DE2905267B2 - - Google Patents
Info
- Publication number
- DE2905267B2 DE2905267B2 DE2905267B2 DE 2905267 B2 DE2905267 B2 DE 2905267B2 DE 2905267 B2 DE2905267 B2 DE 2905267B2
- Authority
- DE
- Germany
- Prior art keywords
- isobutyraldehyde
- stabilizers
- aldehyde
- ppm
- autocondensation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- AMIMRNSIRUDHCM-UHFFFAOYSA-N isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 claims description 12
- 229960002887 Deanol Drugs 0.000 claims description 5
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 claims description 5
- -1 isobutyraldehyde Triethanolamine Chemical compound 0.000 claims description 3
- 238000000034 method Methods 0.000 claims 1
- 238000011105 stabilization Methods 0.000 claims 1
- 239000003381 stabilizer Substances 0.000 description 11
- 150000001299 aldehydes Chemical class 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000006116 polymerization reaction Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Tris Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- DLYUQMMRRRQYAE-UHFFFAOYSA-N Phosphorus pentoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 238000005882 aldol condensation reaction Methods 0.000 description 2
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- IKEHOXWJQXIQAG-UHFFFAOYSA-N 2-tert-butyl-4-methylphenol Chemical compound CC1=CC=C(O)C(C(C)(C)C)=C1 IKEHOXWJQXIQAG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene (PE) Substances 0.000 description 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L Zinc chloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 230000000087 stabilizing Effects 0.000 description 1
- 239000007861 trimeric product Substances 0.000 description 1
- 238000005829 trimerization reaction Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2905267C2 (de) | Verfahren zur Stabilisierung von Isobutyraldehyd | |
| DE2905267B2 (da) | ||
| DE102004058173A1 (de) | Lagerstabile aliphatische, cycloaliphatische oder (cyclo)aliphatische Diisocyanate | |
| DE2612415C2 (de) | Wäßrige Lösungen von Alkalisilikaten und Hydrogenphosphaten | |
| DE19757531C1 (de) | Verfahren zur Stabilisierung von Aldehyden | |
| US4414419A (en) | Stabilization of aldehydes | |
| DE2548088A1 (de) | Selbstverloeschende polyolefinzusammensetzungen | |
| DE1032919B (de) | Verfahren zur Herstellung einer lagerfaehigen, aushaertbaren Polyestermasse | |
| DE1952784A1 (de) | Verfahren zur Stabilisierung von Methylenchlorid und stabilisierte Methylenchloridzusammensetzungen | |
| DE1131004B (de) | Verfahren zum Stabilisieren von Niederdruck-Polyolefinen | |
| DE1947028C3 (de) | Verfahren zur Herstellung von Reaktionsprodukten auf Basis von 13-Dichlorbuten-2 und/oder Düsobutylen und salpetriger Säure und Verwendung dieser Reaktionsprodukte als Inhibitor bei Polymerisationsreaktionen | |
| EP0320728A2 (de) | Verfahren zur Stabilisierung von Aldehyden | |
| DE2917789C2 (de) | Verfahren zur Stabilisierung von Aldehyden | |
| DE1520489C2 (de) | Verfahren zur Herstellung von festen Propylenhomopolymerisaten | |
| EP0498901B1 (de) | Verfahren zur Stabilisierung von Phosphortrichlorid | |
| DE3243926C2 (de) | Stabiles wäßriges Oxidationsmittel | |
| WO2023241995A1 (de) | Lagerung und/oder transport ethylenisch ungesättigter carbonsäuren | |
| WO2023143974A1 (de) | Lagerung und/oder transport ethylenisch ungesättigter verbindungen | |
| EP0076468A2 (de) | Verfahren zur Stabilisierung von Ethylenoxidpolyethern | |
| DE1595545A1 (de) | Verfahren zur Herstellung von Polyalkylenterephthalaten | |
| DE1745011C3 (de) | Verfahren zur Polymerisation von Äthylen | |
| DE1906385C (de) | Verfahren zur Stabilisierung von N Methylolacrylsaureamid und/oder N Methylolmethacrylsaureamid ent haltenden wäßrigen Losungen | |
| DE2033468C3 (de) | Verfahren zur Herstellung von Polymerisationskatalysatoren | |
| DE1952784C (de) | Stabilisierte Methylenchlorid-Zusammensetzung | |
| DE1274087B (de) | Verfahren zur Herstellung von Polymerisationskatalysatoren |