DEP0055074DA - - Google Patents
Info
- Publication number
- DEP0055074DA DEP0055074DA DEP0055074DA DE P0055074D A DEP0055074D A DE P0055074DA DE P0055074D A DEP0055074D A DE P0055074DA
- Authority
- DE
- Germany
- Prior art keywords
- oxide
- enamel
- devices
- silica
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 210000003298 dental enamel Anatomy 0.000 claims description 24
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 5
- 229910000464 lead oxide Inorganic materials 0.000 claims description 5
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 claims description 5
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 3
- 239000004327 boric acid Substances 0.000 claims description 3
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 3
- 239000000292 calcium oxide Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 3
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 claims description 3
- 229910001950 potassium oxide Inorganic materials 0.000 claims description 3
- 239000000377 silicon dioxide Substances 0.000 claims description 3
- 229910001948 sodium oxide Inorganic materials 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 2
- 101100465000 Mus musculus Prag1 gene Proteins 0.000 claims 2
- 238000010292 electrical insulation Methods 0.000 claims 1
- 239000010410 layer Substances 0.000 description 8
- 230000002349 favourable effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000007496 glass forming Methods 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000615 nonconductor Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69806714T2 (de) | Kalknatron-silikatglaszusammensetzungen und deren anwendungen | |
| DE69520759T2 (de) | Kalknatron-Silikatglaszusammensetzungen und deren Anwendungen | |
| DE4430710C1 (de) | Borsäurearmes Borosilikatglas und seine Verwendung | |
| EP0992462B1 (de) | Borosilicatglas hoher chemischer Beständigkeit und dessen Verwendung | |
| DE102006028763B4 (de) | Alkali- blei- und cadmiumfreie Glasfritte, Verfahren zu deren Herstellung und deren Verwendung, Verfahren zur Herstellung einer keramischen Farbe und daraus erhältliche keramische Farbe | |
| DE10337362A1 (de) | Borosilicatglas und seine Verwendungen | |
| DE102015116097B4 (de) | Chemisch beständiges Glas und dessen Verwendung | |
| DE2034393B2 (de) | Anwendung des Verfahrens zur Erhöhung der mechanischen Festigkeit eines Glases durch Austausch von Natriumionen gegen Kaliumionen auf ein Glas, das verkürzte Austauschzeiten ermöglicht | |
| EP0588000A1 (de) | Chemisch und thermisch hochbelastbares, mit Wolfram verschmelzbares Borosilikatglas | |
| DE4201286A1 (de) | Blei- und cadmiumfreie glaszusammensetzung zum glasieren, emaillieren und verzieren und ihre verwendung | |
| EP0297255A2 (de) | Borosilikatglas | |
| EP0526769A1 (de) | Getrübtes Email für Direkt-emaillierungen auf ungebeiztem Stahlblech | |
| DE1496653B2 (de) | Glas metall verbundkoerper mit einer hochlegierten hochtempe raturbestaendigen metallunterlage und teilweise kristallisier ten emailueberzuegen und verfahren zu seiner herstellung | |
| EP0729921A2 (de) | Selbsttrübende Emailfritten für die Emaillierung von Aluminium oder Aluminiumlegierungen | |
| DE1923729A1 (de) | Glasige Loetglaeser | |
| DE2446742A1 (de) | Glaslotzusammensetzung | |
| EP0547263B1 (de) | Bleifreies Zinksilikat-Kristallglas und dessen Verwendung | |
| DE2117944A1 (de) | Emaillierglas und emaillierter Glaskeramikkörper | |
| DE1496652A1 (de) | Semikristallisierte Grundueberzuege und emaillierte Gegenstaende | |
| DE845247C (de) | Glaeser, insbesondere Zwischenglaeser | |
| DEP0055074DA (enExample) | ||
| DE1496467A1 (de) | Verfahren zur Herstellung einer Abdichtung als vorgeformte Teile verbindender Koerper oder als auf wenigstens einem Teil der Oberflaeche eines vorgeformten Koerpers haftend gebundene Materialschicht | |
| EP0658521B1 (de) | Blei- und cadmiumfreie Glasfrittenzusammensetzung | |
| DE802973C (de) | Technisches Email | |
| DE10150239A1 (de) | Bleifreie Glasrohre, deren Verwendung und Dioden |