DK150483C - Analogifremgangsmaade til fremstilling af trans-3-(4-oxo-4h-quinazolin-3-yl)-2-propensyrederivater eller salte deraf med farmaceutisk acceptablesyrer - Google Patents
Analogifremgangsmaade til fremstilling af trans-3-(4-oxo-4h-quinazolin-3-yl)-2-propensyrederivater eller salte deraf med farmaceutisk acceptablesyrerInfo
- Publication number
- DK150483C DK150483C DK294780A DK294780A DK150483C DK 150483 C DK150483 C DK 150483C DK 294780 A DK294780 A DK 294780A DK 294780 A DK294780 A DK 294780A DK 150483 C DK150483 C DK 150483C
- Authority
- DK
- Denmark
- Prior art keywords
- quinazolin
- analogue
- oxo
- trans
- salts
- Prior art date
Links
- JVXJNZOYMJJARA-AATRIKPKSA-N (e)-3-(4-oxoquinazolin-3-yl)prop-2-enoic acid Chemical class C1=CC=C2C(=O)N(/C=C/C(=O)O)C=NC2=C1 JVXJNZOYMJJARA-AATRIKPKSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000007513 acids Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/90—Oxygen atoms with acyclic radicals attached in position 2 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5572879A | 1979-07-09 | 1979-07-09 | |
| US5572879 | 1979-07-09 | ||
| US14290380 | 1980-04-23 | ||
| US06/142,903 US4281127A (en) | 1979-07-09 | 1980-04-23 | Trans-3-(4-oxo-4H-quinazolin-3-yl)-2-propenoic acid derivatives |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK294780A DK294780A (da) | 1981-01-10 |
| DK150483B DK150483B (da) | 1987-03-09 |
| DK150483C true DK150483C (da) | 1987-11-09 |
Family
ID=26734565
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK294780A DK150483C (da) | 1979-07-09 | 1980-07-08 | Analogifremgangsmaade til fremstilling af trans-3-(4-oxo-4h-quinazolin-3-yl)-2-propensyrederivater eller salte deraf med farmaceutisk acceptablesyrer |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4281127A (enFirst) |
| EP (1) | EP0023594B1 (enFirst) |
| AR (1) | AR226854A1 (enFirst) |
| AU (1) | AU521014B2 (enFirst) |
| CA (1) | CA1134825A (enFirst) |
| DE (1) | DE3067830D1 (enFirst) |
| DK (1) | DK150483C (enFirst) |
| ES (2) | ES8106302A1 (enFirst) |
| FI (1) | FI74279C (enFirst) |
| GR (1) | GR65952B (enFirst) |
| HK (1) | HK52187A (enFirst) |
| HU (1) | HU184797B (enFirst) |
| IE (1) | IE49938B1 (enFirst) |
| IL (1) | IL60514A (enFirst) |
| MC (1) | MC1333A1 (enFirst) |
| NO (1) | NO154426C (enFirst) |
| NZ (1) | NZ194259A (enFirst) |
| PH (1) | PH16413A (enFirst) |
| PT (1) | PT71512B (enFirst) |
| SG (1) | SG20887G (enFirst) |
| YU (1) | YU42348B (enFirst) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4599336A (en) * | 1983-08-08 | 1986-07-08 | Hoffmann-La Roche Inc. | Derivatives of (E)-3-(4-oxo-4H-quinazolin-3-yl)-2-propenamide |
| GB9404485D0 (en) * | 1994-03-09 | 1994-04-20 | Cancer Res Campaign Tech | Benzamide analogues |
| US6706721B1 (en) * | 1998-04-29 | 2004-03-16 | Osi Pharmaceuticals, Inc. | N-(3-ethynylphenylamino)-6,7-bis(2-methoxyethoxy)-4-quinazolinamine mesylate anhydrate and monohydrate |
| US6545004B1 (en) * | 1999-10-27 | 2003-04-08 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| US7230000B1 (en) | 1999-10-27 | 2007-06-12 | Cytokinetics, Incorporated | Methods and compositions utilizing quinazolinones |
| UA74803C2 (uk) | 1999-11-11 | 2006-02-15 | Осі Фармасьютікалз, Інк. | Стійкий поліморф гідрохлориду n-(3-етинілфеніл)-6,7-біс(2-метоксіетокси)-4-хіназолінаміну, спосіб його одержання (варіанти) та фармацевтичне застосування |
| US7087613B2 (en) * | 1999-11-11 | 2006-08-08 | Osi Pharmaceuticals, Inc. | Treating abnormal cell growth with a stable polymorph of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-4-quinazolinamine hydrochloride |
| WO2003070701A2 (en) * | 2002-02-15 | 2003-08-28 | Cytokinetics, Inc. | Syntheses of quinazolinones |
| AU2003270015A1 (en) | 2002-05-09 | 2003-12-02 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| WO2003094839A2 (en) * | 2002-05-09 | 2003-11-20 | Cytokinetics, Inc. | Pyrimidinone compounds, compositions and methods |
| JP2005536475A (ja) * | 2002-05-23 | 2005-12-02 | サイトキネティクス・インコーポレーテッド | 化合物、組成物、および方法 |
| EP1556357A4 (en) * | 2002-06-14 | 2006-09-13 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
| EP1537089A4 (en) * | 2002-07-23 | 2008-04-16 | Cytokinetics Inc | CONNECTIONS, COMPOSITIONS AND PROCEDURES |
| AU2003262747A1 (en) * | 2002-08-21 | 2004-03-11 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| EP1558083A4 (en) * | 2002-09-30 | 2008-04-16 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
| WO2005041888A2 (en) * | 2003-11-03 | 2005-05-12 | Cytokinetics, Inc. | Pyrimidin-4-one compounds, compositions and methods |
| US20050148593A1 (en) * | 2003-11-07 | 2005-07-07 | Gustave Bergnes | Compounds, compositions, and methods |
| JP2007513154A (ja) * | 2003-12-08 | 2007-05-24 | サイトキネティクス・インコーポレーテッド | 化合物、組成物及び方法 |
| UY29198A1 (es) * | 2004-11-09 | 2006-05-31 | Cancer Rec Tech Ltd | Derivados sustituidos de quinazolinona y derivados sustituidos de quinazolina-2, 4-diona, composiciones conteniéndolos, procedimientos de preparación y aplicaciones |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2786055A (en) * | 1955-02-10 | 1957-03-19 | Mallinckrodt Chemical Works | Carboxyalkyl-iodoquinazolones |
| US3517005A (en) * | 1967-10-26 | 1970-06-23 | Pfizer & Co C | Certain 2- and 4-substituted quinazolines |
| US3696102A (en) * | 1970-03-09 | 1972-10-03 | Pfizer & Co C | Process for the synthesis of substituted quinazolin-4-ones |
-
1980
- 1980-04-23 US US06/142,903 patent/US4281127A/en not_active Expired - Lifetime
- 1980-07-07 GR GR62402A patent/GR65952B/el unknown
- 1980-07-07 MC MC801458A patent/MC1333A1/fr unknown
- 1980-07-07 NZ NZ194259A patent/NZ194259A/en unknown
- 1980-07-07 CA CA000355555A patent/CA1134825A/en not_active Expired
- 1980-07-07 IL IL60514A patent/IL60514A/xx unknown
- 1980-07-07 HU HU801690A patent/HU184797B/hu not_active IP Right Cessation
- 1980-07-08 DE DE8080103896T patent/DE3067830D1/de not_active Expired
- 1980-07-08 PT PT71512A patent/PT71512B/pt unknown
- 1980-07-08 NO NO802056A patent/NO154426C/no unknown
- 1980-07-08 IE IE1412/80A patent/IE49938B1/en not_active IP Right Cessation
- 1980-07-08 DK DK294780A patent/DK150483C/da active
- 1980-07-08 EP EP80103896A patent/EP0023594B1/de not_active Expired
- 1980-07-08 ES ES493203A patent/ES8106302A1/es not_active Expired
- 1980-07-08 AR AR281693A patent/AR226854A1/es active
- 1980-07-09 YU YU1766/80A patent/YU42348B/xx unknown
- 1980-07-09 FI FI802195A patent/FI74279C/fi not_active IP Right Cessation
- 1980-07-09 AU AU60244/80A patent/AU521014B2/en not_active Ceased
- 1980-07-09 PH PH24261A patent/PH16413A/en unknown
-
1981
- 1981-02-02 ES ES499035A patent/ES499035A0/es active Granted
-
1987
- 1987-02-26 SG SG208/87A patent/SG20887G/en unknown
- 1987-07-09 HK HK521/87A patent/HK52187A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI74279B (fi) | 1987-09-30 |
| ES8207155A1 (es) | 1982-09-16 |
| DK150483B (da) | 1987-03-09 |
| GR65952B (enFirst) | 1981-01-09 |
| NO154426B (no) | 1986-06-09 |
| DE3067830D1 (en) | 1984-06-20 |
| FI74279C (fi) | 1988-01-11 |
| NZ194259A (en) | 1984-09-28 |
| HK52187A (en) | 1987-07-17 |
| EP0023594B1 (de) | 1984-05-16 |
| ES493203A0 (es) | 1981-05-16 |
| AU6024480A (en) | 1981-03-12 |
| YU176680A (en) | 1984-12-31 |
| PT71512A (en) | 1980-08-01 |
| FI802195A7 (fi) | 1981-01-10 |
| NO802056L (no) | 1981-01-12 |
| US4281127A (en) | 1981-07-28 |
| EP0023594A1 (de) | 1981-02-11 |
| MC1333A1 (fr) | 1981-04-21 |
| IE49938B1 (en) | 1986-01-08 |
| IL60514A0 (en) | 1980-09-16 |
| NO154426C (no) | 1986-09-17 |
| AU521014B2 (en) | 1982-03-11 |
| ES499035A0 (es) | 1982-09-16 |
| IL60514A (en) | 1985-03-31 |
| ES8106302A1 (es) | 1981-05-16 |
| IE801412L (en) | 1981-01-09 |
| HU184797B (en) | 1984-10-29 |
| CA1134825A (en) | 1982-11-02 |
| PT71512B (en) | 1981-12-11 |
| AR226854A1 (es) | 1982-08-31 |
| DK294780A (da) | 1981-01-10 |
| YU42348B (en) | 1988-08-31 |
| PH16413A (en) | 1983-09-29 |
| SG20887G (en) | 1988-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK163244C (da) | Analogifremgangsmaade til fremstilling af 7-oe2-(2-aminothiazol-4-yl)-2-oxyimino-acetamidoaa-ceph-3-em-4-carboxylsyrederivater eller fysiologisk acceptable salte deraf | |
| DK161770C (da) | Analogifremgangsmaade til fremstilling af cyklobutylaminderivater eller farmaceutisk acceptable salte deraf | |
| DK162714C (da) | Analogifremgangsmaade til fremstilling af glycinamidderivater eller syreadditionssalte deraf | |
| DK145339C (da) | Analogifremgangsmaade til fremstilling af 4-amino-5-hexensyre eller farmaceutisk acceptable salte deraf | |
| DK149449C (da) | Analogifremgangsmaade til fremstilling af carbostyrilderivater eller farmaceutisk acceptable salte deraf | |
| DK157860C (da) | Analogifremgangsmaade til fremstilling af benzylimidazolderivater samt farmaceutisk acceptable syreadditionssalte deraf | |
| DK149594C (da) | Analogifremgangsmaade til fremstilling af dipeptidderivater eller syreadditionssalte heraf | |
| DK154555C (da) | Analogifremgangsmaade til fremstilling af carbazolyl-(4)-oxy-propanolaminderivater eller deres farmakologisk anvendelige salte | |
| DK147362C (da) | Analogifremgangsmaade til fremstilling af ergolen- eller ergolin-derivater eller syreadditionssalte deraf | |
| DK160250C (da) | Analogifremgangsmaade til fremstilling af 4-substituerede piperidinoalkanon-derivater eller farmaceutisk acceptable salte deraf | |
| DK151623C (da) | Analogifremgangsmaade til fremstilling af n-substituerede moranolinderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK150483C (da) | Analogifremgangsmaade til fremstilling af trans-3-(4-oxo-4h-quinazolin-3-yl)-2-propensyrederivater eller salte deraf med farmaceutisk acceptablesyrer | |
| DK156513C (da) | Analogifremgangsmaade til fremstilling af omega-cyan-1,-omega-diphenyl-azaalkanderivater eller salte deraf med fysiologisk acceptable syrer | |
| DK149609C (da) | Analogifremgangsmaade til fremstilling af hydroxyamino-alkan- eller -alkenphosphonsyrederivater eller estere eller salte deraf | |
| DK152114C (da) | Analogifremgangsmaade til fremstilling af propenylaminer eller farmaceutisk acceptable salte deraf | |
| DK149569C (da) | Analogifremgangsmaade til fremstilling af isoquinolineddikesyre-forbindelser eller farmaceutisk acceptable salte deraf | |
| DK159119C (da) | Analogifremgangsmaade til fremstilling af syreadditionssalte af 3alfa-acyloxy-2beta,16beta-dipiperidino-5alfa-androstanderivater samt fremgangsmaade til fremstilling af farmaceutiske oploesninger deraf | |
| DK148117C (da) | Analogifremgangsmaade til fremstilling af 2-(2-thenoylthio)-propionylglycin eller farmakologisk acceptable salte deraf med baser | |
| DK147940C (da) | Analogifremgangsmaade til fremstilling af 4-substituerede thiazol-2-oxamsyrederivater eller salte eller estre deraf | |
| DK155670C (da) | Analogifremgangsmaade til fremstilling af sesquiterpenderivater eller farmaceutisk acceptable salte deraf | |
| DK158658C (da) | Analogifremgangsmaade til fremstilling af 9-aminoalkylfluorener eller farmaceutisk acceptable salte deraf | |
| DK149269C (da) | Analogifremgangsmaade til fremstilling af beta-mono- eller -difluormethyl-beta-alanin-derivater eller farmaceutisk acceptable salte eller optiske isomere deraf | |
| DK142544C (da) | Analogifremgangsmaade til fremstilling af 2-(n-propargyl-n-phenylamino)-imidazolin-(2)-derivater eller fysiologisk acceptable syreadditionssalte heraf | |
| DK149077C (da) | Analogifremgangsmaade til fremstilling af encephalin-analoge pentapeptidamidderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK149841C (da) | Analogifremgangsmaade til fremstilling af alfa-fluor-methyl-alfa-aminoalkansyrer eller farmaceutisk acceptable syreadditionssalte deraf |