DEI0007195MA - - Google Patents
Info
- Publication number
- DEI0007195MA DEI0007195MA DEI0007195MA DE I0007195M A DEI0007195M A DE I0007195MA DE I0007195M A DEI0007195M A DE I0007195MA
- Authority
- DE
- Germany
- Prior art keywords
- charge
- cylindrical
- burning
- burn
- cartridge
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 claims description 2
- 239000007789 gas Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000000020 Nitrocellulose Substances 0.000 description 8
- 229920001220 nitrocellulos Polymers 0.000 description 8
- 239000000843 powder Substances 0.000 description 7
- 239000002737 fuel gas Substances 0.000 description 4
- 238000002485 combustion reaction Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 2
- 239000000006 Nitroglycerin Substances 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 238000004026 adhesive bonding Methods 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 229960003711 glyceryl trinitrate Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 1
- 229920002160 Celluloid Polymers 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 230000004308 accommodation Effects 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- PZIMIYVOZBTARW-UHFFFAOYSA-N centralite Chemical compound C=1C=CC=CC=1N(CC)C(=O)N(CC)C1=CC=CC=C1 PZIMIYVOZBTARW-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- -1 nitrocellulose compound Chemical class 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69104781T2 (de) | Patronenhülsenelement mit verbrennbarer Hülse, mit einem solchen Element versehene halbverbrennbare Munition und Verfahren zum Laden dieser Munition. | |
| DE3238270C2 (de) | Manöverpatrone | |
| DE2914049C2 (de) | Patrone | |
| DE2105295C1 (de) | Pulverkörper für hülsenlose Munition | |
| DE10207209A1 (de) | Verfahren zur Herstellung eines großkalibrigen Sprenggeschosses und Sprenggeschoß, hergestellt nach diesem Verfahren | |
| DE2265398B1 (de) | Patrone | |
| DE7818115U1 (de) | Treibspiegelgeschoss mit pyrotechnischem satz | |
| DE1109577B (de) | Brennstoffladung fuer eine Vorrichtung zur Gaserzeugung | |
| DE2143605A1 (de) | Patrone und Verfahren zu deren Her stellung | |
| DE949726C (de) | Kraftgas erzeugende Ladung | |
| DE2319705C3 (de) | Geschoß für Feuerwaffen | |
| DE1146784B (de) | Zuendpatrone | |
| DE69109982T2 (de) | Anzündeinlage für die Haupttreibladung einer teleskopischen Munition. | |
| DE952159C (de) | Kraftgas erzeugende Patrone | |
| DE1428680A1 (de) | Verbesserungen an Huelsen fuer Feuerwaffenmunition | |
| DEI0007195MA (enrdf_load_stackoverflow) | ||
| DE7020829U (de) | Selbstangetriebenes geschoss fuer feuerwaffen und schiesswerkzeuge. | |
| DE1056429B (de) | Pulverraketenantrieb | |
| DE1578207A1 (de) | Zerfallgeschoss fuer Ziel-UEbungspatronen | |
| CH318827A (de) | Treibgas erzeugende Ladung | |
| DE1057462B (de) | Gaserzeugungsladungen fuer Startzwecke | |
| DE2605324C2 (de) | Feuerwerksrakete | |
| CH654407A5 (de) | Verfahren und vorrichtung zum zuenden der treibladung in einer ein gas erzeugenden kartusche sowie kartusche mit der vorrichtung. | |
| AT248298B (de) | Kartusche für Artilleriemunition | |
| DE2852173C1 (de) | Treibmittelkoerper fuer huelsenlose Munition fuer UEbungszwecke und Verfahren zu seiner Herstellung |