine derivatives |
| US20080255183A1 (en) * | 2007-04-11 | 2008-10-16 | Astrazeneca Ab | N-[HETEROARYLCARBONYL]-3-THIENYL-L-ALANINE DERIVATIVES AS a5beta1 ANTAGONISTS |
| US20160264566A1 (en) * | 2015-03-10 | 2016-09-15 | The Regents Of The University Of California | Anti-alphavbeta1 integrin inhibitors and methods of use |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0451790A1 (de) * | 1990-04-12 | 1991-10-16 | Hoechst Aktiengesellschaft | 3,5-disubstituierte 2-Isoxazoline und Isoxazole, Verfahren zu deren Herstellung, diese enthaltende Mittel und ihre Verwendung |
| US5849736A (en) | 1993-11-24 | 1998-12-15 | The Dupont Merck Pharmaceutical Company | Isoxazoline and isoxazole fibrinogen receptor antagonists |
| ZA972195B (en) | 1996-03-15 | 1998-09-14 | Du Pont Merck Pharma | Spirocycle integrin inhibitors |
| CA2309204A1 (en) | 1997-11-26 | 1999-06-03 | Dupont Pharmaceuticals Company | 1,3,4-thiadiazoles and 1,3,4-oxadiazoles as .alpha.v.beta.3 antagonists |
| CA2436130A1 (en) | 2001-01-29 | 2002-08-08 | Ortho-Mcneil Pharmaceutical, Inc. | Substituted indoles and their use as integrin antagonists |
| EP1592421A1 (en) * | 2002-12-20 | 2005-11-09 | Pharmacia Corporation | Heteroarylalkanoic acids as integrin receptor antagonists |
| AU2003297409A1 (en) * | 2002-12-20 | 2004-07-22 | Pharmacia Corporation | Pyrazole compounds as integrin receptor antagonists derivatives |
| WO2006108040A1 (en) | 2005-04-05 | 2006-10-12 | Janssen Pharmaceutica, N.V. | Substituted indoles and their use as integrin antagonists |
| TW200800999A (en) * | 2005-09-06 | 2008-01-01 | Astrazeneca Ab | Novel compounds |
| US7592461B2 (en) | 2005-12-21 | 2009-09-22 | Bristol-Myers Squibb Company | Indane modulators of glucocorticoid receptor, AP-1, and/or NF-κB activity and use thereof |
| AR059224A1 (es) | 2006-01-31 | 2008-03-19 | Jerini Ag | Compuestos para la inhibicion de integrinas y uso de estas |
| JP2013503834A (ja) | 2009-09-04 | 2013-02-04 | ビーエーエスエフ ソシエタス・ヨーロピア | 1−フェニルピラゾールの製造方法 |
| MX2012004995A (es) | 2009-10-29 | 2012-10-03 | Sirtris Pharmaceuticals Inc | Piridinas biciclicas y analogos como moduladores de sirtuina. |
| ITFI20100019A1 (it) | 2010-02-12 | 2011-08-13 | Univ Firenze | Inibitori peptidomimetici di integrine basati sull'1,2,3-triazolo per la diagnosi e terapia dei tumori. |
| GB201305668D0 (en) | 2013-03-28 | 2013-05-15 | Glaxosmithkline Ip Dev Ltd | Avs6 Integrin Antagonists |
| TWI667233B (zh) | 2013-12-19 | 2019-08-01 | 德商拜耳製藥公司 | 新穎吲唑羧醯胺,其製備方法、含彼等之醫藥製劑及其製造醫藥之用途 |
| GB201417002D0 (en) | 2014-09-26 | 2014-11-12 | Glaxosmithkline Ip Dev Ltd | Novel compound |
| GB201417094D0 (en) | 2014-09-26 | 2014-11-12 | Glaxosmithkline Ip Dev Ltd | Novel compounds |
| GB201417018D0 (en) | 2014-09-26 | 2014-11-12 | Glaxosmithkline Ip Dev Ltd | Novel compounds |
| GB201417011D0 (en) | 2014-09-26 | 2014-11-12 | Glaxosmithkline Ip Dev Ltd | Novel compounds |
| US9790222B2 (en) | 2015-02-19 | 2017-10-17 | Scifluor Life Sciences, Inc. | Fluorinated tetrahydronaphthyridinyl nonanoic acid derivatives and uses thereof |
| AU2017359023B2 (en) * | 2016-11-08 | 2021-12-09 | Bristol-Myers Squibb Company | 3-substituted propionic acids as alpha v integrin inhibitors |
-
2017
- 2017-11-07 AU AU2017359023A patent/AU2017359023B2/en active Active
- 2017-11-07 EP EP17801230.8A patent/EP3538525B1/en active Active
- 2017-11-07 HU HUE17801230A patent/HUE059708T2/hu unknown
- 2017-11-07 NZ NZ754207A patent/NZ754207A/en unknown
- 2017-11-07 HR HRP20220990TT patent/HRP20220990T1/hr unknown
- 2017-11-07 MX MX2019005244A patent/MX380799B/es unknown
- 2017-11-07 ES ES17801230T patent/ES2925173T3/es active Active
- 2017-11-07 EA EA201991122A patent/EA038164B1/ru unknown
- 2017-11-07 DK DK17801230.8T patent/DK3538525T3/da active
- 2017-11-07 KR KR1020197016082A patent/KR102505629B1/ko active Active
- 2017-11-07 JP JP2019523576A patent/JP7097358B2/ja active Active
- 2017-11-07 PE PE2019000940A patent/PE20191647A1/es unknown
- 2017-11-07 CN CN201780082473.2A patent/CN110167935B/zh active Active
- 2017-11-07 MA MA046743A patent/MA46743A/fr unknown
- 2017-11-07 PT PT178012308T patent/PT3538525T/pt unknown
- 2017-11-07 SM SM20220338T patent/SMT202200338T1/it unknown
- 2017-11-07 WO PCT/US2017/060376 patent/WO2018089353A1/en not_active Ceased
- 2017-11-07 US US16/347,844 patent/US10968219B2/en active Active
- 2017-11-07 PL PL17801230.8T patent/PL3538525T3/pl unknown
- 2017-11-07 RS RS20220759A patent/RS63483B1/sr unknown
- 2017-11-07 MY MYPI2019002576A patent/MY199931A/en unknown
- 2017-11-07 LT LTEPPCT/US2017/060376T patent/LT3538525T/lt unknown
- 2017-11-07 SI SI201731195T patent/SI3538525T1/sl unknown
- 2017-11-08 TW TW106138533A patent/TWI763733B/zh active
- 2017-11-08 AR ARP170103105A patent/AR110153A1/es unknown
-
2019
- 2019-05-06 IL IL266473A patent/IL266473B/en unknown
- 2019-05-08 CL CL2019001264A patent/CL2019001264A1/es unknown
- 2019-06-04 CO CONC2019/0005824A patent/CO2019005824A2/es unknown
- 2019-06-07 ZA ZA2019/03665A patent/ZA201903665B/en unknown
-
2021
- 2021-02-24 US US17/184,179 patent/US11884661B2/en active Active
-
2022
- 2022-08-18 CY CY20221100561T patent/CY1125496T1/el unknown
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999030709A1 (en) * | 1997-12-17 | 1999-06-24 | Merck & Co., Inc. | Integrin receptor antagonists |
| US6090944A (en) * | 1998-08-13 | 2000-07-18 | Merck & Co., Inc. | Alkanoic acid derivatives as αv integrin receptor antagonists |
| US20080045521A1 (en) * | 2006-06-09 | 2008-02-21 | Astrazeneca Ab | Phenylalanine derivatives |
| US20080255183A1 (en) * | 2007-04-11 | 2008-10-16 | Astrazeneca Ab | N-[HETEROARYLCARBONYL]-3-THIENYL-L-ALANINE DERIVATIVES AS a5beta1 ANTAGONISTS |
| US20160264566A1 (en) * | 2015-03-10 | 2016-09-15 | The Regents Of The University Of California | Anti-alphavbeta1 integrin inhibitors and methods of use |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US11884661B2 (en) | 3-substituted propionic acids as αV integrin inhibitors | |
| US11028071B2 (en) | Indazole derivatives as alpha v integrin antagonists | |
| JP7264810B2 (ja) | アルファvインテグリン阻害剤としてのシクロブタン-およびアゼチジン-含有の単環およびスピロ環式化合物 | |
| CN110167933B (zh) | 作为αV整联蛋白抑制剂的唑酰胺和胺 | |
| US10717736B2 (en) | Pyrrole amides as alpha V integrin inhibitors | |
| CA3042707C (en) | 3-substituted propionic acids as .alpha.v integrin inhibitors | |
| BR112019009199B1 (pt) | Compostos de ácidos propiônicos 3-substituídos, composição farmacêutica e seus usos como inibidores de alfa v integrina | |
| HK40009959A (en) | 3-substituted propionic acids as alpha v integrin inhibitors | |
| HK40009959B (en) | 3-substituted propionic acids as alpha v integrin inhibitors |