DE3813977A1 - Verfahren zur herstellung von chinoxalonen - Google Patents
Verfahren zur herstellung von chinoxalonenInfo
- Publication number
- DE3813977A1 DE3813977A1 DE19883813977 DE3813977A DE3813977A1 DE 3813977 A1 DE3813977 A1 DE 3813977A1 DE 19883813977 DE19883813977 DE 19883813977 DE 3813977 A DE3813977 A DE 3813977A DE 3813977 A1 DE3813977 A1 DE 3813977A1
- Authority
- DE
- Germany
- Prior art keywords
- quinoxalone
- approximately
- amino
- percent
- oxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims abstract description 31
- 230000008569 process Effects 0.000 title claims abstract description 14
- 238000002360 preparation method Methods 0.000 title claims abstract description 7
- 239000003054 catalyst Substances 0.000 claims abstract description 28
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims abstract description 22
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 19
- 229910052697 platinum Inorganic materials 0.000 claims abstract description 10
- 239000000243 solution Substances 0.000 claims abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- -1 tetrafluoroethoxy Chemical group 0.000 claims abstract description 7
- 125000001424 substituent group Chemical group 0.000 claims abstract description 6
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims abstract description 5
- 239000012670 alkaline solution Substances 0.000 claims abstract description 5
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 4
- 125000005843 halogen group Chemical group 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract description 3
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical group [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims abstract description 3
- 125000003277 amino group Chemical group 0.000 claims abstract description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 3
- 239000011737 fluorine Substances 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 3
- 150000003385 sodium Chemical class 0.000 claims 1
- 239000007864 aqueous solution Substances 0.000 abstract 1
- 239000000047 product Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 239000006227 byproduct Substances 0.000 description 8
- SJAZZQLTKBYDHN-UHFFFAOYSA-N 6-chloro-1h-quinoxalin-2-one Chemical compound C1=C(Cl)C=CC2=NC(O)=CN=C21 SJAZZQLTKBYDHN-UHFFFAOYSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 150000001555 benzenes Chemical class 0.000 description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- RNOLFZACEWWIHP-UHFFFAOYSA-N 6-chloro-1,4-dihydroquinoxaline-2,3-dione Chemical compound N1C(=O)C(=O)NC2=CC(Cl)=CC=C21 RNOLFZACEWWIHP-UHFFFAOYSA-N 0.000 description 4
- WXIXSRNTPHCSPF-UHFFFAOYSA-N 6-chloro-3,4-dihydro-1h-quinoxalin-2-one Chemical compound N1C(=O)CNC2=CC(Cl)=CC=C21 WXIXSRNTPHCSPF-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- ABJFBJGGLJVMAQ-UHFFFAOYSA-N 1,4-dihydroquinoxaline-2,3-dione Chemical class C1=CC=C2NC(=O)C(=O)NC2=C1 ABJFBJGGLJVMAQ-UHFFFAOYSA-N 0.000 description 3
- FOTMGTRHJLCQPN-UHFFFAOYSA-N 6-chloro-1-hydroxyquinoxalin-2-one Chemical compound C1=C(Cl)C=C2N=CC(=O)N(O)C2=C1 FOTMGTRHJLCQPN-UHFFFAOYSA-N 0.000 description 3
- KDINSGBFCYLRRC-UHFFFAOYSA-N 6-chloro-4-oxido-1h-quinoxalin-4-ium-2-one Chemical compound C1=C(Cl)C=CC2=NC(O)=C[N+]([O-])=C21 KDINSGBFCYLRRC-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- HYTIPJFUWHYQON-UHFFFAOYSA-N 3,4-dihydro-1h-quinoxalin-2-one Chemical class C1=CC=C2NC(=O)CNC2=C1 HYTIPJFUWHYQON-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- APORIKJNLVVUNX-UHFFFAOYSA-N 2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)ethanone Chemical compound NCC(=O)N1CCCC1P(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 APORIKJNLVVUNX-UHFFFAOYSA-N 0.000 description 1
- SEKXGLJSINZNFF-UHFFFAOYSA-N 4-oxido-7-(trifluoromethyl)-1H-quinoxalin-4-ium-2-one Chemical compound FC(C1=CC=C2[N+](=CC(NC2=C1)=O)[O-])(F)F SEKXGLJSINZNFF-UHFFFAOYSA-N 0.000 description 1
- AVMHCGRYGMHOSQ-UHFFFAOYSA-N 5,6,7,8-tetrafluoro-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound FC1=C2[N+](=CC(NC2=C(C(=C1F)F)F)=O)[O-] AVMHCGRYGMHOSQ-UHFFFAOYSA-N 0.000 description 1
- SKJGEVSFXCWBCE-UHFFFAOYSA-N 6,7-dichloro-4-oxido-1h-quinoxalin-4-ium-2-one Chemical compound ClC1=C(Cl)C=C2[N+]([O-])=CC(=O)NC2=C1 SKJGEVSFXCWBCE-UHFFFAOYSA-N 0.000 description 1
- PTDAJKMFHJTQFY-UHFFFAOYSA-N 6,7-difluoro-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound FC=1C=C2[N+](=CC(NC2=CC=1F)=O)[O-] PTDAJKMFHJTQFY-UHFFFAOYSA-N 0.000 description 1
- FJZQJXWFJSSPQZ-UHFFFAOYSA-N 6,8-dichloro-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound ClC=1C=C2[N+](=CC(NC2=C(C=1)Cl)=O)[O-] FJZQJXWFJSSPQZ-UHFFFAOYSA-N 0.000 description 1
- ZLBVSFDFKKXWJL-UHFFFAOYSA-N 6-butoxy-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound C(CCC)OC=1C=C2[N+](=CC(NC2=CC=1)=O)[O-] ZLBVSFDFKKXWJL-UHFFFAOYSA-N 0.000 description 1
- MXJNNELRUWWWAE-UHFFFAOYSA-N 6-chloro-7-methoxy-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound ClC=1C=C2[N+](=CC(NC2=CC=1OC)=O)[O-] MXJNNELRUWWWAE-UHFFFAOYSA-N 0.000 description 1
- SCCFHCVPJPQEDS-UHFFFAOYSA-N 6-ethoxy-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound C(C)OC=1C=C2[N+](=CC(NC2=CC=1)=O)[O-] SCCFHCVPJPQEDS-UHFFFAOYSA-N 0.000 description 1
- BRCYAKJVXZTUBP-UHFFFAOYSA-N 7-chloro-1,2-dihydroquinoxaline Chemical compound N1=CCNC2=CC(Cl)=CC=C21 BRCYAKJVXZTUBP-UHFFFAOYSA-N 0.000 description 1
- YKEWPDOSDZISEI-UHFFFAOYSA-N 7-chloro-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound ClC1=CC=C2[N+](=CC(NC2=C1)=O)[O-] YKEWPDOSDZISEI-UHFFFAOYSA-N 0.000 description 1
- JLKHZKKGDYDNFJ-UHFFFAOYSA-N 7-fluoro-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound FC1=CC=C2[N+](=CC(NC2=C1)=O)[O-] JLKHZKKGDYDNFJ-UHFFFAOYSA-N 0.000 description 1
- OKRYSEIQYJMDQC-UHFFFAOYSA-N 7-hydroxy-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound OC1=CC=C2[N+](=CC(NC2=C1)=O)[O-] OKRYSEIQYJMDQC-UHFFFAOYSA-N 0.000 description 1
- XEVBBKJXLYQQFJ-UHFFFAOYSA-N 7-methoxy-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound COC1=CC=C2[N+](=CC(NC2=C1)=O)[O-] XEVBBKJXLYQQFJ-UHFFFAOYSA-N 0.000 description 1
- LCPFFLYIRDXCBO-UHFFFAOYSA-N 7-methyl-4-oxido-1H-quinoxalin-4-ium-2-one Chemical compound CC1=CC=C2[N+](=CC(NC2=C1)=O)[O-] LCPFFLYIRDXCBO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NHHDNOWSEBOTPT-UHFFFAOYSA-N CC(C=C1N2O)=C(C)C=C1N=CC2=O Chemical compound CC(C=C1N2O)=C(C)C=C1N=CC2=O NHHDNOWSEBOTPT-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 244000178870 Lavandula angustifolia Species 0.000 description 1
- 235000010663 Lavandula angustifolia Nutrition 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000006298 dechlorination reaction Methods 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000001102 lavandula vera Substances 0.000 description 1
- 235000018219 lavender Nutrition 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- FFRYUAVNPBUEIC-UHFFFAOYSA-N quinoxalin-2-ol Chemical compound C1=CC=CC2=NC(O)=CN=C21 FFRYUAVNPBUEIC-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- PTLRDCMBXHILCL-UHFFFAOYSA-M sodium arsenite Chemical compound [Na+].[O-][As]=O PTLRDCMBXHILCL-UHFFFAOYSA-M 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/44—Benzopyrazines with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19883813977 DE3813977A1 (de) | 1988-04-26 | 1988-04-26 | Verfahren zur herstellung von chinoxalonen |
| IN282/CAL/89A IN168567B (https=) | 1988-04-26 | 1989-04-12 | |
| EP89106784A EP0339411B1 (de) | 1988-04-26 | 1989-04-15 | Verfahren zur Herstellung von Chinoxalonen |
| DE8989106784T DE58902023D1 (de) | 1988-04-26 | 1989-04-15 | Verfahren zur herstellung von chinoxalonen. |
| KR1019890005412A KR900016157A (ko) | 1988-04-26 | 1989-04-25 | 퀴녹살론의 제조방법 |
| JP1103594A JPH01313470A (ja) | 1988-04-26 | 1989-04-25 | キノキサロンの製造方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19883813977 DE3813977A1 (de) | 1988-04-26 | 1988-04-26 | Verfahren zur herstellung von chinoxalonen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3813977A1 true DE3813977A1 (de) | 1989-11-09 |
Family
ID=6352866
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19883813977 Withdrawn DE3813977A1 (de) | 1988-04-26 | 1988-04-26 | Verfahren zur herstellung von chinoxalonen |
Country Status (2)
| Country | Link |
|---|---|
| DE (1) | DE3813977A1 (https=) |
| IN (1) | IN168567B (https=) |
-
1988
- 1988-04-26 DE DE19883813977 patent/DE3813977A1/de not_active Withdrawn
-
1989
- 1989-04-12 IN IN282/CAL/89A patent/IN168567B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IN168567B (https=) | 1991-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0324984B1 (de) | Verfahren zur Herstellung eines Gemisches aus Cyclohexylamin und Dicyclohexylamin unter Einsatz eines Ruthenium-Katalysators | |
| DE60125378T2 (de) | Verfahren zur Herstellung von 2-AMINOMETHYL-HALOGEN-PYRIDINEN | |
| EP3935045B1 (de) | Synthese von 4-amino-5-methyl-1h-pyridin-2(1h)-on (zwischenverbindung der synthese des mr antagonsiten finerenone) aus 2-chloro-5-methyl-4-nitro-pyridine-1-oxid über die zwischenverbindung 2-chloro-5-methyl-4-pyridinamin | |
| EP0820808B1 (de) | Multimetallischer Katalysator und Verfahren zur Herstellung substituierter aromatischer Amine | |
| EP1406887B1 (de) | Verfahren zur selektiven herstellung von tetrahydrofuran durch hydrierung von maleinsäureanhydrid | |
| DE3443385C2 (https=) | ||
| EP0339411B1 (de) | Verfahren zur Herstellung von Chinoxalonen | |
| CH685496A5 (de) | Verfahren zur Herstellung von Formylimidazolen. | |
| DE2609530C2 (de) | Verfahren zur Herstellung von Hydrazobenzolen | |
| DE3813977A1 (de) | Verfahren zur herstellung von chinoxalonen | |
| DE3901406A1 (de) | Verfahren zur herstellung von chinoxalonen | |
| EP0039810A1 (de) | Verfahren zur Herstellung von 2-Trifluormethylanilin | |
| EP3010880A1 (de) | Verfahren zur herstellung von 2-chlordialkylbenzylaminen durch hydrierung | |
| DE3137091C2 (de) | Verfahren zur Herstellung von 4-Aminomethyl-benzoesäure aus 4-Hydroxyiminomethyl-benzoesäure | |
| EP0054809B1 (de) | Verfahren zur Herstellung von 5-Amino-2,4-dimethyl-acetanilid | |
| DE3420111A1 (de) | Verfahren zur reinigung von benzoesaeure | |
| DE2758111B2 (https=) | ||
| EP1029862B1 (de) | Verfahren zum Herstellen von endo-Nortropin unter Verwendung von 8-Benzyl-nortropan-3-on-perchlorat als Zwischenprodukt, sowie letzteres Salz selbst | |
| DE2902541C2 (https=) | ||
| DE19636214A1 (de) | Multimetallischer Katalysator und Verfahren zur Herstellung substituierter aromatischer Amine | |
| WO1991001977A1 (de) | Verfahren zur herstellung von 2,6-dichlorchinoxalin | |
| DE2720199A1 (de) | Neamin-derivate und verfahren zu deren herstellung | |
| DE2311185A1 (de) | Verfahren zur herstellung von phthalazon | |
| EP1052253A1 (de) | Verfahren zur Herstellung von 2,3-Pyridindicarbonsäuren | |
| AT331253B (de) | Verfahren zur herstellung von 2,4-diamino-5-formylpyrimidin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |