DE2949034A1 - Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe - Google Patents
Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffeInfo
- Publication number
- DE2949034A1 DE2949034A1 DE19792949034 DE2949034A DE2949034A1 DE 2949034 A1 DE2949034 A1 DE 2949034A1 DE 19792949034 DE19792949034 DE 19792949034 DE 2949034 A DE2949034 A DE 2949034A DE 2949034 A1 DE2949034 A1 DE 2949034A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- group
- compound
- parts
- sulfonic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims description 33
- 238000000034 method Methods 0.000 title claims description 25
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000000975 dye Substances 0.000 claims description 24
- -1 azo compound Chemical class 0.000 claims description 19
- 238000004043 dyeing Methods 0.000 claims description 19
- 239000000463 material Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 150000001989 diazonium salts Chemical class 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 7
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 3
- 125000005518 carboxamido group Chemical group 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims 6
- 229920002554 vinyl polymer Polymers 0.000 claims 1
- 239000000243 solution Substances 0.000 description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 238000005859 coupling reaction Methods 0.000 description 13
- 229920003043 Cellulose fiber Polymers 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000002657 fibrous material Substances 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- 235000017550 sodium carbonate Nutrition 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 230000008878 coupling Effects 0.000 description 10
- 238000010168 coupling process Methods 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 8
- 229910052783 alkali metal Inorganic materials 0.000 description 7
- 239000003792 electrolyte Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000011230 binding agent Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 239000000985 reactive dye Substances 0.000 description 5
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000012928 buffer substance Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000010025 steaming Methods 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002964 rayon Substances 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 1
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 description 1
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical compound ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 description 1
- ZUQOBHTUMCEQBG-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 ZUQOBHTUMCEQBG-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- MIJGJJKVYCRQNI-UHFFFAOYSA-N 4-ethenylsulfonylaniline Chemical compound NC1=CC=C(S(=O)(=O)C=C)C=C1 MIJGJJKVYCRQNI-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 240000008564 Boehmeria nivea Species 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- 240000000491 Corchorus aestuans Species 0.000 description 1
- 235000011777 Corchorus aestuans Nutrition 0.000 description 1
- 235000010862 Corchorus capsularis Nutrition 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229920000571 Nylon 11 Polymers 0.000 description 1
- 229920001007 Nylon 4 Polymers 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- SAQSTQBVENFSKT-UHFFFAOYSA-M TCA-sodium Chemical compound [Na+].[O-]C(=O)C(Cl)(Cl)Cl SAQSTQBVENFSKT-UHFFFAOYSA-M 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical class Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- BEHLMOQXOSLGHN-UHFFFAOYSA-N benzenamine sulfate Chemical compound OS(=O)(=O)NC1=CC=CC=C1 BEHLMOQXOSLGHN-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000009120 camo Nutrition 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical class C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000009963 fulling Methods 0.000 description 1
- 210000004209 hair Anatomy 0.000 description 1
- 239000011487 hemp Substances 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000979 synthetic dye Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/4401—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring with two or more reactive groups at least one of them being directly attached to a heterocyclic system and at least one of them being directly attached to a non-heterocyclic system
- C09B62/4403—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring with two or more reactive groups at least one of them being directly attached to a heterocyclic system and at least one of them being directly attached to a non-heterocyclic system the heterocyclic system being a triazine ring
- C09B62/4411—Azo dyes
- C09B62/4413—Non-metallized monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792949034 DE2949034A1 (de) | 1979-12-06 | 1979-12-06 | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| EP80107444A EP0032187B1 (de) | 1979-12-06 | 1980-11-28 | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
| DE8080107444T DE3065957D1 (en) | 1979-12-06 | 1980-11-28 | Water-soluble azo compounds, process for their preparation and their use as dyestuffs |
| IN1335/CAL/80A IN153476B (https=) | 1979-12-06 | 1980-12-01 | |
| AR283479A AR228045A1 (es) | 1979-12-06 | 1980-12-04 | Compuestos azoicos hidrosolubles,procedimiento para su preparacion,composiciones que los contienen y procedimiento para tenir con los mismos |
| JP17109480A JPS5690857A (en) | 1979-12-06 | 1980-12-05 | Water soluble azo dyestuff * production and use thereof |
| CA000366223A CA1157468A (en) | 1979-12-06 | 1980-12-05 | Water-soluble azo compounds, processes for their preparation and their use as dyestuffs |
| BR8007984A BR8007984A (pt) | 1979-12-06 | 1980-12-05 | Compostos azo,processos para sua preparacao,sua aplicacao,e processo para o tingimento de materiais contendo grupos hidroxi ou carbonamida |
| MX20340780A MX156138A (es) | 1979-12-06 | 1980-12-05 | Procedimiento para la obtencion de compuestos azoicos hidrosolubles |
| MX185062A MX152235A (es) | 1979-12-06 | 1980-12-06 | Procedimiento para preparar colorantes reactivos azoicos,hidrosolubles |
| IN942/CAL/83A IN156400B (https=) | 1979-12-06 | 1983-07-29 | |
| US06/558,548 US4725675A (en) | 1979-12-06 | 1983-12-05 | Water-soluble phenyl-azo-naphthyl compounds, suitable as dyestuffs, containing a chloro-triazinylamino group and a fiber-reactive group of the vinylsulfone type |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792949034 DE2949034A1 (de) | 1979-12-06 | 1979-12-06 | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2949034A1 true DE2949034A1 (de) | 1981-06-25 |
Family
ID=6087714
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792949034 Withdrawn DE2949034A1 (de) | 1979-12-06 | 1979-12-06 | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE8080107444T Expired DE3065957D1 (en) | 1979-12-06 | 1980-11-28 | Water-soluble azo compounds, process for their preparation and their use as dyestuffs |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8080107444T Expired DE3065957D1 (en) | 1979-12-06 | 1980-11-28 | Water-soluble azo compounds, process for their preparation and their use as dyestuffs |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4725675A (https=) |
| EP (1) | EP0032187B1 (https=) |
| JP (1) | JPS5690857A (https=) |
| AR (1) | AR228045A1 (https=) |
| BR (1) | BR8007984A (https=) |
| CA (1) | CA1157468A (https=) |
| DE (2) | DE2949034A1 (https=) |
| IN (1) | IN153476B (https=) |
| MX (1) | MX152235A (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5233026A (en) * | 1984-09-26 | 1993-08-03 | Ciba-Geigy Corporation | Azo dyes containing chloro-s-triazine and vinylsulfonyl type fiber-reactive groups |
| DE4447276A1 (de) * | 1994-12-30 | 1996-07-04 | Hoechst Ag | Farbstoffmischung von wasserlöslichen faserreaktiven Azofarbstoffen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19611636A1 (de) * | 1996-03-25 | 1997-10-02 | Dystar Textilfarben Gmbh & Co | Wasserlösliche, rotfärbende faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3122688A1 (de) * | 1981-06-06 | 1982-12-23 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche monoazo-reaktivfarbstoffe, verfahren zu deren herstellung sowie ihre verwendung zum faerben und bedrucken von fasermaterialien |
| DE3245734A1 (de) * | 1982-12-10 | 1984-06-14 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3585327D1 (de) * | 1984-09-26 | 1992-03-12 | Ciba Geigy Ag | Reaktive monoazofarbstoffe, deren herstellung und verwendung. |
| DE3624136A1 (de) * | 1985-09-30 | 1987-04-09 | Hoechst Ag | Wasserloesliche azoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe |
| US4902786A (en) * | 1986-07-17 | 1990-02-20 | Hoechst Aktiengesellschaft | Phenylazonaphthol or naphthylazonaphthol compounds containing a fibre-reactive aminophenylamino-substituted halogen-s-triazinylamino group and a fibre-reactive group of the vinylsulfone series, suitable as dyestuffs |
| JPH089693B2 (ja) * | 1986-11-14 | 1996-01-31 | 住友化学工業株式会社 | トリアジン化合物及びそれを用いて繊維材料を染色又は捺染する方法 |
| DE3740649A1 (de) * | 1987-12-01 | 1989-06-15 | Bayer Ag | Reaktivfarbstoffe |
| DE3905403A1 (de) * | 1989-02-22 | 1990-08-23 | Hoechst Ag | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| US5175263A (en) * | 1989-02-22 | 1992-12-29 | Hoechst Aktiengesellschaft | Water-soluble azo compounds, having a fiber-reactive group of the vinylsulfone series in the diazo component and having a phenoxy- or aralkyloxy-substituted chloro-s-triazinylamino-naphthol sulfonic acid coupling component, suitable as dyestuffs |
| DE4023475A1 (de) * | 1990-07-24 | 1992-01-30 | Hoechst Ag | Monoazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe |
| DE4414320A1 (de) * | 1994-04-25 | 1995-10-26 | Hoechst Ag | Schwarze Farbstoffmischungen von faserreaktiven Azofarbstoffen und ihre Verwendung zum Färben von hydroxy- und/oder carbonamidgruppenhaltigem Fasermaterial |
| DE4417719A1 (de) * | 1994-05-20 | 1995-11-23 | Hoechst Ag | Reaktivfarbstoffe mit hydrolysestabilen Reaktivgruppen |
| US5514717A (en) * | 1994-10-26 | 1996-05-07 | Monsanto Company | Fluoroalkenyl compounds and their use as pest control agents |
| DE4438544A1 (de) * | 1994-10-28 | 1996-05-02 | Bayer Ag | Verfahren zum Färben und Bedrucken von hydroxy- und/oder carbonamidgruppenhaltigen Materialien |
| DE19510135A1 (de) * | 1995-03-21 | 1996-09-26 | Bayer Ag | Monoazoreaktivfarbstoffe |
| DE19511688C2 (de) * | 1995-03-30 | 1999-07-22 | Dystar Textilfarben Gmbh & Co | Farbstoffmischungen von faserreaktiven Azofarbstoffen und ihre Verwendung zum Färben von hydroxy- und/oder carbonamidgruppenhaltigem Fasermaterial |
| US5980590A (en) * | 1995-12-28 | 1999-11-09 | Dystar Texilfarben Gmbh & Co. Deutschland Kg | Dyestuff mixtures of water-soluble fiber-reactive azo dyestuffs, processes for their preparation and their use |
| DE19635999A1 (de) | 1996-09-05 | 1998-03-12 | Dystar Textilfarben Gmbh & Co | Farbstoffmischungen von faserreaktiven Azofarbstoffen und ihre Verwendung zum Färben von hydroxy- und/oder carbonamidgruppenhaltigem Fasermaterial |
| DE19852051A1 (de) * | 1998-11-11 | 2000-05-18 | Dystar Textilfarben Gmbh & Co | Farbstoffmischung, Verfahren zu ihrer Herstellung und ihre Verwendung |
| US6090163A (en) * | 1998-12-21 | 2000-07-18 | Dystar Textilfarben Gmbh & Co. Deutschland Kg | Red-dyeing dye mixtures of water-soluble fiber-reactive azo dyes and their use |
| US6086639A (en) * | 1999-03-09 | 2000-07-11 | Dystar Textilfarben Gmbh & Co. Deutschland Kg | Black dye mixtures of fiber-reactive azo dyes and use thereof for dyeing hydroxy- and/or carboxamido-containing fiber material |
| US6051037A (en) * | 1999-04-21 | 2000-04-18 | Dystar Textil Farben Gmbh & Co. Deutschland Kg | Dye mixtures of fiber-reactive azo dyes and use thereof for dyeing material containing hydroxy- and/or carboxamido groups |
| US7094277B2 (en) | 2001-10-31 | 2006-08-22 | Hewlett-Packard Development Company, L.P. | Counterion use for reduction of decap and for improvement of durability of inkjet images |
| CN102757667B (zh) * | 2011-04-26 | 2013-12-25 | 上海雅运纺织化工股份有限公司 | 红色活性染料组合物及其在纤维上的染色应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1133051B (de) * | 1959-03-14 | 1962-07-12 | Bayer Ag | Verfahren zur Herstellung von Monoazofarbstoffen |
| GB985481A (en) * | 1960-09-22 | 1965-03-10 | Ici Ltd | Mixtures of metal-complex monoazo dyestuffs containing triazinylamino groups |
| DE1265698C2 (de) * | 1961-05-06 | 1968-11-07 | Hoechst Ag | Verfahren zur Erzeugung von nassechten Faerbungen und Drucken |
| DE1289929B (de) * | 1963-06-10 | 1969-02-27 | Hoechst Ag | Verfahren zur Herstellung von faserreaktiven organischen Farbstoffen |
| GB1151936A (en) * | 1966-08-15 | 1969-05-14 | Ici Ltd | Water-Soluble Reactive Metal Complex Monoazo Dyestuffs |
| US4046754A (en) * | 1969-08-29 | 1977-09-06 | Hoechst Aktiengesellschaft | Water-soluble naphyhyl-azo-pyrazolone fiber reactive dyestuffs |
| BE790741A (fr) * | 1971-10-30 | 1973-04-30 | Hoechst Ag | Colorants azoiques |
| JPS5921906B2 (ja) * | 1974-06-13 | 1984-05-23 | 日本化薬株式会社 | 新しい反応性のアゾ染料の製造法 |
| US4378313B1 (en) * | 1979-06-01 | 1994-05-03 | Sumitomo Chemical Co | Reactive yellow dye having both monochlorotriazinyl and vinylsulfone type reactive groups |
-
1979
- 1979-12-06 DE DE19792949034 patent/DE2949034A1/de not_active Withdrawn
-
1980
- 1980-11-28 DE DE8080107444T patent/DE3065957D1/de not_active Expired
- 1980-11-28 EP EP80107444A patent/EP0032187B1/de not_active Expired
- 1980-12-01 IN IN1335/CAL/80A patent/IN153476B/en unknown
- 1980-12-04 AR AR283479A patent/AR228045A1/es active
- 1980-12-05 JP JP17109480A patent/JPS5690857A/ja active Granted
- 1980-12-05 BR BR8007984A patent/BR8007984A/pt not_active IP Right Cessation
- 1980-12-05 CA CA000366223A patent/CA1157468A/en not_active Expired
- 1980-12-06 MX MX185062A patent/MX152235A/es unknown
-
1983
- 1983-12-05 US US06/558,548 patent/US4725675A/en not_active Expired - Lifetime
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5233026A (en) * | 1984-09-26 | 1993-08-03 | Ciba-Geigy Corporation | Azo dyes containing chloro-s-triazine and vinylsulfonyl type fiber-reactive groups |
| DE4447276A1 (de) * | 1994-12-30 | 1996-07-04 | Hoechst Ag | Farbstoffmischung von wasserlöslichen faserreaktiven Azofarbstoffen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE4447276C2 (de) * | 1994-12-30 | 1998-08-27 | Dystar Textilfarben Gmbh & Co | Farbstoffmischung von wasserlöslichen faserreaktiven Azofarbstoffen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19611636A1 (de) * | 1996-03-25 | 1997-10-02 | Dystar Textilfarben Gmbh & Co | Wasserlösliche, rotfärbende faserreaktive Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0124827B2 (https=) | 1989-05-15 |
| US4725675A (en) | 1988-02-16 |
| IN153476B (https=) | 1984-07-21 |
| CA1157468A (en) | 1983-11-22 |
| AR228045A1 (es) | 1983-01-14 |
| BR8007984A (pt) | 1981-06-23 |
| JPS5690857A (en) | 1981-07-23 |
| EP0032187A2 (de) | 1981-07-22 |
| EP0032187A3 (en) | 1981-09-23 |
| EP0032187B1 (de) | 1983-12-21 |
| MX152235A (es) | 1985-06-12 |
| DE3065957D1 (en) | 1984-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0032187B1 (de) | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0094055B1 (de) | Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0979849B1 (de) | Farbstoffmischung von wasserlöslichen faserreaktiven Azofarbstoffen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0028788B1 (de) | Kupferkomplex-Formazanverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0036582B1 (de) | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP1046679B1 (de) | Reaktivfarbstoffmischungen für salzarme Färbeflotte | |
| EP0065211B1 (de) | Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0629666B1 (de) | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0169457A1 (de) | Wasserlösliche Pyridon-Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0064721B1 (de) | Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE3705789A1 (de) | Kupferkomplex-formazan-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| EP1305370B1 (de) | Wasserlösliche faserreaktive farbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| EP1274803B1 (de) | Farbstoffmischung von wasserlöslichen faserreaktiven azofarbstoffen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3217388A1 (de) | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| EP0078009A1 (de) | Wasserlösliche Pyridon-Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0064711B1 (de) | Diphenyläther-Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE3131667A1 (de) | Wasserloesliche monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| DE3113989A1 (de) | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| DE3517755A1 (de) | Wasserloesliche mono- und disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| DE3204259C2 (https=) | ||
| EP0231836A2 (de) | Wasserlösliche Disazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE19922825A1 (de) | Neue fluortriazinhaltige brillantgelbe Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von hydroxy- und amidgruppenhaltigen Materialien | |
| DE3614045A1 (de) | Wasserloesliche monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| DE2757681A1 (de) | Phenylazopyridon-verbindung, verfahren zu deren herstellung, ihre verwendung als farbstoff und mit ihr gefaerbte fasermaterialien | |
| EP0602550B1 (de) | Wasserlösliche Anthrachinonverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |