DE69525021T2 - Verfahren zur Herstellung vor insektiziden Arylpyrrolen aus Oxazolamin Zwischenprodukte - Google Patents
Verfahren zur Herstellung vor insektiziden Arylpyrrolen aus Oxazolamin ZwischenprodukteInfo
- Publication number
- DE69525021T2 DE69525021T2 DE69525021T DE69525021T DE69525021T2 DE 69525021 T2 DE69525021 T2 DE 69525021T2 DE 69525021 T DE69525021 T DE 69525021T DE 69525021 T DE69525021 T DE 69525021T DE 69525021 T2 DE69525021 T2 DE 69525021T2
- Authority
- DE
- Germany
- Prior art keywords
- halogen
- formula
- c4alkyl
- independently represent
- represent hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000002360 preparation method Methods 0.000 title claims description 20
- 238000000034 method Methods 0.000 title claims description 16
- ACTKAGSPIFDCMF-UHFFFAOYSA-N 1,3-oxazol-2-amine Chemical compound NC1=NC=CO1 ACTKAGSPIFDCMF-UHFFFAOYSA-N 0.000 title claims description 13
- 230000008569 process Effects 0.000 title claims description 13
- 239000000543 intermediate Substances 0.000 title description 21
- 230000000749 insecticidal effect Effects 0.000 title description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 32
- 150000002367 halogens Chemical class 0.000 claims description 32
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- 239000001257 hydrogen Substances 0.000 claims description 26
- 150000001875 compounds Chemical class 0.000 claims description 19
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 18
- 150000002431 hydrogen Chemical class 0.000 claims description 18
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 16
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 11
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 10
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 10
- -1 C1-C4alkylthio Chemical group 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims description 6
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 6
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 6
- ZXLQPJBQKJYNGN-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(trifluoromethyl)-1h-pyrrole-3-carbonitrile Chemical compound N1C(C(F)(F)F)=CC(C#N)=C1C1=CC=C(Cl)C=C1 ZXLQPJBQKJYNGN-UHFFFAOYSA-N 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 6
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 6
- 150000001266 acyl halides Chemical class 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 229910015900 BF3 Inorganic materials 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000007787 solid Substances 0.000 description 10
- 238000005160 1H NMR spectroscopy Methods 0.000 description 6
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 6
- 238000004293 19F NMR spectroscopy Methods 0.000 description 5
- 238000006736 Huisgen cycloaddition reaction Methods 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- 150000003233 pyrroles Chemical class 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 3
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 3
- 230000000895 acaricidal effect Effects 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- LFUMGEZWRAFYQW-UHFFFAOYSA-N n-[(4-chlorophenyl)-cyanomethyl]-2,2,2-trifluoroacetamide Chemical compound FC(F)(F)C(=O)NC(C#N)C1=CC=C(Cl)C=C1 LFUMGEZWRAFYQW-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- IVDHYYCFEMRCDZ-UHFFFAOYSA-N 2-(trifluoromethyl)-1h-pyrrole Chemical class FC(F)(F)C1=CC=CN1 IVDHYYCFEMRCDZ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000001422 N-substituted pyrroles Chemical class 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 230000001069 nematicidal effect Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- PCYWMDGJYQAMCR-UHFFFAOYSA-N 1h-pyrrole-3-carbonitrile Chemical compound N#CC=1C=CNC=1 PCYWMDGJYQAMCR-UHFFFAOYSA-N 0.000 description 1
- RJJDLPQZNANQDQ-UHFFFAOYSA-N 2,3-dichloropropanenitrile Chemical compound ClCC(Cl)C#N RJJDLPQZNANQDQ-UHFFFAOYSA-N 0.000 description 1
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 1
- DQRFCVHLNUNVPL-UHFFFAOYSA-N 2h-1,3-oxazol-5-one Chemical compound O=C1OCN=C1 DQRFCVHLNUNVPL-UHFFFAOYSA-N 0.000 description 1
- DHIRGTQTUUJMKA-UHFFFAOYSA-N 4-(trifluoromethyl)-3H-1,3-oxazol-2-one Chemical class OC1=NC(C(F)(F)F)=CO1 DHIRGTQTUUJMKA-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 101100422771 Caenorhabditis elegans sup-9 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-OUBTZVSYSA-N Carbon-13 Chemical compound [13C] OKTJSMMVPCPJKN-OUBTZVSYSA-N 0.000 description 1
- 241001364932 Chrysodeixis Species 0.000 description 1
- YCKRFDGAMUMZLT-IGMARMGPSA-N Fluorine-19 Chemical compound [19F] YCKRFDGAMUMZLT-IGMARMGPSA-N 0.000 description 1
- 241000255990 Helicoverpa Species 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 206010034133 Pathogen resistance Diseases 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- 241001454294 Tetranychus Species 0.000 description 1
- 241000255985 Trichoplusia Species 0.000 description 1
- IUHFWCGCSVTMPG-UHFFFAOYSA-N [C].[C] Chemical class [C].[C] IUHFWCGCSVTMPG-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000012272 crop production Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000004920 integrated pest control Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- JBXYCUKPDAAYAS-UHFFFAOYSA-N methanol;trifluoroborane Chemical compound OC.FB(F)F JBXYCUKPDAAYAS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000004045 organic chlorine compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229940032330 sulfuric acid Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/343,147 US5446170A (en) | 1994-11-22 | 1994-11-22 | Process for the manufacture of insecticidal arylpyrroles via oxazole amine intermediates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69525021D1 DE69525021D1 (de) | 2002-02-21 |
| DE69525021T2 true DE69525021T2 (de) | 2002-07-18 |
Family
ID=23344892
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69525021T Expired - Lifetime DE69525021T2 (de) | 1994-11-22 | 1995-11-21 | Verfahren zur Herstellung vor insektiziden Arylpyrrolen aus Oxazolamin Zwischenprodukte |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US5446170A (enExample) |
| EP (1) | EP0713868B1 (enExample) |
| JP (1) | JP3781464B2 (enExample) |
| KR (1) | KR960017638A (enExample) |
| CN (1) | CN1133836A (enExample) |
| AR (1) | AR000173A1 (enExample) |
| AT (1) | ATE212012T1 (enExample) |
| AU (1) | AU701087B2 (enExample) |
| BR (1) | BR9505251A (enExample) |
| CA (1) | CA2163327A1 (enExample) |
| CZ (1) | CZ286772B6 (enExample) |
| DE (1) | DE69525021T2 (enExample) |
| ES (1) | ES2170785T3 (enExample) |
| HU (1) | HU217922B (enExample) |
| IL (1) | IL116070A0 (enExample) |
| SK (1) | SK143895A3 (enExample) |
| TW (1) | TW296379B (enExample) |
| ZA (1) | ZA959949B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5659046A (en) * | 1993-12-30 | 1997-08-19 | American Cyanamid Company | Method for the preparation of 2-perfluoroalkyl-3-oxazolin-5-one |
| US5925773A (en) * | 1996-06-28 | 1999-07-20 | American Cyanamid Company | Ammonium oxazole and amino oxazolium intermediates, methods for the preparation thereof and the use thereof in the manufacture of insecticidal arylpyrroles |
| TW381087B (en) * | 1996-06-28 | 2000-02-01 | American Cyanamid Co | Ammonium oxazole and amino oxazolium intermediates, methods for the preparation thereof and the use therefor in the manufacture of insecticidal arylpyrroles |
| US5750726A (en) * | 1996-06-28 | 1998-05-12 | American Cyanamid Company | Process for the manufacture of 2-aryl-5-perfluoroalkylpyrrole derivatives and intermediates useful therefor |
| US5777132A (en) * | 1996-06-28 | 1998-07-07 | American Cyanamid Company | Process for the manufacture of 2-aryl-5 perfluoroalkylpyrrole derivatives |
| US5945538A (en) * | 1996-06-28 | 1999-08-31 | American Cyanamid Company | Ammonium oxazole and amino oxazolium intermediates, methods for the preparation thereof and the use therefor in the manufacture of insecticidal arylpyrroles |
| US6011161A (en) * | 1998-02-09 | 2000-01-04 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoroalkyl)pyrrole compounds from N-(perfluoro-alkylmethyl)arylimidoyl chloride compounds |
| US5817834A (en) * | 1998-02-09 | 1998-10-06 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoro-alkyl) pyrrole compounds from N-(perfluoroalkyl-methyl) arylimidoyl chloride compounds |
| US5965773A (en) * | 1998-02-09 | 1999-10-12 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoroalkyl) pyrrole compounds from N-(perfluoroalkylmethyl) arylimidoyl chloride compounds |
| US6133455A (en) * | 1998-02-09 | 2000-10-17 | American Cyanamid Company | Process for the preparation of 2-aryl-5(perfluoro-alkyl) pyrrole compounds from N-(arylmethylene)-1-chloro-1-(perfluoroalkyl) methylamine compounds |
| US6320059B1 (en) | 2000-03-07 | 2001-11-20 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoro-alkyl) pyrrole compounds from N-[1-chloro-1-(perfluoroalkyl) methyl] arylimidoyl chloride compounds |
| CN103058946A (zh) * | 2012-12-19 | 2013-04-24 | 浙江工业大学 | 一种2,5-二取代噁唑衍生物的制备方法 |
| US11584716B2 (en) | 2017-03-13 | 2023-02-21 | BASF Agro B.V. | Production of arylpyrrol compounds in the presence of DIPEA base |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5030735A (en) * | 1990-07-31 | 1991-07-09 | American Cyanamid Company | Process for the preparation of insecticidal, acaricidal and nematicidal 2-aryl-5-(trifluoromethyl) pyrrole compounds |
| US5118816A (en) * | 1990-12-26 | 1992-06-02 | American Cyanamid Company | 2-aryl-5-(trifluoromethyl)-2-pyrroline compounds useful in the manufacture of insecticidal, nematocidal and acaricidal arylpyrroles |
| YU8592A (sh) * | 1991-08-28 | 1994-06-10 | Flumroc Ag. | Postupak i uređaj za izradu ploča od mineralnih vlakana primenjenih kao nosač zidnog premaza |
| US5130328A (en) * | 1991-09-06 | 1992-07-14 | American Cyanamid Company | N-alkanoylaminomethyl and N-aroylaminomethyl pyrrole insecticidal and acaricidal agents |
| US5145986A (en) * | 1991-09-09 | 1992-09-08 | American Cyanamid Company | Process for the manufacture of insecticidal, nematicidal and acaricidal 2-aryl-3-substituted-5-(trifluoromethyl)pyrrole compounds from N-(substituted benzyl)-2,2,2-trifluoro-acetimidoyl chloride compounds |
| CN1074439A (zh) * | 1992-01-17 | 1993-07-21 | 中国科学院上海有机化学研究所 | 一种从三氟甲基唑酮合成三氟甲基吡咯类化合物的方法 |
| US5286743A (en) * | 1992-10-27 | 1994-02-15 | American Cyanamid Company | N-aminoalkylcarbonyloxyalkylpyrrole insecticidal acaricidal and molluscicidal agents |
| US5426225A (en) | 1993-12-30 | 1995-06-20 | American Cyanamid Company | Perfluoroalkanoyl aminonitriles |
-
1994
- 1994-11-22 US US08/343,147 patent/US5446170A/en not_active Expired - Lifetime
-
1995
- 1995-05-16 US US08/442,045 patent/US5574175A/en not_active Expired - Fee Related
- 1995-08-10 TW TW084108310A patent/TW296379B/zh active
- 1995-11-06 CZ CZ19952887A patent/CZ286772B6/cs not_active IP Right Cessation
- 1995-11-16 SK SK1438-95A patent/SK143895A3/sk unknown
- 1995-11-17 JP JP32383695A patent/JP3781464B2/ja not_active Expired - Fee Related
- 1995-11-20 CA CA002163327A patent/CA2163327A1/en not_active Abandoned
- 1995-11-21 ES ES95308298T patent/ES2170785T3/es not_active Expired - Lifetime
- 1995-11-21 BR BR9505251A patent/BR9505251A/pt not_active IP Right Cessation
- 1995-11-21 AT AT95308298T patent/ATE212012T1/de not_active IP Right Cessation
- 1995-11-21 DE DE69525021T patent/DE69525021T2/de not_active Expired - Lifetime
- 1995-11-21 KR KR1019950042446A patent/KR960017638A/ko not_active Abandoned
- 1995-11-21 IL IL11607095A patent/IL116070A0/xx unknown
- 1995-11-21 HU HU9503324A patent/HU217922B/hu not_active IP Right Cessation
- 1995-11-21 EP EP95308298A patent/EP0713868B1/en not_active Expired - Lifetime
- 1995-11-21 AR AR33431495A patent/AR000173A1/es unknown
- 1995-11-22 CN CN95118932A patent/CN1133836A/zh active Pending
- 1995-11-22 AU AU39017/95A patent/AU701087B2/en not_active Ceased
- 1995-11-22 ZA ZA959949A patent/ZA959949B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES2170785T3 (es) | 2002-08-16 |
| CZ288795A3 (en) | 1996-06-12 |
| BR9505251A (pt) | 1997-09-16 |
| EP0713868A1 (en) | 1996-05-29 |
| US5446170A (en) | 1995-08-29 |
| JPH08225522A (ja) | 1996-09-03 |
| KR960017638A (ko) | 1996-06-17 |
| DE69525021D1 (de) | 2002-02-21 |
| IL116070A0 (en) | 1996-01-31 |
| US5574175A (en) | 1996-11-12 |
| CZ286772B6 (en) | 2000-07-12 |
| TW296379B (enExample) | 1997-01-21 |
| ATE212012T1 (de) | 2002-02-15 |
| HU9503324D0 (en) | 1996-01-29 |
| CA2163327A1 (en) | 1996-05-23 |
| CN1133836A (zh) | 1996-10-23 |
| ZA959949B (en) | 1997-05-22 |
| SK143895A3 (en) | 1996-09-04 |
| AR000173A1 (es) | 1997-05-21 |
| HU217922B (hu) | 2000-05-28 |
| JP3781464B2 (ja) | 2006-05-31 |
| AU3901795A (en) | 1996-05-30 |
| HUT73018A (en) | 1996-06-28 |
| EP0713868B1 (en) | 2002-01-16 |
| AU701087B2 (en) | 1999-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69126350T2 (de) | Verfahren zur Herstellung von Chlorothiazolderivaten | |
| DE69525021T2 (de) | Verfahren zur Herstellung vor insektiziden Arylpyrrolen aus Oxazolamin Zwischenprodukte | |
| EP0539588A1 (en) | Amine derivative | |
| EP0017931A2 (de) | 4H-3,1-Benzoxazinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| US5118816A (en) | 2-aryl-5-(trifluoromethyl)-2-pyrroline compounds useful in the manufacture of insecticidal, nematocidal and acaricidal arylpyrroles | |
| EP0669318B1 (en) | Alkoxymethylation of pyrroles to produce pesticides | |
| DE69115867T2 (de) | Synthese von 2-Aryl-5-(trifluormethyl)pyrrolen als pestizide Wirkstoffe und als Zwischenprodukte bei der Herstellung dieser Wirkstoffe | |
| DE69231843T2 (de) | Verfahren zur Herstellung von insektiziden, nematiziden und akariziden 2-Aryl-3-subst.-5- trifluormethylpyrrolen aus N-(subst. Benzyl)-2,2,2-trifluoracetimidoylchloriden | |
| DE69133140T2 (de) | 2-Aryl-5-(trifluoromethyl)-2-pyrrolinderivate und Verfahren zur Herstellung von 2-Aryl-1-(alkoxymethyl)-4-halo-5-(trifluoromethyl)-pyrrolen mit insektizider Wirkung | |
| JPH054966A (ja) | アミン誘導体、その製法及び殺虫剤 | |
| JP2000515520A (ja) | グリオキシル酸誘導体 | |
| Liu et al. | Fluorine containing heterocyclic compounds: synthesis of 6-substituted-2-substituted-aryl-1, 2, 4-triazolo [5, 1-b] 1, 3, 5-thiadiazin-7-one derivatives | |
| DE69212340T2 (de) | Thiazolin-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende pestizide Zusammensetzungen | |
| DE69406483T2 (de) | Oximetherverbindungen, Verfahren zur Herstellung derselben und Fungizide, die sie enthalten | |
| DE69131002T2 (de) | Verfahren zur Herstellung von 2-Aryl-1-substituierten-5-(Trifluormethyl)-Pyrrolen als Insektizide, Akarizide und Nematizide Wirkstoffe sowie als Zwischenprodukte zur Herstellung dieser Wirkstoffe | |
| DE3875447T2 (de) | Chemisches verfahren zur herstellung von methyl 2-(3-phenoxypyrid-2-yl)-3-propenoaten. | |
| EP0392286B1 (de) | 3-Cyano-4-phenyl-pyrrol-Derivate | |
| US5631379A (en) | Oxazole amines as intermediates in the manufacture of insecticidal pyrroles | |
| DE69002792T2 (de) | Crotonsäureamidderivate und sie enthaltende Insektizide. | |
| DE69605541T2 (de) | Intermediate für die synthese von arthropodizidem oxadiazin | |
| DE69410073T2 (de) | Verfahren zur Herstellung von 2-Perfluoroalkyl-3-oxazolin-5-one | |
| DE69706001T2 (de) | Verfahren zur Herstellung von 2-Aryl-5-perfluoralkylpyrrol-Derivaten und Zwischenprodukte für dieses Verfahren | |
| DE69737823T2 (de) | Ammonium-Oxazol- und Amino-Oxazolium Zwischenprodukte, Verfahren zu deren Herstellung und deren Verwendung in der Herstellung von insektiziden, akariziden und nematoziden Arylpyrrol Derivaten | |
| DE69928107T2 (de) | Heterozyklus mit thiophenol gruppe, intermediate zur herstellung und herstellungsverfahren für beide stoffgruppen | |
| DE60014471T2 (de) | Verfahren zur Herstellung von 2-Aryl-5-(perfluoroalkyl)pyrrolverbindungen aus N-[1-Chloro-1-(perfluoroalkyl)methyl]arylimidoylchlorid-Verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: BASF SE, 67063 LUDWIGSHAFEN, DE |