DE3245795C2 - - Google Patents
Info
- Publication number
- DE3245795C2 DE3245795C2 DE3245795A DE3245795A DE3245795C2 DE 3245795 C2 DE3245795 C2 DE 3245795C2 DE 3245795 A DE3245795 A DE 3245795A DE 3245795 A DE3245795 A DE 3245795A DE 3245795 C2 DE3245795 C2 DE 3245795C2
- Authority
- DE
- Germany
- Prior art keywords
- triene
- copolymers
- radical
- isobutylene
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 229920001577 copolymer Polymers 0.000 claims description 97
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 41
- 238000006884 silylation reaction Methods 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 21
- 150000005671 trienes Chemical class 0.000 claims description 21
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 20
- NDRUXLROLQGDNL-UHFFFAOYSA-N 5-methylhepta-1,3,6-triene Chemical compound C=CC(C)C=CC=C NDRUXLROLQGDNL-UHFFFAOYSA-N 0.000 claims description 18
- ZTJHDEXGCKAXRZ-UHFFFAOYSA-N octa-1,3,7-triene Chemical compound C=CCCC=CC=C ZTJHDEXGCKAXRZ-UHFFFAOYSA-N 0.000 claims description 17
- UUEWCQRISZBELL-UHFFFAOYSA-N 3-trimethoxysilylpropane-1-thiol Chemical compound CO[Si](OC)(OC)CCCS UUEWCQRISZBELL-UHFFFAOYSA-N 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 16
- 150000003573 thiols Chemical class 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 15
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 claims description 14
- -1 amino, aminooxy Chemical group 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 12
- 238000007334 copolymerization reaction Methods 0.000 claims description 11
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 150000003377 silicon compounds Chemical class 0.000 claims description 7
- 150000002430 hydrocarbons Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000005309 thioalkoxy group Chemical group 0.000 claims description 5
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 239000011951 cationic catalyst Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 150000002923 oximes Chemical group 0.000 claims description 4
- 229910002621 H2PtCl6 Inorganic materials 0.000 claims description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 239000000945 filler Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 150000002978 peroxides Chemical class 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- NDRUXLROLQGDNL-VOTSOKGWSA-N (3e)-5-methylhepta-1,3,6-triene Chemical compound C=CC(C)\C=C\C=C NDRUXLROLQGDNL-VOTSOKGWSA-N 0.000 claims description 2
- DCQBZYNUSLHVJC-UHFFFAOYSA-N 3-triethoxysilylpropane-1-thiol Chemical compound CCO[Si](OCC)(OCC)CCCS DCQBZYNUSLHVJC-UHFFFAOYSA-N 0.000 claims description 2
- 229910004721 HSiCl3 Inorganic materials 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 150000003623 transition metal compounds Chemical class 0.000 claims description 2
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims 2
- 150000008282 halocarbons Chemical class 0.000 claims 2
- DKIUYAAMKFJPGB-UHFFFAOYSA-N 1-prop-2-enylcyclopenta-1,3-diene Chemical compound C=CCC1=CC=CC1 DKIUYAAMKFJPGB-UHFFFAOYSA-N 0.000 claims 1
- 239000004971 Cross linker Substances 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 150000001492 aromatic hydrocarbon derivatives Chemical class 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- 229920000642 polymer Polymers 0.000 description 40
- 238000006116 polymerization reaction Methods 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000003999 initiator Substances 0.000 description 14
- 229920002554 vinyl polymer Polymers 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 12
- 239000005052 trichlorosilane Substances 0.000 description 12
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- 229920002367 Polyisobutene Polymers 0.000 description 10
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 10
- 229960003750 ethyl chloride Drugs 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 229920006254 polymer film Polymers 0.000 description 5
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 4
- 238000006136 alcoholysis reaction Methods 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LIQZZAPDGRFJIP-UHFFFAOYSA-L [dodecanoyloxy-bis(2-methylpropyl)stannyl] dodecanoate Chemical compound CC(C)C[Sn+2]CC(C)C.CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O LIQZZAPDGRFJIP-UHFFFAOYSA-L 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 239000000806 elastomer Substances 0.000 description 3
- 229910001385 heavy metal Inorganic materials 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 150000004291 polyenes Chemical class 0.000 description 3
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 3
- 125000005372 silanol group Chemical group 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical group [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- QABCGOSYZHCPGN-UHFFFAOYSA-N chloro(dimethyl)silicon Chemical compound C[Si](C)Cl QABCGOSYZHCPGN-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 238000013329 compounding Methods 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000012975 dibutyltin dilaurate Substances 0.000 description 2
- KTQYJQFGNYHXMB-UHFFFAOYSA-N dichloro(methyl)silicon Chemical compound C[Si](Cl)Cl KTQYJQFGNYHXMB-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 238000010932 ethanolysis reaction Methods 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000005048 methyldichlorosilane Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- OLRJXMHANKMLTD-UHFFFAOYSA-N silyl Chemical compound [SiH3] OLRJXMHANKMLTD-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ZTJHDEXGCKAXRZ-FNORWQNLSA-N (3e)-octa-1,3,7-triene Chemical compound C=CCC\C=C\C=C ZTJHDEXGCKAXRZ-FNORWQNLSA-N 0.000 description 1
- SLQMKNPIYMOEGB-UHFFFAOYSA-N 2-methylhexa-1,5-diene Chemical compound CC(=C)CCC=C SLQMKNPIYMOEGB-UHFFFAOYSA-N 0.000 description 1
- CCJZHCZMNGUOCA-UHFFFAOYSA-L 4-cyclohexylbutanoate;lead(2+) Chemical compound [Pb+2].[O-]C(=O)CCCC1CCCCC1.[O-]C(=O)CCCC1CCCCC1 CCJZHCZMNGUOCA-UHFFFAOYSA-L 0.000 description 1
- DFVOXRAAHOJJBN-UHFFFAOYSA-N 6-methylhept-1-ene Chemical compound CC(C)CCCC=C DFVOXRAAHOJJBN-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VGOVDLBKGSWAHD-UHFFFAOYSA-N C=CC=CCCC=C.CC(C)=C Chemical compound C=CC=CCCC=C.CC(C)=C VGOVDLBKGSWAHD-UHFFFAOYSA-N 0.000 description 1
- 239000004970 Chain extender Substances 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical class [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- KEJQTHYHDVZLMT-UHFFFAOYSA-N bis(2-methylpropyl)tin Chemical compound CC(C)C[Sn]CC(C)C KEJQTHYHDVZLMT-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- 229920005549 butyl rubber Polymers 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000010538 cationic polymerization reaction Methods 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 229940073584 methylene chloride Drugs 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- DJFBJKSMACBYBD-UHFFFAOYSA-N phosphane;hydrate Chemical class O.P DJFBJKSMACBYBD-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000006100 radiation absorber Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000012966 redox initiator Substances 0.000 description 1
- 238000009419 refurbishment Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 239000003566 sealing material Substances 0.000 description 1
- 150000004819 silanols Chemical class 0.000 description 1
- 229910052990 silicon hydride Inorganic materials 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- DFQPZDGUFQJANM-UHFFFAOYSA-M tetrabutylphosphanium;hydroxide Chemical compound [OH-].CCCC[P+](CCCC)(CCCC)CCCC DFQPZDGUFQJANM-UHFFFAOYSA-M 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- CPUDPFPXCZDNGI-UHFFFAOYSA-N triethoxy(methyl)silane Chemical compound CCO[Si](C)(OCC)OCC CPUDPFPXCZDNGI-UHFFFAOYSA-N 0.000 description 1
- 229940124543 ultraviolet light absorber Drugs 0.000 description 1
- 239000006097 ultraviolet radiation absorber Substances 0.000 description 1
- 238000006886 vinylation reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F236/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F236/22—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having three or more carbon-to-carbon double bonds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F210/00—Copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F210/04—Monomers containing three or four carbon atoms
- C08F210/08—Butenes
- C08F210/10—Isobutene
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/42—Introducing metal atoms or metal-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT25517/81A IT1140327B (it) | 1981-12-11 | 1981-12-11 | Coposimeri dell'isobutilene con trieni reticolabili all'umidita' ambientale,processo per la loro preparazione e intermedi adatti allo scopo |
| IT23702/82A IT1152715B (it) | 1982-10-11 | 1982-10-11 | Copolimeri dell'isobutilene con polieni reticolabili all'umidita' ambientale e processo per la loro preparazione |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3245795A1 DE3245795A1 (de) | 1983-08-18 |
| DE3245795C2 true DE3245795C2 (enExample) | 1993-05-13 |
Family
ID=26328412
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823245795 Granted DE3245795A1 (de) | 1981-12-11 | 1982-12-10 | Isobutylen-trien-copolymere, vernetzbar unter umgebungsfeuchtigkeitsbedingungen, verfahren zu ihrer herstellung und fuer diesen zweck geeignetes zwischenprodukt |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4524187A (enExample) |
| BE (1) | BE895327A (enExample) |
| BR (1) | BR8207298A (enExample) |
| CA (1) | CA1193787A (enExample) |
| DE (1) | DE3245795A1 (enExample) |
| FR (1) | FR2530643B1 (enExample) |
| GB (1) | GB2110706B (enExample) |
| NL (1) | NL185843C (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2567895B1 (fr) * | 1984-07-20 | 1986-11-21 | Poudres & Explosifs Ste Nale | Polymere a insaturations ethyleniques comportant des groupements silylmetallocenes, procede de fabrication de ce polymere, et composition propulsive ayant comme liant ce polymere |
| FR2579982B1 (enExample) * | 1985-04-05 | 1987-05-15 | Poudres & Explosifs Ste Nale | |
| CA1274647C (en) * | 1986-06-25 | 1990-09-25 | CURING ISOBUTYLENE POLYMER | |
| IT1196987B (it) * | 1986-07-23 | 1988-11-25 | Enichem Sintesi | Copolimeri sililati dell'isobutilene reticolabili in condizioni ambientali e procedimento per la loro preparazione |
| US4690979A (en) * | 1986-11-05 | 1987-09-01 | Union Camp Corporation | Terminally functionalized poly(alloocimene) |
| US4690982A (en) * | 1986-11-05 | 1987-09-01 | Union Camp Corporation | Epoxidized poly(alloocimene) |
| US4690983A (en) * | 1986-11-05 | 1987-09-01 | Union Camp Corporation | Hydrogenated poly(alloocimene) |
| US4694047A (en) * | 1986-11-06 | 1987-09-15 | Union Camp Corporation | Halogenated poly(alloocimene) |
| US4690984A (en) * | 1986-11-25 | 1987-09-01 | Union Camp Corporation | Metal complexes of poly(alloocimene) |
| JP2512468B2 (ja) * | 1987-04-13 | 1996-07-03 | 鐘淵化学工業株式会社 | 硬化性樹脂組成物 |
| US4808664A (en) * | 1987-12-11 | 1989-02-28 | Dow Corning Corporation | Moisture curable polyisobutylenes |
| FR2630449B1 (fr) * | 1988-04-26 | 1992-03-20 | Bp Chimie Sa | Nouveau produit d'addition entre un thiol et un polybutene comportant une double liaison carbone-carbone et procede de preparation |
| FR2646855B1 (fr) * | 1989-05-12 | 1993-03-12 | Bp Chem Int Ltd | Procede de fabrication de nouveaux polymeres silicones, et produits intermediaires obtenus |
| CA2079854A1 (en) * | 1991-10-21 | 1993-04-22 | Loren D. Durfee | Platinum catalyzed process for preparation of alpha, omega-silylalkenes and organosiloxane copolymers |
| US5334688A (en) * | 1993-04-19 | 1994-08-02 | Hercules Incorporated | Fully substituted cyclopolysiloxanes and their use for making organosilicon polymers |
| JP3393906B2 (ja) * | 1993-12-14 | 2003-04-07 | 鐘淵化学工業株式会社 | 官能基を含有する重合体の製造方法 |
| EP0709403A1 (en) * | 1994-10-28 | 1996-05-01 | Kanegafuchi Kagaku Kogyo Kabushiki Kaisha | Curable composition for injection molding |
| US5840800A (en) | 1995-11-02 | 1998-11-24 | Dow Corning Corporation | Crosslinked emulsions of pre-formed silicon modified organic polymers |
| WO1997019962A1 (fr) * | 1995-11-27 | 1997-06-05 | Kaneka Corporation | Processus de production de polymeres comportant des groupes fonctionnels |
| WO1997047665A1 (en) * | 1996-06-13 | 1997-12-18 | University Of Waterloo | Hydrosilylation of polypropylene |
| US5665823A (en) * | 1996-08-30 | 1997-09-09 | Dow Corning Corporation | Polyisobutylene polymers having acrylic functionality |
| DE19821356B4 (de) * | 1998-05-13 | 2005-09-15 | Chemetall Gmbh | Verfahren zur Herstellung von silanmodifiziertem Butylkautschuk und Verwendung des Verfahrensproduktes |
| US6051657A (en) * | 1998-12-03 | 2000-04-18 | Dow Corning Asia, Ltd. | Silyl-functional living cationic polymers |
| US6177519B1 (en) | 1999-03-02 | 2001-01-23 | Exxon Chemical Patents, Inc. | Silane grafted copolymers of an isomonoolefin and a vinyl aromatic monomer |
| US6258878B1 (en) | 1999-03-29 | 2001-07-10 | Dow Corning Corporation | One-part moisture-curable hydrocarbon polymer composition |
| US6469115B1 (en) | 2000-05-16 | 2002-10-22 | Dow Corning Corporation | Virtually telechelic silyl-functional polyisobutylene |
| US6420485B1 (en) | 2000-08-14 | 2002-07-16 | Dow Corning Corporation | Siloxane-grafted hydrocarbon copolymers |
| US6268451B1 (en) | 2000-10-03 | 2001-07-31 | University Of Massachusetts Lowell | Silyl-functional pseudo-telechelic polyisobutylene terpolymers |
| CA2406775C (en) * | 2002-10-03 | 2011-11-29 | Bayer Inc. | Peroxide curable compounds based on butyl-like polymer without conjugated aliphatic dienes in its composition |
| CA2406432C (en) * | 2002-10-03 | 2011-11-29 | Bayer Inc. | Adhesive compounds of butyl-type rubber |
| KR101133803B1 (ko) * | 2004-05-20 | 2012-04-05 | 제너럴 일렉트릭 캄파니 | 황-함유 기체에 대해 낮은 투과성을 갖는 경화성 코팅물 |
| DE102004050085A1 (de) * | 2004-10-14 | 2006-04-27 | Basf Ag | Vernetzbare Polyisobuten-Zusammensetzungen |
| WO2010137655A1 (ja) | 2009-05-29 | 2010-12-02 | 新日本石油株式会社 | イソブチレン系重合体およびその製造方法 |
| CN116284528B (zh) * | 2023-02-20 | 2024-12-13 | 北京化工大学 | 一种异丁烯与别罗勒烯及其衍生物共聚物及其制备方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2833749A (en) * | 1953-04-23 | 1958-05-06 | Phillips Petroleum Co | Silicon containing addition products of partially hydrogenated rubbery polymers |
| US3408420A (en) * | 1964-04-30 | 1968-10-29 | Du Pont | Silane-modified olefinic copolymers |
| US3344067A (en) * | 1964-12-28 | 1967-09-26 | Standard Oil Co | Derivatives of copolymers of isobutene and conjugated dienes |
| US3503943A (en) * | 1965-10-21 | 1970-03-31 | Exxon Research Engineering Co | Silane modified ethylene-propylene terpolymer |
| DE1745017A1 (de) * | 1966-12-13 | 1971-07-29 | Japan Synthetic Rubber Co Ltd | Mischpolymerisat von Isobutylen und 5-Methylheptatrien-1,3,6 und Verfahren zu dessen Herstellung |
| US3720654A (en) * | 1971-05-21 | 1973-03-13 | Cities Service Co | Molecular sizing process for preparing low molecular isobutylene-conjugated polyene copolymers |
| US3978103A (en) * | 1971-08-17 | 1976-08-31 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Sulfur containing organosilicon compounds |
| IT1040387B (it) * | 1975-08-08 | 1979-12-20 | Snam Progetti | Procedimento per la preparazione di copolimeri contenenti insatu razioni dieniche coniugate e copolimeri cosi ottenuti |
| JPS5277194A (en) * | 1975-12-23 | 1977-06-29 | Shin Etsu Chem Co Ltd | Preparation of polybutadiene derivatives |
-
1982
- 1982-12-08 GB GB08234979A patent/GB2110706B/en not_active Expired
- 1982-12-09 US US06/448,263 patent/US4524187A/en not_active Expired - Fee Related
- 1982-12-10 BE BE0/209716A patent/BE895327A/fr not_active IP Right Cessation
- 1982-12-10 BR BR8207298A patent/BR8207298A/pt not_active IP Right Cessation
- 1982-12-10 NL NLAANVRAGE8204798,A patent/NL185843C/xx not_active IP Right Cessation
- 1982-12-10 DE DE19823245795 patent/DE3245795A1/de active Granted
- 1982-12-10 CA CA000417503A patent/CA1193787A/en not_active Expired
- 1982-12-10 FR FR8220797A patent/FR2530643B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2530643A1 (fr) | 1984-01-27 |
| DE3245795A1 (de) | 1983-08-18 |
| BR8207298A (pt) | 1983-10-18 |
| GB2110706A (en) | 1983-06-22 |
| CA1193787A (en) | 1985-09-17 |
| NL185843C (nl) | 1990-08-01 |
| NL8204798A (nl) | 1983-07-01 |
| FR2530643B1 (fr) | 1987-01-30 |
| NL185843B (nl) | 1990-03-01 |
| BE895327A (fr) | 1983-06-10 |
| GB2110706B (en) | 1985-08-07 |
| US4524187A (en) | 1985-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3245795C2 (enExample) | ||
| DE69133119T2 (de) | Polymerisation für olefinische monomere unter verwendung von anionischen initiatoren | |
| DE60007849T2 (de) | Silangepfropfte copolymere aus isomonoolefinen und vinylaromatischen monomeren | |
| DE69421049T2 (de) | Verfahren zur Herstellung von Polymeren mit funktionellen Gruppen | |
| DE68904637T2 (de) | Silikon-dichtungsmaterialien mit verminderter farbe. | |
| DE60031783T2 (de) | Methode zur kontrolle der viskosität während des alterns siloxanmodifizierter polymere | |
| DE3851079T2 (de) | Vernetzbare Kunststoff-Zusammensetzung. | |
| DE69004712T2 (de) | Verfahren zur Herstellung von Polybutadien mit verbesserter Verarbeitkeit. | |
| EP0042481B1 (de) | Homo- und Copolymere von 1,3-Dienen mit reaktiven Silylgruppen, Verfahren zu ihrer Herstellung sowie deren Verwendung | |
| EP1288235A2 (de) | Mittel für die Verbesserung der Scorch-Bedingungen bei der Herstellung gepfropfter und/oder vernetzter Polymere sowie gefüllter Kunststoffe | |
| DE1420647A1 (de) | Verfahren und Katalysator zum Polymerisieren von Dienen mit konjugierten Doppelbindungen | |
| DE69401386T2 (de) | Verfahren zur Herstellung eines Isopren-Butadien Kautschuks | |
| DE1795738C3 (de) | Polypentenamere, deren Doppelbindungen im wesentlichen cis-Konfiguration aufweisen | |
| DE69112144T2 (de) | Hydroxylierung von Kautschuk in fester Phase. | |
| WO2009047070A2 (de) | Silan-substituierte raft-reagenzien und silan-vernetzbare polymere | |
| DE2142596C3 (de) | Verfahren zum Silylieren von Styrolpolymeren | |
| DE69112420T2 (de) | Makromolekulare monomere aus lebenden polymeren. | |
| DE69821948T2 (de) | Härtbare zusammensetzung | |
| DE3932231C2 (de) | Organopolysiloxan-Verbindung | |
| DE69031138T2 (de) | Dithiokarbamatgruppen enthaltende Polysiloxane | |
| EP0033774A2 (de) | Reaktive Silylgruppen tragende Homo- oder Copolymere von 1,3-Dienen, Verfahren zu ihrer Herstellung sowie deren Verwendung | |
| DE1745112B2 (de) | Verfahren zur herstellung von organosilicium-modifizierten polymerisaten | |
| AT410092B (de) | Copolymer-zusammensetzung und daraus hergestelltes vernetztes produkt | |
| DE3751683T2 (de) | Katalysatoren für die Herstellung elastomerer Olefincopolymere und damit hergestellte Copolymere | |
| DE2310018C3 (de) | Verfahren zur Herstellung von Quadripolymerisaten und ihre Verwendung zur Herstellung von Vulkanisaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR |
|
| D2 | Grant after examination | ||
| 8380 | Miscellaneous part iii |
Free format text: SEITE 14, ZEILE 10,"0 BIS 100(GRAD)C" AENDERN IN "0 BIS -100(GRAD)C" SEITE 15, ZEILE 17, "AUCH" AENDERN IN "DURCH" |
|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |