DE2828314C2 - - Google Patents
Info
- Publication number
- DE2828314C2 DE2828314C2 DE2828314A DE2828314A DE2828314C2 DE 2828314 C2 DE2828314 C2 DE 2828314C2 DE 2828314 A DE2828314 A DE 2828314A DE 2828314 A DE2828314 A DE 2828314A DE 2828314 C2 DE2828314 C2 DE 2828314C2
- Authority
- DE
- Germany
- Prior art keywords
- stator
- pump according
- housing
- induction pump
- opening
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 62
- 230000006698 induction Effects 0.000 claims description 30
- 229910052742 iron Inorganic materials 0.000 claims description 30
- 229910001338 liquidmetal Inorganic materials 0.000 claims description 24
- 239000002826 coolant Substances 0.000 claims description 10
- 238000005086 pumping Methods 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 4
- 239000010935 stainless steel Substances 0.000 claims description 4
- 229910001220 stainless steel Inorganic materials 0.000 claims description 4
- QVYYOKWPCQYKEY-UHFFFAOYSA-N [Fe].[Co] Chemical compound [Fe].[Co] QVYYOKWPCQYKEY-UHFFFAOYSA-N 0.000 claims description 3
- 229910000531 Co alloy Inorganic materials 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims 2
- 229910017052 cobalt Inorganic materials 0.000 claims 1
- 239000010941 cobalt Substances 0.000 claims 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims 1
- 238000009413 insulation Methods 0.000 description 8
- 239000004020 conductor Substances 0.000 description 5
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910000976 Electrical steel Inorganic materials 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000009395 breeding Methods 0.000 description 2
- 230000001488 breeding effect Effects 0.000 description 2
- 244000144987 brood Species 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 230000008439 repair process Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-RNFDNDRNSA-N iron-60 Chemical compound [60Fe] XEEYBQQBJWHFJM-RNFDNDRNSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02K—DYNAMO-ELECTRIC MACHINES
- H02K44/00—Machines in which the dynamo-electric interaction between a plasma or flow of conductive liquid or of fluid-borne conductive or magnetic particles and a coil system or magnetic field converts energy of mass flow into electrical energy or vice versa
- H02K44/02—Electrodynamic pumps
- H02K44/06—Induction pumps
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
- Electromagnetic Pumps, Or The Like (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/811,627 US4174190A (en) | 1977-06-30 | 1977-06-30 | Annular linear induction pump with an externally supported duct |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2828314A1 DE2828314A1 (de) | 1979-01-04 |
| DE2828314C2 true DE2828314C2 (enExample) | 1988-08-18 |
Family
ID=25207085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782828314 Granted DE2828314A1 (de) | 1977-06-30 | 1978-06-28 | Ringfoermie lineare induktionspumpe mit einem extern gehalterten kanal |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4174190A (enExample) |
| JP (1) | JPS5417508A (enExample) |
| DE (1) | DE2828314A1 (enExample) |
| FR (1) | FR2396449A1 (enExample) |
| GB (1) | GB1577389A (enExample) |
| IT (1) | IT1097077B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1103192B (it) * | 1978-03-30 | 1985-10-14 | Nira Spa | Pompa elettromagnetica ad autoinduzione e convertitore diretto ad autoinduzione per fluidi conduttori in particolare metalli liquide |
| US4212592A (en) * | 1978-10-31 | 1980-07-15 | General Electric Company | Electromagnetic pump for molten metals |
| DE3141774A1 (de) * | 1981-10-21 | 1983-04-28 | Interatom Internationale Atomreaktorbau Gmbh, 5060 Bergisch Gladbach | "induktionstauchpumpe, insbesondere fuer aluminium" |
| US4527955A (en) * | 1982-01-08 | 1985-07-09 | United Kingdom Atomic Energy Authority | Electromagnetic pumps of the helical linear induction type |
| DE3204462C1 (de) * | 1982-02-09 | 1983-05-05 | Interatom Internationale Atomreaktorbau Gmbh, 5060 Bergisch Gladbach | Elektromagnetische Pumpe für Flüssigmetalle |
| JPS5925573A (ja) * | 1982-07-30 | 1984-02-09 | Hitachi Ltd | 電磁ポンプ |
| DE8432755U1 (de) * | 1984-11-08 | 1986-03-06 | INTERATOM GmbH, 5060 Bergisch Gladbach | Ringförmige lineare Induktionstauchpumpe zur Förderung von Flüssigmetall |
| US4765948A (en) * | 1986-08-29 | 1988-08-23 | Stone & Webster Engineering Corporation | Coolant circulation system for a liquid metal nuclear reactor |
| NO162640C (no) * | 1987-05-05 | 1990-01-24 | Sintef | Pumpe for flytende metall. |
| JP2664773B2 (ja) * | 1989-05-23 | 1997-10-22 | 株式会社東芝 | 液体金属冷却型原子炉の冷却装置 |
| US5303903A (en) * | 1992-12-16 | 1994-04-19 | Reynolds Metals Company | Air cooled molten metal pump frame |
| EP1477253B1 (en) * | 2003-04-18 | 2005-07-20 | Alm S.A. | Tapping and pouring system for molten metals. |
| US8267669B2 (en) * | 2008-05-19 | 2012-09-18 | Hazelett Strip-Casting Corporation | Magnetic induction pump |
| JP2016101007A (ja) * | 2014-11-21 | 2016-05-30 | 株式会社東芝 | 電磁ポンプ及び流量計測システム |
| US12412675B2 (en) | 2022-08-05 | 2025-09-09 | Ge-Hitachi Nuclear Energy Americas Llc | Shielded electromagnetic pumps for nuclear reactors |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB718429A (en) * | 1951-07-23 | 1954-11-17 | Walter Murgatroyd | Improvements in or relating to pumps for electrical conducting fluids |
| US2786416A (en) * | 1953-09-25 | 1957-03-26 | English Electric Co Ltd | Electro-magnetic pump |
| US3260209A (en) * | 1962-01-16 | 1966-07-12 | Gen Electric | Electromagnetic pump |
| US3135208A (en) * | 1962-04-30 | 1964-06-02 | Litton Systems Inc | Magnetohydrodynamic pump |
| US3196795A (en) * | 1963-01-02 | 1965-07-27 | North American Aviation Inc | Electromagnetic pump system |
| US3302573A (en) * | 1964-06-05 | 1967-02-07 | Ledeen Julian Louis | Apparatus for pumping liquid metals |
| US3372644A (en) * | 1966-03-21 | 1968-03-12 | Gen Electric | Electromagnetic pump having concentric electrodes |
| US3411447A (en) * | 1967-04-07 | 1968-11-19 | Kaiser Aluminium Chem Corp | Repulsion induction pump |
| FR2005379A1 (enExample) * | 1968-04-02 | 1969-12-12 | Inst Badan Jadrowych | |
| FR1593007A (enExample) * | 1968-07-01 | 1970-05-25 | ||
| FR2067735A5 (enExample) * | 1969-11-14 | 1971-08-20 | Fournier Rouge Michel | |
| FR2182623B1 (enExample) * | 1972-03-30 | 1974-12-20 | Activite Atom Avance | |
| GB1413304A (en) * | 1972-04-26 | 1975-11-12 | Atomic Energy Authority Uk | Electromagnetic pumps |
| FR2293101A1 (fr) * | 1974-11-27 | 1976-06-25 | Commissariat Energie Atomique | Pompe electromagnetique a induction |
| DE2637473A1 (de) * | 1976-08-20 | 1978-02-23 | Interatom | Elektromagnetische pumpe |
-
1977
- 1977-06-30 US US05/811,627 patent/US4174190A/en not_active Expired - Lifetime
-
1978
- 1978-03-23 GB GB11563/78A patent/GB1577389A/en not_active Expired
- 1978-06-28 IT IT25048/78A patent/IT1097077B/it active
- 1978-06-28 DE DE19782828314 patent/DE2828314A1/de active Granted
- 1978-06-29 FR FR7819540A patent/FR2396449A1/fr active Granted
- 1978-06-30 JP JP7877078A patent/JPS5417508A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2828314A1 (de) | 1979-01-04 |
| JPS6310661B2 (enExample) | 1988-03-08 |
| FR2396449A1 (fr) | 1979-01-26 |
| US4174190A (en) | 1979-11-13 |
| IT7825048A0 (it) | 1978-06-28 |
| IT1097077B (it) | 1985-08-26 |
| JPS5417508A (en) | 1979-02-08 |
| FR2396449B1 (enExample) | 1984-02-17 |
| GB1577389A (en) | 1980-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2828314C2 (enExample) | ||
| DE2637473A1 (de) | Elektromagnetische pumpe | |
| DE2320522A1 (de) | Elektromagnetische pumpe | |
| DE3816652A1 (de) | Elektrische maschine mit fluessigkeitskuehlung | |
| DE1763579A1 (de) | Anordnung zur Fluessigkeitskuehlung der Staenderblechpakete elektrischer Maschinen,insbesondere fuer Turbogeneratoren | |
| WO2001015304A1 (de) | Reluktanz-elektromaschine | |
| DE19943783A1 (de) | Supraleitungseinrichtung mit einer mehrpoligen Wicklungsanordnung | |
| DE3344047A1 (de) | Magnetsystem fuer einen kernspintomograph | |
| DE3629044A1 (de) | Statische erregervorrichtung fuer eine dynamoelektrische maschine | |
| DE1488433C3 (de) | Turbogenerator mit direkt gekühlten Wicklungen | |
| DE1538803B2 (de) | Turbogeneratorlaufer | |
| EP1869757B1 (de) | Primärteil eines linearmotors und linearmotor hiermit | |
| DE112022004873T5 (de) | Fluidgekühlter stator | |
| DE2524820A1 (de) | Dynamoelektrische maschine | |
| DE69206115T2 (de) | Wicklung für ringförmigen Stator. | |
| DE1514708A1 (de) | Fluessigkeitsgekuehlte Magnetspule | |
| EP1955431B1 (de) | Primärteil eines linearmotors und linearmotor hiermit | |
| EP1779499B1 (de) | MASCHINE MIT EINER ERREGERWICKLUNG AUS HOCH-T<sb>C</sb>-SUPRALEITERN IN EINER HALTEEINRICHTUNG | |
| DE1283343B (de) | Magnetohydrodynamischer (MHD-) Energiewandler | |
| DE19525346A1 (de) | Ringkern-Synchronmaschine | |
| DE2912274A1 (de) | Autoinduktive elektromagnetische pumpe und autoinduktiver direktkonverter fuer leitende fluessigkeiten insbesondere fluessige metalle | |
| DE2803068C2 (enExample) | ||
| EP1062719A1 (de) | Belüftungssystem für die erregerwicklung grosser schenkelpolmaschinen | |
| DE1057219B (de) | Mittel- und Hochfrequenz-Leistungstransformator | |
| DE1488456A1 (de) | Einphasenwechselstrom-Turbogenerator mit sehr grosser Leistung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |