DE3042291C2 - Hochdruck-Metallhalogenid-Entladungslampe - Google Patents
Hochdruck-Metallhalogenid-EntladungslampeInfo
- Publication number
- DE3042291C2 DE3042291C2 DE3042291A DE3042291A DE3042291C2 DE 3042291 C2 DE3042291 C2 DE 3042291C2 DE 3042291 A DE3042291 A DE 3042291A DE 3042291 A DE3042291 A DE 3042291A DE 3042291 C2 DE3042291 C2 DE 3042291C2
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- getter
- thorium
- amount
- iodine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910001507 metal halide Inorganic materials 0.000 title claims description 14
- 150000005309 metal halides Chemical class 0.000 title claims description 14
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 33
- 229910052776 Thorium Inorganic materials 0.000 claims description 32
- 239000011630 iodine Substances 0.000 claims description 32
- 229910052740 iodine Inorganic materials 0.000 claims description 31
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 claims description 29
- 229910052751 metal Inorganic materials 0.000 claims description 24
- 239000002184 metal Substances 0.000 claims description 24
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 22
- 229910052753 mercury Inorganic materials 0.000 claims description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 17
- 238000011049 filling Methods 0.000 claims description 17
- 150000002739 metals Chemical class 0.000 claims description 14
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical group [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 229910052793 cadmium Inorganic materials 0.000 claims description 10
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 5
- 229910052738 indium Inorganic materials 0.000 claims description 4
- 229910052716 thallium Inorganic materials 0.000 claims description 4
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 229910052745 lead Inorganic materials 0.000 claims description 3
- 229910052748 manganese Inorganic materials 0.000 claims description 3
- 229910052709 silver Inorganic materials 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000012535 impurity Substances 0.000 claims description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
- 229910052706 scandium Inorganic materials 0.000 description 12
- 238000000034 method Methods 0.000 description 11
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 11
- 229910052721 tungsten Inorganic materials 0.000 description 11
- 239000010937 tungsten Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 8
- 230000008569 process Effects 0.000 description 6
- 239000011701 zinc Substances 0.000 description 6
- 230000008859 change Effects 0.000 description 5
- 239000011888 foil Substances 0.000 description 5
- -1 iodide compound Chemical class 0.000 description 5
- 150000004694 iodide salts Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- 238000007792 addition Methods 0.000 description 4
- 230000003139 buffering effect Effects 0.000 description 4
- 229910052750 molybdenum Inorganic materials 0.000 description 4
- 239000011733 molybdenum Substances 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 3
- 230000004907 flux Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 3
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 3
- 210000003739 neck Anatomy 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- MDMUQRJQFHEVFG-UHFFFAOYSA-J thorium(iv) iodide Chemical compound [I-].[I-].[I-].[I-].[Th+4] MDMUQRJQFHEVFG-UHFFFAOYSA-J 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 2
- 229910003452 thorium oxide Inorganic materials 0.000 description 2
- WLTSUBTXQJEURO-UHFFFAOYSA-N thorium tungsten Chemical compound [W].[Th] WLTSUBTXQJEURO-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- WXDJHDMIIZKXSK-UHFFFAOYSA-N iodine dioxide Inorganic materials O=I=O WXDJHDMIIZKXSK-UHFFFAOYSA-N 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical class [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- HUIHCQPFSRNMNM-UHFFFAOYSA-K scandium(3+);triiodide Chemical compound [Sc+3].[I-].[I-].[I-] HUIHCQPFSRNMNM-UHFFFAOYSA-K 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- WNUPENMBHHEARK-UHFFFAOYSA-N silicon tungsten Chemical compound [Si].[W] WNUPENMBHHEARK-UHFFFAOYSA-N 0.000 description 1
- JHGCXUUFRJCMON-UHFFFAOYSA-J silicon(4+);tetraiodide Chemical compound [Si+4].[I-].[I-].[I-].[I-] JHGCXUUFRJCMON-UHFFFAOYSA-J 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/24—Means for obtaining or maintaining the desired pressure within the vessel
- H01J61/26—Means for absorbing or adsorbing gas, e.g. by gettering; Means for preventing blackening of the envelope
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/093,899 US4360756A (en) | 1979-11-13 | 1979-11-13 | Metal halide lamp containing ThI4 with added elemental cadmium or zinc |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3042291A1 DE3042291A1 (de) | 1981-05-21 |
| DE3042291C2 true DE3042291C2 (de) | 1983-05-11 |
Family
ID=22241627
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3042291A Expired DE3042291C2 (de) | 1979-11-13 | 1980-11-08 | Hochdruck-Metallhalogenid-Entladungslampe |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4360756A (Direct) |
| JP (1) | JPS5682559A (Direct) |
| AU (1) | AU524153B2 (Direct) |
| BE (1) | BE886111A (Direct) |
| BR (1) | BR8007474A (Direct) |
| CA (1) | CA1162971A (Direct) |
| DE (1) | DE3042291C2 (Direct) |
| FR (1) | FR2469798A1 (Direct) |
| GB (1) | GB2062956B (Direct) |
| IT (1) | IT1134240B (Direct) |
| MX (1) | MX148333A (Direct) |
| NL (1) | NL189788C (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102009039147A1 (de) * | 2009-08-27 | 2011-03-03 | Osram Gesellschaft mit beschränkter Haftung | Gasentladungslampe und Verfahren zum Binden von löslichen Quecksilberverbindungen beim Zerstören von Gasentladungslampen |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4387319A (en) * | 1981-03-30 | 1983-06-07 | General Electric Company | Metal halide lamp containing ScI3 with added cadmium or zinc |
| US4728857A (en) * | 1981-06-29 | 1988-03-01 | Gte Products Corporation | Vertical running, high brightness, low wattage metal halide arc lamp |
| US5001391A (en) * | 1986-07-30 | 1991-03-19 | Gte Products Corporation | Glow discharge starter |
| US4798995A (en) * | 1986-10-06 | 1989-01-17 | General Electric Company | Metal halide lamp containing halide composition to control arc tube performance |
| US4754373A (en) * | 1986-10-14 | 1988-06-28 | General Electric Company | Automotive headlamp |
| US5136214A (en) * | 1990-07-16 | 1992-08-04 | General Electric Company | Use of silicon to extend useful life of metal halide discharge lamps |
| US5212424A (en) * | 1991-11-21 | 1993-05-18 | General Electric Company | Metal halide discharge lamp containing a sodium getter |
| DE4325679A1 (de) * | 1993-07-30 | 1995-02-02 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Elektrische Lampe mit Halogenfüllung |
| CA2130424A1 (en) * | 1993-09-23 | 1995-03-24 | Hsueh-Rong Chang | Use of silver to control iodine level in electrodeless high intensity discharge lamps |
| DE19610387A1 (de) * | 1996-03-16 | 1997-09-18 | Bosch Gmbh Robert | Gasentladungslampe, insbesondere für Kraftfahrzeug-Scheinwerfer |
| DE19714008A1 (de) * | 1997-04-04 | 1998-10-08 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Gleichstrombogenlampe |
| DE19714009A1 (de) * | 1997-04-04 | 1998-10-08 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Gleichstrombogenlampe |
| CN1174464C (zh) * | 1999-11-11 | 2004-11-03 | 皇家菲利浦电子有限公司 | 高压气体放电灯 |
| CN1235260C (zh) * | 2001-03-30 | 2006-01-04 | 松下电器产业株式会社 | 汽车前灯用金属卤化物灯 |
| JP2006523922A (ja) * | 2003-04-16 | 2006-10-19 | コーニンクレッカ フィリップス エレクトロニクス エヌ ヴィ | 高圧メタルハライド放電ランプ |
| US7265493B2 (en) * | 2004-10-04 | 2007-09-04 | General Electric Company | Mercury-free compositions and radiation sources incorporating same |
| GB2420220B (en) * | 2004-11-10 | 2009-10-14 | Gen Electric | Ceramic metal halide lamps |
| US7847484B2 (en) * | 2004-12-20 | 2010-12-07 | General Electric Company | Mercury-free and sodium-free compositions and radiation source incorporating same |
| JP2009121877A (ja) * | 2007-11-13 | 2009-06-04 | Tohoku Denki Hoan Kyokai | 絶縁抵抗測定器 |
| US7777418B2 (en) * | 2008-04-08 | 2010-08-17 | General Electric Company | Ceramic metal halide lamp incorporating a metallic halide getter |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3234421A (en) * | 1961-01-23 | 1966-02-08 | Gen Electric | Metallic halide electric discharge lamps |
| US3845342A (en) * | 1962-10-16 | 1974-10-29 | Sylvania Electric Prod | Electric discharge device containing thorium, mercury and iodine |
| GB1051170A (Direct) * | 1963-05-02 | |||
| US3398312A (en) * | 1965-11-24 | 1968-08-20 | Westinghouse Electric Corp | High pressure vapor discharge lamp having a fill including sodium iodide and a free metal |
| US3521110A (en) * | 1967-09-25 | 1970-07-21 | Gen Electric | Mercury-metallic halide vapor lamp with regenerative cycle |
| US3407327A (en) * | 1967-12-21 | 1968-10-22 | Sylvania Electric Prod | High pressure electric discharge device containing mercury, halogen, scandium and alkalimetal |
| GB1283152A (en) * | 1969-05-19 | 1972-07-26 | Gen Electric | Metal halide discharge lamp |
| FR2102866A5 (Direct) * | 1970-08-27 | 1972-04-07 | Eclairage Lab | |
| US3700960A (en) * | 1971-09-23 | 1972-10-24 | Gen Electric | Metal halide lamp system |
| US3781586A (en) * | 1972-12-04 | 1973-12-25 | Gen Electric | Long lifetime mercury-metal halide discharge lamps |
| US3886391A (en) * | 1973-11-21 | 1975-05-27 | Gte Sylvania Inc | Hafnium activated metal halide arc discharge lamp |
| JPS5086875A (Direct) * | 1973-12-07 | 1975-07-12 | ||
| HU169861B (Direct) * | 1974-12-30 | 1977-02-28 | ||
| JPS5241481A (en) * | 1975-09-26 | 1977-03-31 | Toshiba Corp | Metal vapor discharge lamp |
| DE2655167C2 (de) * | 1976-12-06 | 1986-12-18 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Hochdruckentladungslampe mit Metallhalogeniden |
| DE2826733C2 (de) * | 1977-07-05 | 1982-07-29 | General Electric Co., Schenectady, N.Y. | Hochdruck-Metalldampf-Entladungslampe |
-
1979
- 1979-11-13 US US06/093,899 patent/US4360756A/en not_active Expired - Lifetime
-
1980
- 1980-10-30 AU AU63847/80A patent/AU524153B2/en not_active Ceased
- 1980-10-30 GB GB8034947A patent/GB2062956B/en not_active Expired
- 1980-11-08 DE DE3042291A patent/DE3042291C2/de not_active Expired
- 1980-11-12 NL NLAANVRAGE8006179,A patent/NL189788C/xx not_active IP Right Cessation
- 1980-11-12 IT IT25930/80A patent/IT1134240B/it active
- 1980-11-12 BE BE0/202761A patent/BE886111A/fr not_active IP Right Cessation
- 1980-11-12 JP JP15833180A patent/JPS5682559A/ja active Granted
- 1980-11-13 CA CA000364558A patent/CA1162971A/en not_active Expired
- 1980-11-13 FR FR8024099A patent/FR2469798A1/fr active Granted
- 1980-11-13 MX MX184754A patent/MX148333A/es unknown
- 1980-11-13 BR BR8007474A patent/BR8007474A/pt not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102009039147A1 (de) * | 2009-08-27 | 2011-03-03 | Osram Gesellschaft mit beschränkter Haftung | Gasentladungslampe und Verfahren zum Binden von löslichen Quecksilberverbindungen beim Zerstören von Gasentladungslampen |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6343867B2 (Direct) | 1988-09-01 |
| FR2469798B1 (Direct) | 1983-12-23 |
| DE3042291A1 (de) | 1981-05-21 |
| AU524153B2 (en) | 1982-09-02 |
| NL189788C (nl) | 1993-07-16 |
| NL8006179A (nl) | 1981-06-01 |
| CA1162971A (en) | 1984-02-28 |
| MX148333A (es) | 1983-04-11 |
| BR8007474A (pt) | 1981-06-02 |
| FR2469798A1 (fr) | 1981-05-22 |
| NL189788B (nl) | 1993-02-16 |
| IT8025930A0 (it) | 1980-11-12 |
| BE886111A (fr) | 1981-03-02 |
| GB2062956A (en) | 1981-05-28 |
| GB2062956B (en) | 1983-10-12 |
| IT1134240B (it) | 1986-08-13 |
| US4360756A (en) | 1982-11-23 |
| AU6384780A (en) | 1981-05-21 |
| JPS5682559A (en) | 1981-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3042291C2 (de) | Hochdruck-Metallhalogenid-Entladungslampe | |
| DE69817493T2 (de) | Hochdruck metallhalogenidlampe | |
| DE1464181B2 (de) | Elektrische hochdruck dampfentladungslampe | |
| EP0637056B1 (de) | Hochdruckentladungslampe | |
| DE2161173A1 (de) | Entladungslampe mit thermionischer Kathode mit Emissionsmaterial | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2303066A1 (de) | Metallhalogenid-bogenentladungslampe | |
| DE3210809C2 (de) | Miniatur-Hochdruckentladungslampe | |
| DE69915966T2 (de) | Niederdruck-Quecksilberdampfentladungslampe | |
| DE2550661A1 (de) | Metallhalogenidlampe | |
| DE69608089T2 (de) | Metallhalogenidlampe | |
| DE3733217C2 (Direct) | ||
| DE2456757C2 (de) | Metallhalogenid-Hochdruckgasentladungslampe | |
| DE2149033B2 (de) | Bogenentladungslampe hoher Intensität | |
| DE1807439B2 (de) | Gluehlampe mit verbesserter lichtausbeute | |
| DE3404661A1 (de) | Hochdruck-metalldampflampe mit verbesserter farbwiedergabe | |
| DE2120471B2 (de) | Hochdruckentladungslampe mit Alkalihalogenid-Zusätzen und Getter | |
| DE2846816A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| WO2009115116A1 (de) | Gasentladungslampe und verfahren zum herstellen einer gasentladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE2736311C2 (de) | Quecksilberdampf-Hochdruckentladungslampe | |
| DE2023770B2 (de) | Hochleistungsbogenlampe | |
| DE1464181C (de) | Elektrische Hochdruck Dampfentladungs lampe | |
| DE2851347B2 (de) | Hochdrucknatriumdampfentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8125 | Change of the main classification |
Ipc: H01J 61/26 |
|
| 8126 | Change of the secondary classification |
Free format text: H01J 61/20 H01J 61/073 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: SIEB, R., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 6947 LAUDENBACH |
|
| 8339 | Ceased/non-payment of the annual fee |