DE3713041A1 - Mehrfarben-entladungslampe - Google Patents
Mehrfarben-entladungslampeInfo
- Publication number
- DE3713041A1 DE3713041A1 DE19873713041 DE3713041A DE3713041A1 DE 3713041 A1 DE3713041 A1 DE 3713041A1 DE 19873713041 DE19873713041 DE 19873713041 DE 3713041 A DE3713041 A DE 3713041A DE 3713041 A1 DE3713041 A1 DE 3713041A1
- Authority
- DE
- Germany
- Prior art keywords
- discharge tube
- discharge
- electrode
- discharge lamp
- light
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000463 material Substances 0.000 claims description 24
- 239000011261 inert gas Substances 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 5
- 239000003989 dielectric material Substances 0.000 claims description 4
- 229910052743 krypton Inorganic materials 0.000 claims description 3
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical group [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052754 neon Inorganic materials 0.000 claims description 3
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical group [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052724 xenon Inorganic materials 0.000 claims description 3
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical group [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 claims description 3
- 101100345589 Mus musculus Mical1 gene Proteins 0.000 claims 1
- 239000011521 glass Substances 0.000 description 13
- 239000003086 colorant Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 2
- 239000005388 borosilicate glass Substances 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 238000005253 cladding Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 230000036962 time dependent Effects 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910017881 Cu—Ni—Fe Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/38—Devices for influencing the colour or wavelength of the light
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/92—Lamps with more than one main discharge path
- H01J61/94—Paths producing light of different wavelengths, e.g. for simulating daylight
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP61093177A JPS62252061A (ja) | 1986-04-22 | 1986-04-22 | 複色発光放電灯 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3713041A1 true DE3713041A1 (de) | 1987-11-05 |
| DE3713041C2 DE3713041C2 (cg-RX-API-DMAC7.html) | 1991-07-11 |
Family
ID=14075291
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19873713041 Granted DE3713041A1 (de) | 1986-04-22 | 1987-04-16 | Mehrfarben-entladungslampe |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4740729A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS62252061A (cg-RX-API-DMAC7.html) |
| KR (1) | KR900002448B1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE3713041A1 (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3941799A1 (de) * | 1989-05-19 | 1990-11-22 | Sautter Kg | Lichtquelle und verfahren zu deren steuerung |
| WO1993023977A1 (de) * | 1992-05-20 | 1993-11-25 | Megalux Fénytechnikai Kft. | Beleuchtungsanordnung mit veränderbarer lichtstärke und farbe |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2221084B (en) * | 1988-06-27 | 1992-10-21 | Matsushita Electric Works Ltd | Variable colour lighting device |
| US4990826A (en) * | 1989-10-27 | 1991-02-05 | Cocks Franklin H | Low voltage gas discharge device |
| JPH076734A (ja) * | 1992-05-01 | 1995-01-10 | Oyo Kagaku Kenkyusho | 放電装置 |
| US5804914A (en) * | 1996-11-27 | 1998-09-08 | Industrial Technology Research Institute | Fluorescent lamp having additional and interior fluorescent surfaces to increase luminosity |
| DE19829270B4 (de) * | 1997-07-02 | 2006-03-16 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Lampe |
| US5911613A (en) * | 1998-03-16 | 1999-06-15 | Byrum; Bernard W. | Luminous gas discharge display |
| US6184633B1 (en) * | 1999-06-17 | 2001-02-06 | Philips Electronics North America Corporation | Reduction of vertical segregation in a discharge lamp |
| US6836072B2 (en) * | 2001-11-02 | 2004-12-28 | Electro Plasma, Inc. | Low voltage high efficiency illuminated display having capacitive coupled electrodes |
| DE102009030310A1 (de) * | 2009-06-24 | 2010-12-30 | Osram Gesellschaft mit beschränkter Haftung | Dielektrische Barriere-Entladungslampe mit Entladungsräumen |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB362885A (en) * | 1929-06-26 | 1931-12-08 | Claude Neon Lights Inc | Improvements in or relating to luminescent gas discharge tubes |
| US2269819A (en) * | 1938-08-17 | 1942-01-13 | Gen Luminescent Corp | White light lamp |
| US2312866A (en) * | 1937-05-22 | 1943-03-02 | Boucher Inv S Ltd | Luminescent tube and system |
| GB1282513A (en) * | 1968-09-19 | 1972-07-19 | Philips Electronic Associated | Low-pressure discharge lamps |
| JPS58111251A (ja) * | 1981-12-23 | 1983-07-02 | 周 成祥 | 放電灯 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5834560A (ja) * | 1981-08-21 | 1983-03-01 | 周 成祥 | 放電灯ディスプレイ装置 |
| JPS6023947A (ja) * | 1983-07-18 | 1985-02-06 | Matsushita Electric Works Ltd | カラー放電灯 |
| JPS61133551A (ja) * | 1984-12-03 | 1986-06-20 | Matsushita Electric Works Ltd | 螢光ランプ |
-
1986
- 1986-04-22 JP JP61093177A patent/JPS62252061A/ja active Granted
-
1987
- 1987-04-13 US US07/037,724 patent/US4740729A/en not_active Expired - Lifetime
- 1987-04-16 DE DE19873713041 patent/DE3713041A1/de active Granted
- 1987-04-21 KR KR1019870003809A patent/KR900002448B1/ko not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB362885A (en) * | 1929-06-26 | 1931-12-08 | Claude Neon Lights Inc | Improvements in or relating to luminescent gas discharge tubes |
| US2312866A (en) * | 1937-05-22 | 1943-03-02 | Boucher Inv S Ltd | Luminescent tube and system |
| US2269819A (en) * | 1938-08-17 | 1942-01-13 | Gen Luminescent Corp | White light lamp |
| GB1282513A (en) * | 1968-09-19 | 1972-07-19 | Philips Electronic Associated | Low-pressure discharge lamps |
| JPS58111251A (ja) * | 1981-12-23 | 1983-07-02 | 周 成祥 | 放電灯 |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3941799A1 (de) * | 1989-05-19 | 1990-11-22 | Sautter Kg | Lichtquelle und verfahren zu deren steuerung |
| WO1993023977A1 (de) * | 1992-05-20 | 1993-11-25 | Megalux Fénytechnikai Kft. | Beleuchtungsanordnung mit veränderbarer lichtstärke und farbe |
Also Published As
| Publication number | Publication date |
|---|---|
| KR870010607A (ko) | 1987-11-30 |
| JPH0445935B2 (cg-RX-API-DMAC7.html) | 1992-07-28 |
| KR900002448B1 (ko) | 1990-04-14 |
| JPS62252061A (ja) | 1987-11-02 |
| US4740729A (en) | 1988-04-26 |
| DE3713041C2 (cg-RX-API-DMAC7.html) | 1991-07-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2903866C2 (de) | Anzeigevorrichtung | |
| DE3713041C2 (cg-RX-API-DMAC7.html) | ||
| DE69610127T2 (de) | Zündhilfe für Metallhalogenidlampen | |
| DE2061187C3 (de) | Röhre zur Anzeige von Ziffern oder Zeichen | |
| DE2627380C3 (de) | Metalldampf-Hochdruckentladungslampe für horizontalen Betrieb | |
| DE2057362C3 (de) | Elektrolumineszente Anzeigeeinrichtung | |
| DE2106447C2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE8333920U1 (de) | Kompakte niederdruckentladungslampe | |
| DE10356762B4 (de) | Entladungslampe vom Kurzbogentyp | |
| DE4035561A1 (de) | Lampe mit hochintensitaets-entladungsroehre | |
| DE1287214B (de) | Leuchtstofflampe und Verfahren zu ihrer Herstellung | |
| DE3434589C2 (cg-RX-API-DMAC7.html) | ||
| DE2308083A1 (de) | Gasentladungsvorrichtung mit kapazitiver speicherfunktion | |
| DE3045090C2 (de) | U-förmige Leuchtstofflampe | |
| DE3853557T2 (de) | Integrale Lampe für dreifarbiges Bildelement. | |
| DE4203594A1 (de) | Entladungsroehre | |
| DE2931328A1 (de) | Anzeigeanordnung | |
| EP0118834B1 (de) | Einseitig gesockelte Niederdruckentladungslampe und Verfahren zur Herstellung | |
| DE2119199C3 (de) | Leuchtstofflampe mit Fenster | |
| DE10121697A1 (de) | Verfahren zum Herstellen eines Schichtaufbaus und Verwendung des Schichtaufbaus als Leuchtfolie | |
| DE3147705A1 (de) | Starthilfe fuer nicht-geradlinige entladungslampen und verfahren zur herstellung derselben | |
| EP0118100A1 (de) | Einseitig gesockelte Niederdruckentladungslampe | |
| DE3854103T2 (de) | Niederdruckbogenentladungslampe mit erhöhter Oberflächenhelligkeit. | |
| DE2160960C3 (de) | Hochdruck-Metalldampfentladungslampe | |
| DE2615681A1 (de) | Gasentladungsanzeigevorrichtung mit einer steuerstruktur |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |