DK141621B - Fremgangsmåde til fremstilling af succinyloravsyrediestere. - Google Patents
Fremgangsmåde til fremstilling af succinyloravsyrediestere. Download PDFInfo
- Publication number
- DK141621B DK141621B DK151273AA DK151273A DK141621B DK 141621 B DK141621 B DK 141621B DK 151273A A DK151273A A DK 151273AA DK 151273 A DK151273 A DK 151273A DK 141621 B DK141621 B DK 141621B
- Authority
- DK
- Denmark
- Prior art keywords
- succinylorboxylic
- preparation
- acid
- acid diesters
- esters
- Prior art date
Links
- 239000002253 acid Substances 0.000 title description 11
- 150000005690 diesters Chemical class 0.000 title description 7
- 238000000034 method Methods 0.000 title description 6
- 238000002360 preparation method Methods 0.000 title description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 5
- 235000019439 ethyl acetate Nutrition 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 3
- LOLKAJARZKDJTD-UHFFFAOYSA-N 4-Ethoxy-4-oxobutanoic acid Chemical compound CCOC(=O)CCC(O)=O LOLKAJARZKDJTD-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000012062 aqueous buffer Substances 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NRCMAYZCPIVABH-UHFFFAOYSA-N Quinacridone Chemical compound N1C2=CC=CC=C2C(=O)C2=C1C=C1C(=O)C3=CC=CC=C3NC1=C2 NRCMAYZCPIVABH-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/757—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH423772A CH560670A5 (enExample) | 1972-03-22 | 1972-03-22 | |
| CH423772 | 1972-03-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK141621B true DK141621B (da) | 1980-05-12 |
| DK141621C DK141621C (enExample) | 1980-10-13 |
Family
ID=4272359
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK151273AA DK141621B (da) | 1972-03-22 | 1973-03-20 | Fremgangsmåde til fremstilling af succinyloravsyrediestere. |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3803209A (enExample) |
| JP (1) | JPS4947349A (enExample) |
| AR (1) | AR193933A1 (enExample) |
| AT (1) | AT323127B (enExample) |
| BE (1) | BE797181A (enExample) |
| BG (1) | BG20098A3 (enExample) |
| BR (1) | BR7301961D0 (enExample) |
| CA (1) | CA1023763A (enExample) |
| CH (1) | CH560670A5 (enExample) |
| CS (1) | CS161814B2 (enExample) |
| DD (1) | DD105801A5 (enExample) |
| DE (1) | DE2313329C2 (enExample) |
| DK (1) | DK141621B (enExample) |
| ES (1) | ES412876A1 (enExample) |
| FR (1) | FR2177064B1 (enExample) |
| GB (1) | GB1356909A (enExample) |
| HU (1) | HU167321B (enExample) |
| IT (1) | IT979907B (enExample) |
| LU (1) | LU67266A1 (enExample) |
| NL (1) | NL7303817A (enExample) |
| NO (1) | NO138881C (enExample) |
| PL (1) | PL91814B1 (enExample) |
| RO (1) | RO60154A (enExample) |
| SE (1) | SE396945B (enExample) |
| SU (1) | SU476746A3 (enExample) |
| ZA (1) | ZA731942B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH563334A5 (enExample) * | 1974-05-07 | 1975-06-30 | Lonza Ag | |
| JPS5262248A (en) * | 1975-11-17 | 1977-05-23 | Nippon Synthetic Chem Ind Co Ltd:The | Preparation of diesters of succinylsuccinic acid |
| US4056551A (en) * | 1975-11-17 | 1977-11-01 | Nippon Gohsei Kagaku Kogyo Kabushiki Kaisha | Preparation of succinylsuccinic acid diesters |
| JPS5563397A (en) * | 1978-10-31 | 1980-05-13 | Mitsubishi Electric Corp | Manufacture of bolling heat transmission surface |
| JPS6183895A (ja) * | 1984-09-28 | 1986-04-28 | Hitachi Ltd | 伝熱面およびその製造方法 |
-
1972
- 1972-03-22 CH CH423772A patent/CH560670A5/xx not_active IP Right Cessation
- 1972-07-13 US US00271359A patent/US3803209A/en not_active Expired - Lifetime
-
1973
- 1973-03-06 GB GB1076373A patent/GB1356909A/en not_active Expired
- 1973-03-14 CS CS1839A patent/CS161814B2/cs unknown
- 1973-03-16 CA CA166,256A patent/CA1023763A/en not_active Expired
- 1973-03-17 DE DE2313329A patent/DE2313329C2/de not_active Expired
- 1973-03-19 JP JP48032546A patent/JPS4947349A/ja active Pending
- 1973-03-19 AT AT241173A patent/AT323127B/de not_active IP Right Cessation
- 1973-03-19 NL NL7303817A patent/NL7303817A/xx not_active Application Discontinuation
- 1973-03-19 DD DD169554A patent/DD105801A5/xx unknown
- 1973-03-20 AR AR247136A patent/AR193933A1/es active
- 1973-03-20 SE SE7303917A patent/SE396945B/xx unknown
- 1973-03-20 BR BR731961A patent/BR7301961D0/pt unknown
- 1973-03-20 SU SU1896324A patent/SU476746A3/ru active
- 1973-03-20 PL PL1973161376A patent/PL91814B1/pl unknown
- 1973-03-20 DK DK151273AA patent/DK141621B/da not_active IP Right Cessation
- 1973-03-20 ZA ZA731942A patent/ZA731942B/xx unknown
- 1973-03-20 NO NO731120A patent/NO138881C/no unknown
- 1973-03-20 IT IT48892/73A patent/IT979907B/it active
- 1973-03-21 ES ES412876A patent/ES412876A1/es not_active Expired
- 1973-03-21 RO RO74255A patent/RO60154A/ro unknown
- 1973-03-21 BG BG023050A patent/BG20098A3/xx unknown
- 1973-03-21 HU HULO403A patent/HU167321B/hu unknown
- 1973-03-22 BE BE129135A patent/BE797181A/xx not_active IP Right Cessation
- 1973-03-22 LU LU67266A patent/LU67266A1/xx unknown
- 1973-03-22 FR FR7310365A patent/FR2177064B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| RO60154A (enExample) | 1976-05-15 |
| DE2313329A1 (de) | 1973-10-04 |
| PL91814B1 (enExample) | 1977-03-31 |
| IT979907B (it) | 1974-09-30 |
| BE797181A (fr) | 1973-09-24 |
| GB1356909A (en) | 1974-06-19 |
| DD105801A5 (enExample) | 1974-05-12 |
| AU5366873A (en) | 1974-09-26 |
| JPS4947349A (enExample) | 1974-05-08 |
| DK141621C (enExample) | 1980-10-13 |
| NO138881B (no) | 1978-08-21 |
| BG20098A3 (bg) | 1975-10-30 |
| BR7301961D0 (pt) | 1974-07-25 |
| CH560670A5 (enExample) | 1975-04-15 |
| NL7303817A (enExample) | 1973-09-25 |
| ZA731942B (en) | 1974-03-27 |
| NO138881C (no) | 1978-11-29 |
| FR2177064A1 (enExample) | 1973-11-02 |
| AR193933A1 (es) | 1973-05-31 |
| CA1023763A (en) | 1978-01-03 |
| SU476746A3 (ru) | 1975-07-05 |
| LU67266A1 (enExample) | 1973-09-26 |
| CS161814B2 (enExample) | 1975-06-10 |
| DE2313329C2 (de) | 1984-07-19 |
| US3803209A (en) | 1974-04-09 |
| AT323127B (de) | 1975-06-25 |
| SE396945B (sv) | 1977-10-10 |
| FR2177064B1 (enExample) | 1976-09-10 |
| ES412876A1 (es) | 1975-12-16 |
| HU167321B (enExample) | 1975-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2506258C2 (ru) | Способ получения активированных сложных эфиров | |
| DK141621B (da) | Fremgangsmåde til fremstilling af succinyloravsyrediestere. | |
| Yamazaki et al. | Synthesis of inosine, 2-alkylinosine, and xanthosine from 5-amino-1-. beta.-D-ribofuranosyl-4-imidazolecarboxamide | |
| US4510083A (en) | Process for preparing polypeptides | |
| US3393253A (en) | Ureidophosphonates and preparation thereof | |
| US2709164A (en) | Process for the production of peptides | |
| Kurzer | 221. Cyanamides. Part I. The synthesis of substituted arylsulphonylcyanamides | |
| US3280136A (en) | 5-substituted-2, 4-oxazolidinediones and magnesium chelate intermediates therefor | |
| US2921960A (en) | Substituted amino-carboxylic acid amides and method of making the same | |
| KR920004137B1 (ko) | 이미다졸 유도체의 제조방법 | |
| SU561504A3 (ru) | Способ получени 2,2",3,3"тетракарбоксидиангидрида дифенилового эфира | |
| SU819103A1 (ru) | Способ получени 5-аминобензофуразана | |
| US6291710B1 (en) | Process for preparing sulfonyl halides | |
| FI59414B (fi) | Foerfarande foer framstaellning av alfa-karboxibensylpenicillin eller alfa-karboxi-3-tienylmetylpenicillin | |
| GB1195854A (en) | Oxazole Derivatives and process of producing the same | |
| SU578863A3 (ru) | Способ выделени сложных эфиров -защищенных аминокислот из их водных растворов | |
| SU376388A1 (ru) | ^СОЮЗНАЯtfАвторыIс2М1 i..!j s п V I г-ЛГ!>&; \л v?lr.j;[ БИБЛИО7Е?14 |В. В. Рожкова и Т. М. Александрова | |
| SU1710551A1 (ru) | Способ получени @ -бензиловых эфиров N-защищенных дикарбоновых аминокислот | |
| SU518125A3 (ru) | Способ получени 1-фенокси-2-окси-3аминопропана или его солей | |
| US20250376430A1 (en) | Difluoroaldehyde, epoxy, and derivative thereof | |
| US650408A (en) | Process of making acidyl morphin esters. | |
| DK153877C (da) | Fremgangsmaade til fremstilling af hydrazidiner eller syreadditionssalte deraf ud fra amidiner | |
| SU522170A1 (ru) | Способ получени 6-бром-1,2-нафтохинона/бонафтона | |
| Hattori et al. | Synthesis and condensation polymerization of N‐(3‐carboxy‐2‐hydroxypropyl) derivatives of purine bases | |
| JP2663295B2 (ja) | ヘキサジエン酸誘導体及びその製法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |