DE3875142T2 - Bleichmittel. - Google Patents
Bleichmittel.Info
- Publication number
- DE3875142T2 DE3875142T2 DE8888302262T DE3875142T DE3875142T2 DE 3875142 T2 DE3875142 T2 DE 3875142T2 DE 8888302262 T DE8888302262 T DE 8888302262T DE 3875142 T DE3875142 T DE 3875142T DE 3875142 T2 DE3875142 T2 DE 3875142T2
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- radical
- tert
- composition according
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 63
- 239000000203 mixture Substances 0.000 claims description 100
- -1 acyl radical Chemical class 0.000 claims description 84
- 239000012190 activator Substances 0.000 claims description 39
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 239000003963 antioxidant agent Substances 0.000 claims description 31
- 239000003599 detergent Substances 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- 230000003078 antioxidant effect Effects 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 20
- 239000011230 binding agent Substances 0.000 claims description 16
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 claims description 14
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 13
- 150000003254 radicals Chemical class 0.000 claims description 13
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 239000004094 surface-active agent Substances 0.000 claims description 12
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 11
- 150000004965 peroxy acids Chemical class 0.000 claims description 11
- 239000002243 precursor Substances 0.000 claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 150000001340 alkali metals Chemical class 0.000 claims description 10
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- 238000004061 bleaching Methods 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 239000002736 nonionic surfactant Substances 0.000 claims description 9
- 239000002245 particle Substances 0.000 claims description 9
- 239000003945 anionic surfactant Substances 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 6
- 125000005164 aryl thioalkyl group Chemical group 0.000 claims description 6
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 claims description 4
- 239000012964 benzotriazole Substances 0.000 claims description 4
- 239000003093 cationic surfactant Substances 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical class N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 claims description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 3
- 235000010338 boric acid Nutrition 0.000 claims description 3
- 239000004327 boric acid Substances 0.000 claims description 3
- 229960002645 boric acid Drugs 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000004611 light stabiliser Substances 0.000 claims description 3
- 239000002530 phenolic antioxidant Substances 0.000 claims description 3
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical class C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 claims description 2
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical group CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 claims description 2
- XDVOLDOITVSJGL-UHFFFAOYSA-N 3,7-dihydroxy-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound O1B(O)OB2OB(O)OB1O2 XDVOLDOITVSJGL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004450 alkenylene group Chemical group 0.000 claims description 2
- 125000006365 alkylene oxy carbonyl group Chemical group 0.000 claims description 2
- 125000005529 alkyleneoxy group Chemical group 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims description 2
- UYANAUSDHIFLFQ-UHFFFAOYSA-N borinic acid Chemical compound OB UYANAUSDHIFLFQ-UHFFFAOYSA-N 0.000 claims description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- VILAVOFMIJHSJA-UHFFFAOYSA-N dicarbon monoxide Chemical compound [C]=C=O VILAVOFMIJHSJA-UHFFFAOYSA-N 0.000 claims description 2
- PEYVWSJAZONVQK-UHFFFAOYSA-N hydroperoxy(oxo)borane Chemical compound OOB=O PEYVWSJAZONVQK-UHFFFAOYSA-N 0.000 claims description 2
- 239000002563 ionic surfactant Substances 0.000 claims description 2
- VGTPKLINSHNZRD-UHFFFAOYSA-N oxoborinic acid Chemical compound OB=O VGTPKLINSHNZRD-UHFFFAOYSA-N 0.000 claims description 2
- 125000006353 oxyethylene group Chemical group 0.000 claims description 2
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- 239000000835 fiber Substances 0.000 description 17
- 239000000758 substrate Substances 0.000 description 15
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 14
- 230000002209 hydrophobic effect Effects 0.000 description 14
- 239000011734 sodium Substances 0.000 description 14
- 229910052708 sodium Inorganic materials 0.000 description 14
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 239000000463 material Substances 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 12
- 239000000194 fatty acid Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 235000014113 dietary fatty acids Nutrition 0.000 description 9
- 239000004744 fabric Substances 0.000 description 9
- 229930195729 fatty acid Natural products 0.000 description 9
- 150000004665 fatty acids Chemical class 0.000 description 8
- 239000004745 nonwoven fabric Substances 0.000 description 8
- 229920001577 copolymer Polymers 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000003760 tallow Substances 0.000 description 7
- 108090000790 Enzymes Proteins 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- 235000019832 sodium triphosphate Nutrition 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229920001983 poloxamer Polymers 0.000 description 5
- 150000003138 primary alcohols Chemical class 0.000 description 5
- 235000012239 silicon dioxide Nutrition 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 4
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 4
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 239000001993 wax Substances 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920000297 Rayon Polymers 0.000 description 3
- 239000004115 Sodium Silicate Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- XITRBUPOXXBIJN-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 XITRBUPOXXBIJN-UHFFFAOYSA-N 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 235000010980 cellulose Nutrition 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 235000010981 methylcellulose Nutrition 0.000 description 3
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 3
- 150000004967 organic peroxy acids Chemical class 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 229920001296 polysiloxane Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 239000002964 rayon Substances 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 2
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 2
- DKCPKDPYUFEZCP-UHFFFAOYSA-N 2,6-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=CC(C(C)(C)C)=C1O DKCPKDPYUFEZCP-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- XQESJWNDTICJHW-UHFFFAOYSA-N 2-[(2-hydroxy-5-methyl-3-nonylphenyl)methyl]-4-methyl-6-nonylphenol Chemical compound CCCCCCCCCC1=CC(C)=CC(CC=2C(=C(CCCCCCCCC)C=C(C)C=2)O)=C1O XQESJWNDTICJHW-UHFFFAOYSA-N 0.000 description 2
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 description 2
- PHXLONCQBNATSL-UHFFFAOYSA-N 2-[[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methyl]-4-methyl-6-(1-methylcyclohexyl)phenol Chemical compound OC=1C(C2(C)CCCCC2)=CC(C)=CC=1CC(C=1O)=CC(C)=CC=1C1(C)CCCCC1 PHXLONCQBNATSL-UHFFFAOYSA-N 0.000 description 2
- MNVMYTVDDOXZLS-UHFFFAOYSA-N 4-methoxyguaiacol Natural products COC1=CC=C(O)C(OC)=C1 MNVMYTVDDOXZLS-UHFFFAOYSA-N 0.000 description 2
- YGUMVDWOQQJBGA-VAWYXSNFSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-VAWYXSNFSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 101001028025 Homo sapiens Mdm2-binding protein Proteins 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 102100037572 Mdm2-binding protein Human genes 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 101710194948 Protein phosphatase PhpP Proteins 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 235000001465 calcium Nutrition 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000002738 chelating agent Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 2
- 235000011180 diphosphates Nutrition 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 235000019197 fats Nutrition 0.000 description 2
- 239000007850 fluorescent dye Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- JPZROSNLRWHSQQ-UHFFFAOYSA-N furan-2,5-dione;prop-2-enoic acid Chemical compound OC(=O)C=C.O=C1OC(=O)C=C1 JPZROSNLRWHSQQ-UHFFFAOYSA-N 0.000 description 2
- 150000002402 hexoses Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 2
- 239000000693 micelle Substances 0.000 description 2
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000005365 phosphate glass Substances 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229940079877 pyrogallol Drugs 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 2
- YDLQSTFHBCVEJV-UHFFFAOYSA-M sodium;2-(3,5,5-trimethylhexanoyloxy)benzenesulfonate Chemical compound [Na+].CC(C)(C)CC(C)CC(=O)OC1=CC=CC=C1S([O-])(=O)=O YDLQSTFHBCVEJV-UHFFFAOYSA-M 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- VDLRJZZAPYZUCN-UHFFFAOYSA-N tris(2,6-ditert-butyl-4-methylphenyl) borate Chemical compound CC(C)(C)C1=CC(C)=CC(C(C)(C)C)=C1OB(OC=1C(=CC(C)=CC=1C(C)(C)C)C(C)(C)C)OC1=C(C(C)(C)C)C=C(C)C=C1C(C)(C)C VDLRJZZAPYZUCN-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical group O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- ADDIATRPAYCWOW-UHFFFAOYSA-N 2-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol Chemical compound CCCCC1=CC(C)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O ADDIATRPAYCWOW-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- FEWFXBUNENSNBQ-UHFFFAOYSA-N 2-hydroxyacrylic acid Chemical compound OC(=C)C(O)=O FEWFXBUNENSNBQ-UHFFFAOYSA-N 0.000 description 1
- PTHBKNSHSCMKBV-UHFFFAOYSA-N 4,6,8-trihydroxy-3-(2-hydroxyethyl)-2,3-dihydronaphtho[2,3-f][1]benzofuran-5,10-dione Chemical compound O=C1C2=CC(O)=CC(O)=C2C(=O)C2=C1C=C1OCC(CCO)C1=C2O PTHBKNSHSCMKBV-UHFFFAOYSA-N 0.000 description 1
- UDBVWWVWSXSLAX-UHFFFAOYSA-N 4-[2,3-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-2-tert-butyl-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(C)C(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)CC1=CC(C(C)(C)C)=C(O)C=C1C UDBVWWVWSXSLAX-UHFFFAOYSA-N 0.000 description 1
- YOZWRDKYFCOUMM-UHFFFAOYSA-N 4-oxo-4-pentadec-2-enoxybutanoic acid Chemical compound CCCCCCCCCCCCC=CCOC(=O)CCC(O)=O YOZWRDKYFCOUMM-UHFFFAOYSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- 244000198134 Agave sisalana Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 240000008564 Boehmeria nivea Species 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- CXRFDZFCGOPDTD-UHFFFAOYSA-M Cetrimide Chemical compound [Br-].CCCCCCCCCCCCCC[N+](C)(C)C CXRFDZFCGOPDTD-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 240000000491 Corchorus aestuans Species 0.000 description 1
- 235000011777 Corchorus aestuans Nutrition 0.000 description 1
- 235000010862 Corchorus capsularis Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CODXQVBTPQLAGA-UHFFFAOYSA-N Hydroxydecanoate Chemical compound CCCCCCCCCC(=O)OO CODXQVBTPQLAGA-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical class [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- CVXHBROPWMVEQO-UHFFFAOYSA-N Peroxyoctanoic acid Chemical compound CCCCCCCC(=O)OO CVXHBROPWMVEQO-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- BCKXLBQYZLBQEK-KVVVOXFISA-M Sodium oleate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC([O-])=O BCKXLBQYZLBQEK-KVVVOXFISA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- PZAGQUOSOTUKEC-UHFFFAOYSA-N acetic acid;sulfuric acid Chemical compound CC(O)=O.OS(O)(=O)=O PZAGQUOSOTUKEC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical group 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052915 alkaline earth metal silicate Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- GFXYTQPNNXGICT-UHFFFAOYSA-N allysine Chemical class [O-]C(=O)C([NH3+])CCCC=O GFXYTQPNNXGICT-UHFFFAOYSA-N 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical class N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000002648 azanetriyl group Chemical group *N(*)* 0.000 description 1
- DRZOELSSQWENBA-UHFFFAOYSA-N benzene-1,2-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(=O)OO DRZOELSSQWENBA-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- RSOILICUEWXSLA-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 RSOILICUEWXSLA-UHFFFAOYSA-N 0.000 description 1
- 150000001638 boron Chemical class 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- OCWYEMOEOGEQAN-UHFFFAOYSA-N bumetrizole Chemical compound CC(C)(C)C1=CC(C)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O OCWYEMOEOGEQAN-UHFFFAOYSA-N 0.000 description 1
- 235000009120 camo Nutrition 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000009960 carding Methods 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940096386 coconut alcohol Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- KAOPHVRFVWFGRN-UHFFFAOYSA-M decyl(trimethyl)azanium;methyl sulfate Chemical compound COS([O-])(=O)=O.CCCCCCCCCC[N+](C)(C)C KAOPHVRFVWFGRN-UHFFFAOYSA-M 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- GSPKZYJPUDYKPI-UHFFFAOYSA-N diethoxy sulfate Chemical compound CCOOS(=O)(=O)OOCC GSPKZYJPUDYKPI-UHFFFAOYSA-N 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- JHUXOSATQXGREM-UHFFFAOYSA-N dodecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCC(=O)OO JHUXOSATQXGREM-UHFFFAOYSA-N 0.000 description 1
- BRDYCNFHFWUBCZ-UHFFFAOYSA-N dodecaneperoxoic acid Chemical compound CCCCCCCCCCCC(=O)OO BRDYCNFHFWUBCZ-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000008393 encapsulating agent Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000011552 falling film Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 235000021323 fish oil Nutrition 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 150000002237 fumaric acid derivatives Chemical class 0.000 description 1
- UPBDXRPQPOWRKR-UHFFFAOYSA-N furan-2,5-dione;methoxyethene Chemical compound COC=C.O=C1OC(=O)C=C1 UPBDXRPQPOWRKR-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 239000011487 hemp Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- CYPPCCJJKNISFK-UHFFFAOYSA-J kaolinite Chemical compound [OH-].[OH-].[OH-].[OH-].[Al+3].[Al+3].[O-][Si](=O)O[Si]([O-])=O CYPPCCJJKNISFK-UHFFFAOYSA-J 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical class CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000004750 melt-blown nonwoven Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- ONWPLBKWMAUFGZ-UHFFFAOYSA-N methyl 2-acetyloxybenzoate Chemical compound COC(=O)C1=CC=CC=C1OC(C)=O ONWPLBKWMAUFGZ-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 108010020132 microbial serine proteinases Proteins 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical group CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 1
- 150000002912 oxalic acid derivatives Chemical class 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910021647 smectite Inorganic materials 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical group [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- FVVAVKIAMHJRDT-UHFFFAOYSA-M sodium;2-(2-ethylhexanoyloxy)benzenesulfonate Chemical compound [Na+].CCCCC(CC)C(=O)OC1=CC=CC=C1S([O-])(=O)=O FVVAVKIAMHJRDT-UHFFFAOYSA-M 0.000 description 1
- RCJFEOBNLLGZRV-UHFFFAOYSA-M sodium;2-(3,5,5-trimethylhexanoyloxy)benzoate Chemical compound [Na+].CC(C)(C)CC(C)CC(=O)OC1=CC=CC=C1C([O-])=O RCJFEOBNLLGZRV-UHFFFAOYSA-M 0.000 description 1
- PXDLHKPVKLUIJV-UHFFFAOYSA-M sodium;2-octanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O PXDLHKPVKLUIJV-UHFFFAOYSA-M 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- NWPMTMCXJZTLSO-UHFFFAOYSA-M sodium;4-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 NWPMTMCXJZTLSO-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003443 succinic acid derivatives Chemical class 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- DDFYFBUWEBINLX-UHFFFAOYSA-M tetramethylammonium bromide Chemical compound [Br-].C[N+](C)(C)C DDFYFBUWEBINLX-UHFFFAOYSA-M 0.000 description 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- KCYJBQNPOFBNHE-UHFFFAOYSA-K trisodium;hydroxy-(1-hydroxy-1-phosphonatoethyl)phosphinate Chemical compound [Na+].[Na+].[Na+].OP(=O)([O-])C(O)(C)P([O-])([O-])=O KCYJBQNPOFBNHE-UHFFFAOYSA-K 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 239000004108 vegetable carbon Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- PTHBKNSHSCMKBV-ZETCQYMHSA-N versicol Natural products OCC[C@H]1COc2cc3C(=O)c4cc(O)cc(O)c4C(=O)c3c(O)c12 PTHBKNSHSCMKBV-ZETCQYMHSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229920003176 water-insoluble polymer Polymers 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
- 229910009112 xH2O Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/10—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3935—Bleach activators or bleach catalysts granulated, coated or protected
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0084—Antioxidants; Free-radical scavengers
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Biochemistry (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB878706273A GB8706273D0 (en) | 1987-03-17 | 1987-03-17 | Bleaching compositions |
| GB878728727A GB8728727D0 (en) | 1987-12-09 | 1987-12-09 | Bleaching compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3875142D1 DE3875142D1 (de) | 1992-11-12 |
| DE3875142T2 true DE3875142T2 (de) | 1993-03-04 |
Family
ID=26292021
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8888302262T Expired - Fee Related DE3875142T2 (de) | 1987-03-17 | 1988-03-16 | Bleichmittel. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4853143A (enExample) |
| EP (1) | EP0283252B1 (enExample) |
| JP (1) | JPS64199A (enExample) |
| KR (1) | KR950003848B1 (enExample) |
| CA (1) | CA1302835C (enExample) |
| DE (1) | DE3875142T2 (enExample) |
| DK (1) | DK146688A (enExample) |
| ES (1) | ES2045106T3 (enExample) |
| FI (1) | FI881255A7 (enExample) |
| GR (1) | GR3005906T3 (enExample) |
| MA (1) | MA21216A1 (enExample) |
| MX (1) | MX172178B (enExample) |
| TR (1) | TR24372A (enExample) |
Families Citing this family (71)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5180514A (en) * | 1985-06-17 | 1993-01-19 | The Clorox Company | Stabilizing system for liquid hydrogen peroxide compositions |
| US5112514A (en) * | 1986-11-06 | 1992-05-12 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5002691A (en) * | 1986-11-06 | 1991-03-26 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| GB8711153D0 (en) * | 1987-05-12 | 1987-06-17 | Warwick International Ltd | Bleach activator compositions |
| CA1323282C (en) * | 1988-04-29 | 1993-10-19 | John Stuart Galvin | Liquid cleaning products |
| US4869393A (en) * | 1988-06-01 | 1989-09-26 | Universal Instruments Corporation | Method and apparatus for peeling a covering tape from a component supply tape |
| US5269962A (en) * | 1988-10-14 | 1993-12-14 | The Clorox Company | Oxidant composition containing stable bleach activator granules |
| US5030380A (en) * | 1989-06-27 | 1991-07-09 | Lever Brothers Company, Division Of Conopco, Inc. | Polymeric electrolyte-hydrogen peroxide adducts |
| TR24867A (tr) * | 1989-08-23 | 1992-07-01 | Unilever Nv | CAMASIR MUAMELE MAMULü |
| EP0447553B1 (en) * | 1989-09-11 | 1996-06-12 | Kao Corporation | Bleaching composition |
| US5672580A (en) * | 1990-04-25 | 1997-09-30 | Lever Brothers Company, Division Of Conopco, Inc. | Liquid detergent compositions |
| SE500386C2 (sv) * | 1990-05-09 | 1994-06-13 | Eka Nobel Ab | Nya diacylerade diperkarboxylsyror, förfarande för framställning därav samt kompositioner innehållande föreningarna för blekning |
| US5110640A (en) * | 1990-05-18 | 1992-05-05 | Colgate-Palmolive Company | Detergent pouch construction |
| US5411673A (en) * | 1991-02-06 | 1995-05-02 | The Procter & Gamble Company | Peroxyacid bleach precursor compositions |
| GB9102507D0 (en) * | 1991-02-06 | 1991-03-27 | Procter & Gamble | Peroxyacid bleach precursor compositions |
| EP0504952A1 (en) * | 1991-02-15 | 1992-09-23 | The Procter & Gamble Company | Stable liquid amidoperoxyacid bleach |
| US5445651A (en) * | 1992-01-31 | 1995-08-29 | The Procter & Gamble Company | Detergent compositions inhibiting dye transfer in washing |
| EP0553607B1 (en) * | 1992-01-31 | 1998-03-18 | The Procter & Gamble Company | Detergent compositions inhibiting dye transfer in washing |
| US5234617A (en) * | 1992-04-20 | 1993-08-10 | Kathleen B. Hunter | Aqueous liquid bleach compositions with fluorescent whitening agent and polyvinyl pyrrolidone or polyvinyl alcohol |
| EP0652930A4 (en) * | 1992-08-01 | 1995-08-02 | Procter & Gamble | LOW - LEVEL GELIFICATION DETERSIVE COMPOSITIONS AND METHOD OF PREPARATION. |
| CA2141586A1 (en) * | 1992-08-01 | 1994-02-17 | Anthony Dovey | Peroxyacid bleach precursor compositions |
| EP0652848A4 (en) * | 1992-08-01 | 1995-07-26 | Procter & Gamble | COMPOSITIONS OF PEROXYACID-BASED BLEACHING PRECURSORS. |
| DE4230655A1 (de) * | 1992-09-14 | 1994-03-17 | Ciba Geigy | Verfahren zur Verbesserung von Weißgrad, Helligkeit und Farbort von Faserstoffen |
| EP0592033A1 (en) * | 1992-10-07 | 1994-04-13 | The Procter & Gamble Company | Process for making peroxyacid containing particles |
| US5409632A (en) * | 1992-11-16 | 1995-04-25 | The Procter & Gamble Company | Cleaning and bleaching composition with amidoperoxyacid |
| AU4685193A (en) * | 1992-12-22 | 1994-07-19 | Procter & Gamble Company, The | Coated peroxyacid bleach precursor compositions |
| US5998350A (en) * | 1993-05-20 | 1999-12-07 | The Procter & Gamble Company | Bleaching compounds comprising N-acyl caprolactam and/or peroxy acid activators |
| JPH08510779A (ja) * | 1993-05-20 | 1996-11-12 | ザ、プロクター、エンド、ギャンブル、カンパニー | N−アシルカプロラクタム漂白活性剤とアルカノイルオキシベンゼンスルホネート漂白活性剤とを含む漂白コンパウンド |
| US5932532A (en) * | 1993-10-14 | 1999-08-03 | Procter & Gamble Company | Bleach compositions comprising protease enzyme |
| US5534195A (en) * | 1993-12-23 | 1996-07-09 | The Procter & Gamble Co. | Process for making particles comprising lactam bleach activators |
| US5534196A (en) * | 1993-12-23 | 1996-07-09 | The Procter & Gamble Co. | Process for making lactam bleach activator containing particles |
| JPH07316591A (ja) * | 1994-03-31 | 1995-12-05 | Lion Corp | 漂白性組成物 |
| GB9407536D0 (en) * | 1994-04-13 | 1994-06-08 | Procter & Gamble | Detergents with reduced bleach levels |
| GB9417140D0 (en) * | 1994-08-24 | 1994-10-12 | Unilever Plc | Detergent compositions |
| US5520835A (en) * | 1994-08-31 | 1996-05-28 | The Procter & Gamble Company | Automatic dishwashing compositions comprising multiquaternary bleach activators |
| US5534179A (en) * | 1995-02-03 | 1996-07-09 | Procter & Gamble | Detergent compositions comprising multiperacid-forming bleach activators |
| US5534180A (en) * | 1995-02-03 | 1996-07-09 | Miracle; Gregory S. | Automatic dishwashing compositions comprising multiperacid-forming bleach activators |
| US5565422A (en) * | 1995-06-23 | 1996-10-15 | The Procter & Gamble Company | Process for preparing a free-flowing particulate detergent composition having improved solubility |
| US5843879A (en) * | 1996-02-06 | 1998-12-01 | Lion Corporation | Bleaching activator granulate |
| US5712239A (en) * | 1996-04-08 | 1998-01-27 | Lever Brothers Company, Division Of Conopco, Inc. | Aqueous liquid compositions comprising peracid compounds and substituted phenolic compounds |
| US6001794A (en) * | 1996-06-14 | 1999-12-14 | The Procter & Gamble Company | Laundry pretreatment peroxygen bleach with radical scavenger giving improved fabric/color safety |
| DE19641708A1 (de) * | 1996-10-10 | 1998-04-16 | Clariant Gmbh | Verfahren zur Herstellung eines gecoateten Bleichaktivatorgranulats |
| CN1128870C (zh) * | 1998-04-28 | 2003-11-26 | 西巴特殊化学品控股有限公司 | 用于稳定含表面活性剂制剂的抗氧剂 |
| US7390432B2 (en) * | 1998-06-30 | 2008-06-24 | Sandia Corporation | Enhanced formulations for neutralization of chemical, biological and industrial toxants |
| US7282470B2 (en) * | 2002-07-19 | 2007-10-16 | Sandia Corporation | Decontamination formulation with sorbent additive |
| US7276468B1 (en) * | 1998-06-30 | 2007-10-02 | Sandia Corporation | Granulated decontamination formulations |
| AU1041800A (en) | 1998-11-02 | 2000-05-22 | Ciba Specialty Chemicals Holding Inc. | Stabilisation of body-care and household products |
| US6346600B1 (en) * | 1999-04-22 | 2002-02-12 | Nippon Shokubai Co., Ltd. | Vinylpyrrolidone polymer and its stabilization and preservation processes |
| US7271137B2 (en) * | 2000-06-29 | 2007-09-18 | Sandia Corporation | Decontamination formulations for disinfection and sterilization |
| US7125497B1 (en) * | 2003-05-22 | 2006-10-24 | Sandia Corporation | Reactive formulations for a neutralization of toxic industrial chemicals |
| CA2564250A1 (en) * | 2004-04-28 | 2005-11-10 | The Procter & Gamble Company | Laundry detergent compositions comprising substituted 3-pyridinols |
| JP4602034B2 (ja) * | 2004-09-09 | 2010-12-22 | 花王株式会社 | 漂白方法 |
| JP4509746B2 (ja) * | 2004-11-19 | 2010-07-21 | 花王株式会社 | 液体漂白剤組成物 |
| US7662759B1 (en) * | 2005-01-28 | 2010-02-16 | Sandia Corporation | Decontamination formulation with additive for enhanced mold remediation |
| CA2616776C (en) * | 2005-09-02 | 2014-10-21 | Restore + Inc. | Method for cleaning ion exchange resins using an oxidizing agent |
| US8236522B2 (en) | 2007-03-05 | 2012-08-07 | Om Pharma | Bacterial extract for digestive or urinary tract disorders and process for its preparation |
| WO2012090124A2 (en) | 2010-12-29 | 2012-07-05 | Ecolab Usa Inc. | IN SITU GENERATION OF PEROXYCARBOXYLIC ACIDS AT ALKALINE pH, AND METHODS OF USE THEREOF |
| EP2659057B1 (en) | 2010-12-29 | 2017-09-06 | Ecolab USA Inc. | GENERATION OF PEROXYCARBOXYLIC ACIDS AT ALKALINE pH, AND THEIR USE AS TEXTILE BLEACHING AND ANTIMICROBIAL AGENTS |
| US9321664B2 (en) | 2011-12-20 | 2016-04-26 | Ecolab Usa Inc. | Stable percarboxylic acid compositions and uses thereof |
| KR101372004B1 (ko) | 2011-12-21 | 2014-03-12 | (주)엘지하우시스 | 중공단면을 갖는 섬유복합보강재가 내장되어 있는 범퍼백빔 및 이를 갖는 범퍼 |
| CN104254496B (zh) | 2012-03-30 | 2016-10-26 | 艺康美国股份有限公司 | 过乙酸/过氧化氢和过氧化物还原剂用于处理钻井液、压裂液、回流水和排放水的用途 |
| JP5974326B2 (ja) | 2012-04-25 | 2016-08-23 | 株式会社テージーケー | 膨張弁および防振ばね |
| US8822719B1 (en) | 2013-03-05 | 2014-09-02 | Ecolab Usa Inc. | Peroxycarboxylic acid compositions suitable for inline optical or conductivity monitoring |
| US20140256811A1 (en) | 2013-03-05 | 2014-09-11 | Ecolab Usa Inc. | Efficient stabilizer in controlling self accelerated decomposition temperature of peroxycarboxylic acid compositions with mineral acids |
| US10165774B2 (en) | 2013-03-05 | 2019-01-01 | Ecolab Usa Inc. | Defoamer useful in a peracid composition with anionic surfactants |
| US9783766B2 (en) | 2015-04-03 | 2017-10-10 | Ecolab Usa Inc. | Enhanced peroxygen stability using anionic surfactant in TAED-containing peroxygen solid |
| US10280386B2 (en) | 2015-04-03 | 2019-05-07 | Ecolab Usa Inc. | Enhanced peroxygen stability in multi-dispense TAED-containing peroxygen solid |
| CA3102614C (en) | 2018-06-15 | 2023-02-28 | Ecolab Usa Inc. | Enhanced peroxygen stability using fatty acid in bleach activating agent containing peroxygen solid |
| WO2020041545A1 (en) | 2018-08-22 | 2020-02-27 | Ecolab Usa Inc. | Hydrogen peroxide and peracid stabilization with molecules based on a pyridine carboxylic acid at c-3, -4 or -5 |
| US12096768B2 (en) | 2019-08-07 | 2024-09-24 | Ecolab Usa Inc. | Polymeric and solid-supported chelators for stabilization of peracid-containing compositions |
| US12410381B2 (en) | 2020-06-04 | 2025-09-09 | The Procter & Gamble Company | Particulate laundry additive |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA635620A (en) * | 1962-01-30 | W. Mccune Homer | Bleaching compositions | |
| GB864798A (en) * | 1958-03-20 | 1961-04-06 | Unilever Ltd | Bleaching processes and compositions |
| BE621901A (enExample) * | 1961-08-31 | |||
| NL137165C (enExample) * | 1966-03-11 | |||
| US4167487A (en) * | 1973-06-07 | 1979-09-11 | Colgate-Palmolive Company | Aromatic activator |
| JPS5411806B2 (enExample) * | 1973-12-27 | 1979-05-17 | ||
| US4126573A (en) * | 1976-08-27 | 1978-11-21 | The Procter & Gamble Company | Peroxyacid bleach compositions having increased solubility |
| US4119660A (en) * | 1976-08-27 | 1978-10-10 | The Procter & Gamble Company | Method for making diperoxyacids |
| US4100095A (en) * | 1976-08-27 | 1978-07-11 | The Procter & Gamble Company | Peroxyacid bleach composition having improved exotherm control |
| US4087369A (en) * | 1976-11-08 | 1978-05-02 | The Procter & Gamble Company | Peroxybleach activated detergent composition |
| DE2963842D1 (en) * | 1978-06-26 | 1982-11-18 | Procter & Gamble | Particulate detergent additive product |
| ES506859A0 (es) * | 1980-11-06 | 1983-11-01 | Procter & Gamble | Un procedimiento para preparar una composicion granular ac- tivadora del blanqueo. |
| EP0068547B1 (en) * | 1981-06-22 | 1985-09-18 | THE PROCTER & GAMBLE COMPANY | Mixed peroxyacid bleaches having improved bleaching power |
| US4421668A (en) * | 1981-07-07 | 1983-12-20 | Lever Brothers Company | Bleach composition |
| US4412934A (en) * | 1982-06-30 | 1983-11-01 | The Procter & Gamble Company | Bleaching compositions |
| JPS5922999A (ja) * | 1982-06-30 | 1984-02-06 | ザ・プロクタ−・エンド・ギヤンブル・カンパニ− | 漂白組成物 |
| EP0099197B1 (en) * | 1982-07-03 | 1988-03-16 | The Procter & Gamble Company | Laundry additive products |
| US4552682A (en) * | 1982-09-30 | 1985-11-12 | Ppg Industries, Inc. | Peroxide composition containing phenolic antioxidant |
| JPS59135299A (ja) * | 1982-10-08 | 1984-08-03 | ザ,プロクタ−,エンド,ギヤンブル,カンパニ− | 漂白剤活性剤を含有するボデイ− |
| GB8304990D0 (en) * | 1983-02-23 | 1983-03-30 | Procter & Gamble | Detergent ingredients |
| US4486327A (en) * | 1983-12-22 | 1984-12-04 | The Procter & Gamble Company | Bodies containing stabilized bleach activators |
| US4483778A (en) * | 1983-12-22 | 1984-11-20 | The Procter & Gamble Company | Peroxygen bleach activators and bleaching compositions |
| US4539130A (en) * | 1983-12-22 | 1985-09-03 | The Procter & Gamble Company | Peroxygen bleach activators and bleaching compositions |
| EP0163331A1 (en) * | 1984-05-02 | 1985-12-04 | THE PROCTER & GAMBLE COMPANY | Granular detergent-bleaching compositions |
| EP0209228B2 (en) * | 1985-06-17 | 1999-06-09 | The Clorox Company | Stabilized liquid hydrogen peroxide bleach compositions |
| US4678594A (en) * | 1985-07-19 | 1987-07-07 | Colgate-Palmolive Company | Method of encapsulating a bleach and activator therefor in a binder |
-
1988
- 1988-03-16 EP EP88302262A patent/EP0283252B1/en not_active Expired - Lifetime
- 1988-03-16 FI FI881255A patent/FI881255A7/fi not_active Application Discontinuation
- 1988-03-16 MA MA21457A patent/MA21216A1/fr unknown
- 1988-03-16 CA CA000561607A patent/CA1302835C/en not_active Expired - Lifetime
- 1988-03-16 DE DE8888302262T patent/DE3875142T2/de not_active Expired - Fee Related
- 1988-03-16 ES ES88302262T patent/ES2045106T3/es not_active Expired - Lifetime
- 1988-03-16 US US07/168,723 patent/US4853143A/en not_active Expired - Fee Related
- 1988-03-17 TR TR88/0204A patent/TR24372A/xx unknown
- 1988-03-17 DK DK146688A patent/DK146688A/da not_active Application Discontinuation
- 1988-03-17 MX MX010814A patent/MX172178B/es unknown
- 1988-03-17 JP JP63064684A patent/JPS64199A/ja active Pending
- 1988-03-17 KR KR1019880002828A patent/KR950003848B1/ko not_active Expired - Fee Related
-
1992
- 1992-10-08 GR GR920402007T patent/GR3005906T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI881255A0 (fi) | 1988-03-16 |
| KR880011404A (ko) | 1988-10-28 |
| KR950003848B1 (ko) | 1995-04-20 |
| FI881255L (fi) | 1988-09-18 |
| TR24372A (tr) | 1991-09-20 |
| FI881255A7 (fi) | 1988-09-18 |
| MX172178B (es) | 1993-12-07 |
| ES2045106T3 (es) | 1994-01-16 |
| EP0283252B1 (en) | 1992-10-07 |
| MA21216A1 (fr) | 1988-10-01 |
| US4853143A (en) | 1989-08-01 |
| DK146688A (da) | 1988-09-18 |
| EP0283252A1 (en) | 1988-09-21 |
| JPS64199A (en) | 1989-01-05 |
| DE3875142D1 (de) | 1992-11-12 |
| DK146688D0 (da) | 1988-03-17 |
| GR3005906T3 (enExample) | 1993-06-07 |
| CA1302835C (en) | 1992-06-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3875142T2 (de) | Bleichmittel. | |
| DE3888116T2 (de) | Bleichmittel. | |
| DE3883849T2 (de) | Waschmittel-Zusammensetzungen. | |
| US4795584A (en) | Laundry compositions | |
| AU674405B2 (en) | Peroxyacids | |
| US4681695A (en) | Bleach compositions | |
| US4619779A (en) | Detergent additive product | |
| US4615820A (en) | Detergent compositions | |
| JPS63253053A (ja) | テレフタレートエステル共重合体と洗濯組成物におけるその使用 | |
| JPH01199A (ja) | 漂白剤組成物 | |
| GB2143231A (en) | Peroxy acid bleach precursors and their use in cleaning compositions and washing processes | |
| KR950703038A (ko) | 에틸렌디아민-n,n′-디석신산으로 안정화시킨 퍼옥시 표백 조성물(peroxy bleaching composition stabilized with ethylenediamine-n,n′-disuccinic acid) | |
| JPH0224948B2 (enExample) | ||
| DE3784975T2 (de) | Waeschewaschmittel. | |
| CA1052220A (en) | Detergent composition | |
| EP0123423B1 (en) | Detergent compositions, detergent liquors and method for their preparation | |
| EP0087914B1 (en) | Detergent composition | |
| DE2327862B2 (de) | Pulverfoermiges schaumreguliertes waschmittel | |
| EP0095904B1 (en) | Detergent liquors and compositions for use therein | |
| EP0121949A1 (en) | Anionic/cationic detergent mixture with irregular structure | |
| AU6277298A (en) | Soaker compositions | |
| EP1847589B1 (en) | Bleach particle | |
| DK160265B (da) | Blegemiddel herunder blegende vaskemiddel til lav temperatur | |
| DE19820799A1 (de) | Feste Waschmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |