DE809491C - Piezoelektrischer Umformer - Google Patents
Piezoelektrischer UmformerInfo
- Publication number
- DE809491C DE809491C DEP45579A DEP0045579A DE809491C DE 809491 C DE809491 C DE 809491C DE P45579 A DEP45579 A DE P45579A DE P0045579 A DEP0045579 A DE P0045579A DE 809491 C DE809491 C DE 809491C
- Authority
- DE
- Germany
- Prior art keywords
- electrodes
- electrode
- parts
- shaft
- opposite
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 20
- 238000005452 bending Methods 0.000 claims description 9
- 230000008878 coupling Effects 0.000 claims description 3
- 238000010168 coupling process Methods 0.000 claims description 3
- 238000005859 coupling reaction Methods 0.000 claims description 3
- 239000002356 single layer Substances 0.000 claims description 2
- 230000033001 locomotion Effects 0.000 description 16
- 239000003989 dielectric material Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 230000010355 oscillation Effects 0.000 description 5
- 230000010287 polarization Effects 0.000 description 5
- JRPBQTZRNDNNOP-UHFFFAOYSA-N barium titanate Chemical compound [Ba+2].[Ba+2].[O-][Ti]([O-])([O-])[O-] JRPBQTZRNDNNOP-UHFFFAOYSA-N 0.000 description 4
- 229910002113 barium titanate Inorganic materials 0.000 description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000005686 electrostatic field Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- VEALVRVVWBQVSL-UHFFFAOYSA-N strontium titanate Chemical compound [Sr+2].[O-][Ti]([O-])=O VEALVRVVWBQVSL-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04R—LOUDSPEAKERS, MICROPHONES, GRAMOPHONE PICK-UPS OR LIKE ACOUSTIC ELECTROMECHANICAL TRANSDUCERS; DEAF-AID SETS; PUBLIC ADDRESS SYSTEMS
- H04R17/00—Piezoelectric transducers; Electrostrictive transducers
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04R—LOUDSPEAKERS, MICROPHONES, GRAMOPHONE PICK-UPS OR LIKE ACOUSTIC ELECTROMECHANICAL TRANSDUCERS; DEAF-AID SETS; PUBLIC ADDRESS SYSTEMS
- H04R17/00—Piezoelectric transducers; Electrostrictive transducers
- H04R17/04—Gramophone pick-ups using a stylus; Recorders using a stylus
Landscapes
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Acoustics & Sound (AREA)
- Signal Processing (AREA)
- Transducers For Ultrasonic Waves (AREA)
- Rehabilitation Tools (AREA)
- General Electrical Machinery Utilizing Piezoelectricity, Electrostriction Or Magnetostriction (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US32587A US2515446A (en) | 1948-06-12 | 1948-06-12 | Electromechanical transducer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE809491C true DE809491C (de) | 1951-07-30 |
Family
ID=21865718
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP45579A Expired DE809491C (de) | 1948-06-12 | 1949-06-12 | Piezoelektrischer Umformer |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2515446A (show.php) |
| BE (1) | BE489589A (show.php) |
| CH (1) | CH279345A (show.php) |
| DE (1) | DE809491C (show.php) |
| FR (1) | FR988236A (show.php) |
| GB (1) | GB659869A (show.php) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1000608B (de) * | 1952-11-17 | 1957-01-10 | Electroacustic Gmbh | Tonabnehmer mit als Bieger wirkenden elektroakustischen Wandlern |
| DE1101032B (de) * | 1954-04-27 | 1961-03-02 | Dr Hans Karl Hach | Elektrostriktiver Wandler aus keramischem Material und Verfahren zu seiner Herstellung |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2944118A (en) * | 1960-07-05 | Binaural phonograph pickup | ||
| US2719929A (en) * | 1955-10-04 | brown | ||
| US2640889A (en) * | 1949-05-17 | 1953-06-02 | Zenith Radio Corp | Piezoelectric transducer |
| US2756353A (en) * | 1950-04-10 | 1956-07-24 | Gen Electric | Bender-mode piezoelectric device and method of making the same |
| US2760181A (en) * | 1951-10-08 | 1956-08-21 | Bendix Aviat Corp | Transducer having adjustable electrical impedance |
| US2928068A (en) * | 1952-03-25 | 1960-03-08 | Gen Electric | Compressional wave transducer and method of making the same |
| DE936868C (de) * | 1952-06-19 | 1955-12-22 | Siemens Ag | Verfahren zur Erzeugung von Aerosolen |
| US3168623A (en) * | 1954-10-13 | 1965-02-02 | Gulton Ind Inc | Piezoelectric transducer |
| US2928069A (en) * | 1954-10-13 | 1960-03-08 | Gulton Ind Inc | Transducer |
| US2944117A (en) * | 1955-06-20 | 1960-07-05 | Erie Resistor Corp | Bender type piezoelectric transducer |
| US3115588A (en) * | 1958-02-05 | 1963-12-24 | Raytheon Co | Electroacoustical apparatus |
| NL110623C (show.php) * | 1958-02-10 | |||
| NL236717A (show.php) * | 1958-03-03 | |||
| US3374367A (en) * | 1966-01-21 | 1968-03-19 | John V. Cowan | Electroacoustic transducers |
| US3543059A (en) * | 1968-10-28 | 1970-11-24 | Us Navy | Fluted cylinder for underwater transducer |
| US4834610A (en) * | 1986-04-25 | 1989-05-30 | Bond Iii Frederick W | Wind processing air turbine, and methods of constructing and utilizing same |
| US4782910A (en) * | 1986-05-23 | 1988-11-08 | Mobil Oil Corporation | Bi-polar bender transducer for logging tools |
| DE3622557A1 (de) * | 1986-07-04 | 1988-02-18 | Leitz Ernst Gmbh | Piezoelektrische feinpositioniervorrichtung |
| CA2066084A1 (en) * | 1991-05-31 | 1992-12-01 | Gordon Walter Culp | Twisting actuators |
| JP2007158276A (ja) * | 2005-12-08 | 2007-06-21 | Ngk Insulators Ltd | 圧電/電歪デバイス及び圧電/電歪デバイスの駆動方法 |
| US20230358654A1 (en) * | 2022-05-09 | 2023-11-09 | David Solomon | Methods Circuits Devices Assemblies Systems and Functionally Associated Machine Executable Code for Detecting Structural Cracking or Breaking a Functional Element |
-
0
- BE BE489589D patent/BE489589A/xx unknown
-
1948
- 1948-06-12 US US32587A patent/US2515446A/en not_active Expired - Lifetime
-
1949
- 1949-06-03 GB GB14948/49A patent/GB659869A/en not_active Expired
- 1949-06-12 DE DEP45579A patent/DE809491C/de not_active Expired
- 1949-06-13 FR FR988236D patent/FR988236A/fr not_active Expired
- 1949-06-13 CH CH279345D patent/CH279345A/de unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1000608B (de) * | 1952-11-17 | 1957-01-10 | Electroacustic Gmbh | Tonabnehmer mit als Bieger wirkenden elektroakustischen Wandlern |
| DE1101032B (de) * | 1954-04-27 | 1961-03-02 | Dr Hans Karl Hach | Elektrostriktiver Wandler aus keramischem Material und Verfahren zu seiner Herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| GB659869A (en) | 1951-10-31 |
| BE489589A (show.php) | |
| US2515446A (en) | 1950-07-18 |
| FR988236A (fr) | 1951-08-24 |
| CH279345A (de) | 1951-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE809491C (de) | Piezoelektrischer Umformer | |
| DE4202650C2 (de) | Piezoelektrische bimorphe Einrichtung und Verfahren zum Treiben einer piezoelektrischen bimorphen Einrichtung | |
| DE1967130C2 (de) | Mechanisch-elektrisch bzw. elektrisch-mechanischer Wandler | |
| DE1200890B (de) | Biegungsschwinger aus scheibenfoermigem elektrostriktivem Material | |
| DE1487304A1 (de) | Elektromechanischer akustischer UEbertrager | |
| DE2109063A1 (de) | Piezoelektrischer Motor | |
| EP0109120A2 (de) | Keramisches bistabiles Biegeelement | |
| DE3330538A1 (de) | Piezoelektrisches stellglied | |
| DE2035629A1 (de) | Piezoelektrischer Wandler | |
| DE1466152B2 (de) | Piezoelektrischer biegeschwinger der bimorphbauart und verfahren zur herstellung desselben | |
| DE1806124C3 (de) | Piezoelektrischer Transformator. Ausscheidung aus: 1817919 | |
| DE2231467B2 (de) | Piezoelektrische Anordnung und Verfahren zur Vermeidung von Ubersprechkapazitäten | |
| DE3221145A1 (de) | Selbstklebender piezoelektrischer wandler und vorrichtung zur anwendung des wandlers | |
| DE1023909B (de) | Elektromechanisches Umwandlungselement mit einem plattenfoermigen Koerper aus keramischem piezoelektrischem Material | |
| DE2745050C2 (de) | Material aus flüssigen Kristallen | |
| DE965540C (de) | Elektromechanisches Umformelement mit einem Koerper aus keramischem piezoelektrischem Material | |
| AT224179B (de) | Biegungsschwinger aus plättchenförmigem, elektrostriktivem Material | |
| DE965541C (de) | Elektromechanisches Umformelement mit zwei durch eine Zwischenschicht aneinander befestigten plattenfoermigen Koerpern aus keramischem piezoelektrischem Material | |
| DE2915019A1 (de) | Piezoelektrischer biegeschwinger | |
| DE1616505C (de) | Piezoelektrisches Ubei tragungs element | |
| DE2507329C3 (de) | Ferroelektrischer Analogwertspeicher | |
| DE2444647B2 (de) | Piezoelektrischer biegewandler | |
| DE463188C (de) | Piezoelektrische Vorrichtung mit mehreren Elementen | |
| DE2131614A1 (de) | Funktionselement nach dem Oberflaechenwellenprinzip,insbesondere Frequenzfilter oder Ultraschallverzoegerungsleitung | |
| DE709095C (de) | Kapselung mit elastischer Einspannung fuer piezoelektrische Kristalle |