DE4414877A1 - Verfahren zur Herstellung von 2,3,6-Trimethyl-phenol - Google Patents
Verfahren zur Herstellung von 2,3,6-Trimethyl-phenolInfo
- Publication number
- DE4414877A1 DE4414877A1 DE19944414877 DE4414877A DE4414877A1 DE 4414877 A1 DE4414877 A1 DE 4414877A1 DE 19944414877 DE19944414877 DE 19944414877 DE 4414877 A DE4414877 A DE 4414877A DE 4414877 A1 DE4414877 A1 DE 4414877A1
- Authority
- DE
- Germany
- Prior art keywords
- amino
- ketone
- trimethylphenol
- vinyl methyl
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- QQOMQLYQAXGHSU-UHFFFAOYSA-N 2,3,6-Trimethylphenol Chemical compound CC1=CC=C(C)C(O)=C1C QQOMQLYQAXGHSU-UHFFFAOYSA-N 0.000 title claims description 18
- 238000000034 method Methods 0.000 title claims description 15
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 claims description 20
- IQZZQVQXKNOQAX-UHFFFAOYSA-N 3-aminobut-3-en-2-one Chemical compound CC(=O)C(N)=C IQZZQVQXKNOQAX-UHFFFAOYSA-N 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 150000004678 hydrides Chemical class 0.000 claims description 2
- 239000002585 base Substances 0.000 claims 2
- LITPVXKRJITOIR-UHFFFAOYSA-N 2,6-diaminohepta-1,6-dien-4-one Chemical compound NC(=C)CC(=O)CC(N)=C LITPVXKRJITOIR-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- -1 2,4-dimethyl-phenyl Chemical group 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 description 4
- XRUGBBIQLIVCSI-UHFFFAOYSA-N 2,3,4-trimethylphenol Chemical compound CC1=CC=C(O)C(C)=C1C XRUGBBIQLIVCSI-UHFFFAOYSA-N 0.000 description 3
- NGUGWHFIVAQVMN-UHFFFAOYSA-N 4-aminobut-3-en-2-one Chemical compound CC(=O)C=CN NGUGWHFIVAQVMN-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- BTRPJOHXPQOVLS-UHFFFAOYSA-N 3-ethyl-4-methylphenol Chemical compound CCC1=CC(O)=CC=C1C BTRPJOHXPQOVLS-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229930003427 Vitamin E Natural products 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229940046009 vitamin E Drugs 0.000 description 2
- 235000019165 vitamin E Nutrition 0.000 description 2
- 239000011709 vitamin E Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SPPWGCYEYAMHDT-UHFFFAOYSA-N 1,4-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=C(C(C)C)C=C1 SPPWGCYEYAMHDT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- OTOATSWKRSNICB-UHFFFAOYSA-N 1,5-diaminopenta-1,4-dien-3-one Chemical compound NC=CC(=O)C=CN OTOATSWKRSNICB-UHFFFAOYSA-N 0.000 description 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 1
- HYSVSSHMLNFRAM-UHFFFAOYSA-N 2,3,4-trimethylcyclohex-2-en-1-one Chemical compound CC1CCC(=O)C(C)=C1C HYSVSSHMLNFRAM-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000003890 2-phenylbutyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- FIVYBIKBNLVNCX-UHFFFAOYSA-N 4-(dipropylamino)but-3-en-2-one Chemical compound CCCN(CCC)C=CC(C)=O FIVYBIKBNLVNCX-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical class CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000003442 catalytic alkylation reaction Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/20—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms using aldehydes or ketones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19944414877 DE4414877A1 (de) | 1994-04-28 | 1994-04-28 | Verfahren zur Herstellung von 2,3,6-Trimethyl-phenol |
| EP95105849A EP0679625A2 (de) | 1994-04-28 | 1995-04-19 | Verfahren zur Herstellung von 2,3,6-Trimethyl-phenol |
| JP9728995A JPH07300438A (ja) | 1994-04-28 | 1995-04-21 | 2,3,6−トリメチルフェノールの製造法 |
| CA002147913A CA2147913A1 (en) | 1994-04-28 | 1995-04-26 | Preparation of 2,3,6-trimethylphenol |
| RU95106463/04A RU95106463A (ru) | 1994-04-28 | 1995-04-27 | Способ получения 2,3,6-триметилфенола |
| CN 95105783 CN1117483A (zh) | 1994-04-28 | 1995-04-28 | 2,3,6-三甲基苯酚的制备 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19944414877 DE4414877A1 (de) | 1994-04-28 | 1994-04-28 | Verfahren zur Herstellung von 2,3,6-Trimethyl-phenol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4414877A1 true DE4414877A1 (de) | 1995-11-02 |
Family
ID=6516698
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19944414877 Withdrawn DE4414877A1 (de) | 1994-04-28 | 1994-04-28 | Verfahren zur Herstellung von 2,3,6-Trimethyl-phenol |
Country Status (6)
| Country | Link |
|---|---|
| EP (1) | EP0679625A2 (enExample) |
| JP (1) | JPH07300438A (enExample) |
| CN (1) | CN1117483A (enExample) |
| CA (1) | CA2147913A1 (enExample) |
| DE (1) | DE4414877A1 (enExample) |
| RU (1) | RU95106463A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN108264450B (zh) * | 2016-12-30 | 2021-04-30 | 浙江省诸暨合力化学对外贸易有限公司 | 一种多取代苯酚的制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1668874C2 (de) * | 1968-03-08 | 1975-11-20 | Basf Ag | Verfahren zur Herstellung von 2,3,6-Trimethylphenol |
| DE1793037B1 (de) * | 1968-07-26 | 1971-07-15 | Basf Ag | Verfahren zur Herstellung von 2,3,6-Trimethylphenol |
| US3833673A (en) * | 1971-11-09 | 1974-09-03 | Eastman Kodak Co | Synthesis of alkylated phenols from carbonyl compounds |
-
1994
- 1994-04-28 DE DE19944414877 patent/DE4414877A1/de not_active Withdrawn
-
1995
- 1995-04-19 EP EP95105849A patent/EP0679625A2/de not_active Withdrawn
- 1995-04-21 JP JP9728995A patent/JPH07300438A/ja not_active Withdrawn
- 1995-04-26 CA CA002147913A patent/CA2147913A1/en not_active Abandoned
- 1995-04-27 RU RU95106463/04A patent/RU95106463A/ru unknown
- 1995-04-28 CN CN 95105783 patent/CN1117483A/zh active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CN1117483A (zh) | 1996-02-28 |
| CA2147913A1 (en) | 1995-10-29 |
| EP0679625A3 (enExample) | 1995-12-06 |
| EP0679625A2 (de) | 1995-11-02 |
| RU95106463A (ru) | 1997-02-10 |
| JPH07300438A (ja) | 1995-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69215374T2 (de) | Verfahren zur Herstellung von Aryl- und Aralkyl-Magnesiumhalogeniden | |
| DE2020865A1 (de) | Verfahren zur Herstellung von alpha,ss-ungesaettigten Carbonylverbindungen | |
| DE2331878B2 (de) | Verfahren zur herstellung von diphenylamin und dessen derivaten | |
| EP0735016B1 (de) | Verfahren zur Herstellung von Alpha-Chloralkylarylketonen | |
| DE4414877A1 (de) | Verfahren zur Herstellung von 2,3,6-Trimethyl-phenol | |
| EP0206147B1 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodibenzylen | |
| EP0632010B1 (de) | Verfahren zur Herstellung von alpha,omega-Dicarbonsäurediestern | |
| DE2705602C2 (de) | Verfahren zur Herstellung eines ungesättigten Ketons | |
| DE2329923C3 (de) | Verfahren zur Herstellung von 5-Oxohexannitri! | |
| DE4225763A1 (de) | Verfahren zur Herstellung von Halogenaromaten | |
| EP0620217B1 (de) | Verfahren zur Herstellung von 4-Methylpyrimidinen | |
| DE3688942T2 (de) | Verfahren zur Herstellung von Oximderivaten. | |
| DE2048272B2 (de) | Verfahren zur Herstellung von 1,1,2-Trimethoxyäthan und o-Essigsäuremethylester | |
| EP0066246A2 (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| EP0929505A1 (de) | Verfahren zur herstellung von alkindiolen oder gemischen von alkindiolen mit alkinmonoolen | |
| EP0068283A1 (de) | Verfahren zur Herstellung von alkylsubstituierten Anilinen | |
| EP0084128B1 (de) | Verfahren zur Herstellung von teilweise neuen Alkylbenzolen, die durch Fluor enthaltende Reste substituiert sind | |
| DE2429757C3 (de) | Verfahren zur Herstellung von 3-Hexin-1-ol | |
| DE19647795A1 (de) | Verfahren zur Herstellung aromatischer Nitrile | |
| DE2005515B2 (de) | Verfahren zur Herstellung von γ -Cyanburyraldiminen | |
| US4468522A (en) | Process for the preparation of (omega-carboalkoxy-nor.alkyl)-dialkylamines | |
| DE921027C (de) | Verfahren zur Herstellung von stickstoffhaltigen Kondensations-produkten aus Cyclohexanonen und Ammoniak | |
| EP0182168A2 (de) | Verfahren zur Herstellung von Hydroxymethylen-alkoxyessigsäureestern | |
| EP0630885A1 (de) | Verfahren zur Herstellung von Aminopropionitrilen | |
| EP0161009B1 (de) | Verfahren zur Herstellung von Naphtholacton |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |