DE3028792A1 - Verfahren zur herstellung von (beta)-aminopropionamiden. - Google Patents
Verfahren zur herstellung von (beta)-aminopropionamiden.Info
- Publication number
- DE3028792A1 DE3028792A1 DE19803028792 DE3028792A DE3028792A1 DE 3028792 A1 DE3028792 A1 DE 3028792A1 DE 19803028792 DE19803028792 DE 19803028792 DE 3028792 A DE3028792 A DE 3028792A DE 3028792 A1 DE3028792 A1 DE 3028792A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- aminopropionamides
- methyl
- acrylic
- reacted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004519 manufacturing process Methods 0.000 title description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 11
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 8
- 239000001569 carbon dioxide Substances 0.000 claims description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- -1 methacrylic compound Chemical class 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- HQMLIDZJXVVKCW-UHFFFAOYSA-N 2-aminopropanamide Chemical compound CC(N)C(N)=O HQMLIDZJXVVKCW-UHFFFAOYSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- RSDOASZYYCOXIB-UHFFFAOYSA-N beta-alaninamide Chemical compound NCCC(N)=O RSDOASZYYCOXIB-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- JHPBZFOKBAGZBL-UHFFFAOYSA-N (3-hydroxy-2,2,4-trimethylpentyl) 2-methylprop-2-enoate Chemical compound CC(C)C(O)C(C)(C)COC(=O)C(C)=C JHPBZFOKBAGZBL-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000005395 methacrylic acid group Chemical group 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- GDFCSMCGLZFNFY-UHFFFAOYSA-N Dimethylaminopropyl Methacrylamide Chemical compound CN(C)CCCNC(=O)C(C)=C GDFCSMCGLZFNFY-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000004791 alkyl magnesium halides Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- QOHMWDJIBGVPIF-UHFFFAOYSA-N n',n'-diethylpropane-1,3-diamine Chemical compound CCN(CC)CCCN QOHMWDJIBGVPIF-UHFFFAOYSA-N 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/02—Preparation of carboxylic acid amides from carboxylic acids or from esters, anhydrides, or halides thereof by reaction with ammonia or amines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/071,530 US4256665A (en) | 1979-08-31 | 1979-08-31 | Preparation of β-aminopropionamides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3028792A1 true DE3028792A1 (de) | 1981-03-12 |
| DE3028792C2 DE3028792C2 (cg-RX-API-DMAC10.html) | 1989-04-27 |
Family
ID=22101921
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803028792 Granted DE3028792A1 (de) | 1979-08-31 | 1980-07-30 | Verfahren zur herstellung von (beta)-aminopropionamiden. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4256665A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5835984B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE884929A (cg-RX-API-DMAC10.html) |
| DE (1) | DE3028792A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2464248B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2057434B (cg-RX-API-DMAC10.html) |
| NL (1) | NL186512C (cg-RX-API-DMAC10.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4379928A (en) * | 1981-03-04 | 1983-04-12 | Union Carbide Corporation | Synthesis of amides |
| US4384950A (en) * | 1981-12-02 | 1983-05-24 | Texaco Inc. | Demulsification of bitumen emulsions using branched water soluble quaternary ammonium-containing polymers |
| US4755623A (en) * | 1983-09-06 | 1988-07-05 | American Cyanamid Company | Polyfunctional amine crosslinker, process for making same, and compositions containing same |
| US4675441A (en) * | 1983-09-23 | 1987-06-23 | Texaco Inc. | Preparation of N-substituted acrylamides |
| JPS63223692A (ja) * | 1987-03-12 | 1988-09-19 | 松下電器産業株式会社 | エンベロ−プ発生装置 |
| DE69710935T2 (de) * | 1996-04-04 | 2002-10-02 | Crompton Corp., Greenwich | Verfahren zur Synthese von Polyurethanen mit reaktiven Aminkatalysatoren |
| US6077877A (en) * | 1996-04-04 | 2000-06-20 | Ck Witco Corporation | Reactive amine catalysts for use in polyurethane polymers |
| CN101177403B (zh) * | 2007-04-12 | 2011-01-26 | 本溪万哈特化工有限公司 | 催化裂解制备n-二甲氨基丙基甲基丙烯酰胺方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2502247A1 (de) * | 1974-01-25 | 1975-07-31 | Jefferson Chem Co Inc | Verfahren zur herstellung von n-(tert. aminoalkyl)acrylamiden |
| US4022831A (en) * | 1974-06-28 | 1977-05-10 | The Goodyear Tire & Rubber Company | Preparation of methacrylamides |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2451436A (en) * | 1947-01-03 | 1948-10-12 | American Cyanamid Co | Method of preparing n-alkyl acrylamides |
| US2719175A (en) * | 1952-11-01 | 1955-09-27 | Eastman Kodak Co | Vapor phase preparation of n-substituted acrylamides |
| US2921085A (en) * | 1952-11-01 | 1960-01-12 | Lever Brothers Ltd | Preparation of beta-aminopropionamides |
| US2719178A (en) * | 1953-01-07 | 1955-09-27 | Eastman Kodak Co | Vapor phase method of producing n-substituted acrylamides |
| US3145195A (en) * | 1960-05-25 | 1964-08-18 | Borden Co | Polyamide resins and process |
| US3607940A (en) * | 1967-08-28 | 1971-09-21 | Armour Indstrial Chemical Co | Beta-aliphaticaminopropionamides |
| US3652671A (en) * | 1970-06-01 | 1972-03-28 | Dow Chemical Co | Process for making a cationic methacrylamide |
| US3763234A (en) * | 1970-12-03 | 1973-10-02 | Halcon International Inc | Preparation of amides |
| GB1379268A (en) * | 1972-06-30 | 1975-01-02 | Tokyo Fine Chemical Co Ltd | Process for production of beta-alanine |
| GB1398412A (en) * | 1972-07-28 | 1975-06-18 | Ciba Geigy Ag | Piperidine derivatives |
-
1979
- 1979-08-31 US US06/071,530 patent/US4256665A/en not_active Expired - Lifetime
-
1980
- 1980-07-30 DE DE19803028792 patent/DE3028792A1/de active Granted
- 1980-08-01 GB GB8025232A patent/GB2057434B/en not_active Expired
- 1980-08-12 JP JP55109900A patent/JPS5835984B2/ja not_active Expired
- 1980-08-22 NL NLAANVRAGE8004753,A patent/NL186512C/xx not_active IP Right Cessation
- 1980-08-26 BE BE0/201871A patent/BE884929A/fr not_active IP Right Cessation
- 1980-08-28 FR FR8018680A patent/FR2464248B1/fr not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2502247A1 (de) * | 1974-01-25 | 1975-07-31 | Jefferson Chem Co Inc | Verfahren zur herstellung von n-(tert. aminoalkyl)acrylamiden |
| US4022831A (en) * | 1974-06-28 | 1977-05-10 | The Goodyear Tire & Rubber Company | Preparation of methacrylamides |
Non-Patent Citations (1)
| Title |
|---|
| J.Am.Chem.Soc. Bd.74, 6281-2 (1952) * |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3028792C2 (cg-RX-API-DMAC10.html) | 1989-04-27 |
| FR2464248B1 (fr) | 1985-07-12 |
| NL186512B (nl) | 1990-07-16 |
| NL186512C (nl) | 1990-12-17 |
| JPS5636439A (en) | 1981-04-09 |
| JPS5835984B2 (ja) | 1983-08-05 |
| FR2464248A1 (fr) | 1981-03-06 |
| US4256665A (en) | 1981-03-17 |
| BE884929A (fr) | 1980-12-16 |
| GB2057434A (en) | 1981-04-01 |
| NL8004753A (nl) | 1981-03-03 |
| GB2057434B (en) | 1983-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD207198A5 (de) | Verfahren zur herstellung von n-(tert.aminoalkyl)acrylamiden | |
| DE3039571C2 (cg-RX-API-DMAC10.html) | ||
| DE3028792A1 (de) | Verfahren zur herstellung von (beta)-aminopropionamiden. | |
| EP1786776A1 (de) | Verfahren zur herstellung quartärer ammoniumverbindungen hoher reinheit | |
| DE3039572C2 (cg-RX-API-DMAC10.html) | ||
| CH343388A (de) | Verfahren zur Herstellung neuer Amide | |
| WO1999065861A1 (de) | Verfahren zur symmetrischen und unsymmetrischen disubstitution von carbonsäureamiden mit organotitanaten und grignard-reagenzien | |
| DE69308817T2 (de) | Verfahren zur herstellung von n-monosubstituiertem methacrylamid | |
| EP0164706B1 (de) | Phenylalkylamine - Bioregulatoren | |
| DE2630562C2 (de) | Verfahren zur katalytischen Hydrierung von Perfluoralkyl-substituierten Anilinen | |
| DE3402599C2 (de) | Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten Carbonsäureamiden | |
| DE2655794C2 (de) | Verfahren zur Herstellung von Äthylencyanhydrin | |
| EP1087927A1 (de) | Verfahren zur katalytischen, unsymmetrischen disubstitution von carbonsäureamiden mit zwei unterschiedlichen grignard-reagenzien | |
| DE2005515B2 (de) | Verfahren zur Herstellung von γ -Cyanburyraldiminen | |
| EP1087930A1 (de) | Verfahren zur katalytischen disubstitution von carbonsäureamiden mit wenigstens einem grignard-reagenz | |
| EP0696576B1 (de) | Verfahren zur Herstellung von 2-Amino-2-arylethanolen und neue Zwischenprodukte | |
| DE69838717T2 (de) | Verfahren zur herstellung von imidazolonen | |
| DE1124496B (de) | Verfahren zur Herstellung von tertiaeren Aminen, ihren Saeureadditionssalzen und quaternaeren Ammoniumverbindungen | |
| DE1242216B (de) | Verfahren zur Herstellung von Inaminsalzen | |
| WO1999065862A1 (de) | Verfahren zur katalytischen, symmetrischen disubstitution von carbonsäureamiden mit grignard-reagenzien | |
| EP0606058A2 (de) | Halogenierte Zimtsäuren und deren Ester, sowie Verfahren zu ihrer Herstellung und halogenierte Aryldiazoniumsalze | |
| DE2747999A1 (de) | Verfahren zur herstellung von dimethylformamid | |
| DE2854595A1 (de) | Aminophenylaetherverbindungen, verfahren zu ihrer herstellung sowie ihre verwendung | |
| AT222104B (de) | Verfahren zur Herstellung von neuen Cyclobutanderivaten | |
| AT224636B (de) | Verfahren zur Herstellung von neuen Indolderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HUNTSMAN CORP., SALT LAKE CITY, UTAH, US |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: PATENT- UND RECHTSANWAELTE BOEHMERT & BOEHMERT, NORDEMANN UND PARTNER, 28209 BREMEN |
|
| 8339 | Ceased/non-payment of the annual fee |