DER0017133MA - - Google Patents
Info
- Publication number
- DER0017133MA DER0017133MA DER0017133MA DE R0017133M A DER0017133M A DE R0017133MA DE R0017133M A DER0017133M A DE R0017133MA
- Authority
- DE
- Germany
- Prior art keywords
- temperatures
- sulfuric acid
- mixtures
- polymerization
- hydrocarbon
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 25
- 229930195733 hydrocarbon Natural products 0.000 claims description 23
- 150000002430 hydrocarbons Chemical class 0.000 claims description 23
- 239000004215 Carbon black (E152) Substances 0.000 claims description 19
- 238000005984 hydrogenation reaction Methods 0.000 claims description 13
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 8
- 238000007670 refining Methods 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 238000006116 polymerization reaction Methods 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 230000007935 neutral effect Effects 0.000 claims description 5
- 229910052759 nickel Inorganic materials 0.000 claims description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 238000002156 mixing Methods 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 3
- 244000052769 pathogen Species 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- 238000000746 purification Methods 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- BNPLZQNJUQUSOB-UHFFFAOYSA-N CC(C)([K])C1=CC=CC=C1 Chemical compound CC(C)([K])C1=CC=CC=C1 BNPLZQNJUQUSOB-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- -1 polyethylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP1263707B1 (de) | Verfahren zur herstellung aliphatischer carbonsäuren aus aldehyden | |
EP0223035A1 (de) | Verwendung von modifizierten Raney-Katalysatoren zur Herstellung von aromatischen Diaminoverbindungen | |
DE102006022168A1 (de) | Katalytisches Verfahren zur Herstellung von aliphatischen geradkettigen und ß-alkylverzweigten Carbonsäuren | |
DE3728222A1 (de) | Verfahren zur herstellung von ethercarbonsaeuren | |
EP0328920B1 (de) | Verfahren zur Herstellung von 1,2,4-Butantriol | |
DER0017133MA (cs) | ||
EP0177912B1 (de) | Verfahren zur Herstellung von Alkandiolen | |
EP0204917B1 (de) | Verfahren zur Aufarbeitung von Cyclohexanol, Cyclohexanon sowie Cyclohexylhydroperoxid enthaltenden Reaktionsgemischen | |
EP0121760A1 (de) | Verfahren zur Herstellung von 3-Hydroxytetrahydrofuran | |
DE961477C (de) | Verfahren zur Reinigung von Hilfsfluessigkeiten fuer die Herstellung von Polyaethylen | |
DE938062C (de) | Verfahren zur Herstellung sauerstoffhaltiger organischer Verbindungen | |
DE3524475C2 (cs) | ||
EP0001291B1 (de) | Verfahren zur Herstellung von Tetrahydrofuran aus Butandiol-1,4 | |
DE3002826C2 (de) | Verfahren zur Herstellung von α-Epoxiden mit 11 bis 24 Kohlenstoffatomen | |
DE762535C (de) | Verfahren zur Herstellung von hoehermolekularen Carbonsaeuren | |
DE890945C (de) | Verfahren zur Herstellung von AEthylenglykol | |
DE287660C (cs) | ||
DE4321766A1 (de) | Verfahren zur gleichzeitigen Herstellung von Essigsäure, Methylacetat und Essigsäureanhydrid | |
DE939687C (de) | Verfahren zur Herstellung seifenbildender Fettsaeuren durch Oxydation von Kohlenwasserstoffen aus der Kohlenoxydhydrierung | |
DE750330C (de) | Verfahren zur Herstellung organischer Schwefelverbindungen, die Halogen in leicht verseifbarer Form enthalten | |
US3657293A (en) | Production of alkanoic acids | |
DE931404C (de) | Verfahren zur Herstellung eines Alkoholgemisches aus aliphatischen Kohlenwasserstoffen | |
DE931463C (de) | Verfahren zur synthetischen Gewinnung von hochsiedenden viskosen Kohlenwasserstoffgemischen | |
DE864594C (de) | Verfahren zur Herstellung von Seifen | |
DE68914665T2 (de) | Katalysator zur Entfernung von Peroxid-Verunreinigungen aus tertiärem Butylalkohol. |