DE69404270T2 - Propylen-Homopolymerharze mit einem hohen Stereoblockgehalt - Google Patents
Propylen-Homopolymerharze mit einem hohen StereoblockgehaltInfo
- Publication number
- DE69404270T2 DE69404270T2 DE69404270T DE69404270T DE69404270T2 DE 69404270 T2 DE69404270 T2 DE 69404270T2 DE 69404270 T DE69404270 T DE 69404270T DE 69404270 T DE69404270 T DE 69404270T DE 69404270 T2 DE69404270 T2 DE 69404270T2
- Authority
- DE
- Germany
- Prior art keywords
- propylene
- propylene homopolymer
- alkyl
- temperature
- homopolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229920001384 propylene homopolymer Polymers 0.000 title claims abstract description 65
- 229920005989 resin Polymers 0.000 title description 6
- 239000011347 resin Substances 0.000 title description 6
- 239000003054 catalyst Substances 0.000 claims abstract description 21
- 239000000835 fiber Substances 0.000 claims abstract description 18
- 238000000034 method Methods 0.000 claims description 21
- -1 magnesium halide Chemical class 0.000 claims description 20
- 239000004753 textile Substances 0.000 claims description 15
- 239000011777 magnesium Substances 0.000 claims description 14
- 229910052749 magnesium Inorganic materials 0.000 claims description 14
- 239000000178 monomer Substances 0.000 claims description 13
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 13
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 13
- 238000006116 polymerization reaction Methods 0.000 claims description 12
- 239000011949 solid catalyst Substances 0.000 claims description 11
- 230000008569 process Effects 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 8
- 150000003609 titanium compounds Chemical class 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 229920001519 homopolymer Polymers 0.000 claims description 4
- 150000001299 aldehydes Chemical class 0.000 claims description 3
- 159000000032 aromatic acids Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 150000003018 phosphorus compounds Chemical class 0.000 claims description 3
- 229920000768 polyamine Polymers 0.000 claims description 3
- 239000000155 melt Substances 0.000 claims description 2
- 238000007664 blowing Methods 0.000 claims 1
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 239000010408 film Substances 0.000 abstract 1
- 229920000642 polymer Polymers 0.000 description 22
- 239000010410 layer Substances 0.000 description 20
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 16
- 239000004744 fabric Substances 0.000 description 14
- 229920005604 random copolymer Polymers 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229910003074 TiCl4 Inorganic materials 0.000 description 7
- 229910001629 magnesium chloride Inorganic materials 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000009987 spinning Methods 0.000 description 7
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 6
- 239000005977 Ethylene Substances 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- MGWAVDBGNNKXQV-UHFFFAOYSA-N diisobutyl phthalate Chemical compound CC(C)COC(=O)C1=CC=CC=C1C(=O)OCC(C)C MGWAVDBGNNKXQV-UHFFFAOYSA-N 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000010936 titanium Substances 0.000 description 5
- 230000007547 defect Effects 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 238000002083 X-ray spectrum Methods 0.000 description 3
- 238000005299 abrasion Methods 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- DIJRHOZMLZRNLM-UHFFFAOYSA-N dimethoxy-methyl-(3,3,3-trifluoropropyl)silane Chemical compound CO[Si](C)(OC)CCC(F)(F)F DIJRHOZMLZRNLM-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- 239000002356 single layer Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 3
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical compound CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 2
- DMWVYCCGCQPJEA-UHFFFAOYSA-N 2,5-bis(tert-butylperoxy)-2,5-dimethylhexane Chemical compound CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C DMWVYCCGCQPJEA-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 239000011954 Ziegler–Natta catalyst Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- XSIFPSYPOVKYCO-UHFFFAOYSA-N butyl benzoate Chemical compound CCCCOC(=O)C1=CC=CC=C1 XSIFPSYPOVKYCO-UHFFFAOYSA-N 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000000113 differential scanning calorimetry Methods 0.000 description 2
- YQGOWXYZDLJBFL-UHFFFAOYSA-N dimethoxysilane Chemical compound CO[SiH2]OC YQGOWXYZDLJBFL-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 229920005674 ethylene-propylene random copolymer Polymers 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical class ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000003350 kerosene Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- DDIZAANNODHTRB-UHFFFAOYSA-N methyl p-anisate Chemical compound COC(=O)C1=CC=C(OC)C=C1 DDIZAANNODHTRB-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003377 silicon compounds Chemical class 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000001938 differential scanning calorimetry curve Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- QSSJZLPUHJDYKF-UHFFFAOYSA-N methyl 4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C=C1 QSSJZLPUHJDYKF-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005453 pelletization Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000008039 phosphoramides Chemical class 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 239000004749 staple nonwoven Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004227 thermal cracking Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F110/00—Homopolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F110/04—Monomers containing three or four carbon atoms
- C08F110/06—Propene
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Dental Preparations (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Artificial Filaments (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Nonwoven Fabrics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16869793A | 1993-12-16 | 1993-12-16 | |
| US34906994A | 1994-12-07 | 1994-12-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69404270D1 DE69404270D1 (de) | 1997-08-21 |
| DE69404270T2 true DE69404270T2 (de) | 1998-01-15 |
Family
ID=26864371
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69404270T Expired - Lifetime DE69404270T2 (de) | 1993-12-16 | 1994-12-14 | Propylen-Homopolymerharze mit einem hohen Stereoblockgehalt |
Country Status (12)
| Country | Link |
|---|---|
| EP (1) | EP0658577B1 (enExample) |
| JP (1) | JPH07252312A (enExample) |
| CN (1) | CN1106824A (enExample) |
| AT (1) | ATE155498T1 (enExample) |
| AU (1) | AU686681B2 (enExample) |
| BR (1) | BR9405120A (enExample) |
| CA (1) | CA2138223A1 (enExample) |
| DE (1) | DE69404270T2 (enExample) |
| DK (1) | DK0658577T3 (enExample) |
| ES (1) | ES2107109T3 (enExample) |
| MY (1) | MY111773A (enExample) |
| TW (1) | TW282476B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5948720A (en) * | 1997-01-07 | 1999-09-07 | Huntsman Polymers Corporation | Catalyst for the production of flexible polyolefin compositions, methods for making and using same, and products thereof |
| US6100351A (en) * | 1997-01-07 | 2000-08-08 | Huntsman Polymers Corporation | Olefin polymerization process and products thereof |
| US6080818A (en) * | 1997-03-24 | 2000-06-27 | Huntsman Polymers Corporation | Polyolefin blends used for non-woven applications |
| US6130180A (en) * | 1997-12-23 | 2000-10-10 | Montell North America Inc. | Catalyst for the polymerization of alpha-olefins containing substituted amino silane compounds |
| ATE280188T1 (de) | 1999-12-22 | 2004-11-15 | Basell Poliolefine Spa | Alpha-olefin enthaltendes polymerisationskatalysatorsystem, das ein aromatisches silan enthält |
| PL355609A1 (en) * | 2000-10-13 | 2004-05-04 | Basell Poliolefine Italia S.P.A. | Catalyst components for the polymerization of olefines |
| JP2005510590A (ja) | 2001-11-27 | 2005-04-21 | バセル ポリオレフィン ジーエムビーエイチ | ポリマー組成物の処理の方法 |
| US7078468B2 (en) * | 2003-06-27 | 2006-07-18 | Fina Technology, Inc. | Polymerization catalyst system using di-sec-butyldimethoxysilane for preparation of polypropylene |
| KR20070091444A (ko) | 2006-03-06 | 2007-09-11 | 주식회사 엘지화학 | 올레핀 전중합을 이용한 프로필렌의 중합방법 |
| KR101012147B1 (ko) * | 2006-08-30 | 2011-02-07 | 코오롱글로텍주식회사 | 오픈엔드 정방용 폴리프로필렌 단섬유 및 이의 제조방법 |
| EP1964948A1 (en) * | 2007-02-28 | 2008-09-03 | Total Petrochemicals Research Feluy | Polypropylene fibers and spunbond nonwoven with improved properties. |
| KR102669879B1 (ko) * | 2021-12-23 | 2024-05-29 | 에쓰대시오일 주식회사 | 폴리프로필렌 수지 조성물 및 이의 제조방법 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5943044A (ja) * | 1982-09-06 | 1984-03-09 | Toyo Soda Mfg Co Ltd | 軟質系プロピレン系重合体フイルム |
| GB2206524B (en) * | 1987-07-08 | 1990-03-07 | Courtaulds Films & Packaging | Voided polypropylene films |
| DE3819577A1 (de) * | 1988-06-09 | 1989-12-14 | Hoechst Ag | Verfahren zur herstellung eines polypropylens |
| CA2017782A1 (en) * | 1989-06-01 | 1990-12-01 | James H. Harrington | Rewettable polyolefin fiber and corresponding nonwovens |
| US5102842A (en) * | 1990-08-23 | 1992-04-07 | Himont Incorporated | Catalyst for the polymerization of alpha-olefins containing trifluoropropyl substituted silane compounds |
| JP3016880B2 (ja) * | 1991-02-01 | 2000-03-06 | 三菱化学株式会社 | フィルム成形用高結晶性ポリプロピレン |
| EP0552013B1 (en) * | 1992-01-13 | 1999-04-07 | Hercules Incorporated | Thermally bondable fiber for high strength non-woven fabrics |
| CA2121721C (en) * | 1993-04-29 | 2004-11-23 | Giampiero Morini | Crystalline propylene polymers having high melt flow rate values and a narrow molecular weight distribution |
-
1994
- 1994-12-14 TW TW083111689A patent/TW282476B/zh active
- 1994-12-14 AT AT94119701T patent/ATE155498T1/de active
- 1994-12-14 DK DK94119701.4T patent/DK0658577T3/da active
- 1994-12-14 ES ES94119701T patent/ES2107109T3/es not_active Expired - Lifetime
- 1994-12-14 EP EP94119701A patent/EP0658577B1/en not_active Expired - Lifetime
- 1994-12-14 DE DE69404270T patent/DE69404270T2/de not_active Expired - Lifetime
- 1994-12-15 BR BR9405120A patent/BR9405120A/pt not_active Application Discontinuation
- 1994-12-15 CA CA002138223A patent/CA2138223A1/en not_active Abandoned
- 1994-12-15 AU AU80471/94A patent/AU686681B2/en not_active Ceased
- 1994-12-15 MY MYPI94003360A patent/MY111773A/en unknown
- 1994-12-16 JP JP6313500A patent/JPH07252312A/ja active Pending
- 1994-12-16 CN CN94118426.9A patent/CN1106824A/zh active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| EP0658577A3 (en) | 1995-09-13 |
| CA2138223A1 (en) | 1995-06-17 |
| DK0658577T3 (da) | 1997-10-27 |
| CN1106824A (zh) | 1995-08-16 |
| ATE155498T1 (de) | 1997-08-15 |
| TW282476B (enExample) | 1996-08-01 |
| MY111773A (en) | 2000-12-30 |
| JPH07252312A (ja) | 1995-10-03 |
| ES2107109T3 (es) | 1997-11-16 |
| EP0658577B1 (en) | 1997-07-16 |
| DE69404270D1 (de) | 1997-08-21 |
| AU686681B2 (en) | 1998-02-12 |
| AU8047194A (en) | 1995-06-22 |
| BR9405120A (pt) | 1995-08-22 |
| EP0658577A2 (en) | 1995-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69413107T2 (de) | Kristalline Propylenpolymere, die eine hohe Schmelzflussrate und eine enge Molekulargewichtsverteilung aufweisen | |
| DE69125857T2 (de) | Folie und Laminate aus Propylenpolymer | |
| DE69507844T2 (de) | Crystalline propylen Copolymerzusammensetzung mit niedriger Siegeltemperatur und guten Farbhaftung | |
| DE69205960T3 (de) | Verfahren zur Herstellung von linearen Polyäthylenen mit niedriger Dichte. | |
| DE69123935T2 (de) | Niedrige Verklebungstemperatur aufweisende kristalline Propylen-Polymere | |
| DE69623308T2 (de) | Olefin(co)polymerzusammensetzung, verfahren zu dessen herstellung, katalysator for olefin(co)polymerisation und verfahren zu dessen herstellung | |
| DE69623885T2 (de) | Blasfolien aus Polypropylen | |
| DE69107558T2 (de) | Polyolefin-Filme. | |
| DE69504143T2 (de) | Prokatalysator zur Herstellung von Ethylenpolymer, Verfahren zu seiner Herstellung und Verwendung | |
| US5529850A (en) | Fibers produced from crystalline propylene polymers having high melt flow rate values and a narrow molecular weight distribution | |
| DE69426859T2 (de) | Verfahren zur Herstellung von Polyolefinen für biaxial orientierte Folie und Katalysator für Olefinpolymerisation | |
| DE60114464T2 (de) | Propylenpolymerharz mit verbesserten Eigenschaften | |
| DE69910967T2 (de) | Kristalline propylene-copolymerzusammensetzungen mit heissversiegelungseigenschaften, optischen eigenschaften und reduzierter löslichkeit | |
| DE69322742T2 (de) | Vliesstoffmaterial aus Mischungen von einen Propylenpolymer mit einen Olefinpolymer | |
| DE3021469A1 (de) | Aethylenpolymere, verfahren zu ihrer herstellung und ihre verwendung | |
| EP0881239B1 (de) | Statistische Propylencopolymerisate | |
| DE69404270T2 (de) | Propylen-Homopolymerharze mit einem hohen Stereoblockgehalt | |
| EP0463406B1 (de) | Verfahren zur Herstellung von Homopolymerisaten des Propylens mit breitem Molmassenverhältnis | |
| EP0945472A2 (de) | Statistische Propylencopolymerisate | |
| DE69604169T2 (de) | Verfahren und katalysatorbestandteil für homo- und copolymerisation von olefinen | |
| DE69120601T2 (de) | Polymerzusammensetzungen | |
| DE69607412T2 (de) | Reaktormischungen aus kleinen Mengen syndiotaktischem Polypropylen in isotaktischem Polypropylen | |
| DE19882607B4 (de) | Polypropylen, Verfahren zur Herstellung desselben und Anwendungen davon | |
| EP0887357B1 (de) | Propylenpolymerisate | |
| DE69408864T2 (de) | Randomcopolymerisatzusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |