DE3444354C2 - - Google Patents
Info
- Publication number
- DE3444354C2 DE3444354C2 DE3444354A DE3444354A DE3444354C2 DE 3444354 C2 DE3444354 C2 DE 3444354C2 DE 3444354 A DE3444354 A DE 3444354A DE 3444354 A DE3444354 A DE 3444354A DE 3444354 C2 DE3444354 C2 DE 3444354C2
- Authority
- DE
- Germany
- Prior art keywords
- layer
- film
- electrophotographic recording
- recording material
- monomolecular
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000463 material Substances 0.000 claims description 60
- 239000000758 substrate Substances 0.000 claims description 35
- 230000002209 hydrophobic effect Effects 0.000 claims description 15
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical class C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 claims description 2
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical group [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims 2
- 239000010410 layer Substances 0.000 description 172
- 238000000034 method Methods 0.000 description 41
- 230000006870 function Effects 0.000 description 31
- 239000002356 single layer Substances 0.000 description 22
- 230000035945 sensitivity Effects 0.000 description 17
- 230000008569 process Effects 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- -1 amine salt Chemical class 0.000 description 7
- 125000001165 hydrophobic group Chemical group 0.000 description 7
- 239000012790 adhesive layer Substances 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 230000002776 aggregation Effects 0.000 description 5
- 238000004220 aggregation Methods 0.000 description 5
- 239000000049 pigment Substances 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine group Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 238000007598 dipping method Methods 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- VKOBVWXKNCXXDE-UHFFFAOYSA-N icosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCC(O)=O VKOBVWXKNCXXDE-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000005577 anthracene group Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 230000009189 diving Effects 0.000 description 2
- 230000005672 electromagnetic field Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 208000017983 photosensitivity disease Diseases 0.000 description 2
- 231100000434 photosensitization Toxicity 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 150000004032 porphyrins Chemical group 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical group O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- NTELFBCTNQWGNC-UHFFFAOYSA-N [Cu].C1=CC=CC=2C3=CC=CC=C3NC12 Chemical compound [Cu].C1=CC=CC=2C3=CC=CC=C3NC12 NTELFBCTNQWGNC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229920001940 conductive polymer Polymers 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N guanidine group Chemical group NC(=N)N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical group C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001197 polyacetylene Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920006389 polyphenyl polymer Chemical group 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 238000013517 stratification Methods 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000002604 ultrasonography Methods 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/05—Organic bonding materials; Methods for coating a substrate with a photoconductive layer; Inert supplements for use in photoconductive layers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58228381A JPS60120361A (ja) | 1983-12-05 | 1983-12-05 | 感光体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3444354A1 DE3444354A1 (de) | 1985-06-13 |
| DE3444354C2 true DE3444354C2 (enExample) | 1992-10-15 |
Family
ID=16875572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843444354 Granted DE3444354A1 (de) | 1983-12-05 | 1984-12-05 | Lichtempfindliches aufzeichnungsmaterial |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4592980A (enExample) |
| JP (1) | JPS60120361A (enExample) |
| DE (1) | DE3444354A1 (enExample) |
| GB (1) | GB2152225B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4957851A (en) * | 1985-04-16 | 1990-09-18 | Canon Kabushiki Kaisha | Image recording medium comprising a diacetylene derivative compound film and a radiation absorbing layer |
| FI852574A0 (fi) * | 1985-06-28 | 1985-06-28 | Jorma Virtanen | Filmstruktur samt nya foereningar foer anvaendning i detsamma. |
| US4929524A (en) * | 1986-09-12 | 1990-05-29 | Canon Kabushiki Kaisha | Organic photo conductive medium |
| WO1988006175A1 (en) * | 1987-02-13 | 1988-08-25 | The Secretary Of State For Defence In Her Britanni | Substituted phthalocyanines |
| US4828917A (en) * | 1987-05-08 | 1989-05-09 | Basf Aktiengesellschaft | Layer of metallomacrocyclic polymer on substrate |
| US5139913A (en) * | 1988-04-08 | 1992-08-18 | Fuji Xerox Co., Ltd. | Photosensor having a monomolecular membranes of squarylium pigment |
| US5280183A (en) * | 1988-05-31 | 1994-01-18 | Edison Polymer Innovation Corporation | Microelectronic device employing multiring phthalocyanine compound |
| US4869986A (en) * | 1988-11-23 | 1989-09-26 | Eastman Kodak Company | Multiactive electrophotographic element |
| US4869987A (en) * | 1988-11-23 | 1989-09-26 | Eastman Kodak Company | Multiactive electrophotographic reusable element |
| US5227272A (en) * | 1989-12-12 | 1993-07-13 | Fuji Photo Film Co., Ltd. | Electrophotographic light-sensitive material |
| US20020168667A1 (en) * | 2001-03-23 | 2002-11-14 | Fuji Photo Film Co., Ltd. | Antigen detecting agent and antigen detecting kit, antigen detecting apparatus and antigen detecting method using the same |
| US20020168756A1 (en) * | 2001-03-23 | 2002-11-14 | Fuji Photo Film Co., Ltd. | Particle size variable reactor |
| US7018795B2 (en) * | 2001-03-23 | 2006-03-28 | Fuji Photo Film Co., Ltd. | Hybridization probe and target nucleic acid detecting kit, target nucleic acid detecting apparatus and target nucleic acid detecting method using the same |
| US20030003476A1 (en) * | 2001-03-23 | 2003-01-02 | Fuji Photo Film Co., Ltd. | Waste water inspecting agent and waste water inspecting apparatus using the same |
| JP2002287184A (ja) * | 2001-03-23 | 2002-10-03 | Fuji Photo Film Co Ltd | 画像形成素子及び画像形成装置 |
| US7077982B2 (en) * | 2001-03-23 | 2006-07-18 | Fuji Photo Film Co., Ltd. | Molecular electric wire, molecular electric wire circuit using the same and process for producing the molecular electric wire circuit |
| US20030179381A1 (en) * | 2002-03-18 | 2003-09-25 | Fuji Photo Film Co., Ltd. | Sensor, color sensor and apparatus for inspection using the same |
| JP4294946B2 (ja) * | 2002-12-13 | 2009-07-15 | 富士フイルム株式会社 | 標的検出装置及び標的検出方法並びに標的検出用基材 |
| US7076127B2 (en) * | 2003-01-14 | 2006-07-11 | Fuji Photo Film Co., Ltd. | Optical switch and safety apparatus using the same |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU36383A1 (enExample) * | 1957-09-07 | |||
| US3210185A (en) * | 1961-03-22 | 1965-10-05 | Rca Corp | Simultaneous identical electrostatic image recording on multiple recording elements |
| US3359101A (en) * | 1963-10-12 | 1967-12-19 | Minnestoa Mining And Mfg Compa | Pre-electrosensitive printing plate and novel methods of electro-defining images |
| CH438941A (de) * | 1963-11-13 | 1967-06-30 | Lumiere Soc | Verfahren zur Herstellung eines elektrophotographischen Materials |
| US3397086A (en) * | 1965-03-12 | 1968-08-13 | Gen Electric | Photoconductive composition and coated article |
| US3542546A (en) * | 1966-11-29 | 1970-11-24 | Eastman Kodak Co | Organic photoconductors containing the >n-n< nucleus |
| US3574182A (en) * | 1967-02-01 | 1971-04-06 | Xerox Corp | Calcium salt of 6-bromo-1-(1'-sulfo-2'-naphthylazo)-2-naphthol |
| JPS4925218B1 (enExample) * | 1968-09-21 | 1974-06-28 | ||
| US3865869A (en) * | 1973-05-21 | 1975-02-11 | Ici America Inc | Water-soluble dielectric resins |
| JPS5540860B2 (enExample) * | 1974-02-19 | 1980-10-21 | ||
| JPS5238226A (en) * | 1975-09-22 | 1977-03-24 | Fuji Xerox Co Ltd | Organic photoconductor |
| FR2375623A1 (fr) * | 1976-06-23 | 1978-07-21 | Commissariat Energie Atomique | Nouveaux films photosensibles utilisables en microgravure |
| GB1582860A (en) * | 1977-02-23 | 1981-01-14 | Ici Ltd | Device |
| JPS5643301A (en) * | 1979-09-18 | 1981-04-22 | Kureha Chem Ind Co Ltd | Chitinoid molding material |
| JPS57148750A (en) * | 1981-03-11 | 1982-09-14 | Konishiroku Photo Ind Co Ltd | Electrophotographic receptor |
| JPS5843459A (ja) * | 1981-09-08 | 1983-03-14 | Canon Inc | 電子写真感光体 |
| US4439507A (en) * | 1982-09-21 | 1984-03-27 | Xerox Corporation | Layered photoresponsive imaging device with photogenerating pigments dispersed in a polyhydroxy ether composition |
-
1983
- 1983-12-05 JP JP58228381A patent/JPS60120361A/ja active Granted
-
1984
- 1984-11-29 US US06/676,253 patent/US4592980A/en not_active Expired - Lifetime
- 1984-12-04 GB GB08430611A patent/GB2152225B/en not_active Expired
- 1984-12-05 DE DE19843444354 patent/DE3444354A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2152225A (en) | 1985-07-31 |
| JPH0452939B2 (enExample) | 1992-08-25 |
| GB2152225B (en) | 1987-04-23 |
| JPS60120361A (ja) | 1985-06-27 |
| DE3444354A1 (de) | 1985-06-13 |
| US4592980A (en) | 1986-06-03 |
| GB8430611D0 (en) | 1985-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3444354C2 (enExample) | ||
| DE69327496T2 (de) | Elektrophotographischen Gerät | |
| DE69927534T2 (de) | Elektrophotographisches lichtempfindliches Element, Verfahren zu dessen Herstellung, Verfahrenscassette und elektrophotographischer Apparat die dieses Element eingebaut haben | |
| DE69417119T2 (de) | Verfahren zur Herstellung von Bildaufzeichnungselementen | |
| DE3505322C2 (enExample) | ||
| DE1497070B2 (de) | Vorrichtung zum entwickeln elektrostatischer ladungsbilder | |
| DE1804475C3 (de) | Abbildungsverfahren unter Benutzung eines erweichbaren Materials | |
| DE69028191T2 (de) | Nahtloser Polymergurt und Verfahren zu dessen Herstellung | |
| EP0137217B1 (de) | Elektrophotographisches Aufzeichnungsmaterial und Verfahren zu seiner Herstellung | |
| DE3318282C2 (de) | Elektrophotographisches Aufzeichungsmaterial | |
| DE69315191T2 (de) | Bildherstellungsverfahren | |
| DE3236477C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3825523A1 (de) | Elektrofotografische vorrichtung und bilderzeugungsverfahren | |
| DE2165359C3 (de) | Elektrophotographisches Kopierverfahren | |
| DE2108984C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE19612681A1 (de) | Elektrophotographischer Photoleiter und Verfahren zu seiner Herstellung | |
| DE3222100C2 (enExample) | ||
| DE4130062A1 (de) | Photoleiter fuer die elektrophotographie | |
| DE2016016C3 (de) | Elektrophotographisches Kopiergerät mit einem einen isolierenden Schichtträger, eine leitende Schicht und eine photoleitfähige Schicht aufweisenden Aufzeichnungsmaterial, in Form eines Endlosbandes | |
| DE69216978T3 (de) | Anwendung eines photoleitfähigen Elements in einer elektrophotographischen Vorrichtung mit Kontaktaufladung | |
| DE2708930C2 (de) | Empfangsmaterial für latente elektrostatische Bilder | |
| DE2329905A1 (de) | Lichtempfindliches organ fuer die elektrophotographie | |
| DE4400691A1 (de) | Organisches lichtempfindliches Teil für die Elektrophotographie | |
| DE69730684T2 (de) | Bilderzeugungsgerät | |
| DE69610955T2 (de) | Multiaktive,elektrofotografische Elemente mit einem Träger mit auf einer Oberfläche hervortretenden Erhebungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |