DEU0003124MA - - Google Patents
Info
- Publication number
- DEU0003124MA DEU0003124MA DEU0003124MA DE U0003124M A DEU0003124M A DE U0003124MA DE U0003124M A DEU0003124M A DE U0003124MA
- Authority
- DE
- Germany
- Prior art keywords
- acid
- oil
- isanoic
- vol
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002253 acid Substances 0.000 claims description 38
- 239000003921 oil Substances 0.000 claims description 14
- 235000019198 oils Nutrition 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 239000000344 soap Substances 0.000 claims description 10
- 241001031074 Ongokea gore Species 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 238000000926 separation method Methods 0.000 claims description 6
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000000049 pigment Substances 0.000 claims description 2
- 235000019488 nut oil Nutrition 0.000 claims 1
- 239000010466 nut oil Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 7
- 235000015112 vegetable and seed oil Nutrition 0.000 description 7
- 239000008158 vegetable oil Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000007127 saponification reaction Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- KWLVIGJGNBJKPA-UHFFFAOYSA-N Isanolic acid Chemical compound OC(=O)CCCCCCC(O)C#CC#CCCCCC=C KWLVIGJGNBJKPA-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- -1 alkali metal salts Chemical class 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Natural products CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- OIRKEYBSXAKFEG-UHFFFAOYSA-N ethynyl hydrogen carbonate Chemical compound C(=O)(O)OC#C OIRKEYBSXAKFEG-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- DKFFITSUIIXFPL-UHFFFAOYSA-N penta-2,4-diynoic acid Chemical compound OC(=O)C#CC#C DKFFITSUIIXFPL-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011973 solid acid Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69208120T2 (de) | Verfahren zur Herstellung von Ferulasäure | |
| DE69434277T2 (de) | Wiedergewinnung von Tocopherolen | |
| EP1074540B1 (de) | Verfahren zur Gewinnung von gesättigten Dicarbonsäuren aus der Ozonolyse ungesättigter Fettsäuren | |
| DE2004899C2 (de) | Verfahren zur Abtrennung von Verunreinigungen aus Saccharosefettsäureester-Rohprodukten | |
| DE2358297C2 (de) | Verfahren zur Gewinnung von reinem 3,3,7,7-Tetrahydroxymethyl-5-oxanonan | |
| DE1219484B (de) | Verfahren zur Herstellung von Peroxycarbonsaeuren | |
| DE959908C (de) | Verfahren zur Abtrennung der Isansaeure aus isansaeurehaltigem Bolekooel | |
| DEU0003124MA (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | ||
| DE951865C (de) | Verfahren zur Herstellung von AEthylenglykolestern der Terephthalsaeure | |
| DE2829806C2 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | ||
| DD297396A5 (de) | Verfahren zur behandlung von fettsaeuren | |
| DE2163742A1 (de) | Trennung von gesättigten und ungesättigten Fettsäuren | |
| DE864992C (de) | Verfahren zur Herstellung von cyclischen Polycarbonsaeuren bzw. deren Gemischen | |
| DE862151C (de) | Verfahren zur Abtrennung sauerstoffhaltiger Verbindungen, vorwiegend Carbonsaeuren, aus den Produkten der katalytischen Kohlenoxydhydrierung | |
| DE2111196A1 (de) | Verfahren zur Gewinnung von Adipinsaeure | |
| DE924752C (de) | Verfahren zur Herstellung von Tricyclodekandicarbonsaeure aus Tricyclodekandimethylol durch Alkalischmelze | |
| DE1695714C3 (de) | Verfahren zur Gewinnung von optisch reiner (+)-trans-Chrysanthemummonocarbonsäure | |
| DE1468038C (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | ||
| DE1011411B (de) | Verfahren zur Gewinnung reiner tert. Butylbenzoesaeuren | |
| EP0316729B1 (de) | Verfahren zum Anreichern von Tocopherolen in natürlichen Quellen | |
| DE1274132B (de) | Verfahren zur Herstellung von L-(í¬)-ª-(3, 4-Dihydroxyphenyl)-ª-methyl-alanin | |
| DE963330C (de) | Verfahren zur Gewinnung von reiner Pimelinsaeure | |
| DE929552C (de) | Verfahren zur Reinigung von technischen Polychlorphenoxyfettsaeuren | |
| DE1235486B (de) | Verfahren zum Raffinieren von pflanzlichen und tierischen OElen | |
| DE209382C (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) |