DE3027535C2 - - Google Patents
Info
- Publication number
- DE3027535C2 DE3027535C2 DE3027535A DE3027535A DE3027535C2 DE 3027535 C2 DE3027535 C2 DE 3027535C2 DE 3027535 A DE3027535 A DE 3027535A DE 3027535 A DE3027535 A DE 3027535A DE 3027535 C2 DE3027535 C2 DE 3027535C2
- Authority
- DE
- Germany
- Prior art keywords
- discharge
- groove
- lamp
- outer bulb
- grooves
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 239000011521 glass Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- MYZAXBZLEILEBR-RVFOSREFSA-N (2S)-1-[(2S,3R)-2-[[(2R)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-sulfopropanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carboxylic acid Chemical compound C[C@@H](O)[C@H](NC(=O)[C@H](CS(O)(=O)=O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)C(=O)N1CCC[C@H]1C(O)=O MYZAXBZLEILEBR-RVFOSREFSA-N 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910052771 Terbium Inorganic materials 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- SIWVEOZUMHYXCS-UHFFFAOYSA-N oxo(oxoyttriooxy)yttrium Chemical compound O=[Y]O[Y]=O SIWVEOZUMHYXCS-UHFFFAOYSA-N 0.000 description 1
- 108700002400 risuteganib Proteins 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/34—Double-wall vessels or containers
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7906202A NL7906202A (nl) | 1979-08-15 | 1979-08-15 | Lagedrukontladingslamp. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3027535A1 DE3027535A1 (de) | 1981-03-26 |
| DE3027535C2 true DE3027535C2 (enExample) | 1989-10-12 |
Family
ID=19833687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803027535 Granted DE3027535A1 (de) | 1979-08-15 | 1980-07-21 | Niederdruckentladungslampe |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4445069A (enExample) |
| JP (2) | JPS5630245A (enExample) |
| BE (1) | BE884766A (enExample) |
| DE (1) | DE3027535A1 (enExample) |
| FR (1) | FR2463506A1 (enExample) |
| GB (1) | GB2057185B (enExample) |
| NL (1) | NL7906202A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4027783A1 (de) * | 1990-09-03 | 1992-04-30 | Holzer Walter | Gasentladungsgeraet fuer kompaktlampen |
| DE102012103272B3 (de) * | 2012-04-16 | 2013-05-23 | Walter Wallner | Lampensockel für Gasentladungslampe |
| DE102012103268A1 (de) * | 2012-04-16 | 2013-10-17 | Walter Wallner | Gasentladungslampe |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL8103507A (nl) * | 1981-07-24 | 1983-02-16 | Philips Nv | Elektrische inrichting voor het ontsteken en voeden van een lagedrukontladingslamp. |
| US4587462A (en) * | 1984-08-10 | 1986-05-06 | Gte Laboratories Incorporated | Fluorescent light source with parallel DC discharges |
| US4879489A (en) * | 1986-02-10 | 1989-11-07 | Photo Redux Corp. | Radiation-emitting devices |
| US4835444A (en) * | 1986-02-10 | 1989-05-30 | Photo Redux Corp. | Radiation-emitting devices |
| US4853581A (en) * | 1986-02-10 | 1989-08-01 | Photo Redux Corp. | Radiation-emitting devices |
| DE3912514A1 (de) * | 1989-04-17 | 1990-10-18 | Imris Pavel | Leuchtstofflampe |
| GB9700426D0 (en) * | 1997-01-10 | 1997-02-26 | Light Years Ahead Ltd | Light sources |
| DE19948097A1 (de) * | 1999-10-06 | 2001-04-26 | Siemens Ag | Leuchtstofflampe |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE853615C (de) * | 1948-10-02 | 1952-10-27 | Ulrich W Doering | Der Lichtaussendung dienende elektrische Entladungsroehre |
| DE889951C (de) * | 1948-10-02 | 1953-09-14 | Ulrich W Doering | Vorzugsweise mit Leuchtstoffen und mit grossflaechigen kalten Elektroden versehene Gas- und Dampfentladungslampe |
| US2612618A (en) * | 1950-07-11 | 1952-09-30 | George A Bonadio | Electronic discharge tube control |
| DE1246119B (de) * | 1961-12-15 | 1967-08-03 | Alfred Walz Dr Ing | Gasentladungslampe |
| JPS52113584A (en) * | 1976-03-19 | 1977-09-22 | Matsushita Electronics Corp | Lamp and its production method |
| NL7700159A (nl) * | 1977-01-10 | 1978-07-12 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| JPS53142064A (en) * | 1977-05-17 | 1978-12-11 | Matsushita Electronics Corp | Bulb |
| NL7709266A (nl) * | 1977-08-23 | 1979-02-27 | Koninkl Philips Electronics Nv | Lagedrukkwikdampontladingslamp. |
| NL7801635A (nl) * | 1978-02-14 | 1979-08-16 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| NL7812539A (nl) * | 1978-02-14 | 1979-08-16 | Philips Nv | Lagedrukkwikdampontladingslamp. |
-
1979
- 1979-08-15 NL NL7906202A patent/NL7906202A/nl not_active Application Discontinuation
-
1980
- 1980-07-21 DE DE19803027535 patent/DE3027535A1/de active Granted
- 1980-08-11 GB GB8026120A patent/GB2057185B/en not_active Expired
- 1980-08-12 JP JP10989580A patent/JPS5630245A/ja active Pending
- 1980-08-13 FR FR8017868A patent/FR2463506A1/fr active Granted
- 1980-08-13 BE BE0/201740A patent/BE884766A/fr not_active IP Right Cessation
-
1982
- 1982-12-14 US US06/449,805 patent/US4445069A/en not_active Expired - Fee Related
-
1988
- 1988-12-08 JP JP1988159023U patent/JPH0135404Y2/ja not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4027783A1 (de) * | 1990-09-03 | 1992-04-30 | Holzer Walter | Gasentladungsgeraet fuer kompaktlampen |
| DE102012103272B3 (de) * | 2012-04-16 | 2013-05-23 | Walter Wallner | Lampensockel für Gasentladungslampe |
| DE102012103268A1 (de) * | 2012-04-16 | 2013-10-17 | Walter Wallner | Gasentladungslampe |
| DE102012103268B4 (de) * | 2012-04-16 | 2015-08-20 | Walter Wallner | Gasentladungslampe mit Verbindungsbereich zwischen Innenzylinder und Aussenrohr und Durchgangsöffnung im Verbindungsbereich |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3027535A1 (de) | 1981-03-26 |
| GB2057185B (en) | 1983-04-07 |
| JPH0135404Y2 (enExample) | 1989-10-27 |
| NL7906202A (nl) | 1981-02-17 |
| US4445069A (en) | 1984-04-24 |
| GB2057185A (en) | 1981-03-25 |
| JPS5630245A (en) | 1981-03-26 |
| JPH0189456U (enExample) | 1989-06-13 |
| FR2463506B1 (enExample) | 1982-11-26 |
| FR2463506A1 (fr) | 1981-02-20 |
| BE884766A (fr) | 1981-02-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2940563C2 (enExample) | ||
| DE3344020C2 (enExample) | ||
| DE2835574C2 (enExample) | ||
| DE3607460A1 (de) | Elektrodenlose niederdruckentladungslampe | |
| DE3027535C2 (enExample) | ||
| DE10243867A1 (de) | Quecksilberfreie Bogenentladungsröhre für Entladungslampeneinheit | |
| DE3027536C2 (enExample) | ||
| EP0922297A1 (de) | Leuchtstofflampe | |
| DE1217496B (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogen-Zusatz | |
| DE3038993A1 (de) | Metalldampfentladungslampe | |
| DE2646577C3 (de) | Zündeinrichtung für eine mit Gleichstrom betriebene Blitzlampe | |
| DE2627380C3 (de) | Metalldampf-Hochdruckentladungslampe für horizontalen Betrieb | |
| DE2725412C2 (de) | Leuchtstofflampe | |
| DE3723435C2 (enExample) | ||
| EP1276137B1 (de) | Dielektrische Barrieren-Entladungslampe mit Zündhilfe | |
| DE1489604B1 (de) | Gasgefuellte Entladungslampe | |
| DE2749630C2 (enExample) | ||
| DE10140356A1 (de) | Röhrförmige Entladungslampe mit Zündhilfe | |
| DE69317798T2 (de) | Elektrische Lampe | |
| DE2027893A1 (de) | Entladungslampe mit amalgambildenden Stoffmengen zur Pegulierung des Quecksilberdampfdruckes | |
| DE1199882B (de) | Gasentladungslampe | |
| DE2105184A1 (de) | Hochdruckgasentladungslampe | |
| DE3321479A1 (de) | Hochdruckentladungslampe | |
| CH290444A (de) | Mit Leuchtstoffen versehene Gas- und Dampfentladungslampe. | |
| DE844944C (de) | Kolbenfoermige Leuchtstofflampe fuer uebliche Fassungen und Netzspannungen sowie Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: KUPFERMANN, F., DIPL.-ING., PAT.-ANW., 2000 HAMBURG |
|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |